diff --git a/.gitignore b/.gitignore index 6f8f34302f838471a7aa327f30367b7fd41fcc1b..24adc5f2ea9ad9921905e063e4d75649e524183c 100644 --- a/.gitignore +++ b/.gitignore @@ -8,4 +8,3 @@ output/* *.nfs* *.swp .python-version - diff --git a/binaryc_python_utils/custom_logging_functions.py b/binaryc_python_utils/custom_logging_functions.py index 8da283f9c104553000d04ca45c5c95218d40796a..3bb4d7f481893e6979bdf63c8d208a0cf276be04 100644 --- a/binaryc_python_utils/custom_logging_functions.py +++ b/binaryc_python_utils/custom_logging_functions.py @@ -5,22 +5,21 @@ import socket import tempfile import ctypes -# Functions for the automatic logging of stuff def autogen_C_logging_code(logging_dict): - # See example_perl.pm autologging """ - Function that autogenerates PRINTF statements for binaryc - - Input: - dictionary where the key is the header of that logging line and items which are lists of parameters that will be put in that logging line - - example: {'MY_STELLAR_DATA': - [ - 'model.time', - 'star[0].mass', - 'model.probability', - 'model.dt' - ']} + Function that autogenerates PRINTF statements for binaryc. intput is a dictionary where the key is the header of that logging line and items which are lists of parameters\ + that will be put in that logging line + + Example:: + + {'MY_STELLAR_DATA': + [ + 'model.time', + 'star[0].mass', + 'model.probability', + 'model.dt' + ] + } """ # Check if the input is of the correct form @@ -61,7 +60,6 @@ def autogen_C_logging_code(logging_dict): def binary_c_log_code(code): """ Function to construct the code to construct the custom logging function - # see example_perl.pm binary_c_log_code in perl """ custom_logging_function_string = """\ #pragma push_macro(\"MAX\") diff --git a/docs/Doxygen/Doxyfile b/docs/Doxygen/Doxyfile new file mode 100644 index 0000000000000000000000000000000000000000..a1933d48d24194103f50f2b463d6f60354784b6f --- /dev/null +++ b/docs/Doxygen/Doxyfile @@ -0,0 +1,2494 @@ +# Doxyfile 1.8.13 + +# This file describes the settings to be used by the documentation system +# doxygen (www.doxygen.org) for a project. +# +# All text after a double hash (##) is considered a comment and is placed in +# front of the TAG it is preceding. +# +# All text after a single hash (#) is considered a comment and will be ignored. +# The format is: +# TAG = value [value, ...] +# For lists, items can also be appended using: +# TAG += value [value, ...] +# Values that contain spaces should be placed between quotes (\" \"). + +#--------------------------------------------------------------------------- +# Project related configuration options +#--------------------------------------------------------------------------- + +# This tag specifies the encoding used for all characters in the config file +# that follow. The default is UTF-8 which is also the encoding used for all text +# before the first occurrence of this tag. Doxygen uses libiconv (or the iconv +# built into libc) for the transcoding. See http://www.gnu.org/software/libiconv +# for the list of possible encodings. +# The default value is: UTF-8. + +DOXYFILE_ENCODING = UTF-8 + +# The PROJECT_NAME tag is a single word (or a sequence of words surrounded by +# double-quotes, unless you are using Doxywizard) that should identify the +# project for which the documentation is generated. This name is used in the +# title of most generated pages and in a few other places. +# The default value is: My Project. + +PROJECT_NAME = "My Project" + +# The PROJECT_NUMBER tag can be used to enter a project or revision number. This +# could be handy for archiving the generated documentation or if some version +# control system is used. + +PROJECT_NUMBER = + +# Using the PROJECT_BRIEF tag one can provide an optional one line description +# for a project that appears at the top of each page and should give viewer a +# quick idea about the purpose of the project. Keep the description short. + +PROJECT_BRIEF = + +# With the PROJECT_LOGO tag one can specify a logo or an icon that is included +# in the documentation. The maximum height of the logo should not exceed 55 +# pixels and the maximum width should not exceed 200 pixels. Doxygen will copy +# the logo to the output directory. + +PROJECT_LOGO = + +# The OUTPUT_DIRECTORY tag is used to specify the (relative or absolute) path +# into which the generated documentation will be written. If a relative path is +# entered, it will be relative to the location where doxygen was started. If +# left blank the current directory will be used. + +OUTPUT_DIRECTORY = + +# If the CREATE_SUBDIRS tag is set to YES then doxygen will create 4096 sub- +# directories (in 2 levels) under the output directory of each output format and +# will distribute the generated files over these directories. Enabling this +# option can be useful when feeding doxygen a huge amount of source files, where +# putting all generated files in the same directory would otherwise causes +# performance problems for the file system. +# The default value is: NO. + +CREATE_SUBDIRS = NO + +# If the ALLOW_UNICODE_NAMES tag is set to YES, doxygen will allow non-ASCII +# characters to appear in the names of generated files. If set to NO, non-ASCII +# characters will be escaped, for example _xE3_x81_x84 will be used for Unicode +# U+3044. +# The default value is: NO. + +ALLOW_UNICODE_NAMES = NO + +# The OUTPUT_LANGUAGE tag is used to specify the language in which all +# documentation generated by doxygen is written. Doxygen will use this +# information to generate all constant output in the proper language. +# Possible values are: Afrikaans, Arabic, Armenian, Brazilian, Catalan, Chinese, +# Chinese-Traditional, Croatian, Czech, Danish, Dutch, English (United States), +# Esperanto, Farsi (Persian), Finnish, French, German, Greek, Hungarian, +# Indonesian, Italian, Japanese, Japanese-en (Japanese with English messages), +# Korean, Korean-en (Korean with English messages), Latvian, Lithuanian, +# Macedonian, Norwegian, Persian (Farsi), Polish, Portuguese, Romanian, Russian, +# Serbian, Serbian-Cyrillic, Slovak, Slovene, Spanish, Swedish, Turkish, +# Ukrainian and Vietnamese. +# The default value is: English. + +OUTPUT_LANGUAGE = English + +# If the BRIEF_MEMBER_DESC tag is set to YES, doxygen will include brief member +# descriptions after the members that are listed in the file and class +# documentation (similar to Javadoc). Set to NO to disable this. +# The default value is: YES. + +BRIEF_MEMBER_DESC = YES + +# If the REPEAT_BRIEF tag is set to YES, doxygen will prepend the brief +# description of a member or function before the detailed description +# +# Note: If both HIDE_UNDOC_MEMBERS and BRIEF_MEMBER_DESC are set to NO, the +# brief descriptions will be completely suppressed. +# The default value is: YES. + +REPEAT_BRIEF = YES + +# This tag implements a quasi-intelligent brief description abbreviator that is +# used to form the text in various listings. Each string in this list, if found +# as the leading text of the brief description, will be stripped from the text +# and the result, after processing the whole list, is used as the annotated +# text. Otherwise, the brief description is used as-is. If left blank, the +# following values are used ($name is automatically replaced with the name of +# the entity):The $name class, The $name widget, The $name file, is, provides, +# specifies, contains, represents, a, an and the. + +ABBREVIATE_BRIEF = "The $name class" \ + "The $name widget" \ + "The $name file" \ + is \ + provides \ + specifies \ + contains \ + represents \ + a \ + an \ + the + +# If the ALWAYS_DETAILED_SEC and REPEAT_BRIEF tags are both set to YES then +# doxygen will generate a detailed section even if there is only a brief +# description. +# The default value is: NO. + +ALWAYS_DETAILED_SEC = NO + +# If the INLINE_INHERITED_MEMB tag is set to YES, doxygen will show all +# inherited members of a class in the documentation of that class as if those +# members were ordinary class members. Constructors, destructors and assignment +# operators of the base classes will not be shown. +# The default value is: NO. + +INLINE_INHERITED_MEMB = NO + +# If the FULL_PATH_NAMES tag is set to YES, doxygen will prepend the full path +# before files name in the file list and in the header files. If set to NO the +# shortest path that makes the file name unique will be used +# The default value is: YES. + +FULL_PATH_NAMES = YES + +# The STRIP_FROM_PATH tag can be used to strip a user-defined part of the path. +# Stripping is only done if one of the specified strings matches the left-hand +# part of the path. The tag can be used to show relative paths in the file list. +# If left blank the directory from which doxygen is run is used as the path to +# strip. +# +# Note that you can specify absolute paths here, but also relative paths, which +# will be relative from the directory where doxygen is started. +# This tag requires that the tag FULL_PATH_NAMES is set to YES. + +STRIP_FROM_PATH = + +# The STRIP_FROM_INC_PATH tag can be used to strip a user-defined part of the +# path mentioned in the documentation of a class, which tells the reader which +# header file to include in order to use a class. If left blank only the name of +# the header file containing the class definition is used. Otherwise one should +# specify the list of include paths that are normally passed to the compiler +# using the -I flag. + +STRIP_FROM_INC_PATH = + +# If the SHORT_NAMES tag is set to YES, doxygen will generate much shorter (but +# less readable) file names. This can be useful is your file systems doesn't +# support long names like on DOS, Mac, or CD-ROM. +# The default value is: NO. + +SHORT_NAMES = NO + +# If the JAVADOC_AUTOBRIEF tag is set to YES then doxygen will interpret the +# first line (until the first dot) of a Javadoc-style comment as the brief +# description. If set to NO, the Javadoc-style will behave just like regular Qt- +# style comments (thus requiring an explicit @brief command for a brief +# description.) +# The default value is: NO. + +JAVADOC_AUTOBRIEF = NO + +# If the QT_AUTOBRIEF tag is set to YES then doxygen will interpret the first +# line (until the first dot) of a Qt-style comment as the brief description. If +# set to NO, the Qt-style will behave just like regular Qt-style comments (thus +# requiring an explicit \brief command for a brief description.) +# The default value is: NO. + +QT_AUTOBRIEF = NO + +# The MULTILINE_CPP_IS_BRIEF tag can be set to YES to make doxygen treat a +# multi-line C++ special comment block (i.e. a block of //! or /// comments) as +# a brief description. This used to be the default behavior. The new default is +# to treat a multi-line C++ comment block as a detailed description. Set this +# tag to YES if you prefer the old behavior instead. +# +# Note that setting this tag to YES also means that rational rose comments are +# not recognized any more. +# The default value is: NO. + +MULTILINE_CPP_IS_BRIEF = NO + +# If the INHERIT_DOCS tag is set to YES then an undocumented member inherits the +# documentation from any documented member that it re-implements. +# The default value is: YES. + +INHERIT_DOCS = YES + +# If the SEPARATE_MEMBER_PAGES tag is set to YES then doxygen will produce a new +# page for each member. If set to NO, the documentation of a member will be part +# of the file/class/namespace that contains it. +# The default value is: NO. + +SEPARATE_MEMBER_PAGES = NO + +# The TAB_SIZE tag can be used to set the number of spaces in a tab. Doxygen +# uses this value to replace tabs by spaces in code fragments. +# Minimum value: 1, maximum value: 16, default value: 4. + +TAB_SIZE = 4 + +# This tag can be used to specify a number of aliases that act as commands in +# the documentation. An alias has the form: +# name=value +# For example adding +# "sideeffect=@par Side Effects:\n" +# will allow you to put the command \sideeffect (or @sideeffect) in the +# documentation, which will result in a user-defined paragraph with heading +# "Side Effects:". You can put \n's in the value part of an alias to insert +# newlines. + +ALIASES = + +# This tag can be used to specify a number of word-keyword mappings (TCL only). +# A mapping has the form "name=value". For example adding "class=itcl::class" +# will allow you to use the command class in the itcl::class meaning. + +TCL_SUBST = + +# Set the OPTIMIZE_OUTPUT_FOR_C tag to YES if your project consists of C sources +# only. Doxygen will then generate output that is more tailored for C. For +# instance, some of the names that are used will be different. The list of all +# members will be omitted, etc. +# The default value is: NO. + +OPTIMIZE_OUTPUT_FOR_C = NO + +# Set the OPTIMIZE_OUTPUT_JAVA tag to YES if your project consists of Java or +# Python sources only. Doxygen will then generate output that is more tailored +# for that language. For instance, namespaces will be presented as packages, +# qualified scopes will look different, etc. +# The default value is: NO. + +OPTIMIZE_OUTPUT_JAVA = NO + +# Set the OPTIMIZE_FOR_FORTRAN tag to YES if your project consists of Fortran +# sources. Doxygen will then generate output that is tailored for Fortran. +# The default value is: NO. + +OPTIMIZE_FOR_FORTRAN = NO + +# Set the OPTIMIZE_OUTPUT_VHDL tag to YES if your project consists of VHDL +# sources. Doxygen will then generate output that is tailored for VHDL. +# The default value is: NO. + +OPTIMIZE_OUTPUT_VHDL = NO + +# Doxygen selects the parser to use depending on the extension of the files it +# parses. With this tag you can assign which parser to use for a given +# extension. Doxygen has a built-in mapping, but you can override or extend it +# using this tag. The format is ext=language, where ext is a file extension, and +# language is one of the parsers supported by doxygen: IDL, Java, Javascript, +# C#, C, C++, D, PHP, Objective-C, Python, Fortran (fixed format Fortran: +# FortranFixed, free formatted Fortran: FortranFree, unknown formatted Fortran: +# Fortran. In the later case the parser tries to guess whether the code is fixed +# or free formatted code, this is the default for Fortran type files), VHDL. For +# instance to make doxygen treat .inc files as Fortran files (default is PHP), +# and .f files as C (default is Fortran), use: inc=Fortran f=C. +# +# Note: For files without extension you can use no_extension as a placeholder. +# +# Note that for custom extensions you also need to set FILE_PATTERNS otherwise +# the files are not read by doxygen. + +EXTENSION_MAPPING = + +# If the MARKDOWN_SUPPORT tag is enabled then doxygen pre-processes all comments +# according to the Markdown format, which allows for more readable +# documentation. See http://daringfireball.net/projects/markdown/ for details. +# The output of markdown processing is further processed by doxygen, so you can +# mix doxygen, HTML, and XML commands with Markdown formatting. Disable only in +# case of backward compatibilities issues. +# The default value is: YES. + +MARKDOWN_SUPPORT = YES + +# When the TOC_INCLUDE_HEADINGS tag is set to a non-zero value, all headings up +# to that level are automatically included in the table of contents, even if +# they do not have an id attribute. +# Note: This feature currently applies only to Markdown headings. +# Minimum value: 0, maximum value: 99, default value: 0. +# This tag requires that the tag MARKDOWN_SUPPORT is set to YES. + +TOC_INCLUDE_HEADINGS = 0 + +# When enabled doxygen tries to link words that correspond to documented +# classes, or namespaces to their corresponding documentation. Such a link can +# be prevented in individual cases by putting a % sign in front of the word or +# globally by setting AUTOLINK_SUPPORT to NO. +# The default value is: YES. + +AUTOLINK_SUPPORT = YES + +# If you use STL classes (i.e. std::string, std::vector, etc.) but do not want +# to include (a tag file for) the STL sources as input, then you should set this +# tag to YES in order to let doxygen match functions declarations and +# definitions whose arguments contain STL classes (e.g. func(std::string); +# versus func(std::string) {}). This also make the inheritance and collaboration +# diagrams that involve STL classes more complete and accurate. +# The default value is: NO. + +BUILTIN_STL_SUPPORT = NO + +# If you use Microsoft's C++/CLI language, you should set this option to YES to +# enable parsing support. +# The default value is: NO. + +CPP_CLI_SUPPORT = NO + +# Set the SIP_SUPPORT tag to YES if your project consists of sip (see: +# http://www.riverbankcomputing.co.uk/software/sip/intro) sources only. Doxygen +# will parse them like normal C++ but will assume all classes use public instead +# of private inheritance when no explicit protection keyword is present. +# The default value is: NO. + +SIP_SUPPORT = NO + +# For Microsoft's IDL there are propget and propput attributes to indicate +# getter and setter methods for a property. Setting this option to YES will make +# doxygen to replace the get and set methods by a property in the documentation. +# This will only work if the methods are indeed getting or setting a simple +# type. If this is not the case, or you want to show the methods anyway, you +# should set this option to NO. +# The default value is: YES. + +IDL_PROPERTY_SUPPORT = YES + +# If member grouping is used in the documentation and the DISTRIBUTE_GROUP_DOC +# tag is set to YES then doxygen will reuse the documentation of the first +# member in the group (if any) for the other members of the group. By default +# all members of a group must be documented explicitly. +# The default value is: NO. + +DISTRIBUTE_GROUP_DOC = NO + +# If one adds a struct or class to a group and this option is enabled, then also +# any nested class or struct is added to the same group. By default this option +# is disabled and one has to add nested compounds explicitly via \ingroup. +# The default value is: NO. + +GROUP_NESTED_COMPOUNDS = NO + +# Set the SUBGROUPING tag to YES to allow class member groups of the same type +# (for instance a group of public functions) to be put as a subgroup of that +# type (e.g. under the Public Functions section). Set it to NO to prevent +# subgrouping. Alternatively, this can be done per class using the +# \nosubgrouping command. +# The default value is: YES. + +SUBGROUPING = YES + +# When the INLINE_GROUPED_CLASSES tag is set to YES, classes, structs and unions +# are shown inside the group in which they are included (e.g. using \ingroup) +# instead of on a separate page (for HTML and Man pages) or section (for LaTeX +# and RTF). +# +# Note that this feature does not work in combination with +# SEPARATE_MEMBER_PAGES. +# The default value is: NO. + +INLINE_GROUPED_CLASSES = NO + +# When the INLINE_SIMPLE_STRUCTS tag is set to YES, structs, classes, and unions +# with only public data fields or simple typedef fields will be shown inline in +# the documentation of the scope in which they are defined (i.e. file, +# namespace, or group documentation), provided this scope is documented. If set +# to NO, structs, classes, and unions are shown on a separate page (for HTML and +# Man pages) or section (for LaTeX and RTF). +# The default value is: NO. + +INLINE_SIMPLE_STRUCTS = NO + +# When TYPEDEF_HIDES_STRUCT tag is enabled, a typedef of a struct, union, or +# enum is documented as struct, union, or enum with the name of the typedef. So +# typedef struct TypeS {} TypeT, will appear in the documentation as a struct +# with name TypeT. When disabled the typedef will appear as a member of a file, +# namespace, or class. And the struct will be named TypeS. This can typically be +# useful for C code in case the coding convention dictates that all compound +# types are typedef'ed and only the typedef is referenced, never the tag name. +# The default value is: NO. + +TYPEDEF_HIDES_STRUCT = NO + +# The size of the symbol lookup cache can be set using LOOKUP_CACHE_SIZE. This +# cache is used to resolve symbols given their name and scope. Since this can be +# an expensive process and often the same symbol appears multiple times in the +# code, doxygen keeps a cache of pre-resolved symbols. If the cache is too small +# doxygen will become slower. If the cache is too large, memory is wasted. The +# cache size is given by this formula: 2^(16+LOOKUP_CACHE_SIZE). The valid range +# is 0..9, the default is 0, corresponding to a cache size of 2^16=65536 +# symbols. At the end of a run doxygen will report the cache usage and suggest +# the optimal cache size from a speed point of view. +# Minimum value: 0, maximum value: 9, default value: 0. + +LOOKUP_CACHE_SIZE = 0 + +#--------------------------------------------------------------------------- +# Build related configuration options +#--------------------------------------------------------------------------- + +# If the EXTRACT_ALL tag is set to YES, doxygen will assume all entities in +# documentation are documented, even if no documentation was available. Private +# class members and static file members will be hidden unless the +# EXTRACT_PRIVATE respectively EXTRACT_STATIC tags are set to YES. +# Note: This will also disable the warnings about undocumented members that are +# normally produced when WARNINGS is set to YES. +# The default value is: NO. + +EXTRACT_ALL = NO + +# If the EXTRACT_PRIVATE tag is set to YES, all private members of a class will +# be included in the documentation. +# The default value is: NO. + +EXTRACT_PRIVATE = NO + +# If the EXTRACT_PACKAGE tag is set to YES, all members with package or internal +# scope will be included in the documentation. +# The default value is: NO. + +EXTRACT_PACKAGE = NO + +# If the EXTRACT_STATIC tag is set to YES, all static members of a file will be +# included in the documentation. +# The default value is: NO. + +EXTRACT_STATIC = NO + +# If the EXTRACT_LOCAL_CLASSES tag is set to YES, classes (and structs) defined +# locally in source files will be included in the documentation. If set to NO, +# only classes defined in header files are included. Does not have any effect +# for Java sources. +# The default value is: YES. + +EXTRACT_LOCAL_CLASSES = YES + +# This flag is only useful for Objective-C code. If set to YES, local methods, +# which are defined in the implementation section but not in the interface are +# included in the documentation. If set to NO, only methods in the interface are +# included. +# The default value is: NO. + +EXTRACT_LOCAL_METHODS = NO + +# If this flag is set to YES, the members of anonymous namespaces will be +# extracted and appear in the documentation as a namespace called +# 'anonymous_namespace{file}', where file will be replaced with the base name of +# the file that contains the anonymous namespace. By default anonymous namespace +# are hidden. +# The default value is: NO. + +EXTRACT_ANON_NSPACES = NO + +# If the HIDE_UNDOC_MEMBERS tag is set to YES, doxygen will hide all +# undocumented members inside documented classes or files. If set to NO these +# members will be included in the various overviews, but no documentation +# section is generated. This option has no effect if EXTRACT_ALL is enabled. +# The default value is: NO. + +HIDE_UNDOC_MEMBERS = NO + +# If the HIDE_UNDOC_CLASSES tag is set to YES, doxygen will hide all +# undocumented classes that are normally visible in the class hierarchy. If set +# to NO, these classes will be included in the various overviews. This option +# has no effect if EXTRACT_ALL is enabled. +# The default value is: NO. + +HIDE_UNDOC_CLASSES = NO + +# If the HIDE_FRIEND_COMPOUNDS tag is set to YES, doxygen will hide all friend +# (class|struct|union) declarations. If set to NO, these declarations will be +# included in the documentation. +# The default value is: NO. + +HIDE_FRIEND_COMPOUNDS = NO + +# If the HIDE_IN_BODY_DOCS tag is set to YES, doxygen will hide any +# documentation blocks found inside the body of a function. If set to NO, these +# blocks will be appended to the function's detailed documentation block. +# The default value is: NO. + +HIDE_IN_BODY_DOCS = NO + +# The INTERNAL_DOCS tag determines if documentation that is typed after a +# \internal command is included. If the tag is set to NO then the documentation +# will be excluded. Set it to YES to include the internal documentation. +# The default value is: NO. + +INTERNAL_DOCS = NO + +# If the CASE_SENSE_NAMES tag is set to NO then doxygen will only generate file +# names in lower-case letters. If set to YES, upper-case letters are also +# allowed. This is useful if you have classes or files whose names only differ +# in case and if your file system supports case sensitive file names. Windows +# and Mac users are advised to set this option to NO. +# The default value is: system dependent. + +CASE_SENSE_NAMES = YES + +# If the HIDE_SCOPE_NAMES tag is set to NO then doxygen will show members with +# their full class and namespace scopes in the documentation. If set to YES, the +# scope will be hidden. +# The default value is: NO. + +HIDE_SCOPE_NAMES = NO + +# If the HIDE_COMPOUND_REFERENCE tag is set to NO (default) then doxygen will +# append additional text to a page's title, such as Class Reference. If set to +# YES the compound reference will be hidden. +# The default value is: NO. + +HIDE_COMPOUND_REFERENCE= NO + +# If the SHOW_INCLUDE_FILES tag is set to YES then doxygen will put a list of +# the files that are included by a file in the documentation of that file. +# The default value is: YES. + +SHOW_INCLUDE_FILES = YES + +# If the SHOW_GROUPED_MEMB_INC tag is set to YES then Doxygen will add for each +# grouped member an include statement to the documentation, telling the reader +# which file to include in order to use the member. +# The default value is: NO. + +SHOW_GROUPED_MEMB_INC = NO + +# If the FORCE_LOCAL_INCLUDES tag is set to YES then doxygen will list include +# files with double quotes in the documentation rather than with sharp brackets. +# The default value is: NO. + +FORCE_LOCAL_INCLUDES = NO + +# If the INLINE_INFO tag is set to YES then a tag [inline] is inserted in the +# documentation for inline members. +# The default value is: YES. + +INLINE_INFO = YES + +# If the SORT_MEMBER_DOCS tag is set to YES then doxygen will sort the +# (detailed) documentation of file and class members alphabetically by member +# name. If set to NO, the members will appear in declaration order. +# The default value is: YES. + +SORT_MEMBER_DOCS = YES + +# If the SORT_BRIEF_DOCS tag is set to YES then doxygen will sort the brief +# descriptions of file, namespace and class members alphabetically by member +# name. If set to NO, the members will appear in declaration order. Note that +# this will also influence the order of the classes in the class list. +# The default value is: NO. + +SORT_BRIEF_DOCS = NO + +# If the SORT_MEMBERS_CTORS_1ST tag is set to YES then doxygen will sort the +# (brief and detailed) documentation of class members so that constructors and +# destructors are listed first. If set to NO the constructors will appear in the +# respective orders defined by SORT_BRIEF_DOCS and SORT_MEMBER_DOCS. +# Note: If SORT_BRIEF_DOCS is set to NO this option is ignored for sorting brief +# member documentation. +# Note: If SORT_MEMBER_DOCS is set to NO this option is ignored for sorting +# detailed member documentation. +# The default value is: NO. + +SORT_MEMBERS_CTORS_1ST = NO + +# If the SORT_GROUP_NAMES tag is set to YES then doxygen will sort the hierarchy +# of group names into alphabetical order. If set to NO the group names will +# appear in their defined order. +# The default value is: NO. + +SORT_GROUP_NAMES = NO + +# If the SORT_BY_SCOPE_NAME tag is set to YES, the class list will be sorted by +# fully-qualified names, including namespaces. If set to NO, the class list will +# be sorted only by class name, not including the namespace part. +# Note: This option is not very useful if HIDE_SCOPE_NAMES is set to YES. +# Note: This option applies only to the class list, not to the alphabetical +# list. +# The default value is: NO. + +SORT_BY_SCOPE_NAME = NO + +# If the STRICT_PROTO_MATCHING option is enabled and doxygen fails to do proper +# type resolution of all parameters of a function it will reject a match between +# the prototype and the implementation of a member function even if there is +# only one candidate or it is obvious which candidate to choose by doing a +# simple string match. By disabling STRICT_PROTO_MATCHING doxygen will still +# accept a match between prototype and implementation in such cases. +# The default value is: NO. + +STRICT_PROTO_MATCHING = NO + +# The GENERATE_TODOLIST tag can be used to enable (YES) or disable (NO) the todo +# list. This list is created by putting \todo commands in the documentation. +# The default value is: YES. + +GENERATE_TODOLIST = YES + +# The GENERATE_TESTLIST tag can be used to enable (YES) or disable (NO) the test +# list. This list is created by putting \test commands in the documentation. +# The default value is: YES. + +GENERATE_TESTLIST = YES + +# The GENERATE_BUGLIST tag can be used to enable (YES) or disable (NO) the bug +# list. This list is created by putting \bug commands in the documentation. +# The default value is: YES. + +GENERATE_BUGLIST = YES + +# The GENERATE_DEPRECATEDLIST tag can be used to enable (YES) or disable (NO) +# the deprecated list. This list is created by putting \deprecated commands in +# the documentation. +# The default value is: YES. + +GENERATE_DEPRECATEDLIST= YES + +# The ENABLED_SECTIONS tag can be used to enable conditional documentation +# sections, marked by \if <section_label> ... \endif and \cond <section_label> +# ... \endcond blocks. + +ENABLED_SECTIONS = + +# The MAX_INITIALIZER_LINES tag determines the maximum number of lines that the +# initial value of a variable or macro / define can have for it to appear in the +# documentation. If the initializer consists of more lines than specified here +# it will be hidden. Use a value of 0 to hide initializers completely. The +# appearance of the value of individual variables and macros / defines can be +# controlled using \showinitializer or \hideinitializer command in the +# documentation regardless of this setting. +# Minimum value: 0, maximum value: 10000, default value: 30. + +MAX_INITIALIZER_LINES = 30 + +# Set the SHOW_USED_FILES tag to NO to disable the list of files generated at +# the bottom of the documentation of classes and structs. If set to YES, the +# list will mention the files that were used to generate the documentation. +# The default value is: YES. + +SHOW_USED_FILES = YES + +# Set the SHOW_FILES tag to NO to disable the generation of the Files page. This +# will remove the Files entry from the Quick Index and from the Folder Tree View +# (if specified). +# The default value is: YES. + +SHOW_FILES = YES + +# Set the SHOW_NAMESPACES tag to NO to disable the generation of the Namespaces +# page. This will remove the Namespaces entry from the Quick Index and from the +# Folder Tree View (if specified). +# The default value is: YES. + +SHOW_NAMESPACES = YES + +# The FILE_VERSION_FILTER tag can be used to specify a program or script that +# doxygen should invoke to get the current version for each file (typically from +# the version control system). Doxygen will invoke the program by executing (via +# popen()) the command command input-file, where command is the value of the +# FILE_VERSION_FILTER tag, and input-file is the name of an input file provided +# by doxygen. Whatever the program writes to standard output is used as the file +# version. For an example see the documentation. + +FILE_VERSION_FILTER = + +# The LAYOUT_FILE tag can be used to specify a layout file which will be parsed +# by doxygen. The layout file controls the global structure of the generated +# output files in an output format independent way. To create the layout file +# that represents doxygen's defaults, run doxygen with the -l option. You can +# optionally specify a file name after the option, if omitted DoxygenLayout.xml +# will be used as the name of the layout file. +# +# Note that if you run doxygen from a directory containing a file called +# DoxygenLayout.xml, doxygen will parse it automatically even if the LAYOUT_FILE +# tag is left empty. + +LAYOUT_FILE = + +# The CITE_BIB_FILES tag can be used to specify one or more bib files containing +# the reference definitions. This must be a list of .bib files. The .bib +# extension is automatically appended if omitted. This requires the bibtex tool +# to be installed. See also http://en.wikipedia.org/wiki/BibTeX for more info. +# For LaTeX the style of the bibliography can be controlled using +# LATEX_BIB_STYLE. To use this feature you need bibtex and perl available in the +# search path. See also \cite for info how to create references. + +CITE_BIB_FILES = + +#--------------------------------------------------------------------------- +# Configuration options related to warning and progress messages +#--------------------------------------------------------------------------- + +# The QUIET tag can be used to turn on/off the messages that are generated to +# standard output by doxygen. If QUIET is set to YES this implies that the +# messages are off. +# The default value is: NO. + +QUIET = NO + +# The WARNINGS tag can be used to turn on/off the warning messages that are +# generated to standard error (stderr) by doxygen. If WARNINGS is set to YES +# this implies that the warnings are on. +# +# Tip: Turn warnings on while writing the documentation. +# The default value is: YES. + +WARNINGS = YES + +# If the WARN_IF_UNDOCUMENTED tag is set to YES then doxygen will generate +# warnings for undocumented members. If EXTRACT_ALL is set to YES then this flag +# will automatically be disabled. +# The default value is: YES. + +WARN_IF_UNDOCUMENTED = YES + +# If the WARN_IF_DOC_ERROR tag is set to YES, doxygen will generate warnings for +# potential errors in the documentation, such as not documenting some parameters +# in a documented function, or documenting parameters that don't exist or using +# markup commands wrongly. +# The default value is: YES. + +WARN_IF_DOC_ERROR = YES + +# This WARN_NO_PARAMDOC option can be enabled to get warnings for functions that +# are documented, but have no documentation for their parameters or return +# value. If set to NO, doxygen will only warn about wrong or incomplete +# parameter documentation, but not about the absence of documentation. +# The default value is: NO. + +WARN_NO_PARAMDOC = NO + +# If the WARN_AS_ERROR tag is set to YES then doxygen will immediately stop when +# a warning is encountered. +# The default value is: NO. + +WARN_AS_ERROR = NO + +# The WARN_FORMAT tag determines the format of the warning messages that doxygen +# can produce. The string should contain the $file, $line, and $text tags, which +# will be replaced by the file and line number from which the warning originated +# and the warning text. Optionally the format may contain $version, which will +# be replaced by the version of the file (if it could be obtained via +# FILE_VERSION_FILTER) +# The default value is: $file:$line: $text. + +WARN_FORMAT = "$file:$line: $text" + +# The WARN_LOGFILE tag can be used to specify a file to which warning and error +# messages should be written. If left blank the output is written to standard +# error (stderr). + +WARN_LOGFILE = + +#--------------------------------------------------------------------------- +# Configuration options related to the input files +#--------------------------------------------------------------------------- + +# The INPUT tag is used to specify the files and/or directories that contain +# documented source files. You may enter file names like myfile.cpp or +# directories like /usr/src/myproject. Separate the files or directories with +# spaces. See also FILE_PATTERNS and EXTENSION_MAPPING +# Note: If this tag is empty the current directory is searched. + +INPUT = testing_doxygen . + +# This tag can be used to specify the character encoding of the source files +# that doxygen parses. Internally doxygen uses the UTF-8 encoding. Doxygen uses +# libiconv (or the iconv built into libc) for the transcoding. See the libiconv +# documentation (see: http://www.gnu.org/software/libiconv) for the list of +# possible encodings. +# The default value is: UTF-8. + +INPUT_ENCODING = UTF-8 + +# If the value of the INPUT tag contains directories, you can use the +# FILE_PATTERNS tag to specify one or more wildcard patterns (like *.cpp and +# *.h) to filter out the source-files in the directories. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# read by doxygen. +# +# If left blank the following patterns are tested:*.c, *.cc, *.cxx, *.cpp, +# *.c++, *.java, *.ii, *.ixx, *.ipp, *.i++, *.inl, *.idl, *.ddl, *.odl, *.h, +# *.hh, *.hxx, *.hpp, *.h++, *.cs, *.d, *.php, *.php4, *.php5, *.phtml, *.inc, +# *.m, *.markdown, *.md, *.mm, *.dox, *.py, *.pyw, *.f90, *.f95, *.f03, *.f08, +# *.f, *.for, *.tcl, *.vhd, *.vhdl, *.ucf and *.qsf. + +FILE_PATTERNS = *.c \ + *.cc \ + *.cxx \ + *.cpp \ + *.c++ \ + *.java \ + *.ii \ + *.ixx \ + *.ipp \ + *.i++ \ + *.inl \ + *.idl \ + *.ddl \ + *.odl \ + *.h \ + *.hh \ + *.hxx \ + *.hpp \ + *.h++ \ + *.cs \ + *.d \ + *.php \ + *.php4 \ + *.php5 \ + *.phtml \ + *.inc \ + *.m \ + *.markdown \ + *.md \ + *.mm \ + *.dox \ + *.py \ + *.pyw \ + *.f90 \ + *.f95 \ + *.f03 \ + *.f08 \ + *.f \ + *.for \ + *.tcl \ + *.vhd \ + *.vhdl \ + *.ucf \ + *.qsf + +# The RECURSIVE tag can be used to specify whether or not subdirectories should +# be searched for input files as well. +# The default value is: NO. + +RECURSIVE = NO + +# The EXCLUDE tag can be used to specify files and/or directories that should be +# excluded from the INPUT source files. This way you can easily exclude a +# subdirectory from a directory tree whose root is specified with the INPUT tag. +# +# Note that relative paths are relative to the directory from which doxygen is +# run. + +EXCLUDE = + +# The EXCLUDE_SYMLINKS tag can be used to select whether or not files or +# directories that are symbolic links (a Unix file system feature) are excluded +# from the input. +# The default value is: NO. + +EXCLUDE_SYMLINKS = NO + +# If the value of the INPUT tag contains directories, you can use the +# EXCLUDE_PATTERNS tag to specify one or more wildcard patterns to exclude +# certain files from those directories. +# +# Note that the wildcards are matched against the file with absolute path, so to +# exclude all test directories for example use the pattern */test/* + +EXCLUDE_PATTERNS = + +# The EXCLUDE_SYMBOLS tag can be used to specify one or more symbol names +# (namespaces, classes, functions, etc.) that should be excluded from the +# output. The symbol name can be a fully qualified name, a word, or if the +# wildcard * is used, a substring. Examples: ANamespace, AClass, +# AClass::ANamespace, ANamespace::*Test +# +# Note that the wildcards are matched against the file with absolute path, so to +# exclude all test directories use the pattern */test/* + +EXCLUDE_SYMBOLS = + +# The EXAMPLE_PATH tag can be used to specify one or more files or directories +# that contain example code fragments that are included (see the \include +# command). + +EXAMPLE_PATH = + +# If the value of the EXAMPLE_PATH tag contains directories, you can use the +# EXAMPLE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp and +# *.h) to filter out the source-files in the directories. If left blank all +# files are included. + +EXAMPLE_PATTERNS = * + +# If the EXAMPLE_RECURSIVE tag is set to YES then subdirectories will be +# searched for input files to be used with the \include or \dontinclude commands +# irrespective of the value of the RECURSIVE tag. +# The default value is: NO. + +EXAMPLE_RECURSIVE = NO + +# The IMAGE_PATH tag can be used to specify one or more files or directories +# that contain images that are to be included in the documentation (see the +# \image command). + +IMAGE_PATH = + +# The INPUT_FILTER tag can be used to specify a program that doxygen should +# invoke to filter for each input file. Doxygen will invoke the filter program +# by executing (via popen()) the command: +# +# <filter> <input-file> +# +# where <filter> is the value of the INPUT_FILTER tag, and <input-file> is the +# name of an input file. Doxygen will then use the output that the filter +# program writes to standard output. If FILTER_PATTERNS is specified, this tag +# will be ignored. +# +# Note that the filter must not add or remove lines; it is applied before the +# code is scanned, but not when the output code is generated. If lines are added +# or removed, the anchors will not be placed correctly. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# properly processed by doxygen. + +INPUT_FILTER = + +# The FILTER_PATTERNS tag can be used to specify filters on a per file pattern +# basis. Doxygen will compare the file name with each pattern and apply the +# filter if there is a match. The filters are a list of the form: pattern=filter +# (like *.cpp=my_cpp_filter). See INPUT_FILTER for further information on how +# filters are used. If the FILTER_PATTERNS tag is empty or if none of the +# patterns match the file name, INPUT_FILTER is applied. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# properly processed by doxygen. + +FILTER_PATTERNS = + +# If the FILTER_SOURCE_FILES tag is set to YES, the input filter (if set using +# INPUT_FILTER) will also be used to filter the input files that are used for +# producing the source files to browse (i.e. when SOURCE_BROWSER is set to YES). +# The default value is: NO. + +FILTER_SOURCE_FILES = NO + +# The FILTER_SOURCE_PATTERNS tag can be used to specify source filters per file +# pattern. A pattern will override the setting for FILTER_PATTERN (if any) and +# it is also possible to disable source filtering for a specific pattern using +# *.ext= (so without naming a filter). +# This tag requires that the tag FILTER_SOURCE_FILES is set to YES. + +FILTER_SOURCE_PATTERNS = + +# If the USE_MDFILE_AS_MAINPAGE tag refers to the name of a markdown file that +# is part of the input, its contents will be placed on the main page +# (index.html). This can be useful if you have a project on for instance GitHub +# and want to reuse the introduction page also for the doxygen output. + +USE_MDFILE_AS_MAINPAGE = + +#--------------------------------------------------------------------------- +# Configuration options related to source browsing +#--------------------------------------------------------------------------- + +# If the SOURCE_BROWSER tag is set to YES then a list of source files will be +# generated. Documented entities will be cross-referenced with these sources. +# +# Note: To get rid of all source code in the generated output, make sure that +# also VERBATIM_HEADERS is set to NO. +# The default value is: NO. + +SOURCE_BROWSER = NO + +# Setting the INLINE_SOURCES tag to YES will include the body of functions, +# classes and enums directly into the documentation. +# The default value is: NO. + +INLINE_SOURCES = NO + +# Setting the STRIP_CODE_COMMENTS tag to YES will instruct doxygen to hide any +# special comment blocks from generated source code fragments. Normal C, C++ and +# Fortran comments will always remain visible. +# The default value is: YES. + +STRIP_CODE_COMMENTS = YES + +# If the REFERENCED_BY_RELATION tag is set to YES then for each documented +# function all documented functions referencing it will be listed. +# The default value is: NO. + +REFERENCED_BY_RELATION = NO + +# If the REFERENCES_RELATION tag is set to YES then for each documented function +# all documented entities called/used by that function will be listed. +# The default value is: NO. + +REFERENCES_RELATION = NO + +# If the REFERENCES_LINK_SOURCE tag is set to YES and SOURCE_BROWSER tag is set +# to YES then the hyperlinks from functions in REFERENCES_RELATION and +# REFERENCED_BY_RELATION lists will link to the source code. Otherwise they will +# link to the documentation. +# The default value is: YES. + +REFERENCES_LINK_SOURCE = YES + +# If SOURCE_TOOLTIPS is enabled (the default) then hovering a hyperlink in the +# source code will show a tooltip with additional information such as prototype, +# brief description and links to the definition and documentation. Since this +# will make the HTML file larger and loading of large files a bit slower, you +# can opt to disable this feature. +# The default value is: YES. +# This tag requires that the tag SOURCE_BROWSER is set to YES. + +SOURCE_TOOLTIPS = YES + +# If the USE_HTAGS tag is set to YES then the references to source code will +# point to the HTML generated by the htags(1) tool instead of doxygen built-in +# source browser. The htags tool is part of GNU's global source tagging system +# (see http://www.gnu.org/software/global/global.html). You will need version +# 4.8.6 or higher. +# +# To use it do the following: +# - Install the latest version of global +# - Enable SOURCE_BROWSER and USE_HTAGS in the config file +# - Make sure the INPUT points to the root of the source tree +# - Run doxygen as normal +# +# Doxygen will invoke htags (and that will in turn invoke gtags), so these +# tools must be available from the command line (i.e. in the search path). +# +# The result: instead of the source browser generated by doxygen, the links to +# source code will now point to the output of htags. +# The default value is: NO. +# This tag requires that the tag SOURCE_BROWSER is set to YES. + +USE_HTAGS = NO + +# If the VERBATIM_HEADERS tag is set the YES then doxygen will generate a +# verbatim copy of the header file for each class for which an include is +# specified. Set to NO to disable this. +# See also: Section \class. +# The default value is: YES. + +VERBATIM_HEADERS = YES + +# If the CLANG_ASSISTED_PARSING tag is set to YES then doxygen will use the +# clang parser (see: http://clang.llvm.org/) for more accurate parsing at the +# cost of reduced performance. This can be particularly helpful with template +# rich C++ code for which doxygen's built-in parser lacks the necessary type +# information. +# Note: The availability of this option depends on whether or not doxygen was +# generated with the -Duse-libclang=ON option for CMake. +# The default value is: NO. + +CLANG_ASSISTED_PARSING = NO + +# If clang assisted parsing is enabled you can provide the compiler with command +# line options that you would normally use when invoking the compiler. Note that +# the include paths will already be set by doxygen for the files and directories +# specified with INPUT and INCLUDE_PATH. +# This tag requires that the tag CLANG_ASSISTED_PARSING is set to YES. + +CLANG_OPTIONS = + +#--------------------------------------------------------------------------- +# Configuration options related to the alphabetical class index +#--------------------------------------------------------------------------- + +# If the ALPHABETICAL_INDEX tag is set to YES, an alphabetical index of all +# compounds will be generated. Enable this if the project contains a lot of +# classes, structs, unions or interfaces. +# The default value is: YES. + +ALPHABETICAL_INDEX = YES + +# The COLS_IN_ALPHA_INDEX tag can be used to specify the number of columns in +# which the alphabetical index list will be split. +# Minimum value: 1, maximum value: 20, default value: 5. +# This tag requires that the tag ALPHABETICAL_INDEX is set to YES. + +COLS_IN_ALPHA_INDEX = 5 + +# In case all classes in a project start with a common prefix, all classes will +# be put under the same header in the alphabetical index. The IGNORE_PREFIX tag +# can be used to specify a prefix (or a list of prefixes) that should be ignored +# while generating the index headers. +# This tag requires that the tag ALPHABETICAL_INDEX is set to YES. + +IGNORE_PREFIX = + +#--------------------------------------------------------------------------- +# Configuration options related to the HTML output +#--------------------------------------------------------------------------- + +# If the GENERATE_HTML tag is set to YES, doxygen will generate HTML output +# The default value is: YES. + +GENERATE_HTML = YES + +# The HTML_OUTPUT tag is used to specify where the HTML docs will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. +# The default directory is: html. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_OUTPUT = html + +# The HTML_FILE_EXTENSION tag can be used to specify the file extension for each +# generated HTML page (for example: .htm, .php, .asp). +# The default value is: .html. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_FILE_EXTENSION = .html + +# The HTML_HEADER tag can be used to specify a user-defined HTML header file for +# each generated HTML page. If the tag is left blank doxygen will generate a +# standard header. +# +# To get valid HTML the header file that includes any scripts and style sheets +# that doxygen needs, which is dependent on the configuration options used (e.g. +# the setting GENERATE_TREEVIEW). It is highly recommended to start with a +# default header using +# doxygen -w html new_header.html new_footer.html new_stylesheet.css +# YourConfigFile +# and then modify the file new_header.html. See also section "Doxygen usage" +# for information on how to generate the default header that doxygen normally +# uses. +# Note: The header is subject to change so you typically have to regenerate the +# default header when upgrading to a newer version of doxygen. For a description +# of the possible markers and block names see the documentation. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_HEADER = + +# The HTML_FOOTER tag can be used to specify a user-defined HTML footer for each +# generated HTML page. If the tag is left blank doxygen will generate a standard +# footer. See HTML_HEADER for more information on how to generate a default +# footer and what special commands can be used inside the footer. See also +# section "Doxygen usage" for information on how to generate the default footer +# that doxygen normally uses. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_FOOTER = + +# The HTML_STYLESHEET tag can be used to specify a user-defined cascading style +# sheet that is used by each HTML page. It can be used to fine-tune the look of +# the HTML output. If left blank doxygen will generate a default style sheet. +# See also section "Doxygen usage" for information on how to generate the style +# sheet that doxygen normally uses. +# Note: It is recommended to use HTML_EXTRA_STYLESHEET instead of this tag, as +# it is more robust and this tag (HTML_STYLESHEET) will in the future become +# obsolete. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_STYLESHEET = + +# The HTML_EXTRA_STYLESHEET tag can be used to specify additional user-defined +# cascading style sheets that are included after the standard style sheets +# created by doxygen. Using this option one can overrule certain style aspects. +# This is preferred over using HTML_STYLESHEET since it does not replace the +# standard style sheet and is therefore more robust against future updates. +# Doxygen will copy the style sheet files to the output directory. +# Note: The order of the extra style sheet files is of importance (e.g. the last +# style sheet in the list overrules the setting of the previous ones in the +# list). For an example see the documentation. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_EXTRA_STYLESHEET = + +# The HTML_EXTRA_FILES tag can be used to specify one or more extra images or +# other source files which should be copied to the HTML output directory. Note +# that these files will be copied to the base HTML output directory. Use the +# $relpath^ marker in the HTML_HEADER and/or HTML_FOOTER files to load these +# files. In the HTML_STYLESHEET file, use the file name only. Also note that the +# files will be copied as-is; there are no commands or markers available. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_EXTRA_FILES = + +# The HTML_COLORSTYLE_HUE tag controls the color of the HTML output. Doxygen +# will adjust the colors in the style sheet and background images according to +# this color. Hue is specified as an angle on a colorwheel, see +# http://en.wikipedia.org/wiki/Hue for more information. For instance the value +# 0 represents red, 60 is yellow, 120 is green, 180 is cyan, 240 is blue, 300 +# purple, and 360 is red again. +# Minimum value: 0, maximum value: 359, default value: 220. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_COLORSTYLE_HUE = 220 + +# The HTML_COLORSTYLE_SAT tag controls the purity (or saturation) of the colors +# in the HTML output. For a value of 0 the output will use grayscales only. A +# value of 255 will produce the most vivid colors. +# Minimum value: 0, maximum value: 255, default value: 100. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_COLORSTYLE_SAT = 100 + +# The HTML_COLORSTYLE_GAMMA tag controls the gamma correction applied to the +# luminance component of the colors in the HTML output. Values below 100 +# gradually make the output lighter, whereas values above 100 make the output +# darker. The value divided by 100 is the actual gamma applied, so 80 represents +# a gamma of 0.8, The value 220 represents a gamma of 2.2, and 100 does not +# change the gamma. +# Minimum value: 40, maximum value: 240, default value: 80. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_COLORSTYLE_GAMMA = 80 + +# If the HTML_TIMESTAMP tag is set to YES then the footer of each generated HTML +# page will contain the date and time when the page was generated. Setting this +# to YES can help to show when doxygen was last run and thus if the +# documentation is up to date. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_TIMESTAMP = NO + +# If the HTML_DYNAMIC_SECTIONS tag is set to YES then the generated HTML +# documentation will contain sections that can be hidden and shown after the +# page has loaded. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_DYNAMIC_SECTIONS = NO + +# With HTML_INDEX_NUM_ENTRIES one can control the preferred number of entries +# shown in the various tree structured indices initially; the user can expand +# and collapse entries dynamically later on. Doxygen will expand the tree to +# such a level that at most the specified number of entries are visible (unless +# a fully collapsed tree already exceeds this amount). So setting the number of +# entries 1 will produce a full collapsed tree by default. 0 is a special value +# representing an infinite number of entries and will result in a full expanded +# tree by default. +# Minimum value: 0, maximum value: 9999, default value: 100. +# This tag requires that the tag GENERATE_HTML is set to YES. + +HTML_INDEX_NUM_ENTRIES = 100 + +# If the GENERATE_DOCSET tag is set to YES, additional index files will be +# generated that can be used as input for Apple's Xcode 3 integrated development +# environment (see: http://developer.apple.com/tools/xcode/), introduced with +# OSX 10.5 (Leopard). To create a documentation set, doxygen will generate a +# Makefile in the HTML output directory. Running make will produce the docset in +# that directory and running make install will install the docset in +# ~/Library/Developer/Shared/Documentation/DocSets so that Xcode will find it at +# startup. See http://developer.apple.com/tools/creatingdocsetswithdoxygen.html +# for more information. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_DOCSET = NO + +# This tag determines the name of the docset feed. A documentation feed provides +# an umbrella under which multiple documentation sets from a single provider +# (such as a company or product suite) can be grouped. +# The default value is: Doxygen generated docs. +# This tag requires that the tag GENERATE_DOCSET is set to YES. + +DOCSET_FEEDNAME = "Doxygen generated docs" + +# This tag specifies a string that should uniquely identify the documentation +# set bundle. This should be a reverse domain-name style string, e.g. +# com.mycompany.MyDocSet. Doxygen will append .docset to the name. +# The default value is: org.doxygen.Project. +# This tag requires that the tag GENERATE_DOCSET is set to YES. + +DOCSET_BUNDLE_ID = org.doxygen.Project + +# The DOCSET_PUBLISHER_ID tag specifies a string that should uniquely identify +# the documentation publisher. This should be a reverse domain-name style +# string, e.g. com.mycompany.MyDocSet.documentation. +# The default value is: org.doxygen.Publisher. +# This tag requires that the tag GENERATE_DOCSET is set to YES. + +DOCSET_PUBLISHER_ID = org.doxygen.Publisher + +# The DOCSET_PUBLISHER_NAME tag identifies the documentation publisher. +# The default value is: Publisher. +# This tag requires that the tag GENERATE_DOCSET is set to YES. + +DOCSET_PUBLISHER_NAME = Publisher + +# If the GENERATE_HTMLHELP tag is set to YES then doxygen generates three +# additional HTML index files: index.hhp, index.hhc, and index.hhk. The +# index.hhp is a project file that can be read by Microsoft's HTML Help Workshop +# (see: http://www.microsoft.com/en-us/download/details.aspx?id=21138) on +# Windows. +# +# The HTML Help Workshop contains a compiler that can convert all HTML output +# generated by doxygen into a single compiled HTML file (.chm). Compiled HTML +# files are now used as the Windows 98 help format, and will replace the old +# Windows help format (.hlp) on all Windows platforms in the future. Compressed +# HTML files also contain an index, a table of contents, and you can search for +# words in the documentation. The HTML workshop also contains a viewer for +# compressed HTML files. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_HTMLHELP = NO + +# The CHM_FILE tag can be used to specify the file name of the resulting .chm +# file. You can add a path in front of the file if the result should not be +# written to the html output directory. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +CHM_FILE = + +# The HHC_LOCATION tag can be used to specify the location (absolute path +# including file name) of the HTML help compiler (hhc.exe). If non-empty, +# doxygen will try to run the HTML help compiler on the generated index.hhp. +# The file has to be specified with full path. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +HHC_LOCATION = + +# The GENERATE_CHI flag controls if a separate .chi index file is generated +# (YES) or that it should be included in the master .chm file (NO). +# The default value is: NO. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +GENERATE_CHI = NO + +# The CHM_INDEX_ENCODING is used to encode HtmlHelp index (hhk), content (hhc) +# and project file content. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +CHM_INDEX_ENCODING = + +# The BINARY_TOC flag controls whether a binary table of contents is generated +# (YES) or a normal table of contents (NO) in the .chm file. Furthermore it +# enables the Previous and Next buttons. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +BINARY_TOC = NO + +# The TOC_EXPAND flag can be set to YES to add extra items for group members to +# the table of contents of the HTML help documentation and to the tree view. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTMLHELP is set to YES. + +TOC_EXPAND = NO + +# If the GENERATE_QHP tag is set to YES and both QHP_NAMESPACE and +# QHP_VIRTUAL_FOLDER are set, an additional index file will be generated that +# can be used as input for Qt's qhelpgenerator to generate a Qt Compressed Help +# (.qch) of the generated HTML documentation. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_QHP = NO + +# If the QHG_LOCATION tag is specified, the QCH_FILE tag can be used to specify +# the file name of the resulting .qch file. The path specified is relative to +# the HTML output folder. +# This tag requires that the tag GENERATE_QHP is set to YES. + +QCH_FILE = + +# The QHP_NAMESPACE tag specifies the namespace to use when generating Qt Help +# Project output. For more information please see Qt Help Project / Namespace +# (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#namespace). +# The default value is: org.doxygen.Project. +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_NAMESPACE = org.doxygen.Project + +# The QHP_VIRTUAL_FOLDER tag specifies the namespace to use when generating Qt +# Help Project output. For more information please see Qt Help Project / Virtual +# Folders (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#virtual- +# folders). +# The default value is: doc. +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_VIRTUAL_FOLDER = doc + +# If the QHP_CUST_FILTER_NAME tag is set, it specifies the name of a custom +# filter to add. For more information please see Qt Help Project / Custom +# Filters (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#custom- +# filters). +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_CUST_FILTER_NAME = + +# The QHP_CUST_FILTER_ATTRS tag specifies the list of the attributes of the +# custom filter to add. For more information please see Qt Help Project / Custom +# Filters (see: http://qt-project.org/doc/qt-4.8/qthelpproject.html#custom- +# filters). +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_CUST_FILTER_ATTRS = + +# The QHP_SECT_FILTER_ATTRS tag specifies the list of the attributes this +# project's filter section matches. Qt Help Project / Filter Attributes (see: +# http://qt-project.org/doc/qt-4.8/qthelpproject.html#filter-attributes). +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHP_SECT_FILTER_ATTRS = + +# The QHG_LOCATION tag can be used to specify the location of Qt's +# qhelpgenerator. If non-empty doxygen will try to run qhelpgenerator on the +# generated .qhp file. +# This tag requires that the tag GENERATE_QHP is set to YES. + +QHG_LOCATION = + +# If the GENERATE_ECLIPSEHELP tag is set to YES, additional index files will be +# generated, together with the HTML files, they form an Eclipse help plugin. To +# install this plugin and make it available under the help contents menu in +# Eclipse, the contents of the directory containing the HTML and XML files needs +# to be copied into the plugins directory of eclipse. The name of the directory +# within the plugins directory should be the same as the ECLIPSE_DOC_ID value. +# After copying Eclipse needs to be restarted before the help appears. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_ECLIPSEHELP = NO + +# A unique identifier for the Eclipse help plugin. When installing the plugin +# the directory name containing the HTML and XML files should also have this +# name. Each documentation set should have its own identifier. +# The default value is: org.doxygen.Project. +# This tag requires that the tag GENERATE_ECLIPSEHELP is set to YES. + +ECLIPSE_DOC_ID = org.doxygen.Project + +# If you want full control over the layout of the generated HTML pages it might +# be necessary to disable the index and replace it with your own. The +# DISABLE_INDEX tag can be used to turn on/off the condensed index (tabs) at top +# of each HTML page. A value of NO enables the index and the value YES disables +# it. Since the tabs in the index contain the same information as the navigation +# tree, you can set this option to YES if you also set GENERATE_TREEVIEW to YES. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +DISABLE_INDEX = NO + +# The GENERATE_TREEVIEW tag is used to specify whether a tree-like index +# structure should be generated to display hierarchical information. If the tag +# value is set to YES, a side panel will be generated containing a tree-like +# index structure (just like the one that is generated for HTML Help). For this +# to work a browser that supports JavaScript, DHTML, CSS and frames is required +# (i.e. any modern browser). Windows users are probably better off using the +# HTML help feature. Via custom style sheets (see HTML_EXTRA_STYLESHEET) one can +# further fine-tune the look of the index. As an example, the default style +# sheet generated by doxygen has an example that shows how to put an image at +# the root of the tree instead of the PROJECT_NAME. Since the tree basically has +# the same information as the tab index, you could consider setting +# DISABLE_INDEX to YES when enabling this option. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +GENERATE_TREEVIEW = NO + +# The ENUM_VALUES_PER_LINE tag can be used to set the number of enum values that +# doxygen will group on one line in the generated HTML documentation. +# +# Note that a value of 0 will completely suppress the enum values from appearing +# in the overview section. +# Minimum value: 0, maximum value: 20, default value: 4. +# This tag requires that the tag GENERATE_HTML is set to YES. + +ENUM_VALUES_PER_LINE = 4 + +# If the treeview is enabled (see GENERATE_TREEVIEW) then this tag can be used +# to set the initial width (in pixels) of the frame in which the tree is shown. +# Minimum value: 0, maximum value: 1500, default value: 250. +# This tag requires that the tag GENERATE_HTML is set to YES. + +TREEVIEW_WIDTH = 250 + +# If the EXT_LINKS_IN_WINDOW option is set to YES, doxygen will open links to +# external symbols imported via tag files in a separate window. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +EXT_LINKS_IN_WINDOW = NO + +# Use this tag to change the font size of LaTeX formulas included as images in +# the HTML documentation. When you change the font size after a successful +# doxygen run you need to manually remove any form_*.png images from the HTML +# output directory to force them to be regenerated. +# Minimum value: 8, maximum value: 50, default value: 10. +# This tag requires that the tag GENERATE_HTML is set to YES. + +FORMULA_FONTSIZE = 10 + +# Use the FORMULA_TRANPARENT tag to determine whether or not the images +# generated for formulas are transparent PNGs. Transparent PNGs are not +# supported properly for IE 6.0, but are supported on all modern browsers. +# +# Note that when changing this option you need to delete any form_*.png files in +# the HTML output directory before the changes have effect. +# The default value is: YES. +# This tag requires that the tag GENERATE_HTML is set to YES. + +FORMULA_TRANSPARENT = YES + +# Enable the USE_MATHJAX option to render LaTeX formulas using MathJax (see +# http://www.mathjax.org) which uses client side Javascript for the rendering +# instead of using pre-rendered bitmaps. Use this if you do not have LaTeX +# installed or if you want to formulas look prettier in the HTML output. When +# enabled you may also need to install MathJax separately and configure the path +# to it using the MATHJAX_RELPATH option. +# The default value is: NO. +# This tag requires that the tag GENERATE_HTML is set to YES. + +USE_MATHJAX = NO + +# When MathJax is enabled you can set the default output format to be used for +# the MathJax output. See the MathJax site (see: +# http://docs.mathjax.org/en/latest/output.html) for more details. +# Possible values are: HTML-CSS (which is slower, but has the best +# compatibility), NativeMML (i.e. MathML) and SVG. +# The default value is: HTML-CSS. +# This tag requires that the tag USE_MATHJAX is set to YES. + +MATHJAX_FORMAT = HTML-CSS + +# When MathJax is enabled you need to specify the location relative to the HTML +# output directory using the MATHJAX_RELPATH option. The destination directory +# should contain the MathJax.js script. For instance, if the mathjax directory +# is located at the same level as the HTML output directory, then +# MATHJAX_RELPATH should be ../mathjax. The default value points to the MathJax +# Content Delivery Network so you can quickly see the result without installing +# MathJax. However, it is strongly recommended to install a local copy of +# MathJax from http://www.mathjax.org before deployment. +# The default value is: http://cdn.mathjax.org/mathjax/latest. +# This tag requires that the tag USE_MATHJAX is set to YES. + +MATHJAX_RELPATH = http://cdn.mathjax.org/mathjax/latest + +# The MATHJAX_EXTENSIONS tag can be used to specify one or more MathJax +# extension names that should be enabled during MathJax rendering. For example +# MATHJAX_EXTENSIONS = TeX/AMSmath TeX/AMSsymbols +# This tag requires that the tag USE_MATHJAX is set to YES. + +MATHJAX_EXTENSIONS = + +# The MATHJAX_CODEFILE tag can be used to specify a file with javascript pieces +# of code that will be used on startup of the MathJax code. See the MathJax site +# (see: http://docs.mathjax.org/en/latest/output.html) for more details. For an +# example see the documentation. +# This tag requires that the tag USE_MATHJAX is set to YES. + +MATHJAX_CODEFILE = + +# When the SEARCHENGINE tag is enabled doxygen will generate a search box for +# the HTML output. The underlying search engine uses javascript and DHTML and +# should work on any modern browser. Note that when using HTML help +# (GENERATE_HTMLHELP), Qt help (GENERATE_QHP), or docsets (GENERATE_DOCSET) +# there is already a search function so this one should typically be disabled. +# For large projects the javascript based search engine can be slow, then +# enabling SERVER_BASED_SEARCH may provide a better solution. It is possible to +# search using the keyboard; to jump to the search box use <access key> + S +# (what the <access key> is depends on the OS and browser, but it is typically +# <CTRL>, <ALT>/<option>, or both). Inside the search box use the <cursor down +# key> to jump into the search results window, the results can be navigated +# using the <cursor keys>. Press <Enter> to select an item or <escape> to cancel +# the search. The filter options can be selected when the cursor is inside the +# search box by pressing <Shift>+<cursor down>. Also here use the <cursor keys> +# to select a filter and <Enter> or <escape> to activate or cancel the filter +# option. +# The default value is: YES. +# This tag requires that the tag GENERATE_HTML is set to YES. + +SEARCHENGINE = YES + +# When the SERVER_BASED_SEARCH tag is enabled the search engine will be +# implemented using a web server instead of a web client using Javascript. There +# are two flavors of web server based searching depending on the EXTERNAL_SEARCH +# setting. When disabled, doxygen will generate a PHP script for searching and +# an index file used by the script. When EXTERNAL_SEARCH is enabled the indexing +# and searching needs to be provided by external tools. See the section +# "External Indexing and Searching" for details. +# The default value is: NO. +# This tag requires that the tag SEARCHENGINE is set to YES. + +SERVER_BASED_SEARCH = NO + +# When EXTERNAL_SEARCH tag is enabled doxygen will no longer generate the PHP +# script for searching. Instead the search results are written to an XML file +# which needs to be processed by an external indexer. Doxygen will invoke an +# external search engine pointed to by the SEARCHENGINE_URL option to obtain the +# search results. +# +# Doxygen ships with an example indexer (doxyindexer) and search engine +# (doxysearch.cgi) which are based on the open source search engine library +# Xapian (see: http://xapian.org/). +# +# See the section "External Indexing and Searching" for details. +# The default value is: NO. +# This tag requires that the tag SEARCHENGINE is set to YES. + +EXTERNAL_SEARCH = NO + +# The SEARCHENGINE_URL should point to a search engine hosted by a web server +# which will return the search results when EXTERNAL_SEARCH is enabled. +# +# Doxygen ships with an example indexer (doxyindexer) and search engine +# (doxysearch.cgi) which are based on the open source search engine library +# Xapian (see: http://xapian.org/). See the section "External Indexing and +# Searching" for details. +# This tag requires that the tag SEARCHENGINE is set to YES. + +SEARCHENGINE_URL = + +# When SERVER_BASED_SEARCH and EXTERNAL_SEARCH are both enabled the unindexed +# search data is written to a file for indexing by an external tool. With the +# SEARCHDATA_FILE tag the name of this file can be specified. +# The default file is: searchdata.xml. +# This tag requires that the tag SEARCHENGINE is set to YES. + +SEARCHDATA_FILE = searchdata.xml + +# When SERVER_BASED_SEARCH and EXTERNAL_SEARCH are both enabled the +# EXTERNAL_SEARCH_ID tag can be used as an identifier for the project. This is +# useful in combination with EXTRA_SEARCH_MAPPINGS to search through multiple +# projects and redirect the results back to the right project. +# This tag requires that the tag SEARCHENGINE is set to YES. + +EXTERNAL_SEARCH_ID = + +# The EXTRA_SEARCH_MAPPINGS tag can be used to enable searching through doxygen +# projects other than the one defined by this configuration file, but that are +# all added to the same external search index. Each project needs to have a +# unique id set via EXTERNAL_SEARCH_ID. The search mapping then maps the id of +# to a relative location where the documentation can be found. The format is: +# EXTRA_SEARCH_MAPPINGS = tagname1=loc1 tagname2=loc2 ... +# This tag requires that the tag SEARCHENGINE is set to YES. + +EXTRA_SEARCH_MAPPINGS = + +#--------------------------------------------------------------------------- +# Configuration options related to the LaTeX output +#--------------------------------------------------------------------------- + +# If the GENERATE_LATEX tag is set to YES, doxygen will generate LaTeX output. +# The default value is: YES. + +GENERATE_LATEX = YES + +# The LATEX_OUTPUT tag is used to specify where the LaTeX docs will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. +# The default directory is: latex. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_OUTPUT = latex + +# The LATEX_CMD_NAME tag can be used to specify the LaTeX command name to be +# invoked. +# +# Note that when enabling USE_PDFLATEX this option is only used for generating +# bitmaps for formulas in the HTML output, but not in the Makefile that is +# written to the output directory. +# The default file is: latex. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_CMD_NAME = latex + +# The MAKEINDEX_CMD_NAME tag can be used to specify the command name to generate +# index for LaTeX. +# The default file is: makeindex. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +MAKEINDEX_CMD_NAME = makeindex + +# If the COMPACT_LATEX tag is set to YES, doxygen generates more compact LaTeX +# documents. This may be useful for small projects and may help to save some +# trees in general. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +COMPACT_LATEX = NO + +# The PAPER_TYPE tag can be used to set the paper type that is used by the +# printer. +# Possible values are: a4 (210 x 297 mm), letter (8.5 x 11 inches), legal (8.5 x +# 14 inches) and executive (7.25 x 10.5 inches). +# The default value is: a4. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +PAPER_TYPE = a4 + +# The EXTRA_PACKAGES tag can be used to specify one or more LaTeX package names +# that should be included in the LaTeX output. The package can be specified just +# by its name or with the correct syntax as to be used with the LaTeX +# \usepackage command. To get the times font for instance you can specify : +# EXTRA_PACKAGES=times or EXTRA_PACKAGES={times} +# To use the option intlimits with the amsmath package you can specify: +# EXTRA_PACKAGES=[intlimits]{amsmath} +# If left blank no extra packages will be included. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +EXTRA_PACKAGES = + +# The LATEX_HEADER tag can be used to specify a personal LaTeX header for the +# generated LaTeX document. The header should contain everything until the first +# chapter. If it is left blank doxygen will generate a standard header. See +# section "Doxygen usage" for information on how to let doxygen write the +# default header to a separate file. +# +# Note: Only use a user-defined header if you know what you are doing! The +# following commands have a special meaning inside the header: $title, +# $datetime, $date, $doxygenversion, $projectname, $projectnumber, +# $projectbrief, $projectlogo. Doxygen will replace $title with the empty +# string, for the replacement values of the other commands the user is referred +# to HTML_HEADER. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_HEADER = + +# The LATEX_FOOTER tag can be used to specify a personal LaTeX footer for the +# generated LaTeX document. The footer should contain everything after the last +# chapter. If it is left blank doxygen will generate a standard footer. See +# LATEX_HEADER for more information on how to generate a default footer and what +# special commands can be used inside the footer. +# +# Note: Only use a user-defined footer if you know what you are doing! +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_FOOTER = + +# The LATEX_EXTRA_STYLESHEET tag can be used to specify additional user-defined +# LaTeX style sheets that are included after the standard style sheets created +# by doxygen. Using this option one can overrule certain style aspects. Doxygen +# will copy the style sheet files to the output directory. +# Note: The order of the extra style sheet files is of importance (e.g. the last +# style sheet in the list overrules the setting of the previous ones in the +# list). +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_EXTRA_STYLESHEET = + +# The LATEX_EXTRA_FILES tag can be used to specify one or more extra images or +# other source files which should be copied to the LATEX_OUTPUT output +# directory. Note that the files will be copied as-is; there are no commands or +# markers available. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_EXTRA_FILES = + +# If the PDF_HYPERLINKS tag is set to YES, the LaTeX that is generated is +# prepared for conversion to PDF (using ps2pdf or pdflatex). The PDF file will +# contain links (just like the HTML output) instead of page references. This +# makes the output suitable for online browsing using a PDF viewer. +# The default value is: YES. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +PDF_HYPERLINKS = YES + +# If the USE_PDFLATEX tag is set to YES, doxygen will use pdflatex to generate +# the PDF file directly from the LaTeX files. Set this option to YES, to get a +# higher quality PDF documentation. +# The default value is: YES. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +USE_PDFLATEX = YES + +# If the LATEX_BATCHMODE tag is set to YES, doxygen will add the \batchmode +# command to the generated LaTeX files. This will instruct LaTeX to keep running +# if errors occur, instead of asking the user for help. This option is also used +# when generating formulas in HTML. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_BATCHMODE = NO + +# If the LATEX_HIDE_INDICES tag is set to YES then doxygen will not include the +# index chapters (such as File Index, Compound Index, etc.) in the output. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_HIDE_INDICES = NO + +# If the LATEX_SOURCE_CODE tag is set to YES then doxygen will include source +# code with syntax highlighting in the LaTeX output. +# +# Note that which sources are shown also depends on other settings such as +# SOURCE_BROWSER. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_SOURCE_CODE = NO + +# The LATEX_BIB_STYLE tag can be used to specify the style to use for the +# bibliography, e.g. plainnat, or ieeetr. See +# http://en.wikipedia.org/wiki/BibTeX and \cite for more info. +# The default value is: plain. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_BIB_STYLE = plain + +# If the LATEX_TIMESTAMP tag is set to YES then the footer of each generated +# page will contain the date and time when the page was generated. Setting this +# to NO can help when comparing the output of multiple runs. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_TIMESTAMP = NO + +#--------------------------------------------------------------------------- +# Configuration options related to the RTF output +#--------------------------------------------------------------------------- + +# If the GENERATE_RTF tag is set to YES, doxygen will generate RTF output. The +# RTF output is optimized for Word 97 and may not look too pretty with other RTF +# readers/editors. +# The default value is: NO. + +GENERATE_RTF = NO + +# The RTF_OUTPUT tag is used to specify where the RTF docs will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. +# The default directory is: rtf. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_OUTPUT = rtf + +# If the COMPACT_RTF tag is set to YES, doxygen generates more compact RTF +# documents. This may be useful for small projects and may help to save some +# trees in general. +# The default value is: NO. +# This tag requires that the tag GENERATE_RTF is set to YES. + +COMPACT_RTF = NO + +# If the RTF_HYPERLINKS tag is set to YES, the RTF that is generated will +# contain hyperlink fields. The RTF file will contain links (just like the HTML +# output) instead of page references. This makes the output suitable for online +# browsing using Word or some other Word compatible readers that support those +# fields. +# +# Note: WordPad (write) and others do not support links. +# The default value is: NO. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_HYPERLINKS = NO + +# Load stylesheet definitions from file. Syntax is similar to doxygen's config +# file, i.e. a series of assignments. You only have to provide replacements, +# missing definitions are set to their default value. +# +# See also section "Doxygen usage" for information on how to generate the +# default style sheet that doxygen normally uses. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_STYLESHEET_FILE = + +# Set optional variables used in the generation of an RTF document. Syntax is +# similar to doxygen's config file. A template extensions file can be generated +# using doxygen -e rtf extensionFile. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_EXTENSIONS_FILE = + +# If the RTF_SOURCE_CODE tag is set to YES then doxygen will include source code +# with syntax highlighting in the RTF output. +# +# Note that which sources are shown also depends on other settings such as +# SOURCE_BROWSER. +# The default value is: NO. +# This tag requires that the tag GENERATE_RTF is set to YES. + +RTF_SOURCE_CODE = NO + +#--------------------------------------------------------------------------- +# Configuration options related to the man page output +#--------------------------------------------------------------------------- + +# If the GENERATE_MAN tag is set to YES, doxygen will generate man pages for +# classes and files. +# The default value is: NO. + +GENERATE_MAN = NO + +# The MAN_OUTPUT tag is used to specify where the man pages will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. A directory man3 will be created inside the directory specified by +# MAN_OUTPUT. +# The default directory is: man. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_OUTPUT = man + +# The MAN_EXTENSION tag determines the extension that is added to the generated +# man pages. In case the manual section does not start with a number, the number +# 3 is prepended. The dot (.) at the beginning of the MAN_EXTENSION tag is +# optional. +# The default value is: .3. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_EXTENSION = .3 + +# The MAN_SUBDIR tag determines the name of the directory created within +# MAN_OUTPUT in which the man pages are placed. If defaults to man followed by +# MAN_EXTENSION with the initial . removed. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_SUBDIR = + +# If the MAN_LINKS tag is set to YES and doxygen generates man output, then it +# will generate one additional man file for each entity documented in the real +# man page(s). These additional files only source the real man page, but without +# them the man command would be unable to find the correct page. +# The default value is: NO. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_LINKS = NO + +#--------------------------------------------------------------------------- +# Configuration options related to the XML output +#--------------------------------------------------------------------------- + +# If the GENERATE_XML tag is set to YES, doxygen will generate an XML file that +# captures the structure of the code including all documentation. +# The default value is: NO. + +GENERATE_XML = YES + +# The XML_OUTPUT tag is used to specify where the XML pages will be put. If a +# relative path is entered the value of OUTPUT_DIRECTORY will be put in front of +# it. +# The default directory is: xml. +# This tag requires that the tag GENERATE_XML is set to YES. + +XML_OUTPUT = xml + +# If the XML_PROGRAMLISTING tag is set to YES, doxygen will dump the program +# listings (including syntax highlighting and cross-referencing information) to +# the XML output. Note that enabling this will significantly increase the size +# of the XML output. +# The default value is: YES. +# This tag requires that the tag GENERATE_XML is set to YES. + +XML_PROGRAMLISTING = YES + +#--------------------------------------------------------------------------- +# Configuration options related to the DOCBOOK output +#--------------------------------------------------------------------------- + +# If the GENERATE_DOCBOOK tag is set to YES, doxygen will generate Docbook files +# that can be used to generate PDF. +# The default value is: NO. + +GENERATE_DOCBOOK = NO + +# The DOCBOOK_OUTPUT tag is used to specify where the Docbook pages will be put. +# If a relative path is entered the value of OUTPUT_DIRECTORY will be put in +# front of it. +# The default directory is: docbook. +# This tag requires that the tag GENERATE_DOCBOOK is set to YES. + +DOCBOOK_OUTPUT = docbook + +# If the DOCBOOK_PROGRAMLISTING tag is set to YES, doxygen will include the +# program listings (including syntax highlighting and cross-referencing +# information) to the DOCBOOK output. Note that enabling this will significantly +# increase the size of the DOCBOOK output. +# The default value is: NO. +# This tag requires that the tag GENERATE_DOCBOOK is set to YES. + +DOCBOOK_PROGRAMLISTING = NO + +#--------------------------------------------------------------------------- +# Configuration options for the AutoGen Definitions output +#--------------------------------------------------------------------------- + +# If the GENERATE_AUTOGEN_DEF tag is set to YES, doxygen will generate an +# AutoGen Definitions (see http://autogen.sf.net) file that captures the +# structure of the code including all documentation. Note that this feature is +# still experimental and incomplete at the moment. +# The default value is: NO. + +GENERATE_AUTOGEN_DEF = NO + +#--------------------------------------------------------------------------- +# Configuration options related to the Perl module output +#--------------------------------------------------------------------------- + +# If the GENERATE_PERLMOD tag is set to YES, doxygen will generate a Perl module +# file that captures the structure of the code including all documentation. +# +# Note that this feature is still experimental and incomplete at the moment. +# The default value is: NO. + +GENERATE_PERLMOD = NO + +# If the PERLMOD_LATEX tag is set to YES, doxygen will generate the necessary +# Makefile rules, Perl scripts and LaTeX code to be able to generate PDF and DVI +# output from the Perl module output. +# The default value is: NO. +# This tag requires that the tag GENERATE_PERLMOD is set to YES. + +PERLMOD_LATEX = NO + +# If the PERLMOD_PRETTY tag is set to YES, the Perl module output will be nicely +# formatted so it can be parsed by a human reader. This is useful if you want to +# understand what is going on. On the other hand, if this tag is set to NO, the +# size of the Perl module output will be much smaller and Perl will parse it +# just the same. +# The default value is: YES. +# This tag requires that the tag GENERATE_PERLMOD is set to YES. + +PERLMOD_PRETTY = YES + +# The names of the make variables in the generated doxyrules.make file are +# prefixed with the string contained in PERLMOD_MAKEVAR_PREFIX. This is useful +# so different doxyrules.make files included by the same Makefile don't +# overwrite each other's variables. +# This tag requires that the tag GENERATE_PERLMOD is set to YES. + +PERLMOD_MAKEVAR_PREFIX = + +#--------------------------------------------------------------------------- +# Configuration options related to the preprocessor +#--------------------------------------------------------------------------- + +# If the ENABLE_PREPROCESSING tag is set to YES, doxygen will evaluate all +# C-preprocessor directives found in the sources and include files. +# The default value is: YES. + +ENABLE_PREPROCESSING = YES + +# If the MACRO_EXPANSION tag is set to YES, doxygen will expand all macro names +# in the source code. If set to NO, only conditional compilation will be +# performed. Macro expansion can be done in a controlled way by setting +# EXPAND_ONLY_PREDEF to YES. +# The default value is: NO. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +MACRO_EXPANSION = NO + +# If the EXPAND_ONLY_PREDEF and MACRO_EXPANSION tags are both set to YES then +# the macro expansion is limited to the macros specified with the PREDEFINED and +# EXPAND_AS_DEFINED tags. +# The default value is: NO. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +EXPAND_ONLY_PREDEF = NO + +# If the SEARCH_INCLUDES tag is set to YES, the include files in the +# INCLUDE_PATH will be searched if a #include is found. +# The default value is: YES. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +SEARCH_INCLUDES = YES + +# The INCLUDE_PATH tag can be used to specify one or more directories that +# contain include files that are not input files but should be processed by the +# preprocessor. +# This tag requires that the tag SEARCH_INCLUDES is set to YES. + +INCLUDE_PATH = + +# You can use the INCLUDE_FILE_PATTERNS tag to specify one or more wildcard +# patterns (like *.h and *.hpp) to filter out the header-files in the +# directories. If left blank, the patterns specified with FILE_PATTERNS will be +# used. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +INCLUDE_FILE_PATTERNS = + +# The PREDEFINED tag can be used to specify one or more macro names that are +# defined before the preprocessor is started (similar to the -D option of e.g. +# gcc). The argument of the tag is a list of macros of the form: name or +# name=definition (no spaces). If the definition and the "=" are omitted, "=1" +# is assumed. To prevent a macro definition from being undefined via #undef or +# recursively expanded use the := operator instead of the = operator. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +PREDEFINED = + +# If the MACRO_EXPANSION and EXPAND_ONLY_PREDEF tags are set to YES then this +# tag can be used to specify a list of macro names that should be expanded. The +# macro definition that is found in the sources will be used. Use the PREDEFINED +# tag if you want to use a different macro definition that overrules the +# definition found in the source code. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +EXPAND_AS_DEFINED = + +# If the SKIP_FUNCTION_MACROS tag is set to YES then doxygen's preprocessor will +# remove all references to function-like macros that are alone on a line, have +# an all uppercase name, and do not end with a semicolon. Such function macros +# are typically used for boiler-plate code, and will confuse the parser if not +# removed. +# The default value is: YES. +# This tag requires that the tag ENABLE_PREPROCESSING is set to YES. + +SKIP_FUNCTION_MACROS = YES + +#--------------------------------------------------------------------------- +# Configuration options related to external references +#--------------------------------------------------------------------------- + +# The TAGFILES tag can be used to specify one or more tag files. For each tag +# file the location of the external documentation should be added. The format of +# a tag file without this location is as follows: +# TAGFILES = file1 file2 ... +# Adding location for the tag files is done as follows: +# TAGFILES = file1=loc1 "file2 = loc2" ... +# where loc1 and loc2 can be relative or absolute paths or URLs. See the +# section "Linking to external documentation" for more information about the use +# of tag files. +# Note: Each tag file must have a unique name (where the name does NOT include +# the path). If a tag file is not located in the directory in which doxygen is +# run, you must also specify the path to the tagfile here. + +TAGFILES = + +# When a file name is specified after GENERATE_TAGFILE, doxygen will create a +# tag file that is based on the input files it reads. See section "Linking to +# external documentation" for more information about the usage of tag files. + +GENERATE_TAGFILE = + +# If the ALLEXTERNALS tag is set to YES, all external class will be listed in +# the class index. If set to NO, only the inherited external classes will be +# listed. +# The default value is: NO. + +ALLEXTERNALS = NO + +# If the EXTERNAL_GROUPS tag is set to YES, all external groups will be listed +# in the modules index. If set to NO, only the current project's groups will be +# listed. +# The default value is: YES. + +EXTERNAL_GROUPS = YES + +# If the EXTERNAL_PAGES tag is set to YES, all external pages will be listed in +# the related pages index. If set to NO, only the current project's pages will +# be listed. +# The default value is: YES. + +EXTERNAL_PAGES = YES + +# The PERL_PATH should be the absolute path and name of the perl script +# interpreter (i.e. the result of 'which perl'). +# The default file (with absolute path) is: /usr/bin/perl. + +PERL_PATH = /usr/bin/perl + +#--------------------------------------------------------------------------- +# Configuration options related to the dot tool +#--------------------------------------------------------------------------- + +# If the CLASS_DIAGRAMS tag is set to YES, doxygen will generate a class diagram +# (in HTML and LaTeX) for classes with base or super classes. Setting the tag to +# NO turns the diagrams off. Note that this option also works with HAVE_DOT +# disabled, but it is recommended to install and use dot, since it yields more +# powerful graphs. +# The default value is: YES. + +CLASS_DIAGRAMS = YES + +# You can define message sequence charts within doxygen comments using the \msc +# command. Doxygen will then run the mscgen tool (see: +# http://www.mcternan.me.uk/mscgen/)) to produce the chart and insert it in the +# documentation. The MSCGEN_PATH tag allows you to specify the directory where +# the mscgen tool resides. If left empty the tool is assumed to be found in the +# default search path. + +MSCGEN_PATH = + +# You can include diagrams made with dia in doxygen documentation. Doxygen will +# then run dia to produce the diagram and insert it in the documentation. The +# DIA_PATH tag allows you to specify the directory where the dia binary resides. +# If left empty dia is assumed to be found in the default search path. + +DIA_PATH = + +# If set to YES the inheritance and collaboration graphs will hide inheritance +# and usage relations if the target is undocumented or is not a class. +# The default value is: YES. + +HIDE_UNDOC_RELATIONS = YES + +# If you set the HAVE_DOT tag to YES then doxygen will assume the dot tool is +# available from the path. This tool is part of Graphviz (see: +# http://www.graphviz.org/), a graph visualization toolkit from AT&T and Lucent +# Bell Labs. The other options in this section have no effect if this option is +# set to NO +# The default value is: YES. + +HAVE_DOT = YES + +# The DOT_NUM_THREADS specifies the number of dot invocations doxygen is allowed +# to run in parallel. When set to 0 doxygen will base this on the number of +# processors available in the system. You can set it explicitly to a value +# larger than 0 to get control over the balance between CPU load and processing +# speed. +# Minimum value: 0, maximum value: 32, default value: 0. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_NUM_THREADS = 0 + +# When you want a differently looking font in the dot files that doxygen +# generates you can specify the font name using DOT_FONTNAME. You need to make +# sure dot is able to find the font, which can be done by putting it in a +# standard location or by setting the DOTFONTPATH environment variable or by +# setting DOT_FONTPATH to the directory containing the font. +# The default value is: Helvetica. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_FONTNAME = Helvetica + +# The DOT_FONTSIZE tag can be used to set the size (in points) of the font of +# dot graphs. +# Minimum value: 4, maximum value: 24, default value: 10. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_FONTSIZE = 10 + +# By default doxygen will tell dot to use the default font as specified with +# DOT_FONTNAME. If you specify a different font using DOT_FONTNAME you can set +# the path where dot can find it using this tag. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_FONTPATH = + +# If the CLASS_GRAPH tag is set to YES then doxygen will generate a graph for +# each documented class showing the direct and indirect inheritance relations. +# Setting this tag to YES will force the CLASS_DIAGRAMS tag to NO. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +CLASS_GRAPH = YES + +# If the COLLABORATION_GRAPH tag is set to YES then doxygen will generate a +# graph for each documented class showing the direct and indirect implementation +# dependencies (inheritance, containment, and class references variables) of the +# class with other documented classes. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +COLLABORATION_GRAPH = YES + +# If the GROUP_GRAPHS tag is set to YES then doxygen will generate a graph for +# groups, showing the direct groups dependencies. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +GROUP_GRAPHS = YES + +# If the UML_LOOK tag is set to YES, doxygen will generate inheritance and +# collaboration diagrams in a style similar to the OMG's Unified Modeling +# Language. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +UML_LOOK = NO + +# If the UML_LOOK tag is enabled, the fields and methods are shown inside the +# class node. If there are many fields or methods and many nodes the graph may +# become too big to be useful. The UML_LIMIT_NUM_FIELDS threshold limits the +# number of items for each type to make the size more manageable. Set this to 0 +# for no limit. Note that the threshold may be exceeded by 50% before the limit +# is enforced. So when you set the threshold to 10, up to 15 fields may appear, +# but if the number exceeds 15, the total amount of fields shown is limited to +# 10. +# Minimum value: 0, maximum value: 100, default value: 10. +# This tag requires that the tag HAVE_DOT is set to YES. + +UML_LIMIT_NUM_FIELDS = 10 + +# If the TEMPLATE_RELATIONS tag is set to YES then the inheritance and +# collaboration graphs will show the relations between templates and their +# instances. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +TEMPLATE_RELATIONS = NO + +# If the INCLUDE_GRAPH, ENABLE_PREPROCESSING and SEARCH_INCLUDES tags are set to +# YES then doxygen will generate a graph for each documented file showing the +# direct and indirect include dependencies of the file with other documented +# files. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +INCLUDE_GRAPH = YES + +# If the INCLUDED_BY_GRAPH, ENABLE_PREPROCESSING and SEARCH_INCLUDES tags are +# set to YES then doxygen will generate a graph for each documented file showing +# the direct and indirect include dependencies of the file with other documented +# files. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +INCLUDED_BY_GRAPH = YES + +# If the CALL_GRAPH tag is set to YES then doxygen will generate a call +# dependency graph for every global function or class method. +# +# Note that enabling this option will significantly increase the time of a run. +# So in most cases it will be better to enable call graphs for selected +# functions only using the \callgraph command. Disabling a call graph can be +# accomplished by means of the command \hidecallgraph. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +CALL_GRAPH = NO + +# If the CALLER_GRAPH tag is set to YES then doxygen will generate a caller +# dependency graph for every global function or class method. +# +# Note that enabling this option will significantly increase the time of a run. +# So in most cases it will be better to enable caller graphs for selected +# functions only using the \callergraph command. Disabling a caller graph can be +# accomplished by means of the command \hidecallergraph. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +CALLER_GRAPH = NO + +# If the GRAPHICAL_HIERARCHY tag is set to YES then doxygen will graphical +# hierarchy of all classes instead of a textual one. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +GRAPHICAL_HIERARCHY = YES + +# If the DIRECTORY_GRAPH tag is set to YES then doxygen will show the +# dependencies a directory has on other directories in a graphical way. The +# dependency relations are determined by the #include relations between the +# files in the directories. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +DIRECTORY_GRAPH = YES + +# The DOT_IMAGE_FORMAT tag can be used to set the image format of the images +# generated by dot. For an explanation of the image formats see the section +# output formats in the documentation of the dot tool (Graphviz (see: +# http://www.graphviz.org/)). +# Note: If you choose svg you need to set HTML_FILE_EXTENSION to xhtml in order +# to make the SVG files visible in IE 9+ (other browsers do not have this +# requirement). +# Possible values are: png, png:cairo, png:cairo:cairo, png:cairo:gd, png:gd, +# png:gd:gd, jpg, jpg:cairo, jpg:cairo:gd, jpg:gd, jpg:gd:gd, gif, gif:cairo, +# gif:cairo:gd, gif:gd, gif:gd:gd, svg, png:gd, png:gd:gd, png:cairo, +# png:cairo:gd, png:cairo:cairo, png:cairo:gdiplus, png:gdiplus and +# png:gdiplus:gdiplus. +# The default value is: png. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_IMAGE_FORMAT = png + +# If DOT_IMAGE_FORMAT is set to svg, then this option can be set to YES to +# enable generation of interactive SVG images that allow zooming and panning. +# +# Note that this requires a modern browser other than Internet Explorer. Tested +# and working are Firefox, Chrome, Safari, and Opera. +# Note: For IE 9+ you need to set HTML_FILE_EXTENSION to xhtml in order to make +# the SVG files visible. Older versions of IE do not have SVG support. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +INTERACTIVE_SVG = NO + +# The DOT_PATH tag can be used to specify the path where the dot tool can be +# found. If left blank, it is assumed the dot tool can be found in the path. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_PATH = + +# The DOTFILE_DIRS tag can be used to specify one or more directories that +# contain dot files that are included in the documentation (see the \dotfile +# command). +# This tag requires that the tag HAVE_DOT is set to YES. + +DOTFILE_DIRS = + +# The MSCFILE_DIRS tag can be used to specify one or more directories that +# contain msc files that are included in the documentation (see the \mscfile +# command). + +MSCFILE_DIRS = + +# The DIAFILE_DIRS tag can be used to specify one or more directories that +# contain dia files that are included in the documentation (see the \diafile +# command). + +DIAFILE_DIRS = + +# When using plantuml, the PLANTUML_JAR_PATH tag should be used to specify the +# path where java can find the plantuml.jar file. If left blank, it is assumed +# PlantUML is not used or called during a preprocessing step. Doxygen will +# generate a warning when it encounters a \startuml command in this case and +# will not generate output for the diagram. + +PLANTUML_JAR_PATH = + +# When using plantuml, the PLANTUML_CFG_FILE tag can be used to specify a +# configuration file for plantuml. + +PLANTUML_CFG_FILE = + +# When using plantuml, the specified paths are searched for files specified by +# the !include statement in a plantuml block. + +PLANTUML_INCLUDE_PATH = + +# The DOT_GRAPH_MAX_NODES tag can be used to set the maximum number of nodes +# that will be shown in the graph. If the number of nodes in a graph becomes +# larger than this value, doxygen will truncate the graph, which is visualized +# by representing a node as a red box. Note that doxygen if the number of direct +# children of the root node in a graph is already larger than +# DOT_GRAPH_MAX_NODES then the graph will not be shown at all. Also note that +# the size of a graph can be further restricted by MAX_DOT_GRAPH_DEPTH. +# Minimum value: 0, maximum value: 10000, default value: 50. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_GRAPH_MAX_NODES = 50 + +# The MAX_DOT_GRAPH_DEPTH tag can be used to set the maximum depth of the graphs +# generated by dot. A depth value of 3 means that only nodes reachable from the +# root by following a path via at most 3 edges will be shown. Nodes that lay +# further from the root node will be omitted. Note that setting this option to 1 +# or 2 may greatly reduce the computation time needed for large code bases. Also +# note that the size of a graph can be further restricted by +# DOT_GRAPH_MAX_NODES. Using a depth of 0 means no depth restriction. +# Minimum value: 0, maximum value: 1000, default value: 0. +# This tag requires that the tag HAVE_DOT is set to YES. + +MAX_DOT_GRAPH_DEPTH = 0 + +# Set the DOT_TRANSPARENT tag to YES to generate images with a transparent +# background. This is disabled by default, because dot on Windows does not seem +# to support this out of the box. +# +# Warning: Depending on the platform used, enabling this option may lead to +# badly anti-aliased labels on the edges of a graph (i.e. they become hard to +# read). +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_TRANSPARENT = NO + +# Set the DOT_MULTI_TARGETS tag to YES to allow dot to generate multiple output +# files in one run (i.e. multiple -o and -T options on the command line). This +# makes dot run faster, but since only newer versions of dot (>1.8.10) support +# this, this feature is disabled by default. +# The default value is: NO. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_MULTI_TARGETS = NO + +# If the GENERATE_LEGEND tag is set to YES doxygen will generate a legend page +# explaining the meaning of the various boxes and arrows in the dot generated +# graphs. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +GENERATE_LEGEND = YES + +# If the DOT_CLEANUP tag is set to YES, doxygen will remove the intermediate dot +# files that are used to generate the various graphs. +# The default value is: YES. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_CLEANUP = YES diff --git a/docs/Doxygen/html/annotated.html b/docs/Doxygen/html/annotated.html new file mode 100644 index 0000000000000000000000000000000000000000..213ff53d787166ee16b6b546278fb8f362c06f6c --- /dev/null +++ b/docs/Doxygen/html/annotated.html @@ -0,0 +1,79 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Class List</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Class List</div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock">Here are the classes, structs, unions and interfaces with brief descriptions:</div><div class="directory"> +<table class="directory"> +<tr id="row_0_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="structBoxStruct__struct.html" target="_self">BoxStruct_struct</a></td><td class="desc">Use brief, otherwise the index won't have a brief explanation </td></tr> +<tr id="row_1_"><td class="entry"><span style="width:16px;display:inline-block;"> </span><span class="icona"><span class="icon">C</span></span><a class="el" href="structpoint3d.html" target="_self">point3d</a></td><td class="desc"></td></tr> +</table> +</div><!-- directory --> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/bc_s.png b/docs/Doxygen/html/bc_s.png new file mode 100644 index 0000000000000000000000000000000000000000..224b29aa9847d5a4b3902efd602b7ddf7d33e6c2 Binary files /dev/null and b/docs/Doxygen/html/bc_s.png differ diff --git a/docs/Doxygen/html/bdwn.png b/docs/Doxygen/html/bdwn.png new file mode 100644 index 0000000000000000000000000000000000000000..940a0b950443a0bb1b216ac03c45b8a16c955452 Binary files /dev/null and b/docs/Doxygen/html/bdwn.png differ diff --git a/docs/Doxygen/html/binary__c__python_8h_source.html b/docs/Doxygen/html/binary__c__python_8h_source.html new file mode 100644 index 0000000000000000000000000000000000000000..c82be05a5ec419682494afd4ac8be4b738831524 --- /dev/null +++ b/docs/Doxygen/html/binary__c__python_8h_source.html @@ -0,0 +1,73 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: binary_c_python.h Source File</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">binary_c_python.h</div> </div> +</div><!--header--> +<div class="contents"> +<div class="fragment"><div class="line"><a name="l00001"></a><span class="lineno"> 1</span> <span class="preprocessor">#pragma once</span></div><div class="line"><a name="l00002"></a><span class="lineno"> 2</span> <span class="preprocessor">#ifndef BINARY_C_PYTHON_H</span></div><div class="line"><a name="l00003"></a><span class="lineno"> 3</span> <span class="preprocessor">#define BINARY_C_PYTHON_H</span></div><div class="line"><a name="l00004"></a><span class="lineno"> 4</span> </div><div class="line"><a name="l00005"></a><span class="lineno"> 5</span> <span class="comment">/*</span></div><div class="line"><a name="l00006"></a><span class="lineno"> 6</span> <span class="comment"> * Include binary_C's API</span></div><div class="line"><a name="l00007"></a><span class="lineno"> 7</span> <span class="comment"> */</span></div><div class="line"><a name="l00008"></a><span class="lineno"> 8</span> <span class="preprocessor">#include "binary_c_API.h"</span></div><div class="line"><a name="l00009"></a><span class="lineno"> 9</span> <span class="preprocessor">#include "binary_c_API_prototypes.h"</span></div><div class="line"><a name="l00010"></a><span class="lineno"> 10</span> </div><div class="line"><a name="l00011"></a><span class="lineno"> 11</span> <span class="comment">/* Binary_c's python API prototypes */</span></div><div class="line"><a name="l00012"></a><span class="lineno"> 12</span> <span class="keywordtype">int</span> run_binary (<span class="keywordtype">char</span> * argstring,</div><div class="line"><a name="l00013"></a><span class="lineno"> 13</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> outstring,</div><div class="line"><a name="l00014"></a><span class="lineno"> 14</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> errorstring,</div><div class="line"><a name="l00015"></a><span class="lineno"> 15</span>  <span class="keywordtype">size_t</span> * <span class="keyword">const</span> nbytes);</div><div class="line"><a name="l00016"></a><span class="lineno"> 16</span> </div><div class="line"><a name="l00017"></a><span class="lineno"> 17</span> <span class="keywordtype">int</span> run_binary_with_logfile (<span class="keywordtype">char</span> * argstring,</div><div class="line"><a name="l00018"></a><span class="lineno"> 18</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> outstring,</div><div class="line"><a name="l00019"></a><span class="lineno"> 19</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> errorstring,</div><div class="line"><a name="l00020"></a><span class="lineno"> 20</span>  <span class="keywordtype">size_t</span> * <span class="keyword">const</span> nbytes);</div><div class="line"><a name="l00021"></a><span class="lineno"> 21</span> </div><div class="line"><a name="l00022"></a><span class="lineno"> 22</span> <span class="keywordtype">int</span> run_binary_custom_logging(<span class="keywordtype">char</span> * argstring,</div><div class="line"><a name="l00023"></a><span class="lineno"> 23</span>  <span class="keywordtype">long</span> <span class="keywordtype">int</span> func_memaddr,</div><div class="line"><a name="l00024"></a><span class="lineno"> 24</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> buffer,</div><div class="line"><a name="l00025"></a><span class="lineno"> 25</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> error_buffer,</div><div class="line"><a name="l00026"></a><span class="lineno"> 26</span>  <span class="keywordtype">size_t</span> * <span class="keyword">const</span> nbytes);</div><div class="line"><a name="l00027"></a><span class="lineno"> 27</span> </div><div class="line"><a name="l00028"></a><span class="lineno"> 28</span> <span class="keywordtype">int</span> return_arglines(<span class="keywordtype">char</span> ** <span class="keyword">const</span> outstring,</div><div class="line"><a name="l00029"></a><span class="lineno"> 29</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> errorstring, </div><div class="line"><a name="l00030"></a><span class="lineno"> 30</span>  <span class="keywordtype">size_t</span> * <span class="keyword">const</span> nbytes);</div><div class="line"><a name="l00031"></a><span class="lineno"> 31</span> </div><div class="line"><a name="l00032"></a><span class="lineno"> 32</span> <span class="comment">/* C macros */</span></div><div class="line"><a name="l00033"></a><span class="lineno"> 33</span> <span class="preprocessor">#define BINARY_C_APITEST_VERSION 0.1</span></div><div class="line"><a name="l00034"></a><span class="lineno"> 34</span> <span class="preprocessor">#define APIprint(...) APIprintf(__VA_ARGS__);</span></div><div class="line"><a name="l00035"></a><span class="lineno"> 35</span> <span class="preprocessor">#define NO_OUTPUT</span></div><div class="line"><a name="l00036"></a><span class="lineno"> 36</span> </div><div class="line"><a name="l00037"></a><span class="lineno"> 37</span> <span class="preprocessor">#endif // BINARY_C_C_PYTHON_H</span></div></div><!-- fragment --></div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/classes.html b/docs/Doxygen/html/classes.html new file mode 100644 index 0000000000000000000000000000000000000000..95c7da0968a31ff382bfa2100f85704f0dafbf94 --- /dev/null +++ b/docs/Doxygen/html/classes.html @@ -0,0 +1,83 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Class Index</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Class Index</div> </div> +</div><!--header--> +<div class="contents"> +<div class="qindex"><a class="qindex" href="#letter_b">b</a> | <a class="qindex" href="#letter_p">p</a></div> +<table class="classindex"> +<tr><td rowspan="2" valign="bottom"><a name="letter_b"></a><table border="0" cellspacing="0" cellpadding="0"><tr><td><div class="ah">  b  </div></td></tr></table> +</td><td rowspan="2" valign="bottom"><a name="letter_p"></a><table border="0" cellspacing="0" cellpadding="0"><tr><td><div class="ah">  p  </div></td></tr></table> +</td><td></td></tr> +<tr><td></td></tr> +<tr><td valign="top"><a class="el" href="structBoxStruct__struct.html">BoxStruct_struct</a>   </td><td valign="top"><a class="el" href="structpoint3d.html">point3d</a>   </td><td></td></tr> +<tr><td></td><td></td><td></td></tr> +</table> +<div class="qindex"><a class="qindex" href="#letter_b">b</a> | <a class="qindex" href="#letter_p">p</a></div> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/closed.png b/docs/Doxygen/html/closed.png new file mode 100644 index 0000000000000000000000000000000000000000..98cc2c909da37a6df914fbf67780eebd99c597f5 Binary files /dev/null and b/docs/Doxygen/html/closed.png differ diff --git a/docs/Doxygen/html/ding_8h_source.html b/docs/Doxygen/html/ding_8h_source.html new file mode 100644 index 0000000000000000000000000000000000000000..1fff235f93c3348d9d7decd698421061f89ecacb --- /dev/null +++ b/docs/Doxygen/html/ding_8h_source.html @@ -0,0 +1,81 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: testing_doxygen/ding.h Source File</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div id="nav-path" class="navpath"> + <ul> +<li class="navelem"><a class="el" href="dir_eedb883b3a90ccdfffd3f135939cac7c.html">testing_doxygen</a></li> </ul> +</div> +</div><!-- top --> +<div class="header"> + <div class="headertitle"> +<div class="title">ding.h</div> </div> +</div><!--header--> +<div class="contents"> +<div class="fragment"><div class="line"><a name="l00001"></a><span class="lineno"> 1</span> <span class="comment">/****************************************************************************</span></div><div class="line"><a name="l00002"></a><span class="lineno"> 2</span> <span class="comment"> * Copyright (C) 2012 by Matteo Franchin *</span></div><div class="line"><a name="l00003"></a><span class="lineno"> 3</span> <span class="comment"> * *</span></div><div class="line"><a name="l00004"></a><span class="lineno"> 4</span> <span class="comment"> * This file is part of Box. *</span></div><div class="line"><a name="l00005"></a><span class="lineno"> 5</span> <span class="comment"> * *</span></div><div class="line"><a name="l00006"></a><span class="lineno"> 6</span> <span class="comment"> * Box is free software: you can redistribute it and/or modify it *</span></div><div class="line"><a name="l00007"></a><span class="lineno"> 7</span> <span class="comment"> * under the terms of the GNU Lesser General Public License as published *</span></div><div class="line"><a name="l00008"></a><span class="lineno"> 8</span> <span class="comment"> * by the Free Software Foundation, either version 3 of the License, or *</span></div><div class="line"><a name="l00009"></a><span class="lineno"> 9</span> <span class="comment"> * (at your option) any later version. *</span></div><div class="line"><a name="l00010"></a><span class="lineno"> 10</span> <span class="comment"> * *</span></div><div class="line"><a name="l00011"></a><span class="lineno"> 11</span> <span class="comment"> * Box is distributed in the hope that it will be useful, *</span></div><div class="line"><a name="l00012"></a><span class="lineno"> 12</span> <span class="comment"> * but WITHOUT ANY WARRANTY; without even the implied warranty of *</span></div><div class="line"><a name="l00013"></a><span class="lineno"> 13</span> <span class="comment"> * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the *</span></div><div class="line"><a name="l00014"></a><span class="lineno"> 14</span> <span class="comment"> * GNU Lesser General Public License for more details. *</span></div><div class="line"><a name="l00015"></a><span class="lineno"> 15</span> <span class="comment"> * *</span></div><div class="line"><a name="l00016"></a><span class="lineno"> 16</span> <span class="comment"> * You should have received a copy of the GNU Lesser General Public *</span></div><div class="line"><a name="l00017"></a><span class="lineno"> 17</span> <span class="comment"> * License along with Box. If not, see <http://www.gnu.org/licenses/>. *</span></div><div class="line"><a name="l00018"></a><span class="lineno"> 18</span> <span class="comment"> ****************************************************************************/</span></div><div class="line"><a name="l00019"></a><span class="lineno"> 19</span> </div><div class="line"><a name="l00033"></a><span class="lineno"> 33</span> <span class="preprocessor">#ifndef _BOX_PROTOTYPES_DOXYGEN_H</span></div><div class="line"><a name="l00034"></a><span class="lineno"> 34</span> <span class="preprocessor"># define _BOX_PROTOTYPES_DOXYGEN_H</span></div><div class="line"><a name="l00035"></a><span class="lineno"> 35</span> </div><div class="line"><a name="l00036"></a><span class="lineno"> 36</span> <span class="preprocessor"># include <systemheader1.h></span></div><div class="line"><a name="l00037"></a><span class="lineno"> 37</span> <span class="preprocessor"># include <systemheader2.h></span></div><div class="line"><a name="l00038"></a><span class="lineno"> 38</span> </div><div class="line"><a name="l00039"></a><span class="lineno"> 39</span> <span class="preprocessor"># include <box/header1.h></span></div><div class="line"><a name="l00040"></a><span class="lineno"> 40</span> <span class="preprocessor"># include <box/header2.h></span></div><div class="line"><a name="l00041"></a><span class="lineno"> 41</span> </div><div class="line"><a name="l00042"></a><span class="lineno"> 42</span> <span class="preprocessor"># include "local_header1.h"</span></div><div class="line"><a name="l00043"></a><span class="lineno"> 43</span> <span class="preprocessor"># include "local_header2.h"</span></div><div class="line"><a name="l00044"></a><span class="lineno"> 44</span> </div><div class="line"><a name="l00050"></a><span class="lineno"> 50</span> <span class="keyword">typedef</span> <span class="keyword">enum</span> BoxEnum_enum {</div><div class="line"><a name="l00051"></a><span class="lineno"> 51</span>  BOXENUM_FIRST, </div><div class="line"><a name="l00052"></a><span class="lineno"> 52</span>  BOXENUM_SECOND, </div><div class="line"><a name="l00053"></a><span class="lineno"> 53</span>  BOXENUM_ETC </div><div class="line"><a name="l00054"></a><span class="lineno"> 54</span> } BoxEnum;</div><div class="line"><a name="l00055"></a><span class="lineno"> 55</span> </div><div class="line"><a name="l00061"></a><span class="lineno"><a class="line" href="structBoxStruct__struct.html"> 61</a></span> <span class="keyword">typedef</span> <span class="keyword">struct </span><a class="code" href="structBoxStruct__struct.html">BoxStruct_struct</a> {</div><div class="line"><a name="l00062"></a><span class="lineno"><a class="line" href="structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6"> 62</a></span>  <span class="keywordtype">int</span> <a class="code" href="structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6">a</a>; </div><div class="line"><a name="l00063"></a><span class="lineno"><a class="line" href="structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197"> 63</a></span>  <span class="keywordtype">int</span> <a class="code" href="structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197">b</a>; </div><div class="line"><a name="l00064"></a><span class="lineno"><a class="line" href="structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6"> 64</a></span>  <span class="keywordtype">double</span> <a class="code" href="structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6">c</a>; </div><div class="line"><a name="l00065"></a><span class="lineno"> 65</span> } <a class="code" href="structBoxStruct__struct.html">BoxStruct</a>;</div><div class="line"><a name="l00066"></a><span class="lineno"> 66</span> </div><div class="line"><a name="l00100"></a><span class="lineno"> 100</span> BOXEXPORT <a class="code" href="structBoxStruct__struct.html">BoxStruct</a> *</div><div class="line"><a name="l00101"></a><span class="lineno"> 101</span> Box_The_Function_Name(BoxParamType1 param1, BoxParamType2 param2 <span class="comment">/*, ...*/</span>);</div><div class="line"><a name="l00102"></a><span class="lineno"> 102</span> </div><div class="line"><a name="l00114"></a><span class="lineno"> 114</span> BOXEXPORT <span class="keywordtype">void</span> *</div><div class="line"><a name="l00115"></a><span class="lineno"> 115</span> Box_The_Second_Function(<span class="keywordtype">void</span>);</div><div class="line"><a name="l00116"></a><span class="lineno"> 116</span> </div><div class="line"><a name="l00124"></a><span class="lineno"> 124</span> BOXEXPORT <span class="keywordtype">void</span></div><div class="line"><a name="l00125"></a><span class="lineno"> 125</span> Box_The_Last_One(<span class="keywordtype">void</span>);</div><div class="line"><a name="l00126"></a><span class="lineno"> 126</span> </div><div class="line"><a name="l00127"></a><span class="lineno"> 127</span> <span class="preprocessor">#endif </span><span class="comment">/* _BOX_PROTOTYPES_DOXYGEN_H */</span><span class="preprocessor"></span></div><div class="ttc" id="structBoxStruct__struct_html_a4593938c5e90f024e7971bdb1392d9d6"><div class="ttname"><a href="structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6">BoxStruct_struct::a</a></div><div class="ttdeci">int a</div><div class="ttdef"><b>Definition:</b> ding.h:62</div></div> +<div class="ttc" id="structBoxStruct__struct_html"><div class="ttname"><a href="structBoxStruct__struct.html">BoxStruct_struct</a></div><div class="ttdoc">Use brief, otherwise the index won&#39;t have a brief explanation. </div><div class="ttdef"><b>Definition:</b> ding.h:61</div></div> +<div class="ttc" id="structBoxStruct__struct_html_a4543370ed67b2cf5ae3f55201bea11e6"><div class="ttname"><a href="structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6">BoxStruct_struct::c</a></div><div class="ttdeci">double c</div><div class="ttdef"><b>Definition:</b> ding.h:64</div></div> +<div class="ttc" id="structBoxStruct__struct_html_aee44748dc579c5d794853ee8b133d197"><div class="ttname"><a href="structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197">BoxStruct_struct::b</a></div><div class="ttdeci">int b</div><div class="ttdef"><b>Definition:</b> ding.h:63</div></div> +</div><!-- fragment --></div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/dir_eedb883b3a90ccdfffd3f135939cac7c.html b/docs/Doxygen/html/dir_eedb883b3a90ccdfffd3f135939cac7c.html new file mode 100644 index 0000000000000000000000000000000000000000..149279d0e05d7e502dbb074837a249c509467cf5 --- /dev/null +++ b/docs/Doxygen/html/dir_eedb883b3a90ccdfffd3f135939cac7c.html @@ -0,0 +1,77 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: testing_doxygen Directory Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div id="nav-path" class="navpath"> + <ul> +<li class="navelem"><a class="el" href="dir_eedb883b3a90ccdfffd3f135939cac7c.html">testing_doxygen</a></li> </ul> +</div> +</div><!-- top --> +<div class="header"> + <div class="headertitle"> +<div class="title">testing_doxygen Directory Reference</div> </div> +</div><!--header--> +<div class="contents"> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/doc.png b/docs/Doxygen/html/doc.png new file mode 100644 index 0000000000000000000000000000000000000000..17edabff95f7b8da13c9516a04efe05493c29501 Binary files /dev/null and b/docs/Doxygen/html/doc.png differ diff --git a/docs/Doxygen/html/doxygen.css b/docs/Doxygen/html/doxygen.css new file mode 100644 index 0000000000000000000000000000000000000000..4f1ab9195b447e18dacbf914142f997e7637a27f --- /dev/null +++ b/docs/Doxygen/html/doxygen.css @@ -0,0 +1,1596 @@ +/* The standard CSS for doxygen 1.8.13 */ + +body, table, div, p, dl { + font: 400 14px/22px Roboto,sans-serif; +} + +p.reference, p.definition { + font: 400 14px/22px Roboto,sans-serif; +} + +/* @group Heading Levels */ + +h1.groupheader { + font-size: 150%; +} + +.title { + font: 400 14px/28px Roboto,sans-serif; + font-size: 150%; + font-weight: bold; + margin: 10px 2px; +} + +h2.groupheader { + border-bottom: 1px solid #879ECB; + color: #354C7B; + font-size: 150%; + font-weight: normal; + margin-top: 1.75em; + padding-top: 8px; + padding-bottom: 4px; + width: 100%; +} + +h3.groupheader { + font-size: 100%; +} + +h1, h2, h3, h4, h5, h6 { + -webkit-transition: text-shadow 0.5s linear; + -moz-transition: text-shadow 0.5s linear; + -ms-transition: text-shadow 0.5s linear; + -o-transition: text-shadow 0.5s linear; + transition: text-shadow 0.5s linear; + margin-right: 15px; +} + +h1.glow, h2.glow, h3.glow, h4.glow, h5.glow, h6.glow { + text-shadow: 0 0 15px cyan; +} + +dt { + font-weight: bold; +} + +div.multicol { + -moz-column-gap: 1em; + -webkit-column-gap: 1em; + -moz-column-count: 3; + -webkit-column-count: 3; +} + +p.startli, p.startdd { + margin-top: 2px; +} + +p.starttd { + margin-top: 0px; +} + +p.endli { + margin-bottom: 0px; +} + +p.enddd { + margin-bottom: 4px; +} + +p.endtd { + margin-bottom: 2px; +} + +/* @end */ + +caption { + font-weight: bold; +} + +span.legend { + font-size: 70%; + text-align: center; +} + +h3.version { + font-size: 90%; + text-align: center; +} + +div.qindex, div.navtab{ + background-color: #EBEFF6; + border: 1px solid #A3B4D7; + text-align: center; +} + +div.qindex, div.navpath { + width: 100%; + line-height: 140%; +} + +div.navtab { + margin-right: 15px; +} + +/* @group Link Styling */ + +a { + color: #3D578C; + font-weight: normal; + text-decoration: none; +} + +.contents a:visited { + color: #4665A2; +} + +a:hover { + text-decoration: underline; +} + +a.qindex { + font-weight: bold; +} + +a.qindexHL { + font-weight: bold; + background-color: #9CAFD4; + color: #ffffff; + border: 1px double #869DCA; +} + +.contents a.qindexHL:visited { + color: #ffffff; +} + +a.el { + font-weight: bold; +} + +a.elRef { +} + +a.code, a.code:visited, a.line, a.line:visited { + color: #4665A2; +} + +a.codeRef, a.codeRef:visited, a.lineRef, a.lineRef:visited { + color: #4665A2; +} + +/* @end */ + +dl.el { + margin-left: -1cm; +} + +pre.fragment { + border: 1px solid #C4CFE5; + background-color: #FBFCFD; + padding: 4px 6px; + margin: 4px 8px 4px 2px; + overflow: auto; + word-wrap: break-word; + font-size: 9pt; + line-height: 125%; + font-family: monospace, fixed; + font-size: 105%; +} + +div.fragment { + padding: 0px; + margin: 4px 8px 4px 2px; + background-color: #FBFCFD; + border: 1px solid #C4CFE5; +} + +div.line { + font-family: monospace, fixed; + font-size: 13px; + min-height: 13px; + line-height: 1.0; + text-wrap: unrestricted; + white-space: -moz-pre-wrap; /* Moz */ + white-space: -pre-wrap; /* Opera 4-6 */ + white-space: -o-pre-wrap; /* Opera 7 */ + white-space: pre-wrap; /* CSS3 */ + word-wrap: break-word; /* IE 5.5+ */ + text-indent: -53px; + padding-left: 53px; + padding-bottom: 0px; + margin: 0px; + -webkit-transition-property: background-color, box-shadow; + -webkit-transition-duration: 0.5s; + -moz-transition-property: background-color, box-shadow; + -moz-transition-duration: 0.5s; + -ms-transition-property: background-color, box-shadow; + -ms-transition-duration: 0.5s; + -o-transition-property: background-color, box-shadow; + -o-transition-duration: 0.5s; + transition-property: background-color, box-shadow; + transition-duration: 0.5s; +} + +div.line:after { + content:"\000A"; + white-space: pre; +} + +div.line.glow { + background-color: cyan; + box-shadow: 0 0 10px cyan; +} + + +span.lineno { + padding-right: 4px; + text-align: right; + border-right: 2px solid #0F0; + background-color: #E8E8E8; + white-space: pre; +} +span.lineno a { + background-color: #D8D8D8; +} + +span.lineno a:hover { + background-color: #C8C8C8; +} + +.lineno { + -webkit-touch-callout: none; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +div.ah, span.ah { + background-color: black; + font-weight: bold; + color: #ffffff; + margin-bottom: 3px; + margin-top: 3px; + padding: 0.2em; + border: solid thin #333; + border-radius: 0.5em; + -webkit-border-radius: .5em; + -moz-border-radius: .5em; + box-shadow: 2px 2px 3px #999; + -webkit-box-shadow: 2px 2px 3px #999; + -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; + background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#000),color-stop(0.3, #444)); + background-image: -moz-linear-gradient(center top, #eee 0%, #444 40%, #000 110%); +} + +div.classindex ul { + list-style: none; + padding-left: 0; +} + +div.classindex span.ai { + display: inline-block; +} + +div.groupHeader { + margin-left: 16px; + margin-top: 12px; + font-weight: bold; +} + +div.groupText { + margin-left: 16px; + font-style: italic; +} + +body { + background-color: white; + color: black; + margin: 0; +} + +div.contents { + margin-top: 10px; + margin-left: 12px; + margin-right: 8px; +} + +td.indexkey { + background-color: #EBEFF6; + font-weight: bold; + border: 1px solid #C4CFE5; + margin: 2px 0px 2px 0; + padding: 2px 10px; + white-space: nowrap; + vertical-align: top; +} + +td.indexvalue { + background-color: #EBEFF6; + border: 1px solid #C4CFE5; + padding: 2px 10px; + margin: 2px 0px; +} + +tr.memlist { + background-color: #EEF1F7; +} + +p.formulaDsp { + text-align: center; +} + +img.formulaDsp { + +} + +img.formulaInl { + vertical-align: middle; +} + +div.center { + text-align: center; + margin-top: 0px; + margin-bottom: 0px; + padding: 0px; +} + +div.center img { + border: 0px; +} + +address.footer { + text-align: right; + padding-right: 12px; +} + +img.footer { + border: 0px; + vertical-align: middle; +} + +/* @group Code Colorization */ + +span.keyword { + color: #008000 +} + +span.keywordtype { + color: #604020 +} + +span.keywordflow { + color: #e08000 +} + +span.comment { + color: #800000 +} + +span.preprocessor { + color: #806020 +} + +span.stringliteral { + color: #002080 +} + +span.charliteral { + color: #008080 +} + +span.vhdldigit { + color: #ff00ff +} + +span.vhdlchar { + color: #000000 +} + +span.vhdlkeyword { + color: #700070 +} + +span.vhdllogic { + color: #ff0000 +} + +blockquote { + background-color: #F7F8FB; + border-left: 2px solid #9CAFD4; + margin: 0 24px 0 4px; + padding: 0 12px 0 16px; +} + +/* @end */ + +/* +.search { + color: #003399; + font-weight: bold; +} + +form.search { + margin-bottom: 0px; + margin-top: 0px; +} + +input.search { + font-size: 75%; + color: #000080; + font-weight: normal; + background-color: #e8eef2; +} +*/ + +td.tiny { + font-size: 75%; +} + +.dirtab { + padding: 4px; + border-collapse: collapse; + border: 1px solid #A3B4D7; +} + +th.dirtab { + background: #EBEFF6; + font-weight: bold; +} + +hr { + height: 0px; + border: none; + border-top: 1px solid #4A6AAA; +} + +hr.footer { + height: 1px; +} + +/* @group Member Descriptions */ + +table.memberdecls { + border-spacing: 0px; + padding: 0px; +} + +.memberdecls td, .fieldtable tr { + -webkit-transition-property: background-color, box-shadow; + -webkit-transition-duration: 0.5s; + -moz-transition-property: background-color, box-shadow; + -moz-transition-duration: 0.5s; + -ms-transition-property: background-color, box-shadow; + -ms-transition-duration: 0.5s; + -o-transition-property: background-color, box-shadow; + -o-transition-duration: 0.5s; + transition-property: background-color, box-shadow; + transition-duration: 0.5s; +} + +.memberdecls td.glow, .fieldtable tr.glow { + background-color: cyan; + box-shadow: 0 0 15px cyan; +} + +.mdescLeft, .mdescRight, +.memItemLeft, .memItemRight, +.memTemplItemLeft, .memTemplItemRight, .memTemplParams { + background-color: #F9FAFC; + border: none; + margin: 4px; + padding: 1px 0 0 8px; +} + +.mdescLeft, .mdescRight { + padding: 0px 8px 4px 8px; + color: #555; +} + +.memSeparator { + border-bottom: 1px solid #DEE4F0; + line-height: 1px; + margin: 0px; + padding: 0px; +} + +.memItemLeft, .memTemplItemLeft { + white-space: nowrap; +} + +.memItemRight { + width: 100%; +} + +.memTemplParams { + color: #4665A2; + white-space: nowrap; + font-size: 80%; +} + +/* @end */ + +/* @group Member Details */ + +/* Styles for detailed member documentation */ + +.memtitle { + padding: 8px; + border-top: 1px solid #A8B8D9; + border-left: 1px solid #A8B8D9; + border-right: 1px solid #A8B8D9; + border-top-right-radius: 4px; + border-top-left-radius: 4px; + margin-bottom: -1px; + background-image: url('nav_f.png'); + background-repeat: repeat-x; + background-color: #E2E8F2; + line-height: 1.25; + font-weight: 300; + float:left; +} + +.permalink +{ + font-size: 65%; + display: inline-block; + vertical-align: middle; +} + +.memtemplate { + font-size: 80%; + color: #4665A2; + font-weight: normal; + margin-left: 9px; +} + +.memnav { + background-color: #EBEFF6; + border: 1px solid #A3B4D7; + text-align: center; + margin: 2px; + margin-right: 15px; + padding: 2px; +} + +.mempage { + width: 100%; +} + +.memitem { + padding: 0; + margin-bottom: 10px; + margin-right: 5px; + -webkit-transition: box-shadow 0.5s linear; + -moz-transition: box-shadow 0.5s linear; + -ms-transition: box-shadow 0.5s linear; + -o-transition: box-shadow 0.5s linear; + transition: box-shadow 0.5s linear; + display: table !important; + width: 100%; +} + +.memitem.glow { + box-shadow: 0 0 15px cyan; +} + +.memname { + font-weight: 400; + margin-left: 6px; +} + +.memname td { + vertical-align: bottom; +} + +.memproto, dl.reflist dt { + border-top: 1px solid #A8B8D9; + border-left: 1px solid #A8B8D9; + border-right: 1px solid #A8B8D9; + padding: 6px 0px 6px 0px; + color: #253555; + font-weight: bold; + text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); + background-color: #DFE5F1; + /* opera specific markup */ + box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); + border-top-right-radius: 4px; + /* firefox specific markup */ + -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; + -moz-border-radius-topright: 4px; + /* webkit specific markup */ + -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); + -webkit-border-top-right-radius: 4px; + +} + +.overload { + font-family: "courier new",courier,monospace; + font-size: 65%; +} + +.memdoc, dl.reflist dd { + border-bottom: 1px solid #A8B8D9; + border-left: 1px solid #A8B8D9; + border-right: 1px solid #A8B8D9; + padding: 6px 10px 2px 10px; + background-color: #FBFCFD; + border-top-width: 0; + background-image:url('nav_g.png'); + background-repeat:repeat-x; + background-color: #FFFFFF; + /* opera specific markup */ + border-bottom-left-radius: 4px; + border-bottom-right-radius: 4px; + box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); + /* firefox specific markup */ + -moz-border-radius-bottomleft: 4px; + -moz-border-radius-bottomright: 4px; + -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; + /* webkit specific markup */ + -webkit-border-bottom-left-radius: 4px; + -webkit-border-bottom-right-radius: 4px; + -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); +} + +dl.reflist dt { + padding: 5px; +} + +dl.reflist dd { + margin: 0px 0px 10px 0px; + padding: 5px; +} + +.paramkey { + text-align: right; +} + +.paramtype { + white-space: nowrap; +} + +.paramname { + color: #602020; + white-space: nowrap; +} +.paramname em { + font-style: normal; +} +.paramname code { + line-height: 14px; +} + +.params, .retval, .exception, .tparams { + margin-left: 0px; + padding-left: 0px; +} + +.params .paramname, .retval .paramname { + font-weight: bold; + vertical-align: top; +} + +.params .paramtype { + font-style: italic; + vertical-align: top; +} + +.params .paramdir { + font-family: "courier new",courier,monospace; + vertical-align: top; +} + +table.mlabels { + border-spacing: 0px; +} + +td.mlabels-left { + width: 100%; + padding: 0px; +} + +td.mlabels-right { + vertical-align: bottom; + padding: 0px; + white-space: nowrap; +} + +span.mlabels { + margin-left: 8px; +} + +span.mlabel { + background-color: #728DC1; + border-top:1px solid #5373B4; + border-left:1px solid #5373B4; + border-right:1px solid #C4CFE5; + border-bottom:1px solid #C4CFE5; + text-shadow: none; + color: white; + margin-right: 4px; + padding: 2px 3px; + border-radius: 3px; + font-size: 7pt; + white-space: nowrap; + vertical-align: middle; +} + + + +/* @end */ + +/* these are for tree view inside a (index) page */ + +div.directory { + margin: 10px 0px; + border-top: 1px solid #9CAFD4; + border-bottom: 1px solid #9CAFD4; + width: 100%; +} + +.directory table { + border-collapse:collapse; +} + +.directory td { + margin: 0px; + padding: 0px; + vertical-align: top; +} + +.directory td.entry { + white-space: nowrap; + padding-right: 6px; + padding-top: 3px; +} + +.directory td.entry a { + outline:none; +} + +.directory td.entry a img { + border: none; +} + +.directory td.desc { + width: 100%; + padding-left: 6px; + padding-right: 6px; + padding-top: 3px; + border-left: 1px solid rgba(0,0,0,0.05); +} + +.directory tr.even { + padding-left: 6px; + background-color: #F7F8FB; +} + +.directory img { + vertical-align: -30%; +} + +.directory .levels { + white-space: nowrap; + width: 100%; + text-align: right; + font-size: 9pt; +} + +.directory .levels span { + cursor: pointer; + padding-left: 2px; + padding-right: 2px; + color: #3D578C; +} + +.arrow { + color: #9CAFD4; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + cursor: pointer; + font-size: 80%; + display: inline-block; + width: 16px; + height: 22px; +} + +.icon { + font-family: Arial, Helvetica; + font-weight: bold; + font-size: 12px; + height: 14px; + width: 16px; + display: inline-block; + background-color: #728DC1; + color: white; + text-align: center; + border-radius: 4px; + margin-left: 2px; + margin-right: 2px; +} + +.icona { + width: 24px; + height: 22px; + display: inline-block; +} + +.iconfopen { + width: 24px; + height: 18px; + margin-bottom: 4px; + background-image:url('folderopen.png'); + background-position: 0px -4px; + background-repeat: repeat-y; + vertical-align:top; + display: inline-block; +} + +.iconfclosed { + width: 24px; + height: 18px; + margin-bottom: 4px; + background-image:url('folderclosed.png'); + background-position: 0px -4px; + background-repeat: repeat-y; + vertical-align:top; + display: inline-block; +} + +.icondoc { + width: 24px; + height: 18px; + margin-bottom: 4px; + background-image:url('doc.png'); + background-position: 0px -4px; + background-repeat: repeat-y; + vertical-align:top; + display: inline-block; +} + +table.directory { + font: 400 14px Roboto,sans-serif; +} + +/* @end */ + +div.dynheader { + margin-top: 8px; + -webkit-touch-callout: none; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +address { + font-style: normal; + color: #2A3D61; +} + +table.doxtable caption { + caption-side: top; +} + +table.doxtable { + border-collapse:collapse; + margin-top: 4px; + margin-bottom: 4px; +} + +table.doxtable td, table.doxtable th { + border: 1px solid #2D4068; + padding: 3px 7px 2px; +} + +table.doxtable th { + background-color: #374F7F; + color: #FFFFFF; + font-size: 110%; + padding-bottom: 4px; + padding-top: 5px; +} + +table.fieldtable { + /*width: 100%;*/ + margin-bottom: 10px; + border: 1px solid #A8B8D9; + border-spacing: 0px; + -moz-border-radius: 4px; + -webkit-border-radius: 4px; + border-radius: 4px; + -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; + -webkit-box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); + box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); +} + +.fieldtable td, .fieldtable th { + padding: 3px 7px 2px; +} + +.fieldtable td.fieldtype, .fieldtable td.fieldname { + white-space: nowrap; + border-right: 1px solid #A8B8D9; + border-bottom: 1px solid #A8B8D9; + vertical-align: top; +} + +.fieldtable td.fieldname { + padding-top: 3px; +} + +.fieldtable td.fielddoc { + border-bottom: 1px solid #A8B8D9; + /*width: 100%;*/ +} + +.fieldtable td.fielddoc p:first-child { + margin-top: 0px; +} + +.fieldtable td.fielddoc p:last-child { + margin-bottom: 2px; +} + +.fieldtable tr:last-child td { + border-bottom: none; +} + +.fieldtable th { + background-image:url('nav_f.png'); + background-repeat:repeat-x; + background-color: #E2E8F2; + font-size: 90%; + color: #253555; + padding-bottom: 4px; + padding-top: 5px; + text-align:left; + font-weight: 400; + -moz-border-radius-topleft: 4px; + -moz-border-radius-topright: 4px; + -webkit-border-top-left-radius: 4px; + -webkit-border-top-right-radius: 4px; + border-top-left-radius: 4px; + border-top-right-radius: 4px; + border-bottom: 1px solid #A8B8D9; +} + + +.tabsearch { + top: 0px; + left: 10px; + height: 36px; + background-image: url('tab_b.png'); + z-index: 101; + overflow: hidden; + font-size: 13px; +} + +.navpath ul +{ + font-size: 11px; + background-image:url('tab_b.png'); + background-repeat:repeat-x; + background-position: 0 -5px; + height:30px; + line-height:30px; + color:#8AA0CC; + border:solid 1px #C2CDE4; + overflow:hidden; + margin:0px; + padding:0px; +} + +.navpath li +{ + list-style-type:none; + float:left; + padding-left:10px; + padding-right:15px; + background-image:url('bc_s.png'); + background-repeat:no-repeat; + background-position:right; + color:#364D7C; +} + +.navpath li.navelem a +{ + height:32px; + display:block; + text-decoration: none; + outline: none; + color: #283A5D; + font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif; + text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); + text-decoration: none; +} + +.navpath li.navelem a:hover +{ + color:#6884BD; +} + +.navpath li.footer +{ + list-style-type:none; + float:right; + padding-left:10px; + padding-right:15px; + background-image:none; + background-repeat:no-repeat; + background-position:right; + color:#364D7C; + font-size: 8pt; +} + + +div.summary +{ + float: right; + font-size: 8pt; + padding-right: 5px; + width: 50%; + text-align: right; +} + +div.summary a +{ + white-space: nowrap; +} + +table.classindex +{ + margin: 10px; + white-space: nowrap; + margin-left: 3%; + margin-right: 3%; + width: 94%; + border: 0; + border-spacing: 0; + padding: 0; +} + +div.ingroups +{ + font-size: 8pt; + width: 50%; + text-align: left; +} + +div.ingroups a +{ + white-space: nowrap; +} + +div.header +{ + background-image:url('nav_h.png'); + background-repeat:repeat-x; + background-color: #F9FAFC; + margin: 0px; + border-bottom: 1px solid #C4CFE5; +} + +div.headertitle +{ + padding: 5px 5px 5px 10px; +} + +dl +{ + padding: 0 0 0 10px; +} + +/* dl.note, dl.warning, dl.attention, dl.pre, dl.post, dl.invariant, dl.deprecated, dl.todo, dl.test, dl.bug */ +dl.section +{ + margin-left: 0px; + padding-left: 0px; +} + +dl.note +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #D0C000; +} + +dl.warning, dl.attention +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #FF0000; +} + +dl.pre, dl.post, dl.invariant +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #00D000; +} + +dl.deprecated +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #505050; +} + +dl.todo +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #00C0E0; +} + +dl.test +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #3030E0; +} + +dl.bug +{ + margin-left:-7px; + padding-left: 3px; + border-left:4px solid; + border-color: #C08050; +} + +dl.section dd { + margin-bottom: 6px; +} + + +#projectlogo +{ + text-align: center; + vertical-align: bottom; + border-collapse: separate; +} + +#projectlogo img +{ + border: 0px none; +} + +#projectalign +{ + vertical-align: middle; +} + +#projectname +{ + font: 300% Tahoma, Arial,sans-serif; + margin: 0px; + padding: 2px 0px; +} + +#projectbrief +{ + font: 120% Tahoma, Arial,sans-serif; + margin: 0px; + padding: 0px; +} + +#projectnumber +{ + font: 50% Tahoma, Arial,sans-serif; + margin: 0px; + padding: 0px; +} + +#titlearea +{ + padding: 0px; + margin: 0px; + width: 100%; + border-bottom: 1px solid #5373B4; +} + +.image +{ + text-align: center; +} + +.dotgraph +{ + text-align: center; +} + +.mscgraph +{ + text-align: center; +} + +.plantumlgraph +{ + text-align: center; +} + +.diagraph +{ + text-align: center; +} + +.caption +{ + font-weight: bold; +} + +div.zoom +{ + border: 1px solid #90A5CE; +} + +dl.citelist { + margin-bottom:50px; +} + +dl.citelist dt { + color:#334975; + float:left; + font-weight:bold; + margin-right:10px; + padding:5px; +} + +dl.citelist dd { + margin:2px 0; + padding:5px 0; +} + +div.toc { + padding: 14px 25px; + background-color: #F4F6FA; + border: 1px solid #D8DFEE; + border-radius: 7px 7px 7px 7px; + float: right; + height: auto; + margin: 0 8px 10px 10px; + width: 200px; +} + +div.toc li { + background: url("bdwn.png") no-repeat scroll 0 5px transparent; + font: 10px/1.2 Verdana,DejaVu Sans,Geneva,sans-serif; + margin-top: 5px; + padding-left: 10px; + padding-top: 2px; +} + +div.toc h3 { + font: bold 12px/1.2 Arial,FreeSans,sans-serif; + color: #4665A2; + border-bottom: 0 none; + margin: 0; +} + +div.toc ul { + list-style: none outside none; + border: medium none; + padding: 0px; +} + +div.toc li.level1 { + margin-left: 0px; +} + +div.toc li.level2 { + margin-left: 15px; +} + +div.toc li.level3 { + margin-left: 30px; +} + +div.toc li.level4 { + margin-left: 45px; +} + +.inherit_header { + font-weight: bold; + color: gray; + cursor: pointer; + -webkit-touch-callout: none; + -webkit-user-select: none; + -khtml-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; +} + +.inherit_header td { + padding: 6px 0px 2px 5px; +} + +.inherit { + display: none; +} + +tr.heading h2 { + margin-top: 12px; + margin-bottom: 4px; +} + +/* tooltip related style info */ + +.ttc { + position: absolute; + display: none; +} + +#powerTip { + cursor: default; + white-space: nowrap; + background-color: white; + border: 1px solid gray; + border-radius: 4px 4px 4px 4px; + box-shadow: 1px 1px 7px gray; + display: none; + font-size: smaller; + max-width: 80%; + opacity: 0.9; + padding: 1ex 1em 1em; + position: absolute; + z-index: 2147483647; +} + +#powerTip div.ttdoc { + color: grey; + font-style: italic; +} + +#powerTip div.ttname a { + font-weight: bold; +} + +#powerTip div.ttname { + font-weight: bold; +} + +#powerTip div.ttdeci { + color: #006318; +} + +#powerTip div { + margin: 0px; + padding: 0px; + font: 12px/16px Roboto,sans-serif; +} + +#powerTip:before, #powerTip:after { + content: ""; + position: absolute; + margin: 0px; +} + +#powerTip.n:after, #powerTip.n:before, +#powerTip.s:after, #powerTip.s:before, +#powerTip.w:after, #powerTip.w:before, +#powerTip.e:after, #powerTip.e:before, +#powerTip.ne:after, #powerTip.ne:before, +#powerTip.se:after, #powerTip.se:before, +#powerTip.nw:after, #powerTip.nw:before, +#powerTip.sw:after, #powerTip.sw:before { + border: solid transparent; + content: " "; + height: 0; + width: 0; + position: absolute; +} + +#powerTip.n:after, #powerTip.s:after, +#powerTip.w:after, #powerTip.e:after, +#powerTip.nw:after, #powerTip.ne:after, +#powerTip.sw:after, #powerTip.se:after { + border-color: rgba(255, 255, 255, 0); +} + +#powerTip.n:before, #powerTip.s:before, +#powerTip.w:before, #powerTip.e:before, +#powerTip.nw:before, #powerTip.ne:before, +#powerTip.sw:before, #powerTip.se:before { + border-color: rgba(128, 128, 128, 0); +} + +#powerTip.n:after, #powerTip.n:before, +#powerTip.ne:after, #powerTip.ne:before, +#powerTip.nw:after, #powerTip.nw:before { + top: 100%; +} + +#powerTip.n:after, #powerTip.ne:after, #powerTip.nw:after { + border-top-color: #ffffff; + border-width: 10px; + margin: 0px -10px; +} +#powerTip.n:before { + border-top-color: #808080; + border-width: 11px; + margin: 0px -11px; +} +#powerTip.n:after, #powerTip.n:before { + left: 50%; +} + +#powerTip.nw:after, #powerTip.nw:before { + right: 14px; +} + +#powerTip.ne:after, #powerTip.ne:before { + left: 14px; +} + +#powerTip.s:after, #powerTip.s:before, +#powerTip.se:after, #powerTip.se:before, +#powerTip.sw:after, #powerTip.sw:before { + bottom: 100%; +} + +#powerTip.s:after, #powerTip.se:after, #powerTip.sw:after { + border-bottom-color: #ffffff; + border-width: 10px; + margin: 0px -10px; +} + +#powerTip.s:before, #powerTip.se:before, #powerTip.sw:before { + border-bottom-color: #808080; + border-width: 11px; + margin: 0px -11px; +} + +#powerTip.s:after, #powerTip.s:before { + left: 50%; +} + +#powerTip.sw:after, #powerTip.sw:before { + right: 14px; +} + +#powerTip.se:after, #powerTip.se:before { + left: 14px; +} + +#powerTip.e:after, #powerTip.e:before { + left: 100%; +} +#powerTip.e:after { + border-left-color: #ffffff; + border-width: 10px; + top: 50%; + margin-top: -10px; +} +#powerTip.e:before { + border-left-color: #808080; + border-width: 11px; + top: 50%; + margin-top: -11px; +} + +#powerTip.w:after, #powerTip.w:before { + right: 100%; +} +#powerTip.w:after { + border-right-color: #ffffff; + border-width: 10px; + top: 50%; + margin-top: -10px; +} +#powerTip.w:before { + border-right-color: #808080; + border-width: 11px; + top: 50%; + margin-top: -11px; +} + +@media print +{ + #top { display: none; } + #side-nav { display: none; } + #nav-path { display: none; } + body { overflow:visible; } + h1, h2, h3, h4, h5, h6 { page-break-after: avoid; } + .summary { display: none; } + .memitem { page-break-inside: avoid; } + #doc-content + { + margin-left:0 !important; + height:auto !important; + width:auto !important; + overflow:inherit; + display:inline; + } +} + +/* @group Markdown */ + +/* +table.markdownTable { + border-collapse:collapse; + margin-top: 4px; + margin-bottom: 4px; +} + +table.markdownTable td, table.markdownTable th { + border: 1px solid #2D4068; + padding: 3px 7px 2px; +} + +table.markdownTableHead tr { +} + +table.markdownTableBodyLeft td, table.markdownTable th { + border: 1px solid #2D4068; + padding: 3px 7px 2px; +} + +th.markdownTableHeadLeft th.markdownTableHeadRight th.markdownTableHeadCenter th.markdownTableHeadNone { + background-color: #374F7F; + color: #FFFFFF; + font-size: 110%; + padding-bottom: 4px; + padding-top: 5px; +} + +th.markdownTableHeadLeft { + text-align: left +} + +th.markdownTableHeadRight { + text-align: right +} + +th.markdownTableHeadCenter { + text-align: center +} +*/ + +table.markdownTable { + border-collapse:collapse; + margin-top: 4px; + margin-bottom: 4px; +} + +table.markdownTable td, table.markdownTable th { + border: 1px solid #2D4068; + padding: 3px 7px 2px; +} + +table.markdownTable tr { +} + +th.markdownTableHeadLeft, th.markdownTableHeadRight, th.markdownTableHeadCenter, th.markdownTableHeadNone { + background-color: #374F7F; + color: #FFFFFF; + font-size: 110%; + padding-bottom: 4px; + padding-top: 5px; +} + +th.markdownTableHeadLeft, td.markdownTableBodyLeft { + text-align: left +} + +th.markdownTableHeadRight, td.markdownTableBodyRight { + text-align: right +} + +th.markdownTableHeadCenter, td.markdownTableBodyCenter { + text-align: center +} + + +/* @end */ diff --git a/docs/Doxygen/html/doxygen.png b/docs/Doxygen/html/doxygen.png new file mode 100644 index 0000000000000000000000000000000000000000..3ff17d807fd8aa003bed8bb2a69e8f0909592fd1 Binary files /dev/null and b/docs/Doxygen/html/doxygen.png differ diff --git a/docs/Doxygen/html/dynsections.js b/docs/Doxygen/html/dynsections.js new file mode 100644 index 0000000000000000000000000000000000000000..85e183690954af49931335b87a063b2c078d4546 --- /dev/null +++ b/docs/Doxygen/html/dynsections.js @@ -0,0 +1,97 @@ +function toggleVisibility(linkObj) +{ + var base = $(linkObj).attr('id'); + var summary = $('#'+base+'-summary'); + var content = $('#'+base+'-content'); + var trigger = $('#'+base+'-trigger'); + var src=$(trigger).attr('src'); + if (content.is(':visible')===true) { + content.hide(); + summary.show(); + $(linkObj).addClass('closed').removeClass('opened'); + $(trigger).attr('src',src.substring(0,src.length-8)+'closed.png'); + } else { + content.show(); + summary.hide(); + $(linkObj).removeClass('closed').addClass('opened'); + $(trigger).attr('src',src.substring(0,src.length-10)+'open.png'); + } + return false; +} + +function updateStripes() +{ + $('table.directory tr'). + removeClass('even').filter(':visible:even').addClass('even'); +} + +function toggleLevel(level) +{ + $('table.directory tr').each(function() { + var l = this.id.split('_').length-1; + var i = $('#img'+this.id.substring(3)); + var a = $('#arr'+this.id.substring(3)); + if (l<level+1) { + i.removeClass('iconfopen iconfclosed').addClass('iconfopen'); + a.html('▼'); + $(this).show(); + } else if (l==level+1) { + i.removeClass('iconfclosed iconfopen').addClass('iconfclosed'); + a.html('►'); + $(this).show(); + } else { + $(this).hide(); + } + }); + updateStripes(); +} + +function toggleFolder(id) +{ + // the clicked row + var currentRow = $('#row_'+id); + + // all rows after the clicked row + var rows = currentRow.nextAll("tr"); + + var re = new RegExp('^row_'+id+'\\d+_$', "i"); //only one sub + + // only match elements AFTER this one (can't hide elements before) + var childRows = rows.filter(function() { return this.id.match(re); }); + + // first row is visible we are HIDING + if (childRows.filter(':first').is(':visible')===true) { + // replace down arrow by right arrow for current row + var currentRowSpans = currentRow.find("span"); + currentRowSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed"); + currentRowSpans.filter(".arrow").html('►'); + rows.filter("[id^=row_"+id+"]").hide(); // hide all children + } else { // we are SHOWING + // replace right arrow by down arrow for current row + var currentRowSpans = currentRow.find("span"); + currentRowSpans.filter(".iconfclosed").removeClass("iconfclosed").addClass("iconfopen"); + currentRowSpans.filter(".arrow").html('▼'); + // replace down arrows by right arrows for child rows + var childRowsSpans = childRows.find("span"); + childRowsSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed"); + childRowsSpans.filter(".arrow").html('►'); + childRows.show(); //show all children + } + updateStripes(); +} + + +function toggleInherit(id) +{ + var rows = $('tr.inherit.'+id); + var img = $('tr.inherit_header.'+id+' img'); + var src = $(img).attr('src'); + if (rows.filter(':first').is(':visible')===true) { + rows.css('display','none'); + $(img).attr('src',src.substring(0,src.length-8)+'closed.png'); + } else { + rows.css('display','table-row'); // using show() causes jump in firefox + $(img).attr('src',src.substring(0,src.length-10)+'open.png'); + } +} + diff --git a/docs/Doxygen/html/files.html b/docs/Doxygen/html/files.html new file mode 100644 index 0000000000000000000000000000000000000000..b190dc1f65730d65b89f904a6991d3b673569cb8 --- /dev/null +++ b/docs/Doxygen/html/files.html @@ -0,0 +1,81 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: File List</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">File List</div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock">Here is a list of all documented files with brief descriptions:</div><div class="directory"> +<div class="levels">[detail level <span onclick="javascript:toggleLevel(1);">1</span><span onclick="javascript:toggleLevel(2);">2</span>]</div><table class="directory"> +<tr id="row_0_" class="even"><td class="entry"><span style="width:0px;display:inline-block;"> </span><span id="arr_0_" class="arrow" onclick="toggleFolder('0_')">▼</span><span id="img_0_" class="iconfopen" onclick="toggleFolder('0_')"> </span><a class="el" href="dir_eedb883b3a90ccdfffd3f135939cac7c.html" target="_self">testing_doxygen</a></td><td class="desc"></td></tr> +<tr id="row_0_0_"><td class="entry"><span style="width:32px;display:inline-block;"> </span><a href="ding_8h_source.html"><span class="icondoc"></span></a><b>ding.h</b></td><td class="desc"></td></tr> +<tr id="row_0_1_" class="even"><td class="entry"><span style="width:32px;display:inline-block;"> </span><a href="test_8h_source.html"><span class="icondoc"></span></a><b>test.h</b></td><td class="desc"></td></tr> +<tr id="row_1_"><td class="entry"><span style="width:16px;display:inline-block;"> </span><a href="binary__c__python_8h_source.html"><span class="icondoc"></span></a><b>binary_c_python.h</b></td><td class="desc"></td></tr> +</table> +</div><!-- directory --> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/folderclosed.png b/docs/Doxygen/html/folderclosed.png new file mode 100644 index 0000000000000000000000000000000000000000..bb8ab35edce8e97554e360005ee9fc5bffb36e66 Binary files /dev/null and b/docs/Doxygen/html/folderclosed.png differ diff --git a/docs/Doxygen/html/folderopen.png b/docs/Doxygen/html/folderopen.png new file mode 100644 index 0000000000000000000000000000000000000000..d6c7f676a3b3ef8c2c307d319dff3c6a604eb227 Binary files /dev/null and b/docs/Doxygen/html/folderopen.png differ diff --git a/docs/Doxygen/html/functions.html b/docs/Doxygen/html/functions.html new file mode 100644 index 0000000000000000000000000000000000000000..14df6da7a8d970d31772f055701cc20d950d6b7d --- /dev/null +++ b/docs/Doxygen/html/functions.html @@ -0,0 +1,95 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Class Members</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="contents"> +<div class="textblock">Here is a list of all documented class members with links to the class documentation for each member:</div><ul> +<li>a +: <a class="el" href="structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6">BoxStruct_struct</a> +</li> +<li>b +: <a class="el" href="structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197">BoxStruct_struct</a> +</li> +<li>c +: <a class="el" href="structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6">BoxStruct_struct</a> +</li> +<li>name +: <a class="el" href="structpoint3d.html#afb9519af724fab8e88b239b60c864a6d">point3d</a> +</li> +<li>namelength +: <a class="el" href="structpoint3d.html#a809caeed7433b4f182554ef12f8705a9">point3d</a> +</li> +<li>x +: <a class="el" href="structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9">point3d</a> +</li> +<li>y +: <a class="el" href="structpoint3d.html#af76302f192767fd9546392affbe5631c">point3d</a> +</li> +<li>z +: <a class="el" href="structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1">point3d</a> +</li> +</ul> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/functions_vars.html b/docs/Doxygen/html/functions_vars.html new file mode 100644 index 0000000000000000000000000000000000000000..f1bf40bb2212fdb2722c49d1575e444c3c32d641 --- /dev/null +++ b/docs/Doxygen/html/functions_vars.html @@ -0,0 +1,95 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Class Members - Variables</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="contents"> + <ul> +<li>a +: <a class="el" href="structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6">BoxStruct_struct</a> +</li> +<li>b +: <a class="el" href="structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197">BoxStruct_struct</a> +</li> +<li>c +: <a class="el" href="structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6">BoxStruct_struct</a> +</li> +<li>name +: <a class="el" href="structpoint3d.html#afb9519af724fab8e88b239b60c864a6d">point3d</a> +</li> +<li>namelength +: <a class="el" href="structpoint3d.html#a809caeed7433b4f182554ef12f8705a9">point3d</a> +</li> +<li>x +: <a class="el" href="structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9">point3d</a> +</li> +<li>y +: <a class="el" href="structpoint3d.html#af76302f192767fd9546392affbe5631c">point3d</a> +</li> +<li>z +: <a class="el" href="structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1">point3d</a> +</li> +</ul> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/graph_legend.dot b/docs/Doxygen/html/graph_legend.dot new file mode 100644 index 0000000000000000000000000000000000000000..789df56728f11d5c4cfa2cc8aaa89497f64bad18 --- /dev/null +++ b/docs/Doxygen/html/graph_legend.dot @@ -0,0 +1,22 @@ +digraph "Graph Legend" +{ + edge [fontname="Helvetica",fontsize="10",labelfontname="Helvetica",labelfontsize="10"]; + node [fontname="Helvetica",fontsize="10",shape=record]; + Node9 [shape="box",label="Inherited",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",fillcolor="grey75",style="filled" fontcolor="black"]; + Node10 -> Node9 [dir="back",color="midnightblue",fontsize="10",style="solid",fontname="Helvetica"]; + Node10 [shape="box",label="PublicBase",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",color="black",URL="$classPublicBase.html"]; + Node11 -> Node10 [dir="back",color="midnightblue",fontsize="10",style="solid",fontname="Helvetica"]; + Node11 [shape="box",label="Truncated",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",color="red",URL="$classTruncated.html"]; + Node13 -> Node9 [dir="back",color="darkgreen",fontsize="10",style="solid",fontname="Helvetica"]; + Node13 [shape="box",label="ProtectedBase",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",color="black",URL="$classProtectedBase.html"]; + Node14 -> Node9 [dir="back",color="firebrick4",fontsize="10",style="solid",fontname="Helvetica"]; + Node14 [shape="box",label="PrivateBase",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",color="black",URL="$classPrivateBase.html"]; + Node15 -> Node9 [dir="back",color="midnightblue",fontsize="10",style="solid",fontname="Helvetica"]; + Node15 [shape="box",label="Undocumented",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",color="grey75"]; + Node16 -> Node9 [dir="back",color="midnightblue",fontsize="10",style="solid",fontname="Helvetica"]; + Node16 [shape="box",label="Templ< int >",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",color="black",URL="$classTempl.html"]; + Node17 -> Node16 [dir="back",color="orange",fontsize="10",style="dashed",label="< int >",fontname="Helvetica"]; + Node17 [shape="box",label="Templ< T >",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",color="black",URL="$classTempl.html"]; + Node18 -> Node9 [dir="back",color="darkorchid3",fontsize="10",style="dashed",label="m_usedClass",fontname="Helvetica"]; + Node18 [shape="box",label="Used",fontsize="10",height=0.2,width=0.4,fontname="Helvetica",color="black",URL="$classUsed.html"]; +} diff --git a/docs/Doxygen/html/graph_legend.html b/docs/Doxygen/html/graph_legend.html new file mode 100644 index 0000000000000000000000000000000000000000..1625d6c341351bc0beb575bb306f91c9eb760e3e --- /dev/null +++ b/docs/Doxygen/html/graph_legend.html @@ -0,0 +1,102 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Graph Legend</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Graph Legend</div> </div> +</div><!--header--> +<div class="contents"> +<p>This page explains how to interpret the graphs that are generated by doxygen.</p> +<p>Consider the following example: </p><div class="fragment"><div class="line">/*! Invisible class because of truncation */</div><div class="line">class Invisible { };</div><div class="line"></div><div class="line">/*! Truncated class, inheritance relation is hidden */</div><div class="line">class Truncated : public Invisible { };</div><div class="line"></div><div class="line">/* Class not documented with doxygen comments */</div><div class="line">class Undocumented { };</div><div class="line"></div><div class="line">/*! Class that is inherited using public inheritance */</div><div class="line">class PublicBase : public Truncated { };</div><div class="line"></div><div class="line">/*! A template class */</div><div class="line">template<class T> class Templ { };</div><div class="line"></div><div class="line">/*! Class that is inherited using protected inheritance */</div><div class="line">class ProtectedBase { };</div><div class="line"></div><div class="line">/*! Class that is inherited using private inheritance */</div><div class="line">class PrivateBase { };</div><div class="line"></div><div class="line">/*! Class that is used by the Inherited class */</div><div class="line">class Used { };</div><div class="line"></div><div class="line">/*! Super class that inherits a number of other classes */</div><div class="line">class Inherited : public PublicBase,</div><div class="line"> protected ProtectedBase,</div><div class="line"> private PrivateBase,</div><div class="line"> public Undocumented,</div><div class="line"> public Templ<int></div><div class="line">{</div><div class="line"> private:</div><div class="line"> Used *m_usedClass;</div><div class="line">};</div></div><!-- fragment --><p> This will result in the following graph:</p> +<center><div class="image"> +<img src="graph_legend.png"/> +</div> +</center><p>The boxes in the above graph have the following meaning: </p> +<ul> +<li> +A filled gray box represents the struct or class for which the graph is generated. </li> +<li> +A box with a black border denotes a documented struct or class. </li> +<li> +A box with a gray border denotes an undocumented struct or class. </li> +<li> +A box with a red border denotes a documented struct or class forwhich not all inheritance/containment relations are shown. A graph is truncated if it does not fit within the specified boundaries. </li> +</ul> +<p>The arrows have the following meaning: </p> +<ul> +<li> +A dark blue arrow is used to visualize a public inheritance relation between two classes. </li> +<li> +A dark green arrow is used for protected inheritance. </li> +<li> +A dark red arrow is used for private inheritance. </li> +<li> +A purple dashed arrow is used if a class is contained or used by another class. The arrow is labelled with the variable(s) through which the pointed class or struct is accessible. </li> +<li> +A yellow dashed arrow denotes a relation between a template instance and the template class it was instantiated from. The arrow is labelled with the template parameters of the instance. </li> +</ul> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/graph_legend.md5 b/docs/Doxygen/html/graph_legend.md5 new file mode 100644 index 0000000000000000000000000000000000000000..a06ed050cbb5398b6f149c32c29006e39f00d56a --- /dev/null +++ b/docs/Doxygen/html/graph_legend.md5 @@ -0,0 +1 @@ +387ff8eb65306fa251338d3c9bd7bfff \ No newline at end of file diff --git a/docs/Doxygen/html/index.html b/docs/Doxygen/html/index.html new file mode 100644 index 0000000000000000000000000000000000000000..04e75a55e29df2e811b7721bdf88606f19925a56 --- /dev/null +++ b/docs/Doxygen/html/index.html @@ -0,0 +1,73 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Main Page</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">My Project Documentation</div> </div> +</div><!--header--> +<div class="contents"> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/jquery.js b/docs/Doxygen/html/jquery.js new file mode 100644 index 0000000000000000000000000000000000000000..f5343eda922a502398f4fce93cbf2ea09a997fe4 --- /dev/null +++ b/docs/Doxygen/html/jquery.js @@ -0,0 +1,87 @@ +/*! + * jQuery JavaScript Library v1.7.1 + * http://jquery.com/ + * + * Copyright 2011, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Mon Nov 21 21:11:03 2011 -0500 + */ +(function(bb,L){var av=bb.document,bu=bb.navigator,bl=bb.location;var b=(function(){var bF=function(b0,b1){return new bF.fn.init(b0,b1,bD)},bU=bb.jQuery,bH=bb.$,bD,bY=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bE=/\s+$/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bW=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bB=/-([a-z]|[0-9])/ig,bZ=/^-ms-/,bT=function(b0,b1){return(b1+"").toUpperCase()},bX=bu.userAgent,bV,bC,e,bL=Object.prototype.toString,bG=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bF.fn=bF.prototype={constructor:bF,init:function(b0,b4,b3){var b2,b5,b1,b6;if(!b0){return this}if(b0.nodeType){this.context=this[0]=b0;this.length=1;return this}if(b0==="body"&&!b4&&av.body){this.context=av;this[0]=av.body;this.selector=b0;this.length=1;return this}if(typeof b0==="string"){if(b0.charAt(0)==="<"&&b0.charAt(b0.length-1)===">"&&b0.length>=3){b2=[null,b0,null]}else{b2=bY.exec(b0)}if(b2&&(b2[1]||!b4)){if(b2[1]){b4=b4 instanceof bF?b4[0]:b4;b6=(b4?b4.ownerDocument||b4:av);b1=bA.exec(b0);if(b1){if(bF.isPlainObject(b4)){b0=[av.createElement(b1[1])];bF.fn.attr.call(b0,b4,true)}else{b0=[b6.createElement(b1[1])]}}else{b1=bF.buildFragment([b2[1]],[b6]);b0=(b1.cacheable?bF.clone(b1.fragment):b1.fragment).childNodes}return bF.merge(this,b0)}else{b5=av.getElementById(b2[2]);if(b5&&b5.parentNode){if(b5.id!==b2[2]){return b3.find(b0)}this.length=1;this[0]=b5}this.context=av;this.selector=b0;return this}}else{if(!b4||b4.jquery){return(b4||b3).find(b0)}else{return this.constructor(b4).find(b0)}}}else{if(bF.isFunction(b0)){return b3.ready(b0)}}if(b0.selector!==L){this.selector=b0.selector;this.context=b0.context}return bF.makeArray(b0,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(b0){return b0==null?this.toArray():(b0<0?this[this.length+b0]:this[b0])},pushStack:function(b1,b3,b0){var b2=this.constructor();if(bF.isArray(b1)){bz.apply(b2,b1)}else{bF.merge(b2,b1)}b2.prevObject=this;b2.context=this.context;if(b3==="find"){b2.selector=this.selector+(this.selector?" ":"")+b0}else{if(b3){b2.selector=this.selector+"."+b3+"("+b0+")"}}return b2},each:function(b1,b0){return bF.each(this,b1,b0)},ready:function(b0){bF.bindReady();bC.add(b0);return this},eq:function(b0){b0=+b0;return b0===-1?this.slice(b0):this.slice(b0,b0+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(b0){return this.pushStack(bF.map(this,function(b2,b1){return b0.call(b2,b1,b2)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bF.fn.init.prototype=bF.fn;bF.extend=bF.fn.extend=function(){var b9,b2,b0,b1,b6,b7,b5=arguments[0]||{},b4=1,b3=arguments.length,b8=false;if(typeof b5==="boolean"){b8=b5;b5=arguments[1]||{};b4=2}if(typeof b5!=="object"&&!bF.isFunction(b5)){b5={}}if(b3===b4){b5=this;--b4}for(;b4<b3;b4++){if((b9=arguments[b4])!=null){for(b2 in b9){b0=b5[b2];b1=b9[b2];if(b5===b1){continue}if(b8&&b1&&(bF.isPlainObject(b1)||(b6=bF.isArray(b1)))){if(b6){b6=false;b7=b0&&bF.isArray(b0)?b0:[]}else{b7=b0&&bF.isPlainObject(b0)?b0:{}}b5[b2]=bF.extend(b8,b7,b1)}else{if(b1!==L){b5[b2]=b1}}}}}return b5};bF.extend({noConflict:function(b0){if(bb.$===bF){bb.$=bH}if(b0&&bb.jQuery===bF){bb.jQuery=bU}return bF},isReady:false,readyWait:1,holdReady:function(b0){if(b0){bF.readyWait++}else{bF.ready(true)}},ready:function(b0){if((b0===true&&!--bF.readyWait)||(b0!==true&&!bF.isReady)){if(!av.body){return setTimeout(bF.ready,1)}bF.isReady=true;if(b0!==true&&--bF.readyWait>0){return}bC.fireWith(av,[bF]);if(bF.fn.trigger){bF(av).trigger("ready").off("ready")}}},bindReady:function(){if(bC){return}bC=bF.Callbacks("once memory");if(av.readyState==="complete"){return setTimeout(bF.ready,1)}if(av.addEventListener){av.addEventListener("DOMContentLoaded",e,false);bb.addEventListener("load",bF.ready,false)}else{if(av.attachEvent){av.attachEvent("onreadystatechange",e);bb.attachEvent("onload",bF.ready);var b0=false;try{b0=bb.frameElement==null}catch(b1){}if(av.documentElement.doScroll&&b0){bw()}}}},isFunction:function(b0){return bF.type(b0)==="function"},isArray:Array.isArray||function(b0){return bF.type(b0)==="array"},isWindow:function(b0){return b0&&typeof b0==="object"&&"setInterval" in b0},isNumeric:function(b0){return !isNaN(parseFloat(b0))&&isFinite(b0)},type:function(b0){return b0==null?String(b0):bx[bL.call(b0)]||"object"},isPlainObject:function(b2){if(!b2||bF.type(b2)!=="object"||b2.nodeType||bF.isWindow(b2)){return false}try{if(b2.constructor&&!bG.call(b2,"constructor")&&!bG.call(b2.constructor.prototype,"isPrototypeOf")){return false}}catch(b1){return false}var b0;for(b0 in b2){}return b0===L||bG.call(b2,b0)},isEmptyObject:function(b1){for(var b0 in b1){return false}return true},error:function(b0){throw new Error(b0)},parseJSON:function(b0){if(typeof b0!=="string"||!b0){return null}b0=bF.trim(b0);if(bb.JSON&&bb.JSON.parse){return bb.JSON.parse(b0)}if(bN.test(b0.replace(bW,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+b0))()}bF.error("Invalid JSON: "+b0)},parseXML:function(b2){var b0,b1;try{if(bb.DOMParser){b1=new DOMParser();b0=b1.parseFromString(b2,"text/xml")}else{b0=new ActiveXObject("Microsoft.XMLDOM");b0.async="false";b0.loadXML(b2)}}catch(b3){b0=L}if(!b0||!b0.documentElement||b0.getElementsByTagName("parsererror").length){bF.error("Invalid XML: "+b2)}return b0},noop:function(){},globalEval:function(b0){if(b0&&bM.test(b0)){(bb.execScript||function(b1){bb["eval"].call(bb,b1)})(b0)}},camelCase:function(b0){return b0.replace(bZ,"ms-").replace(bB,bT)},nodeName:function(b1,b0){return b1.nodeName&&b1.nodeName.toUpperCase()===b0.toUpperCase()},each:function(b3,b6,b2){var b1,b4=0,b5=b3.length,b0=b5===L||bF.isFunction(b3);if(b2){if(b0){for(b1 in b3){if(b6.apply(b3[b1],b2)===false){break}}}else{for(;b4<b5;){if(b6.apply(b3[b4++],b2)===false){break}}}}else{if(b0){for(b1 in b3){if(b6.call(b3[b1],b1,b3[b1])===false){break}}}else{for(;b4<b5;){if(b6.call(b3[b4],b4,b3[b4++])===false){break}}}}return b3},trim:bO?function(b0){return b0==null?"":bO.call(b0)}:function(b0){return b0==null?"":b0.toString().replace(bI,"").replace(bE,"")},makeArray:function(b3,b1){var b0=b1||[];if(b3!=null){var b2=bF.type(b3);if(b3.length==null||b2==="string"||b2==="function"||b2==="regexp"||bF.isWindow(b3)){bz.call(b0,b3)}else{bF.merge(b0,b3)}}return b0},inArray:function(b2,b3,b1){var b0;if(b3){if(bv){return bv.call(b3,b2,b1)}b0=b3.length;b1=b1?b1<0?Math.max(0,b0+b1):b1:0;for(;b1<b0;b1++){if(b1 in b3&&b3[b1]===b2){return b1}}}return -1},merge:function(b4,b2){var b3=b4.length,b1=0;if(typeof b2.length==="number"){for(var b0=b2.length;b1<b0;b1++){b4[b3++]=b2[b1]}}else{while(b2[b1]!==L){b4[b3++]=b2[b1++]}}b4.length=b3;return b4},grep:function(b1,b6,b0){var b2=[],b5;b0=!!b0;for(var b3=0,b4=b1.length;b3<b4;b3++){b5=!!b6(b1[b3],b3);if(b0!==b5){b2.push(b1[b3])}}return b2},map:function(b0,b7,b8){var b5,b6,b4=[],b2=0,b1=b0.length,b3=b0 instanceof bF||b1!==L&&typeof b1==="number"&&((b1>0&&b0[0]&&b0[b1-1])||b1===0||bF.isArray(b0));if(b3){for(;b2<b1;b2++){b5=b7(b0[b2],b2,b8);if(b5!=null){b4[b4.length]=b5}}}else{for(b6 in b0){b5=b7(b0[b6],b6,b8);if(b5!=null){b4[b4.length]=b5}}}return b4.concat.apply([],b4)},guid:1,proxy:function(b4,b3){if(typeof b3==="string"){var b2=b4[b3];b3=b4;b4=b2}if(!bF.isFunction(b4)){return L}var b0=bK.call(arguments,2),b1=function(){return b4.apply(b3,b0.concat(bK.call(arguments)))};b1.guid=b4.guid=b4.guid||b1.guid||bF.guid++;return b1},access:function(b0,b8,b6,b2,b5,b7){var b1=b0.length;if(typeof b8==="object"){for(var b3 in b8){bF.access(b0,b3,b8[b3],b2,b5,b6)}return b0}if(b6!==L){b2=!b7&&b2&&bF.isFunction(b6);for(var b4=0;b4<b1;b4++){b5(b0[b4],b8,b2?b6.call(b0[b4],b4,b5(b0[b4],b8)):b6,b7)}return b0}return b1?b5(b0[0],b8):L},now:function(){return(new Date()).getTime()},uaMatch:function(b1){b1=b1.toLowerCase();var b0=by.exec(b1)||bR.exec(b1)||bQ.exec(b1)||b1.indexOf("compatible")<0&&bS.exec(b1)||[];return{browser:b0[1]||"",version:b0[2]||"0"}},sub:function(){function b0(b3,b4){return new b0.fn.init(b3,b4)}bF.extend(true,b0,this);b0.superclass=this;b0.fn=b0.prototype=this();b0.fn.constructor=b0;b0.sub=this.sub;b0.fn.init=function b2(b3,b4){if(b4&&b4 instanceof bF&&!(b4 instanceof b0)){b4=b0(b4)}return bF.fn.init.call(this,b3,b4,b1)};b0.fn.init.prototype=b0.fn;var b1=b0(av);return b0},browser:{}});bF.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(b1,b0){bx["[object "+b0+"]"]=b0.toLowerCase()});bV=bF.uaMatch(bX);if(bV.browser){bF.browser[bV.browser]=true;bF.browser.version=bV.version}if(bF.browser.webkit){bF.browser.safari=true}if(bM.test("\xA0")){bI=/^[\s\xA0]+/;bE=/[\s\xA0]+$/}bD=bF(av);if(av.addEventListener){e=function(){av.removeEventListener("DOMContentLoaded",e,false);bF.ready()}}else{if(av.attachEvent){e=function(){if(av.readyState==="complete"){av.detachEvent("onreadystatechange",e);bF.ready()}}}}function bw(){if(bF.isReady){return}try{av.documentElement.doScroll("left")}catch(b0){setTimeout(bw,1);return}bF.ready()}return bF})();var a2={};function X(e){var bv=a2[e]={},bw,bx;e=e.split(/\s+/);for(bw=0,bx=e.length;bw<bx;bw++){bv[e[bw]]=true}return bv}b.Callbacks=function(bw){bw=bw?(a2[bw]||X(bw)):{};var bB=[],bC=[],bx,by,bv,bz,bA,bE=function(bF){var bG,bJ,bI,bH,bK;for(bG=0,bJ=bF.length;bG<bJ;bG++){bI=bF[bG];bH=b.type(bI);if(bH==="array"){bE(bI)}else{if(bH==="function"){if(!bw.unique||!bD.has(bI)){bB.push(bI)}}}}},e=function(bG,bF){bF=bF||[];bx=!bw.memory||[bG,bF];by=true;bA=bv||0;bv=0;bz=bB.length;for(;bB&&bA<bz;bA++){if(bB[bA].apply(bG,bF)===false&&bw.stopOnFalse){bx=true;break}}by=false;if(bB){if(!bw.once){if(bC&&bC.length){bx=bC.shift();bD.fireWith(bx[0],bx[1])}}else{if(bx===true){bD.disable()}else{bB=[]}}}},bD={add:function(){if(bB){var bF=bB.length;bE(arguments);if(by){bz=bB.length}else{if(bx&&bx!==true){bv=bF;e(bx[0],bx[1])}}}return this},remove:function(){if(bB){var bF=arguments,bH=0,bI=bF.length;for(;bH<bI;bH++){for(var bG=0;bG<bB.length;bG++){if(bF[bH]===bB[bG]){if(by){if(bG<=bz){bz--;if(bG<=bA){bA--}}}bB.splice(bG--,1);if(bw.unique){break}}}}}return this},has:function(bG){if(bB){var bF=0,bH=bB.length;for(;bF<bH;bF++){if(bG===bB[bF]){return true}}}return false},empty:function(){bB=[];return this},disable:function(){bB=bC=bx=L;return this},disabled:function(){return !bB},lock:function(){bC=L;if(!bx||bx===true){bD.disable()}return this},locked:function(){return !bC},fireWith:function(bG,bF){if(bC){if(by){if(!bw.once){bC.push([bG,bF])}}else{if(!(bw.once&&bx)){e(bG,bF)}}}return this},fire:function(){bD.fireWith(this,arguments);return this},fired:function(){return !!bx}};return bD};var aJ=[].slice;b.extend({Deferred:function(by){var bx=b.Callbacks("once memory"),bw=b.Callbacks("once memory"),bv=b.Callbacks("memory"),e="pending",bA={resolve:bx,reject:bw,notify:bv},bC={done:bx.add,fail:bw.add,progress:bv.add,state:function(){return e},isResolved:bx.fired,isRejected:bw.fired,then:function(bE,bD,bF){bB.done(bE).fail(bD).progress(bF);return this},always:function(){bB.done.apply(bB,arguments).fail.apply(bB,arguments);return this},pipe:function(bF,bE,bD){return b.Deferred(function(bG){b.each({done:[bF,"resolve"],fail:[bE,"reject"],progress:[bD,"notify"]},function(bI,bL){var bH=bL[0],bK=bL[1],bJ;if(b.isFunction(bH)){bB[bI](function(){bJ=bH.apply(this,arguments);if(bJ&&b.isFunction(bJ.promise)){bJ.promise().then(bG.resolve,bG.reject,bG.notify)}else{bG[bK+"With"](this===bB?bG:this,[bJ])}})}else{bB[bI](bG[bK])}})}).promise()},promise:function(bE){if(bE==null){bE=bC}else{for(var bD in bC){bE[bD]=bC[bD]}}return bE}},bB=bC.promise({}),bz;for(bz in bA){bB[bz]=bA[bz].fire;bB[bz+"With"]=bA[bz].fireWith}bB.done(function(){e="resolved"},bw.disable,bv.lock).fail(function(){e="rejected"},bx.disable,bv.lock);if(by){by.call(bB,bB)}return bB},when:function(bA){var bx=aJ.call(arguments,0),bv=0,e=bx.length,bB=new Array(e),bw=e,by=e,bC=e<=1&&bA&&b.isFunction(bA.promise)?bA:b.Deferred(),bE=bC.promise();function bD(bF){return function(bG){bx[bF]=arguments.length>1?aJ.call(arguments,0):bG;if(!(--bw)){bC.resolveWith(bC,bx)}}}function bz(bF){return function(bG){bB[bF]=arguments.length>1?aJ.call(arguments,0):bG;bC.notifyWith(bE,bB)}}if(e>1){for(;bv<e;bv++){if(bx[bv]&&bx[bv].promise&&b.isFunction(bx[bv].promise)){bx[bv].promise().then(bD(bv),bC.reject,bz(bv))}else{--bw}}if(!bw){bC.resolveWith(bC,bx)}}else{if(bC!==bA){bC.resolveWith(bC,e?[bA]:[])}}return bE}});b.support=(function(){var bJ,bI,bF,bG,bx,bE,bA,bD,bz,bK,bB,by,bw,bv=av.createElement("div"),bH=av.documentElement;bv.setAttribute("className","t");bv.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";bI=bv.getElementsByTagName("*");bF=bv.getElementsByTagName("a")[0];if(!bI||!bI.length||!bF){return{}}bG=av.createElement("select");bx=bG.appendChild(av.createElement("option"));bE=bv.getElementsByTagName("input")[0];bJ={leadingWhitespace:(bv.firstChild.nodeType===3),tbody:!bv.getElementsByTagName("tbody").length,htmlSerialize:!!bv.getElementsByTagName("link").length,style:/top/.test(bF.getAttribute("style")),hrefNormalized:(bF.getAttribute("href")==="/a"),opacity:/^0.55/.test(bF.style.opacity),cssFloat:!!bF.style.cssFloat,checkOn:(bE.value==="on"),optSelected:bx.selected,getSetAttribute:bv.className!=="t",enctype:!!av.createElement("form").enctype,html5Clone:av.createElement("nav").cloneNode(true).outerHTML!=="<:nav></:nav>",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true};bE.checked=true;bJ.noCloneChecked=bE.cloneNode(true).checked;bG.disabled=true;bJ.optDisabled=!bx.disabled;try{delete bv.test}catch(bC){bJ.deleteExpando=false}if(!bv.addEventListener&&bv.attachEvent&&bv.fireEvent){bv.attachEvent("onclick",function(){bJ.noCloneEvent=false});bv.cloneNode(true).fireEvent("onclick")}bE=av.createElement("input");bE.value="t";bE.setAttribute("type","radio");bJ.radioValue=bE.value==="t";bE.setAttribute("checked","checked");bv.appendChild(bE);bD=av.createDocumentFragment();bD.appendChild(bv.lastChild);bJ.checkClone=bD.cloneNode(true).cloneNode(true).lastChild.checked;bJ.appendChecked=bE.checked;bD.removeChild(bE);bD.appendChild(bv);bv.innerHTML="";if(bb.getComputedStyle){bA=av.createElement("div");bA.style.width="0";bA.style.marginRight="0";bv.style.width="2px";bv.appendChild(bA);bJ.reliableMarginRight=(parseInt((bb.getComputedStyle(bA,null)||{marginRight:0}).marginRight,10)||0)===0}if(bv.attachEvent){for(by in {submit:1,change:1,focusin:1}){bB="on"+by;bw=(bB in bv);if(!bw){bv.setAttribute(bB,"return;");bw=(typeof bv[bB]==="function")}bJ[by+"Bubbles"]=bw}}bD.removeChild(bv);bD=bG=bx=bA=bv=bE=null;b(function(){var bM,bU,bV,bT,bN,bO,bL,bS,bR,e,bP,bQ=av.getElementsByTagName("body")[0];if(!bQ){return}bL=1;bS="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;";bR="visibility:hidden;border:0;";e="style='"+bS+"border:5px solid #000;padding:0;'";bP="<div "+e+"><div></div></div><table "+e+" cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";bM=av.createElement("div");bM.style.cssText=bR+"width:0;height:0;position:static;top:0;margin-top:"+bL+"px";bQ.insertBefore(bM,bQ.firstChild);bv=av.createElement("div");bM.appendChild(bv);bv.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";bz=bv.getElementsByTagName("td");bw=(bz[0].offsetHeight===0);bz[0].style.display="";bz[1].style.display="none";bJ.reliableHiddenOffsets=bw&&(bz[0].offsetHeight===0);bv.innerHTML="";bv.style.width=bv.style.paddingLeft="1px";b.boxModel=bJ.boxModel=bv.offsetWidth===2;if(typeof bv.style.zoom!=="undefined"){bv.style.display="inline";bv.style.zoom=1;bJ.inlineBlockNeedsLayout=(bv.offsetWidth===2);bv.style.display="";bv.innerHTML="<div style='width:4px;'></div>";bJ.shrinkWrapBlocks=(bv.offsetWidth!==2)}bv.style.cssText=bS+bR;bv.innerHTML=bP;bU=bv.firstChild;bV=bU.firstChild;bN=bU.nextSibling.firstChild.firstChild;bO={doesNotAddBorder:(bV.offsetTop!==5),doesAddBorderForTableAndCells:(bN.offsetTop===5)};bV.style.position="fixed";bV.style.top="20px";bO.fixedPosition=(bV.offsetTop===20||bV.offsetTop===15);bV.style.position=bV.style.top="";bU.style.overflow="hidden";bU.style.position="relative";bO.subtractsBorderForOverflowNotVisible=(bV.offsetTop===-5);bO.doesNotIncludeMarginInBodyOffset=(bQ.offsetTop!==bL);bQ.removeChild(bM);bv=bM=null;b.extend(bJ,bO)});return bJ})();var aS=/^(?:\{.*\}|\[.*\])$/,aA=/([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!S(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bG,bA,bD,bE=b.expando,bC=typeof bv==="string",bF=bx.nodeType,e=bF?b.cache:bx,bw=bF?bx[bE]:bx[bE]&&bE,bB=bv==="events";if((!bw||!e[bw]||(!bB&&!by&&!e[bw].data))&&bC&&bz===L){return}if(!bw){if(bF){bx[bE]=bw=++b.uuid}else{bw=bE}}if(!e[bw]){e[bw]={};if(!bF){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw]=b.extend(e[bw],bv)}else{e[bw].data=b.extend(e[bw].data,bv)}}bG=bA=e[bw];if(!by){if(!bA.data){bA.data={}}bA=bA.data}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bB&&!bA[bv]){return bG.events}if(bC){bD=bA[bv];if(bD==null){bD=bA[b.camelCase(bv)]}}else{bD=bA}return bD},removeData:function(bx,bv,by){if(!b.acceptData(bx)){return}var bB,bA,bz,bC=b.expando,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[bC]:bC;if(!e[bw]){return}if(bv){bB=by?e[bw]:e[bw].data;if(bB){if(!b.isArray(bv)){if(bv in bB){bv=[bv]}else{bv=b.camelCase(bv);if(bv in bB){bv=[bv]}else{bv=bv.split(" ")}}}for(bA=0,bz=bv.length;bA<bz;bA++){delete bB[bv[bA]]}if(!(by?S:b.isEmptyObject)(bB)){return}}}if(!by){delete e[bw].data;if(!S(e[bw])){return}}if(b.support.deleteExpando||!e.setInterval){delete e[bw]}else{e[bw]=null}if(bD){if(b.support.deleteExpando){delete bx[bC]}else{if(bx.removeAttribute){bx.removeAttribute(bC)}else{bx[bC]=null}}}},_data:function(bv,e,bw){return b.data(bv,e,bw,true)},acceptData:function(bv){if(bv.nodeName){var e=b.noData[bv.nodeName.toLowerCase()];if(e){return !(e===true||bv.getAttribute("classid")!==e)}}return true}});b.fn.extend({data:function(by,bA){var bB,e,bw,bz=null;if(typeof by==="undefined"){if(this.length){bz=b.data(this[0]);if(this[0].nodeType===1&&!b._data(this[0],"parsedAttrs")){e=this[0].attributes;for(var bx=0,bv=e.length;bx<bv;bx++){bw=e[bx].name;if(bw.indexOf("data-")===0){bw=b.camelCase(bw.substring(5));a5(this[0],bw,bz[bw])}}b._data(this[0],"parsedAttrs",true)}}return bz}else{if(typeof by==="object"){return this.each(function(){b.data(this,by)})}}bB=by.split(".");bB[1]=bB[1]?"."+bB[1]:"";if(bA===L){bz=this.triggerHandler("getData"+bB[1]+"!",[bB[0]]);if(bz===L&&this.length){bz=b.data(this[0],by);bz=a5(this[0],by,bz)}return bz===L&&bB[1]?this.data(bB[0]):bz}else{return this.each(function(){var bC=b(this),bD=[bB[0],bA];bC.triggerHandler("setData"+bB[1]+"!",bD);b.data(this,by,bA);bC.triggerHandler("changeData"+bB[1]+"!",bD)})}},removeData:function(e){return this.each(function(){b.removeData(this,e)})}});function a5(bx,bw,by){if(by===L&&bx.nodeType===1){var bv="data-"+bw.replace(aA,"-$1").toLowerCase();by=bx.getAttribute(bv);if(typeof by==="string"){try{by=by==="true"?true:by==="false"?false:by==="null"?null:b.isNumeric(by)?parseFloat(by):aS.test(by)?b.parseJSON(by):by}catch(bz){}b.data(bx,bw,by)}else{by=L}}return by}function S(bv){for(var e in bv){if(e==="data"&&b.isEmptyObject(bv[e])){continue}if(e!=="toJSON"){return false}}return true}function bi(by,bx,bA){var bw=bx+"defer",bv=bx+"queue",e=bx+"mark",bz=b._data(by,bw);if(bz&&(bA==="queue"||!b._data(by,bv))&&(bA==="mark"||!b._data(by,e))){setTimeout(function(){if(!b._data(by,bv)&&!b._data(by,e)){b.removeData(by,bw,true);bz.fire()}},0)}}b.extend({_mark:function(bv,e){if(bv){e=(e||"fx")+"mark";b._data(bv,e,(b._data(bv,e)||0)+1)}},_unmark:function(by,bx,bv){if(by!==true){bv=bx;bx=by;by=false}if(bx){bv=bv||"fx";var e=bv+"mark",bw=by?0:((b._data(bx,e)||1)-1);if(bw){b._data(bx,e,bw)}else{b.removeData(bx,e,true);bi(bx,bv,"mark")}}},queue:function(bv,e,bx){var bw;if(bv){e=(e||"fx")+"queue";bw=b._data(bv,e);if(bx){if(!bw||b.isArray(bx)){bw=b._data(bv,e,b.makeArray(bx))}else{bw.push(bx)}}return bw||[]}},dequeue:function(by,bx){bx=bx||"fx";var bv=b.queue(by,bx),bw=bv.shift(),e={};if(bw==="inprogress"){bw=bv.shift()}if(bw){if(bx==="fx"){bv.unshift("inprogress")}b._data(by,bx+".run",e);bw.call(by,function(){b.dequeue(by,bx)},e)}if(!bv.length){b.removeData(by,bx+"queue "+bx+".run",true);bi(by,bx,"queue")}}});b.fn.extend({queue:function(e,bv){if(typeof e!=="string"){bv=e;e="fx"}if(bv===L){return b.queue(this[0],e)}return this.each(function(){var bw=b.queue(this,e,bv);if(e==="fx"&&bw[0]!=="inprogress"){b.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){b.dequeue(this,e)})},delay:function(bv,e){bv=b.fx?b.fx.speeds[bv]||bv:bv;e=e||"fx";return this.queue(e,function(bx,bw){var by=setTimeout(bx,bv);bw.stop=function(){clearTimeout(by)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(bD,bw){if(typeof bD!=="string"){bw=bD;bD=L}bD=bD||"fx";var e=b.Deferred(),bv=this,by=bv.length,bB=1,bz=bD+"defer",bA=bD+"queue",bC=bD+"mark",bx;function bE(){if(!(--bB)){e.resolveWith(bv,[bv])}}while(by--){if((bx=b.data(bv[by],bz,L,true)||(b.data(bv[by],bA,L,true)||b.data(bv[by],bC,L,true))&&b.data(bv[by],bz,b.Callbacks("once memory"),true))){bB++;bx.add(bE)}}bE();return e.promise()}});var aP=/[\n\t\r]/g,af=/\s+/,aU=/\r/g,g=/^(?:button|input)$/i,D=/^(?:button|input|object|select|textarea)$/i,l=/^a(?:rea)?$/i,ao=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,F=b.support.getSetAttribute,be,aY,aF;b.fn.extend({attr:function(e,bv){return b.access(this,e,bv,true,b.attr)},removeAttr:function(e){return this.each(function(){b.removeAttr(this,e)})},prop:function(e,bv){return b.access(this,e,bv,true,b.prop)},removeProp:function(e){e=b.propFix[e]||e;return this.each(function(){try{this[e]=L;delete this[e]}catch(bv){}})},addClass:function(by){var bA,bw,bv,bx,bz,bB,e;if(b.isFunction(by)){return this.each(function(bC){b(this).addClass(by.call(this,bC,this.className))})}if(by&&typeof by==="string"){bA=by.split(af);for(bw=0,bv=this.length;bw<bv;bw++){bx=this[bw];if(bx.nodeType===1){if(!bx.className&&bA.length===1){bx.className=by}else{bz=" "+bx.className+" ";for(bB=0,e=bA.length;bB<e;bB++){if(!~bz.indexOf(" "+bA[bB]+" ")){bz+=bA[bB]+" "}}bx.className=b.trim(bz)}}}}return this},removeClass:function(bz){var bA,bw,bv,by,bx,bB,e;if(b.isFunction(bz)){return this.each(function(bC){b(this).removeClass(bz.call(this,bC,this.className))})}if((bz&&typeof bz==="string")||bz===L){bA=(bz||"").split(af);for(bw=0,bv=this.length;bw<bv;bw++){by=this[bw];if(by.nodeType===1&&by.className){if(bz){bx=(" "+by.className+" ").replace(aP," ");for(bB=0,e=bA.length;bB<e;bB++){bx=bx.replace(" "+bA[bB]+" "," ")}by.className=b.trim(bx)}else{by.className=""}}}}return this},toggleClass:function(bx,bv){var bw=typeof bx,e=typeof bv==="boolean";if(b.isFunction(bx)){return this.each(function(by){b(this).toggleClass(bx.call(this,by,this.className,bv),bv)})}return this.each(function(){if(bw==="string"){var bA,bz=0,by=b(this),bB=bv,bC=bx.split(af);while((bA=bC[bz++])){bB=e?bB:!by.hasClass(bA);by[bB?"addClass":"removeClass"](bA)}}else{if(bw==="undefined"||bw==="boolean"){if(this.className){b._data(this,"__className__",this.className)}this.className=this.className||bx===false?"":b._data(this,"__className__")||""}}})},hasClass:function(e){var bx=" "+e+" ",bw=0,bv=this.length;for(;bw<bv;bw++){if(this[bw].nodeType===1&&(" "+this[bw].className+" ").replace(aP," ").indexOf(bx)>-1){return true}}return false},val:function(bx){var e,bv,by,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.nodeName.toLowerCase()]||b.valHooks[bw.type];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}bv=bw.value;return typeof bv==="string"?bv.replace(aU,""):bv==null?"":bv}return}by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.nodeName.toLowerCase()]||b.valHooks[this.type];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,bv,bz,bx,by=e.selectedIndex,bB=[],bC=e.options,bw=e.type==="select-one";if(by<0){return null}bv=bw?by:0;bz=bw?by+1:bC.length;for(;bv<bz;bv++){bx=bC[bv];if(bx.selected&&(b.support.optDisabled?!bx.disabled:bx.getAttribute("disabled")===null)&&(!bx.parentNode.disabled||!b.nodeName(bx.parentNode,"optgroup"))){bA=b(bx).val();if(bw){return bA}bB.push(bA)}}if(bw&&!bB.length&&bC.length){return b(bC[by]).val()}return bB},set:function(bv,bw){var e=b.makeArray(bw);b(bv).find("option").each(function(){this.selected=b.inArray(b(this).val(),e)>=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bA,bx,bB,bz){var bw,e,by,bv=bA.nodeType;if(!bA||bv===3||bv===8||bv===2){return}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(typeof bA.getAttribute==="undefined"){return b.prop(bA,bx,bB)}by=bv!==1||!b.isXMLDoc(bA);if(by){bx=bx.toLowerCase();e=b.attrHooks[bx]||(ao.test(bx)?aY:be)}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by&&(bw=e.get(bA,bx))!==null){return bw}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(bx,bz){var by,bA,bv,e,bw=0;if(bz&&bx.nodeType===1){bA=bz.toLowerCase().split(af);e=bA.length;for(;bw<e;bw++){bv=bA[bw];if(bv){by=b.propFix[bv]||bv;b.attr(bx,bv,"");bx.removeAttribute(F?bv:by);if(ao.test(bv)&&by in bx){bx[by]=false}}}}},attrHooks:{type:{set:function(e,bv){if(g.test(e.nodeName)&&e.parentNode){b.error("type property can't be changed")}else{if(!b.support.radioValue&&bv==="radio"&&b.nodeName(e,"input")){var bw=e.value;e.setAttribute("type",bv);if(bw){e.value=bw}return bv}}}},value:{get:function(bv,e){if(be&&b.nodeName(bv,"button")){return be.get(bv,e)}return e in bv?bv.value:null},set:function(bv,bw,e){if(be&&b.nodeName(bv,"button")){return be.set(bv,bw,e)}bv.value=bw}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(bz,bx,bA){var bw,e,by,bv=bz.nodeType;if(!bz||bv===3||bv===8||bv===2){return}by=bv!==1||!b.isXMLDoc(bz);if(by){bx=b.propFix[bx]||bx;e=b.propHooks[bx]}if(bA!==L){if(e&&"set" in e&&(bw=e.set(bz,bA,bx))!==L){return bw}else{return(bz[bx]=bA)}}else{if(e&&"get" in e&&(bw=e.get(bz,bx))!==null){return bw}else{return bz[bx]}}},propHooks:{tabIndex:{get:function(bv){var e=bv.getAttributeNode("tabindex");return e&&e.specified?parseInt(e.value,10):D.test(bv.nodeName)||l.test(bv.nodeName)&&bv.href?0:L}}}});b.attrHooks.tabindex=b.propHooks.tabIndex;aY={get:function(bv,e){var bx,bw=b.prop(bv,e);return bw===true||typeof bw!=="boolean"&&(bx=bv.getAttributeNode(e))&&bx.nodeValue!==false?e.toLowerCase():L},set:function(bv,bx,e){var bw;if(bx===false){b.removeAttr(bv,e)}else{bw=b.propFix[e]||e;if(bw in bv){bv[bw]=true}bv.setAttribute(e,e.toLowerCase())}return e}};if(!F){aF={name:true,id:true};be=b.valHooks.button={get:function(bw,bv){var e;e=bw.getAttributeNode(bv);return e&&(aF[bv]?e.nodeValue!=="":e.specified)?e.nodeValue:L},set:function(bw,bx,bv){var e=bw.getAttributeNode(bv);if(!e){e=av.createAttribute(bv);bw.setAttributeNode(e)}return(e.nodeValue=bx+"")}};b.attrHooks.tabindex.set=be.set;b.each(["width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{set:function(bw,bx){if(bx===""){bw.setAttribute(e,"auto");return bx}}})});b.attrHooks.contenteditable={get:be.get,set:function(bv,bw,e){if(bw===""){bw="false"}be.set(bv,bw,e)}}}if(!b.support.hrefNormalized){b.each(["href","src","width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{get:function(bx){var bw=bx.getAttribute(e,2);return bw===null?L:bw}})})}if(!b.support.style){b.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||L},set:function(e,bv){return(e.style.cssText=""+bv)}}}if(!b.support.optSelected){b.propHooks.selected=b.extend(b.propHooks.selected,{get:function(bv){var e=bv.parentNode;if(e){e.selectedIndex;if(e.parentNode){e.parentNode.selectedIndex}}return null}})}if(!b.support.enctype){b.propFix.enctype="encoding"}if(!b.support.checkOn){b.each(["radio","checkbox"],function(){b.valHooks[this]={get:function(e){return e.getAttribute("value")===null?"on":e.value}}})}b.each(["radio","checkbox"],function(){b.valHooks[this]=b.extend(b.valHooks[this],{set:function(e,bv){if(b.isArray(bv)){return(e.checked=b.inArray(b(e).val(),bv)>=0)}}})});var bd=/^(?:textarea|input|select)$/i,n=/^([^\.]*)?(?:\.(.+))?$/,J=/\bhover(\.\S+)?\b/,aO=/^key/,bf=/^(?:mouse|contextmenu)|click/,T=/^(?:focusinfocus|focusoutblur)$/,U=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,Y=function(e){var bv=U.exec(e);if(bv){bv[1]=(bv[1]||"").toLowerCase();bv[3]=bv[3]&&new RegExp("(?:^|\\s)"+bv[3]+"(?:\\s|$)")}return bv},j=function(bw,e){var bv=bw.attributes||{};return((!e[1]||bw.nodeName.toLowerCase()===e[1])&&(!e[2]||(bv.id||{}).value===e[2])&&(!e[3]||e[3].test((bv["class"]||{}).value)))},bt=function(e){return b.event.special.hover?e:e.replace(J,"mouseenter$1 mouseleave$1")};b.event={add:function(bx,bC,bJ,bA,by){var bD,bB,bK,bI,bH,bF,e,bG,bv,bz,bw,bE;if(bx.nodeType===3||bx.nodeType===8||!bC||!bJ||!(bD=b._data(bx))){return}if(bJ.handler){bv=bJ;bJ=bv.handler}if(!bJ.guid){bJ.guid=b.guid++}bK=bD.events;if(!bK){bD.events=bK={}}bB=bD.handle;if(!bB){bD.handle=bB=function(bL){return typeof b!=="undefined"&&(!bL||b.event.triggered!==bL.type)?b.event.dispatch.apply(bB.elem,arguments):L};bB.elem=bx}bC=b.trim(bt(bC)).split(" ");for(bI=0;bI<bC.length;bI++){bH=n.exec(bC[bI])||[];bF=bH[1];e=(bH[2]||"").split(".").sort();bE=b.event.special[bF]||{};bF=(by?bE.delegateType:bE.bindType)||bF;bE=b.event.special[bF]||{};bG=b.extend({type:bF,origType:bH[1],data:bA,handler:bJ,guid:bJ.guid,selector:by,quick:Y(by),namespace:e.join(".")},bv);bw=bK[bF];if(!bw){bw=bK[bF]=[];bw.delegateCount=0;if(!bE.setup||bE.setup.call(bx,bA,e,bB)===false){if(bx.addEventListener){bx.addEventListener(bF,bB,false)}else{if(bx.attachEvent){bx.attachEvent("on"+bF,bB)}}}}if(bE.add){bE.add.call(bx,bG);if(!bG.handler.guid){bG.handler.guid=bJ.guid}}if(by){bw.splice(bw.delegateCount++,0,bG)}else{bw.push(bG)}b.event.global[bF]=true}bx=null},global:{},remove:function(bJ,bE,bv,bH,bB){var bI=b.hasData(bJ)&&b._data(bJ),bF,bx,bz,bL,bC,bA,bG,bw,by,bK,bD,e;if(!bI||!(bw=bI.events)){return}bE=b.trim(bt(bE||"")).split(" ");for(bF=0;bF<bE.length;bF++){bx=n.exec(bE[bF])||[];bz=bL=bx[1];bC=bx[2];if(!bz){for(bz in bw){b.event.remove(bJ,bz+bE[bF],bv,bH,true)}continue}by=b.event.special[bz]||{};bz=(bH?by.delegateType:by.bindType)||bz;bD=bw[bz]||[];bA=bD.length;bC=bC?new RegExp("(^|\\.)"+bC.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(bG=0;bG<bD.length;bG++){e=bD[bG];if((bB||bL===e.origType)&&(!bv||bv.guid===e.guid)&&(!bC||bC.test(e.namespace))&&(!bH||bH===e.selector||bH==="**"&&e.selector)){bD.splice(bG--,1);if(e.selector){bD.delegateCount--}if(by.remove){by.remove.call(bJ,e)}}}if(bD.length===0&&bA!==bD.length){if(!by.teardown||by.teardown.call(bJ,bC)===false){b.removeEvent(bJ,bz,bI.handle)}delete bw[bz]}}if(b.isEmptyObject(bw)){bK=bI.handle;if(bK){bK.elem=null}b.removeData(bJ,["events","handle"],true)}},customEvent:{getData:true,setData:true,changeData:true},trigger:function(bv,bD,bA,bJ){if(bA&&(bA.nodeType===3||bA.nodeType===8)){return}var bG=bv.type||bv,bx=[],e,bw,bC,bH,bz,by,bF,bE,bB,bI;if(T.test(bG+b.event.triggered)){return}if(bG.indexOf("!")>=0){bG=bG.slice(0,-1);bw=true}if(bG.indexOf(".")>=0){bx=bG.split(".");bG=bx.shift();bx.sort()}if((!bA||b.event.customEvent[bG])&&!b.event.global[bG]){return}bv=typeof bv==="object"?bv[b.expando]?bv:new b.Event(bG,bv):new b.Event(bG);bv.type=bG;bv.isTrigger=true;bv.exclusive=bw;bv.namespace=bx.join(".");bv.namespace_re=bv.namespace?new RegExp("(^|\\.)"+bx.join("\\.(?:.*\\.)?")+"(\\.|$)"):null;by=bG.indexOf(":")<0?"on"+bG:"";if(!bA){e=b.cache;for(bC in e){if(e[bC].events&&e[bC].events[bG]){b.event.trigger(bv,bD,e[bC].handle.elem,true)}}return}bv.result=L;if(!bv.target){bv.target=bA}bD=bD!=null?b.makeArray(bD):[];bD.unshift(bv);bF=b.event.special[bG]||{};if(bF.trigger&&bF.trigger.apply(bA,bD)===false){return}bB=[[bA,bF.bindType||bG]];if(!bJ&&!bF.noBubble&&!b.isWindow(bA)){bI=bF.delegateType||bG;bH=T.test(bI+bG)?bA:bA.parentNode;bz=null;for(;bH;bH=bH.parentNode){bB.push([bH,bI]);bz=bH}if(bz&&bz===bA.ownerDocument){bB.push([bz.defaultView||bz.parentWindow||bb,bI])}}for(bC=0;bC<bB.length&&!bv.isPropagationStopped();bC++){bH=bB[bC][0];bv.type=bB[bC][1];bE=(b._data(bH,"events")||{})[bv.type]&&b._data(bH,"handle");if(bE){bE.apply(bH,bD)}bE=by&&bH[by];if(bE&&b.acceptData(bH)&&bE.apply(bH,bD)===false){bv.preventDefault()}}bv.type=bG;if(!bJ&&!bv.isDefaultPrevented()){if((!bF._default||bF._default.apply(bA.ownerDocument,bD)===false)&&!(bG==="click"&&b.nodeName(bA,"a"))&&b.acceptData(bA)){if(by&&bA[bG]&&((bG!=="focus"&&bG!=="blur")||bv.target.offsetWidth!==0)&&!b.isWindow(bA)){bz=bA[by];if(bz){bA[by]=null}b.event.triggered=bG;bA[bG]();b.event.triggered=L;if(bz){bA[by]=bz}}}}return bv.result},dispatch:function(e){e=b.event.fix(e||bb.event);var bz=((b._data(this,"events")||{})[e.type]||[]),bA=bz.delegateCount,bG=[].slice.call(arguments,0),by=!e.exclusive&&!e.namespace,bH=[],bC,bB,bK,bx,bF,bE,bv,bD,bI,bw,bJ;bG[0]=e;e.delegateTarget=this;if(bA&&!e.target.disabled&&!(e.button&&e.type==="click")){bx=b(this);bx.context=this.ownerDocument||this;for(bK=e.target;bK!=this;bK=bK.parentNode||this){bE={};bD=[];bx[0]=bK;for(bC=0;bC<bA;bC++){bI=bz[bC];bw=bI.selector;if(bE[bw]===L){bE[bw]=(bI.quick?j(bK,bI.quick):bx.is(bw))}if(bE[bw]){bD.push(bI)}}if(bD.length){bH.push({elem:bK,matches:bD})}}}if(bz.length>bA){bH.push({elem:this,matches:bz.slice(bA)})}for(bC=0;bC<bH.length&&!e.isPropagationStopped();bC++){bv=bH[bC];e.currentTarget=bv.elem;for(bB=0;bB<bv.matches.length&&!e.isImmediatePropagationStopped();bB++){bI=bv.matches[bB];if(by||(!e.namespace&&!bI.namespace)||e.namespace_re&&e.namespace_re.test(bI.namespace)){e.data=bI.data;e.handleObj=bI;bF=((b.event.special[bI.origType]||{}).handle||bI.handler).apply(bv.elem,bG);if(bF!==L){e.result=bF;if(bF===false){e.preventDefault();e.stopPropagation()}}}}}return e.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(bv,e){if(bv.which==null){bv.which=e.charCode!=null?e.charCode:e.keyCode}return bv}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(bx,bw){var by,bz,e,bv=bw.button,bA=bw.fromElement;if(bx.pageX==null&&bw.clientX!=null){by=bx.target.ownerDocument||av;bz=by.documentElement;e=by.body;bx.pageX=bw.clientX+(bz&&bz.scrollLeft||e&&e.scrollLeft||0)-(bz&&bz.clientLeft||e&&e.clientLeft||0);bx.pageY=bw.clientY+(bz&&bz.scrollTop||e&&e.scrollTop||0)-(bz&&bz.clientTop||e&&e.clientTop||0)}if(!bx.relatedTarget&&bA){bx.relatedTarget=bA===bx.target?bw.toElement:bA}if(!bx.which&&bv!==L){bx.which=(bv&1?1:(bv&2?3:(bv&4?2:0)))}return bx}},fix:function(bw){if(bw[b.expando]){return bw}var bv,bz,e=bw,bx=b.event.fixHooks[bw.type]||{},by=bx.props?this.props.concat(bx.props):this.props;bw=b.Event(e);for(bv=by.length;bv;){bz=by[--bv];bw[bz]=e[bz]}if(!bw.target){bw.target=e.srcElement||av}if(bw.target.nodeType===3){bw.target=bw.target.parentNode}if(bw.metaKey===L){bw.metaKey=bw.ctrlKey}return bx.filter?bx.filter(bw,e):bw},special:{ready:{setup:b.bindReady},load:{noBubble:true},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(bw,bv,e){if(b.isWindow(this)){this.onbeforeunload=e}},teardown:function(bv,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}},simulate:function(bw,by,bx,bv){var bz=b.extend(new b.Event(),bx,{type:bw,isSimulated:true,originalEvent:{}});if(bv){b.event.trigger(bz,null,by)}else{b.event.dispatch.call(by,bz)}if(bz.isDefaultPrevented()){bx.preventDefault()}}};b.event.handle=b.event.dispatch;b.removeEvent=av.removeEventListener?function(bv,e,bw){if(bv.removeEventListener){bv.removeEventListener(e,bw,false)}}:function(bv,e,bw){if(bv.detachEvent){bv.detachEvent("on"+e,bw)}};b.Event=function(bv,e){if(!(this instanceof b.Event)){return new b.Event(bv,e)}if(bv&&bv.type){this.originalEvent=bv;this.type=bv.type;this.isDefaultPrevented=(bv.defaultPrevented||bv.returnValue===false||bv.getPreventDefault&&bv.getPreventDefault())?i:bk}else{this.type=bv}if(e){b.extend(this,e)}this.timeStamp=bv&&bv.timeStamp||b.now();this[b.expando]=true};function bk(){return false}function i(){return true}b.Event.prototype={preventDefault:function(){this.isDefaultPrevented=i;var bv=this.originalEvent;if(!bv){return}if(bv.preventDefault){bv.preventDefault()}else{bv.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=i;var bv=this.originalEvent;if(!bv){return}if(bv.stopPropagation){bv.stopPropagation()}bv.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=i;this.stopPropagation()},isDefaultPrevented:bk,isPropagationStopped:bk,isImmediatePropagationStopped:bk};b.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bv,e){b.event.special[bv]={delegateType:e,bindType:e,handle:function(bz){var bB=this,bA=bz.relatedTarget,by=bz.handleObj,bw=by.selector,bx;if(!bA||(bA!==bB&&!b.contains(bB,bA))){bz.type=by.origType;bx=by.handler.apply(this,arguments);bz.type=e}return bx}}});if(!b.support.submitBubbles){b.event.special.submit={setup:function(){if(b.nodeName(this,"form")){return false}b.event.add(this,"click._submit keypress._submit",function(bx){var bw=bx.target,bv=b.nodeName(bw,"input")||b.nodeName(bw,"button")?bw.form:L;if(bv&&!bv._submit_attached){b.event.add(bv,"submit._submit",function(e){if(this.parentNode&&!e.isTrigger){b.event.simulate("submit",this.parentNode,e,true)}});bv._submit_attached=true}})},teardown:function(){if(b.nodeName(this,"form")){return false}b.event.remove(this,"._submit")}}}if(!b.support.changeBubbles){b.event.special.change={setup:function(){if(bd.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio"){b.event.add(this,"propertychange._change",function(e){if(e.originalEvent.propertyName==="checked"){this._just_changed=true}});b.event.add(this,"click._change",function(e){if(this._just_changed&&!e.isTrigger){this._just_changed=false;b.event.simulate("change",this,e,true)}})}return false}b.event.add(this,"beforeactivate._change",function(bw){var bv=bw.target;if(bd.test(bv.nodeName)&&!bv._change_attached){b.event.add(bv,"change._change",function(e){if(this.parentNode&&!e.isSimulated&&!e.isTrigger){b.event.simulate("change",this.parentNode,e,true)}});bv._change_attached=true}})},handle:function(bv){var e=bv.target;if(this!==e||bv.isSimulated||bv.isTrigger||(e.type!=="radio"&&e.type!=="checkbox")){return bv.handleObj.handler.apply(this,arguments)}},teardown:function(){b.event.remove(this,"._change");return bd.test(this.nodeName)}}}if(!b.support.focusinBubbles){b.each({focus:"focusin",blur:"focusout"},function(bx,e){var bv=0,bw=function(by){b.event.simulate(e,by.target,b.event.fix(by),true)};b.event.special[e]={setup:function(){if(bv++===0){av.addEventListener(bx,bw,true)}},teardown:function(){if(--bv===0){av.removeEventListener(bx,bw,true)}}}})}b.fn.extend({on:function(bw,e,bz,by,bv){var bA,bx;if(typeof bw==="object"){if(typeof e!=="string"){bz=e;e=L}for(bx in bw){this.on(bx,e,bz,bw[bx],bv)}return this}if(bz==null&&by==null){by=e;bz=e=L}else{if(by==null){if(typeof e==="string"){by=bz;bz=L}else{by=bz;bz=e;e=L}}}if(by===false){by=bk}else{if(!by){return this}}if(bv===1){bA=by;by=function(bB){b().off(bB);return bA.apply(this,arguments)};by.guid=bA.guid||(bA.guid=b.guid++)}return this.each(function(){b.event.add(this,bw,by,bz,e)})},one:function(bv,e,bx,bw){return this.on.call(this,bv,e,bx,bw,1)},off:function(bw,e,by){if(bw&&bw.preventDefault&&bw.handleObj){var bv=bw.handleObj;b(bw.delegateTarget).off(bv.namespace?bv.type+"."+bv.namespace:bv.type,bv.selector,bv.handler);return this}if(typeof bw==="object"){for(var bx in bw){this.off(bx,e,bw[bx])}return this}if(e===false||typeof e==="function"){by=e;e=L}if(by===false){by=bk}return this.each(function(){b.event.remove(this,bw,by,e)})},bind:function(e,bw,bv){return this.on(e,null,bw,bv)},unbind:function(e,bv){return this.off(e,null,bv)},live:function(e,bw,bv){b(this.context).on(e,this.selector,bw,bv);return this},die:function(e,bv){b(this.context).off(e,this.selector||"**",bv);return this},delegate:function(e,bv,bx,bw){return this.on(bv,e,bx,bw)},undelegate:function(e,bv,bw){return arguments.length==1?this.off(e,"**"):this.off(bv,e,bw)},trigger:function(e,bv){return this.each(function(){b.event.trigger(e,bv,this)})},triggerHandler:function(e,bv){if(this[0]){return b.event.trigger(e,bv,this[0],true)}},toggle:function(bx){var bv=arguments,e=bx.guid||b.guid++,bw=0,by=function(bz){var bA=(b._data(this,"lastToggle"+bx.guid)||0)%bw;b._data(this,"lastToggle"+bx.guid,bA+1);bz.preventDefault();return bv[bA].apply(this,arguments)||false};by.guid=e;while(bw<bv.length){bv[bw++].guid=e}return this.click(by)},hover:function(e,bv){return this.mouseenter(e).mouseleave(bv||e)}});b.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu").split(" "),function(bv,e){b.fn[e]=function(bx,bw){if(bw==null){bw=bx;bx=null}return arguments.length>0?this.on(e,null,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}if(aO.test(e)){b.event.fixHooks[e]=b.event.keyHooks}if(bf.test(e)){b.event.fixHooks[e]=b.event.mouseHooks}}); +/*! + * Sizzle CSS Selector Engine + * Copyright 2011, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){var bH=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bC="sizcache"+(Math.random()+"").replace(".",""),bI=0,bL=Object.prototype.toString,bB=false,bA=true,bK=/\\/g,bO=/\r\n/g,bQ=/\W/;[0,0].sort(function(){bA=false;return 0});var by=function(bV,e,bY,bZ){bY=bY||[];e=e||av;var b1=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bV||typeof bV!=="string"){return bY}var bS,b3,b6,bR,b2,b5,b4,bX,bU=true,bT=by.isXML(e),bW=[],b0=bV;do{bH.exec("");bS=bH.exec(b0);if(bS){b0=bS[3];bW.push(bS[1]);if(bS[2]){bR=bS[3];break}}}while(bS);if(bW.length>1&&bD.exec(bV)){if(bW.length===2&&bE.relative[bW[0]]){b3=bM(bW[0]+bW[1],e,bZ)}else{b3=bE.relative[bW[0]]?[e]:by(bW.shift(),e);while(bW.length){bV=bW.shift();if(bE.relative[bV]){bV+=bW.shift()}b3=bM(bV,b3,bZ)}}}else{if(!bZ&&bW.length>1&&e.nodeType===9&&!bT&&bE.match.ID.test(bW[0])&&!bE.match.ID.test(bW[bW.length-1])){b2=by.find(bW.shift(),e,bT);e=b2.expr?by.filter(b2.expr,b2.set)[0]:b2.set[0]}if(e){b2=bZ?{expr:bW.pop(),set:bF(bZ)}:by.find(bW.pop(),bW.length===1&&(bW[0]==="~"||bW[0]==="+")&&e.parentNode?e.parentNode:e,bT);b3=b2.expr?by.filter(b2.expr,b2.set):b2.set;if(bW.length>0){b6=bF(b3)}else{bU=false}while(bW.length){b5=bW.pop();b4=b5;if(!bE.relative[b5]){b5=""}else{b4=bW.pop()}if(b4==null){b4=e}bE.relative[b5](b6,b4,bT)}}else{b6=bW=[]}}if(!b6){b6=b3}if(!b6){by.error(b5||bV)}if(bL.call(b6)==="[object Array]"){if(!bU){bY.push.apply(bY,b6)}else{if(e&&e.nodeType===1){for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&(b6[bX]===true||b6[bX].nodeType===1&&by.contains(e,b6[bX]))){bY.push(b3[bX])}}}else{for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&b6[bX].nodeType===1){bY.push(b3[bX])}}}}}else{bF(b6,bY)}if(bR){by(bR,b1,bY,bZ);by.uniqueSort(bY)}return bY};by.uniqueSort=function(bR){if(bJ){bB=bA;bR.sort(bJ);if(bB){for(var e=1;e<bR.length;e++){if(bR[e]===bR[e-1]){bR.splice(e--,1)}}}}return bR};by.matches=function(e,bR){return by(e,null,null,bR)};by.matchesSelector=function(e,bR){return by(bR,null,null,[e]).length>0};by.find=function(bX,e,bY){var bW,bS,bU,bT,bV,bR;if(!bX){return[]}for(bS=0,bU=bE.order.length;bS<bU;bS++){bV=bE.order[bS];if((bT=bE.leftMatch[bV].exec(bX))){bR=bT[1];bT.splice(1,1);if(bR.substr(bR.length-1)!=="\\"){bT[1]=(bT[1]||"").replace(bK,"");bW=bE.find[bV](bT,e,bY);if(bW!=null){bX=bX.replace(bE.match[bV],"");break}}}}if(!bW){bW=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bW,expr:bX}};by.filter=function(b1,b0,b4,bU){var bW,e,bZ,b6,b3,bR,bT,bV,b2,bS=b1,b5=[],bY=b0,bX=b0&&b0[0]&&by.isXML(b0[0]);while(b1&&b0.length){for(bZ in bE.filter){if((bW=bE.leftMatch[bZ].exec(b1))!=null&&bW[2]){bR=bE.filter[bZ];bT=bW[1];e=false;bW.splice(1,1);if(bT.substr(bT.length-1)==="\\"){continue}if(bY===b5){b5=[]}if(bE.preFilter[bZ]){bW=bE.preFilter[bZ](bW,bY,b4,b5,bU,bX);if(!bW){e=b6=true}else{if(bW===true){continue}}}if(bW){for(bV=0;(b3=bY[bV])!=null;bV++){if(b3){b6=bR(b3,bW,bV,bY);b2=bU^b6;if(b4&&b6!=null){if(b2){e=true}else{bY[bV]=false}}else{if(b2){b5.push(b3);e=true}}}}}if(b6!==L){if(!b4){bY=b5}b1=b1.replace(bE.match[bZ],"");if(!e){return[]}break}}}if(b1===bS){if(e==null){by.error(b1)}else{break}}bS=b1}return bY};by.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)};var bw=by.getText=function(bU){var bS,bT,e=bU.nodeType,bR="";if(e){if(e===1||e===9){if(typeof bU.textContent==="string"){return bU.textContent}else{if(typeof bU.innerText==="string"){return bU.innerText.replace(bO,"")}else{for(bU=bU.firstChild;bU;bU=bU.nextSibling){bR+=bw(bU)}}}}else{if(e===3||e===4){return bU.nodeValue}}}else{for(bS=0;(bT=bU[bS]);bS++){if(bT.nodeType!==8){bR+=bw(bT)}}}return bR};var bE=by.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bW,bR){var bT=typeof bR==="string",bV=bT&&!bQ.test(bR),bX=bT&&!bV;if(bV){bR=bR.toLowerCase()}for(var bS=0,e=bW.length,bU;bS<e;bS++){if((bU=bW[bS])){while((bU=bU.previousSibling)&&bU.nodeType!==1){}bW[bS]=bX||bU&&bU.nodeName.toLowerCase()===bR?bU||false:bU===bR}}if(bX){by.filter(bR,bW,true)}},">":function(bW,bR){var bV,bU=typeof bR==="string",bS=0,e=bW.length;if(bU&&!bQ.test(bR)){bR=bR.toLowerCase();for(;bS<e;bS++){bV=bW[bS];if(bV){var bT=bV.parentNode;bW[bS]=bT.nodeName.toLowerCase()===bR?bT:false}}}else{for(;bS<e;bS++){bV=bW[bS];if(bV){bW[bS]=bU?bV.parentNode:bV.parentNode===bR}}if(bU){by.filter(bR,bW,true)}}},"":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("parentNode",bR,bS,bT,bU,bV)},"~":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("previousSibling",bR,bS,bT,bU,bV)}},find:{ID:function(bR,bS,bT){if(typeof bS.getElementById!=="undefined"&&!bT){var e=bS.getElementById(bR[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bS,bV){if(typeof bV.getElementsByName!=="undefined"){var bR=[],bU=bV.getElementsByName(bS[1]);for(var bT=0,e=bU.length;bT<e;bT++){if(bU[bT].getAttribute("name")===bS[1]){bR.push(bU[bT])}}return bR.length===0?null:bR}},TAG:function(e,bR){if(typeof bR.getElementsByTagName!=="undefined"){return bR.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(bT,bR,bS,e,bW,bX){bT=" "+bT[1].replace(bK,"")+" ";if(bX){return bT}for(var bU=0,bV;(bV=bR[bU])!=null;bU++){if(bV){if(bW^(bV.className&&(" "+bV.className+" ").replace(/[\t\n\r]/g," ").indexOf(bT)>=0)){if(!bS){e.push(bV)}}else{if(bS){bR[bU]=false}}}}return false},ID:function(e){return e[1].replace(bK,"")},TAG:function(bR,e){return bR[1].replace(bK,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){by.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bR=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bR[1]+(bR[2]||1))-0;e[3]=bR[3]-0}else{if(e[2]){by.error(e[0])}}e[0]=bI++;return e},ATTR:function(bU,bR,bS,e,bV,bW){var bT=bU[1]=bU[1].replace(bK,"");if(!bW&&bE.attrMap[bT]){bU[1]=bE.attrMap[bT]}bU[4]=(bU[4]||bU[5]||"").replace(bK,"");if(bU[2]==="~="){bU[4]=" "+bU[4]+" "}return bU},PSEUDO:function(bU,bR,bS,e,bV){if(bU[1]==="not"){if((bH.exec(bU[3])||"").length>1||/^\w/.test(bU[3])){bU[3]=by(bU[3],null,null,bR)}else{var bT=by.filter(bU[3],bR,bS,true^bV);if(!bS){e.push.apply(e,bT)}return false}}else{if(bE.match.POS.test(bU[0])||bE.match.CHILD.test(bU[0])){return true}}return bU},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bS,bR,e){return !!by(e[3],bS).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bS){var e=bS.getAttribute("type"),bR=bS.type;return bS.nodeName.toLowerCase()==="input"&&"text"===bR&&(e===bR||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bR.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bR.type},button:function(bR){var e=bR.nodeName.toLowerCase();return e==="input"&&"button"===bR.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bR,e){return e===0},last:function(bS,bR,e,bT){return bR===bT.length-1},even:function(bR,e){return e%2===0},odd:function(bR,e){return e%2===1},lt:function(bS,bR,e){return bR<e[3]-0},gt:function(bS,bR,e){return bR>e[3]-0},nth:function(bS,bR,e){return e[3]-0===bR},eq:function(bS,bR,e){return e[3]-0===bR}},filter:{PSEUDO:function(bS,bX,bW,bY){var e=bX[1],bR=bE.filters[e];if(bR){return bR(bS,bW,bX,bY)}else{if(e==="contains"){return(bS.textContent||bS.innerText||bw([bS])||"").indexOf(bX[3])>=0}else{if(e==="not"){var bT=bX[3];for(var bV=0,bU=bT.length;bV<bU;bV++){if(bT[bV]===bS){return false}}return true}else{by.error(e)}}}},CHILD:function(bS,bU){var bT,b0,bW,bZ,e,bV,bY,bX=bU[1],bR=bS;switch(bX){case"only":case"first":while((bR=bR.previousSibling)){if(bR.nodeType===1){return false}}if(bX==="first"){return true}bR=bS;case"last":while((bR=bR.nextSibling)){if(bR.nodeType===1){return false}}return true;case"nth":bT=bU[2];b0=bU[3];if(bT===1&&b0===0){return true}bW=bU[0];bZ=bS.parentNode;if(bZ&&(bZ[bC]!==bW||!bS.nodeIndex)){bV=0;for(bR=bZ.firstChild;bR;bR=bR.nextSibling){if(bR.nodeType===1){bR.nodeIndex=++bV}}bZ[bC]=bW}bY=bS.nodeIndex-b0;if(bT===0){return bY===0}else{return(bY%bT===0&&bY/bT>=0)}}},ID:function(bR,e){return bR.nodeType===1&&bR.getAttribute("id")===e},TAG:function(bR,e){return(e==="*"&&bR.nodeType===1)||!!bR.nodeName&&bR.nodeName.toLowerCase()===e},CLASS:function(bR,e){return(" "+(bR.className||bR.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bV,bT){var bS=bT[1],e=by.attr?by.attr(bV,bS):bE.attrHandle[bS]?bE.attrHandle[bS](bV):bV[bS]!=null?bV[bS]:bV.getAttribute(bS),bW=e+"",bU=bT[2],bR=bT[4];return e==null?bU==="!=":!bU&&by.attr?e!=null:bU==="="?bW===bR:bU==="*="?bW.indexOf(bR)>=0:bU==="~="?(" "+bW+" ").indexOf(bR)>=0:!bR?bW&&e!==false:bU==="!="?bW!==bR:bU==="^="?bW.indexOf(bR)===0:bU==="$="?bW.substr(bW.length-bR.length)===bR:bU==="|="?bW===bR||bW.substr(0,bR.length+1)===bR+"-":false},POS:function(bU,bR,bS,bV){var e=bR[2],bT=bE.setFilters[e];if(bT){return bT(bU,bS,bR,bV)}}}};var bD=bE.match.POS,bx=function(bR,e){return"\\"+(e-0+1)};for(var bz in bE.match){bE.match[bz]=new RegExp(bE.match[bz].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bE.leftMatch[bz]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bE.match[bz].source.replace(/\\(\d+)/g,bx))}var bF=function(bR,e){bR=Array.prototype.slice.call(bR,0);if(e){e.push.apply(e,bR);return e}return bR};try{Array.prototype.slice.call(av.documentElement.childNodes,0)[0].nodeType}catch(bP){bF=function(bU,bT){var bS=0,bR=bT||[];if(bL.call(bU)==="[object Array]"){Array.prototype.push.apply(bR,bU)}else{if(typeof bU.length==="number"){for(var e=bU.length;bS<e;bS++){bR.push(bU[bS])}}else{for(;bU[bS];bS++){bR.push(bU[bS])}}}return bR}}var bJ,bG;if(av.documentElement.compareDocumentPosition){bJ=function(bR,e){if(bR===e){bB=true;return 0}if(!bR.compareDocumentPosition||!e.compareDocumentPosition){return bR.compareDocumentPosition?-1:1}return bR.compareDocumentPosition(e)&4?-1:1}}else{bJ=function(bY,bX){if(bY===bX){bB=true;return 0}else{if(bY.sourceIndex&&bX.sourceIndex){return bY.sourceIndex-bX.sourceIndex}}var bV,bR,bS=[],e=[],bU=bY.parentNode,bW=bX.parentNode,bZ=bU;if(bU===bW){return bG(bY,bX)}else{if(!bU){return -1}else{if(!bW){return 1}}}while(bZ){bS.unshift(bZ);bZ=bZ.parentNode}bZ=bW;while(bZ){e.unshift(bZ);bZ=bZ.parentNode}bV=bS.length;bR=e.length;for(var bT=0;bT<bV&&bT<bR;bT++){if(bS[bT]!==e[bT]){return bG(bS[bT],e[bT])}}return bT===bV?bG(bY,e[bT],-1):bG(bS[bT],bX,1)};bG=function(bR,e,bS){if(bR===e){return bS}var bT=bR.nextSibling;while(bT){if(bT===e){return -1}bT=bT.nextSibling}return 1}}(function(){var bR=av.createElement("div"),bS="script"+(new Date()).getTime(),e=av.documentElement;bR.innerHTML="<a name='"+bS+"'/>";e.insertBefore(bR,e.firstChild);if(av.getElementById(bS)){bE.find.ID=function(bU,bV,bW){if(typeof bV.getElementById!=="undefined"&&!bW){var bT=bV.getElementById(bU[1]);return bT?bT.id===bU[1]||typeof bT.getAttributeNode!=="undefined"&&bT.getAttributeNode("id").nodeValue===bU[1]?[bT]:L:[]}};bE.filter.ID=function(bV,bT){var bU=typeof bV.getAttributeNode!=="undefined"&&bV.getAttributeNode("id");return bV.nodeType===1&&bU&&bU.nodeValue===bT}}e.removeChild(bR);e=bR=null})();(function(){var e=av.createElement("div");e.appendChild(av.createComment(""));if(e.getElementsByTagName("*").length>0){bE.find.TAG=function(bR,bV){var bU=bV.getElementsByTagName(bR[1]);if(bR[1]==="*"){var bT=[];for(var bS=0;bU[bS];bS++){if(bU[bS].nodeType===1){bT.push(bU[bS])}}bU=bT}return bU}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bE.attrHandle.href=function(bR){return bR.getAttribute("href",2)}}e=null})();if(av.querySelectorAll){(function(){var e=by,bT=av.createElement("div"),bS="__sizzle__";bT.innerHTML="<p class='TEST'></p>";if(bT.querySelectorAll&&bT.querySelectorAll(".TEST").length===0){return}by=function(b4,bV,bZ,b3){bV=bV||av;if(!b3&&!by.isXML(bV)){var b2=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b4);if(b2&&(bV.nodeType===1||bV.nodeType===9)){if(b2[1]){return bF(bV.getElementsByTagName(b4),bZ)}else{if(b2[2]&&bE.find.CLASS&&bV.getElementsByClassName){return bF(bV.getElementsByClassName(b2[2]),bZ)}}}if(bV.nodeType===9){if(b4==="body"&&bV.body){return bF([bV.body],bZ)}else{if(b2&&b2[3]){var bY=bV.getElementById(b2[3]);if(bY&&bY.parentNode){if(bY.id===b2[3]){return bF([bY],bZ)}}else{return bF([],bZ)}}}try{return bF(bV.querySelectorAll(b4),bZ)}catch(b0){}}else{if(bV.nodeType===1&&bV.nodeName.toLowerCase()!=="object"){var bW=bV,bX=bV.getAttribute("id"),bU=bX||bS,b6=bV.parentNode,b5=/^\s*[+~]/.test(b4);if(!bX){bV.setAttribute("id",bU)}else{bU=bU.replace(/'/g,"\\$&")}if(b5&&b6){bV=bV.parentNode}try{if(!b5||b6){return bF(bV.querySelectorAll("[id='"+bU+"'] "+b4),bZ)}}catch(b1){}finally{if(!bX){bW.removeAttribute("id")}}}}}return e(b4,bV,bZ,b3)};for(var bR in e){by[bR]=e[bR]}bT=null})()}(function(){var e=av.documentElement,bS=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bS){var bU=!bS.call(av.createElement("div"),"div"),bR=false;try{bS.call(av.documentElement,"[test!='']:sizzle")}catch(bT){bR=true}by.matchesSelector=function(bW,bY){bY=bY.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!by.isXML(bW)){try{if(bR||!bE.match.PSEUDO.test(bY)&&!/!=/.test(bY)){var bV=bS.call(bW,bY);if(bV||!bU||bW.document&&bW.document.nodeType!==11){return bV}}}catch(bX){}}return by(bY,null,null,[bW]).length>0}}})();(function(){var e=av.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bE.order.splice(1,0,"CLASS");bE.find.CLASS=function(bR,bS,bT){if(typeof bS.getElementsByClassName!=="undefined"&&!bT){return bS.getElementsByClassName(bR[1])}};e=null})();function bv(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1&&!bY){e[bC]=bV;e.sizset=bT}if(e.nodeName.toLowerCase()===bW){bU=e;break}e=e[bR]}bZ[bT]=bU}}}function bN(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1){if(!bY){e[bC]=bV;e.sizset=bT}if(typeof bW!=="string"){if(e===bW){bU=true;break}}else{if(by.filter(bW,[e]).length>0){bU=e;break}}}e=e[bR]}bZ[bT]=bU}}}if(av.documentElement.contains){by.contains=function(bR,e){return bR!==e&&(bR.contains?bR.contains(e):true)}}else{if(av.documentElement.compareDocumentPosition){by.contains=function(bR,e){return !!(bR.compareDocumentPosition(e)&16)}}else{by.contains=function(){return false}}}by.isXML=function(e){var bR=(e?e.ownerDocument||e:0).documentElement;return bR?bR.nodeName!=="HTML":false};var bM=function(bS,e,bW){var bV,bX=[],bU="",bY=e.nodeType?[e]:e;while((bV=bE.match.PSEUDO.exec(bS))){bU+=bV[0];bS=bS.replace(bE.match.PSEUDO,"")}bS=bE.relative[bS]?bS+"*":bS;for(var bT=0,bR=bY.length;bT<bR;bT++){by(bS,bY[bT],bX,bW)}return by.filter(bU,bX)};by.attr=b.attr;by.selectors.attrMap={};b.find=by;b.expr=by.selectors;b.expr[":"]=b.expr.filters;b.unique=by.uniqueSort;b.text=by.getText;b.isXMLDoc=by.isXML;b.contains=by.contains})();var ab=/Until$/,aq=/^(?:parents|prevUntil|prevAll)/,a9=/,/,bp=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,H=b.expr.match.POS,ay={children:true,contents:true,next:true,prev:true};b.fn.extend({find:function(e){var bw=this,by,bv;if(typeof e!=="string"){return b(e).filter(function(){for(by=0,bv=bw.length;by<bv;by++){if(b.contains(bw[by],this)){return true}}})}var bx=this.pushStack("","find",e),bA,bB,bz;for(by=0,bv=this.length;by<bv;by++){bA=bx.length;b.find(e,this[by],bx);if(by>0){for(bB=bA;bB<bx.length;bB++){for(bz=0;bz<bA;bz++){if(bx[bz]===bx[bB]){bx.splice(bB--,1);break}}}}}return bx},has:function(bv){var e=b(bv);return this.filter(function(){for(var bx=0,bw=e.length;bx<bw;bx++){if(b.contains(this,e[bx])){return true}}})},not:function(e){return this.pushStack(aG(this,e,false),"not",e)},filter:function(e){return this.pushStack(aG(this,e,true),"filter",e)},is:function(e){return !!e&&(typeof e==="string"?H.test(e)?b(e,this.context).index(this[0])>=0:b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(by,bx){var bv=[],bw,e,bz=this[0];if(b.isArray(by)){var bB=1;while(bz&&bz.ownerDocument&&bz!==bx){for(bw=0;bw<by.length;bw++){if(b(bz).is(by[bw])){bv.push({selector:by[bw],elem:bz,level:bB})}}bz=bz.parentNode;bB++}return bv}var bA=H.test(by)||typeof by!=="string"?b(by,bx||this.context):0;for(bw=0,e=this.length;bw<e;bw++){bz=this[bw];while(bz){if(bA?bA.index(bz)>-1:b.find.matchesSelector(bz,by)){bv.push(bz);break}else{bz=bz.parentNode;if(!bz||!bz.ownerDocument||bz===bx||bz.nodeType===11){break}}}}bv=bv.length>1?b.unique(bv):bv;return this.pushStack(bv,"closest",by)},index:function(e){if(!e){return(this[0]&&this[0].parentNode)?this.prevAll().length:-1}if(typeof e==="string"){return b.inArray(this[0],b(e))}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(C(bx[0])||C(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function C(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling(e.parentNode.firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(by,bw){var bx=b.map(this,bv,by);if(!ab.test(e)){bw=by}if(bw&&typeof bw==="string"){bx=b.filter(bw,bx)}bx=this.length>1&&!ay[e]?b.unique(bx):bx;if((this.length>1||a9.test(bw))&&aq.test(e)){bx=bx.reverse()}return this.pushStack(bx,e,P.call(arguments).join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aG(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bp.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}function a(e){var bw=aR.split("|"),bv=e.createDocumentFragment();if(bv.createElement){while(bw.length){bv.createElement(bw.pop())}}return bv}var aR="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ag=/ jQuery\d+="(?:\d+|null)"/g,ar=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,w=/<tbody/i,W=/<|&#?\w+;/,ae=/<(?:script|style)/i,O=/<(?:script|object|embed|option|style)/i,ah=new RegExp("<(?:"+aR+")","i"),o=/checked\s*(?:[^=]|=\s*.checked.)/i,bm=/\/(java|ecma)script/i,aN=/^\s*<!(?:\[CDATA\[|\-\-)/,ax={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},ac=a(av);ax.optgroup=ax.option;ax.tbody=ax.tfoot=ax.colgroup=ax.caption=ax.thead;ax.th=ax.td;if(!b.support.htmlSerialize){ax._default=[1,"div<div>","</div>"]}b.fn.extend({text:function(e){if(b.isFunction(e)){return this.each(function(bw){var bv=b(this);bv.text(e.call(this,bw,bv.text()))})}if(typeof e!=="object"&&e!==L){return this.empty().append((this[0]&&this[0].ownerDocument||av).createTextNode(e))}return b.text(this)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){var bv=b.isFunction(e);return this.each(function(bw){b(this).wrapAll(bv?e.call(this,bw):e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b.clean(arguments);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b.clean(arguments));return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(bx){if(bx===L){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ag,""):null}else{if(typeof bx==="string"&&!ae.test(bx)&&(b.support.leadingWhitespace||!ar.test(bx))&&!ax[(d.exec(bx)||["",""])[1].toLowerCase()]){bx=bx.replace(R,"<$1></$2>");try{for(var bw=0,bv=this.length;bw<bv;bw++){if(this[bw].nodeType===1){b.cleanData(this[bw].getElementsByTagName("*"));this[bw].innerHTML=bx}}}catch(by){this.empty().append(bx)}}else{if(b.isFunction(bx)){this.each(function(bz){var e=b(this);e.html(bx.call(this,bz,e.html()))})}else{this.empty().append(bx)}}}return this},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(b.isFunction(e)){return this.each(function(bx){var bw=b(this),bv=bw.html();bw.replaceWith(e.call(this,bx,bv))})}if(typeof e!=="string"){e=b(e).detach()}return this.each(function(){var bw=this.nextSibling,bv=this.parentNode;b(this).remove();if(bw){b(bw).before(e)}else{b(bv).append(e)}})}else{return this.length?this.pushStack(b(b.isFunction(e)?e():e),"replaceWith",e):this}},detach:function(e){return this.remove(e,true)},domManip:function(bB,bF,bE){var bx,by,bA,bD,bC=bB[0],bv=[];if(!b.support.checkClone&&arguments.length===3&&typeof bC==="string"&&o.test(bC)){return this.each(function(){b(this).domManip(bB,bF,bE,true)})}if(b.isFunction(bC)){return this.each(function(bH){var bG=b(this);bB[0]=bC.call(this,bH,bF?bG.html():L);bG.domManip(bB,bF,bE)})}if(this[0]){bD=bC&&bC.parentNode;if(b.support.parentNode&&bD&&bD.nodeType===11&&bD.childNodes.length===this.length){bx={fragment:bD}}else{bx=b.buildFragment(bB,this,bv)}bA=bx.fragment;if(bA.childNodes.length===1){by=bA=bA.firstChild}else{by=bA.firstChild}if(by){bF=bF&&b.nodeName(by,"tr");for(var bw=0,e=this.length,bz=e-1;bw<e;bw++){bE.call(bF?ba(this[bw],by):this[bw],bx.cacheable||(e>1&&bw<bz)?b.clone(bA,true,true):bA)}}if(bv.length){b.each(bv,bo)}}return this}});function ba(e,bv){return b.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function t(bB,bv){if(bv.nodeType!==1||!b.hasData(bB)){return}var by,bx,e,bA=b._data(bB),bz=b._data(bv,bA),bw=bA.events;if(bw){delete bz.handle;bz.events={};for(by in bw){for(bx=0,e=bw[by].length;bx<e;bx++){b.event.add(bv,by+(bw[by][bx].namespace?".":"")+bw[by][bx].namespace,bw[by][bx],bw[by][bx].data)}}}if(bz.data){bz.data=b.extend({},bz.data)}}function ai(bv,e){var bw;if(e.nodeType!==1){return}if(e.clearAttributes){e.clearAttributes()}if(e.mergeAttributes){e.mergeAttributes(bv)}bw=e.nodeName.toLowerCase();if(bw==="object"){e.outerHTML=bv.outerHTML}else{if(bw==="input"&&(bv.type==="checkbox"||bv.type==="radio")){if(bv.checked){e.defaultChecked=e.checked=bv.checked}if(e.value!==bv.value){e.value=bv.value}}else{if(bw==="option"){e.selected=bv.defaultSelected}else{if(bw==="input"||bw==="textarea"){e.defaultValue=bv.defaultValue}}}}e.removeAttribute(b.expando)}b.buildFragment=function(bz,bx,bv){var by,e,bw,bA,bB=bz[0];if(bx&&bx[0]){bA=bx[0].ownerDocument||bx[0]}if(!bA.createDocumentFragment){bA=av}if(bz.length===1&&typeof bB==="string"&&bB.length<512&&bA===av&&bB.charAt(0)==="<"&&!O.test(bB)&&(b.support.checkClone||!o.test(bB))&&(b.support.html5Clone||!ah.test(bB))){e=true;bw=b.fragments[bB];if(bw&&bw!==1){by=bw}}if(!by){by=bA.createDocumentFragment();b.clean(bz,bA,by,bv)}if(e){b.fragments[bB]=bw?by:1}return{fragment:by,cacheable:e}};b.fragments={};b.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bv){b.fn[e]=function(bw){var bz=[],bC=b(bw),bB=this.length===1&&this[0].parentNode;if(bB&&bB.nodeType===11&&bB.childNodes.length===1&&bC.length===1){bC[bv](this[0]);return this}else{for(var bA=0,bx=bC.length;bA<bx;bA++){var by=(bA>0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bg(e){if(typeof e.getElementsByTagName!=="undefined"){return e.getElementsByTagName("*")}else{if(typeof e.querySelectorAll!=="undefined"){return e.querySelectorAll("*")}else{return[]}}}function az(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function E(e){var bv=(e.nodeName||"").toLowerCase();if(bv==="input"){az(e)}else{if(bv!=="script"&&typeof e.getElementsByTagName!=="undefined"){b.grep(e.getElementsByTagName("input"),az)}}}function al(e){var bv=av.createElement("div");ac.appendChild(bv);bv.innerHTML=e.outerHTML;return bv.firstChild}b.extend({clone:function(by,bA,bw){var e,bv,bx,bz=b.support.html5Clone||!ah.test("<"+by.nodeName)?by.cloneNode(true):al(by);if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){ai(by,bz);e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){if(bv[bx]){ai(e[bx],bv[bx])}}}if(bA){t(by,bz);if(bw){e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){t(e[bx],bv[bx])}}}e=bv=null;return bz},clean:function(bw,by,bH,bA){var bF;by=by||av;if(typeof by.createElement==="undefined"){by=by.ownerDocument||by[0]&&by[0].ownerDocument||av}var bI=[],bB;for(var bE=0,bz;(bz=bw[bE])!=null;bE++){if(typeof bz==="number"){bz+=""}if(!bz){continue}if(typeof bz==="string"){if(!W.test(bz)){bz=by.createTextNode(bz)}else{bz=bz.replace(R,"<$1></$2>");var bK=(d.exec(bz)||["",""])[1].toLowerCase(),bx=ax[bK]||ax._default,bD=bx[0],bv=by.createElement("div");if(by===av){ac.appendChild(bv)}else{a(by).appendChild(bv)}bv.innerHTML=bx[1]+bz+bx[2];while(bD--){bv=bv.lastChild}if(!b.support.tbody){var e=w.test(bz),bC=bK==="table"&&!e?bv.firstChild&&bv.firstChild.childNodes:bx[1]==="<table>"&&!e?bv.childNodes:[];for(bB=bC.length-1;bB>=0;--bB){if(b.nodeName(bC[bB],"tbody")&&!bC[bB].childNodes.length){bC[bB].parentNode.removeChild(bC[bB])}}}if(!b.support.leadingWhitespace&&ar.test(bz)){bv.insertBefore(by.createTextNode(ar.exec(bz)[0]),bv.firstChild)}bz=bv.childNodes}}var bG;if(!b.support.appendChecked){if(bz[0]&&typeof(bG=bz.length)==="number"){for(bB=0;bB<bG;bB++){E(bz[bB])}}else{E(bz)}}if(bz.nodeType){bI.push(bz)}else{bI=b.merge(bI,bz)}}if(bH){bF=function(bL){return !bL.type||bm.test(bL.type)};for(bE=0;bI[bE];bE++){if(bA&&b.nodeName(bI[bE],"script")&&(!bI[bE].type||bI[bE].type.toLowerCase()==="text/javascript")){bA.push(bI[bE].parentNode?bI[bE].parentNode.removeChild(bI[bE]):bI[bE])}else{if(bI[bE].nodeType===1){var bJ=b.grep(bI[bE].getElementsByTagName("script"),bF);bI.splice.apply(bI,[bE+1,0].concat(bJ))}bH.appendChild(bI[bE])}}}return bI},cleanData:function(bv){var by,bw,e=b.cache,bB=b.event.special,bA=b.support.deleteExpando;for(var bz=0,bx;(bx=bv[bz])!=null;bz++){if(bx.nodeName&&b.noData[bx.nodeName.toLowerCase()]){continue}bw=bx[b.expando];if(bw){by=e[bw];if(by&&by.events){for(var bC in by.events){if(bB[bC]){b.event.remove(bx,bC)}else{b.removeEvent(bx,bC,by.handle)}}if(by.handle){by.handle.elem=null}}if(bA){delete bx[b.expando]}else{if(bx.removeAttribute){bx.removeAttribute(b.expando)}}delete e[bw]}}}});function bo(e,bv){if(bv.src){b.ajax({url:bv.src,async:false,dataType:"script"})}else{b.globalEval((bv.text||bv.textContent||bv.innerHTML||"").replace(aN,"/*$0*/"))}if(bv.parentNode){bv.parentNode.removeChild(bv)}}var ak=/alpha\([^)]*\)/i,au=/opacity=([^)]*)/,z=/([A-Z]|^ms)/g,bc=/^-?\d+(?:px)?$/i,bn=/^-?\d/,I=/^([\-+])=([\-+.\de]+)/,a7={position:"absolute",visibility:"hidden",display:"block"},an=["Left","Right"],a1=["Top","Bottom"],Z,aI,aX;b.fn.css=function(e,bv){if(arguments.length===2&&bv===L){return this}return b.access(this,e,bv,true,function(bx,bw,by){return by!==L?b.style(bx,bw,by):b.css(bx,bw)})};b.extend({cssHooks:{opacity:{get:function(bw,bv){if(bv){var e=Z(bw,"opacity","opacity");return e===""?"1":e}else{return bw.style.opacity}}}},cssNumber:{fillOpacity:true,fontWeight:true,lineHeight:true,opacity:true,orphans:true,widows:true,zIndex:true,zoom:true},cssProps:{"float":b.support.cssFloat?"cssFloat":"styleFloat"},style:function(bx,bw,bD,by){if(!bx||bx.nodeType===3||bx.nodeType===8||!bx.style){return}var bB,bC,bz=b.camelCase(bw),bv=bx.style,bE=b.cssHooks[bz];bw=b.cssProps[bz]||bz;if(bD!==L){bC=typeof bD;if(bC==="string"&&(bB=I.exec(bD))){bD=(+(bB[1]+1)*+bB[2])+parseFloat(b.css(bx,bw));bC="number"}if(bD==null||bC==="number"&&isNaN(bD)){return}if(bC==="number"&&!b.cssNumber[bz]){bD+="px"}if(!bE||!("set" in bE)||(bD=bE.set(bx,bD))!==L){try{bv[bw]=bD}catch(bA){}}}else{if(bE&&"get" in bE&&(bB=bE.get(bx,false,by))!==L){return bB}return bv[bw]}},css:function(by,bx,bv){var bw,e;bx=b.camelCase(bx);e=b.cssHooks[bx];bx=b.cssProps[bx]||bx;if(bx==="cssFloat"){bx="float"}if(e&&"get" in e&&(bw=e.get(by,true,bv))!==L){return bw}else{if(Z){return Z(by,bx)}}},swap:function(bx,bw,by){var e={};for(var bv in bw){e[bv]=bx.style[bv];bx.style[bv]=bw[bv]}by.call(bx);for(bv in bw){bx.style[bv]=e[bv]}}});b.curCSS=b.css;b.each(["height","width"],function(bv,e){b.cssHooks[e]={get:function(by,bx,bw){var bz;if(bx){if(by.offsetWidth!==0){return p(by,e,bw)}else{b.swap(by,a7,function(){bz=p(by,e,bw)})}return bz}},set:function(bw,bx){if(bc.test(bx)){bx=parseFloat(bx);if(bx>=0){return bx+"px"}}else{return bx}}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return au.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle,e=b.isNumeric(bz)?"alpha(opacity="+bz*100+")":"",bw=bv&&bv.filter||bx.filter||"";bx.zoom=1;if(bz>=1&&b.trim(bw.replace(ak,""))===""){bx.removeAttribute("filter");if(bv&&!bv.filter){return}}bx.filter=ak.test(bw)?bw.replace(ak,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bw,bv){var e;b.swap(bw,{display:"inline-block"},function(){if(bv){e=Z(bw,"margin-right","marginRight")}else{e=bw.style.marginRight}});return e}}}});if(av.defaultView&&av.defaultView.getComputedStyle){aI=function(by,bw){var bv,bx,e;bw=bw.replace(z,"-$1").toLowerCase();if((bx=by.ownerDocument.defaultView)&&(e=bx.getComputedStyle(by,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(by.ownerDocument.documentElement,by)){bv=b.style(by,bw)}}return bv}}if(av.documentElement.currentStyle){aX=function(bz,bw){var bA,e,by,bv=bz.currentStyle&&bz.currentStyle[bw],bx=bz.style;if(bv===null&&bx&&(by=bx[bw])){bv=by}if(!bc.test(bv)&&bn.test(bv)){bA=bx.left;e=bz.runtimeStyle&&bz.runtimeStyle.left;if(e){bz.runtimeStyle.left=bz.currentStyle.left}bx.left=bw==="fontSize"?"1em":(bv||0);bv=bx.pixelLeft+"px";bx.left=bA;if(e){bz.runtimeStyle.left=e}}return bv===""?"auto":bv}}Z=aI||aX;function p(by,bw,bv){var bA=bw==="width"?by.offsetWidth:by.offsetHeight,bz=bw==="width"?an:a1,bx=0,e=bz.length;if(bA>0){if(bv!=="border"){for(;bx<e;bx++){if(!bv){bA-=parseFloat(b.css(by,"padding"+bz[bx]))||0}if(bv==="margin"){bA+=parseFloat(b.css(by,bv+bz[bx]))||0}else{bA-=parseFloat(b.css(by,"border"+bz[bx]+"Width"))||0}}}return bA+"px"}bA=Z(by,bw,bw);if(bA<0||bA==null){bA=by.style[bw]||0}bA=parseFloat(bA)||0;if(bv){for(;bx<e;bx++){bA+=parseFloat(b.css(by,"padding"+bz[bx]))||0;if(bv!=="padding"){bA+=parseFloat(b.css(by,"border"+bz[bx]+"Width"))||0}if(bv==="margin"){bA+=parseFloat(b.css(by,bv+bz[bx]))||0}}}return bA+"px"}if(b.expr&&b.expr.filters){b.expr.filters.hidden=function(bw){var bv=bw.offsetWidth,e=bw.offsetHeight;return(bv===0&&e===0)||(!b.support.reliableHiddenOffsets&&((bw.style&&bw.style.display)||b.css(bw,"display"))==="none")};b.expr.filters.visible=function(e){return !b.expr.filters.hidden(e)}}var k=/%20/g,ap=/\[\]$/,bs=/\r?\n/g,bq=/#.*$/,aD=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,aZ=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aM=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,aQ=/^(?:GET|HEAD)$/,c=/^\/\//,M=/\?/,a6=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,q=/^(?:select|textarea)/i,h=/\s+/,br=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,A=b.fn.load,aa={},r={},aE,s,aV=["*/"]+["*"];try{aE=bl.href}catch(aw){aE=av.createElement("a");aE.href="";aE=aE.href}s=K.exec(aE.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw<bz;bw++){bv=bx[bw];bC=/^\+/.test(bv);if(bC){bv=bv.substr(1)||"*"}bB=e[bv]=e[bv]||[];bB[bC?"unshift":"push"](bA)}}}}function aW(bv,bE,bz,bD,bB,bx){bB=bB||bE.dataTypes[0];bx=bx||{};bx[bB]=true;var bA=bv[bB],bw=0,e=bA?bA.length:0,by=(bv===aa),bC;for(;bw<e&&(by||!bC);bw++){bC=bA[bw](bE,bz,bD);if(typeof bC==="string"){if(!by||bx[bC]){bC=L}else{bE.dataTypes.unshift(bC);bC=aW(bv,bE,bz,bD,bC,bx)}}}if((by||!bC)&&!bx["*"]){bC=aW(bv,bE,bz,bD,"*",bx)}return bC}function am(bw,bx){var bv,e,by=b.ajaxSettings.flatOptions||{};for(bv in bx){if(bx[bv]!==L){(by[bv]?bw:(e||(e={})))[bv]=bx[bv]}}if(e){b.extend(true,bw,e)}}b.fn.extend({load:function(bw,bz,bA){if(typeof bw!=="string"&&A){return A.apply(this,arguments)}else{if(!this.length){return this}}var by=bw.indexOf(" ");if(by>=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("<div>").append(bD.replace(a6,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||q.test(this.nodeName)||aZ.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bs,"\r\n")}}):{name:bv.name,value:bw.replace(bs,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.on(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bv,e){if(e){am(bv,b.ajaxSettings)}else{e=bv;bv=b.ajaxSettings}am(bv,e);return bv},ajaxSettings:{url:aE,isLocal:aM.test(s[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":aV},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bb.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML},flatOptions:{context:true,url:true}},ajaxPrefilter:f(aa),ajaxTransport:f(r),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b.Callbacks("once memory"),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aD.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bZ,bU,b0,bW){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bW||"";bJ.readyState=bZ>0?4:0;var bT,b4,b3,bX=bU,bY=b0?bj(bD,bJ,b0):L,bV,b2;if(bZ>=200&&bZ<300||bZ===304){if(bD.ifModified){if((bV=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bV}if((b2=bJ.getResponseHeader("Etag"))){b.etag[bC]=b2}}if(bZ===304){bX="notmodified";bT=true}else{try{b4=G(bD,bY);bX="success";bT=true}catch(b1){bX="parsererror";b3=b1}}}else{b3=bX;if(!bX||bZ){bX="error";if(bZ<0){bZ=0}}}bJ.status=bZ;bJ.statusText=""+(bU||bX);if(bT){bR.resolveWith(bS,[b4,bX,bJ])}else{bR.rejectWith(bS,[bJ,bX,b3])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b4:b3])}bN.fireWith(bS,[bJ,bX]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.add;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(bq,"").replace(c,s[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=s[1]||bI[2]!=s[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(s[3]||(s[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aW(aa,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aQ.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data;delete bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(br,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", "+aV+"; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aW(r,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(bA<2){bF(-1,bM)}else{throw bM}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){v(bx,e[bx],bw,by)}}return bv.join("&").replace(k,"+")}});function v(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||ap.test(bw)){bx(bw,bz)}else{v(bw+"["+(typeof bz==="object"||b.isArray(bz)?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&by!=null&&typeof by==="object"){for(var e in by){v(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bj(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function G(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA<bw;bA++){if(bA===1){for(bE in bH.converters){if(typeof bE==="string"){bG[bE.toLowerCase()]=bH.converters[bE]}}}bx=bC;bC=bD[bA];if(bC==="*"){bC=bx}else{if(bx!=="*"&&bx!==bC){by=bx+" "+bC;bF=bG[by]||bG["* "+bC];if(!bF){e=L;for(bv in bG){bB=bv.split(" ");if(bB[0]===bx||bB[0]==="*"){e=bG[bB[1]+" "+bC];if(e){bv=bG[bv];if(bv===true){bF=e}else{if(e===true){bF=bv}}break}}}}if(!(bF||e)){b.error("No conversion from "+by.replace(" "," to "))}if(bF!==true){bz=bF?bF(bz):e(bv(bz))}}}}return bz}var aC=b.now(),u=/(\=)\?(&|$)|\?\?/i;b.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return b.expando+"_"+(aC++)}});b.ajaxPrefilter("json jsonp",function(bD,bA,bC){var bx=bD.contentType==="application/x-www-form-urlencoded"&&(typeof bD.data==="string");if(bD.dataTypes[0]==="jsonp"||bD.jsonp!==false&&(u.test(bD.url)||bx&&u.test(bD.data))){var bB,bw=bD.jsonpCallback=b.isFunction(bD.jsonpCallback)?bD.jsonpCallback():bD.jsonpCallback,bz=bb[bw],e=bD.url,by=bD.data,bv="$1"+bw+"$2";if(bD.jsonp!==false){e=e.replace(u,bv);if(bD.url===e){if(bx){by=by.replace(u,bv)}if(bD.data===by){e+=(/\?/.test(e)?"&":"?")+bD.jsonp+"="+bw}}}bD.url=e;bD.data=by;bb[bw]=function(bE){bB=[bE]};bC.always(function(){bb[bw]=bz;if(bB&&b.isFunction(bz)){bb[bw](bB[0])}});bD.converters["script json"]=function(){if(!bB){b.error(bw+" was not called")}return bB[0]};bD.dataTypes[0]="json";return"script"}});b.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){b.globalEval(e);return e}}});b.ajaxPrefilter("script",function(e){if(e.cache===L){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});b.ajaxTransport("script",function(bw){if(bw.crossDomain){var e,bv=av.head||av.getElementsByTagName("head")[0]||av.documentElement;return{send:function(bx,by){e=av.createElement("script");e.async="async";if(bw.scriptCharset){e.charset=bw.scriptCharset}e.src=bw.url;e.onload=e.onreadystatechange=function(bA,bz){if(bz||!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bv&&e.parentNode){bv.removeChild(e)}e=L;if(!bz){by(200,"success")}}};bv.insertBefore(e,bv.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var B=bb.ActiveXObject?function(){for(var e in N){N[e](0,1)}}:false,y=0,N;function aL(){try{return new bb.XMLHttpRequest()}catch(bv){}}function aj(){try{return new bb.ActiveXObject("Microsoft.XMLHTTP")}catch(bv){}}b.ajaxSettings.xhr=bb.ActiveXObject?function(){return !this.isLocal&&aL()||aj()}:aL;(function(e){b.extend(b.support,{ajax:!!e,cors:!!e&&("withCredentials" in e)})})(b.ajaxSettings.xhr());if(b.support.ajax){b.ajaxTransport(function(e){if(!e.crossDomain||b.support.cors){var bv;return{send:function(bB,bw){var bA=e.xhr(),bz,by;if(e.username){bA.open(e.type,e.url,e.async,e.username,e.password)}else{bA.open(e.type,e.url,e.async)}if(e.xhrFields){for(by in e.xhrFields){bA[by]=e.xhrFields[by]}}if(e.mimeType&&bA.overrideMimeType){bA.overrideMimeType(e.mimeType)}if(!e.crossDomain&&!bB["X-Requested-With"]){bB["X-Requested-With"]="XMLHttpRequest"}try{for(by in bB){bA.setRequestHeader(by,bB[by])}}catch(bx){}bA.send((e.hasContent&&e.data)||null);bv=function(bK,bE){var bF,bD,bC,bI,bH;try{if(bv&&(bE||bA.readyState===4)){bv=L;if(bz){bA.onreadystatechange=b.noop;if(B){delete N[bz]}}if(bE){if(bA.readyState!==4){bA.abort()}}else{bF=bA.status;bC=bA.getAllResponseHeaders();bI={};bH=bA.responseXML;if(bH&&bH.documentElement){bI.xml=bH}bI.text=bA.responseText;try{bD=bA.statusText}catch(bJ){bD=""}if(!bF&&e.isLocal&&!e.crossDomain){bF=bI.text?200:404}else{if(bF===1223){bF=204}}}}}catch(bG){if(!bE){bw(-1,bG)}}if(bI){bw(bF,bD,bI,bC)}};if(!e.async||bA.readyState===4){bv()}else{bz=++y;if(B){if(!N){N={};b(bb).unload(B)}N[bz]=bv}bA.onreadystatechange=bv}},abort:function(){if(bv){bv(0,1)}}}}})}var Q={},a8,m,aB=/^(?:toggle|show|hide)$/,aT=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,a3,aH=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],a4;b.fn.extend({show:function(bx,bA,bz){var bw,by;if(bx||bx===0){return this.animate(a0("show",3),bx,bA,bz)}else{for(var bv=0,e=this.length;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(!b._data(bw,"olddisplay")&&by==="none"){by=bw.style.display=""}if(by===""&&b.css(bw,"display")==="none"){b._data(bw,"olddisplay",x(bw.nodeName))}}}for(bv=0;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(by===""||by==="none"){bw.style.display=b._data(bw,"olddisplay")||""}}}return this}},hide:function(bx,bA,bz){if(bx||bx===0){return this.animate(a0("hide",3),bx,bA,bz)}else{var bw,by,bv=0,e=this.length;for(;bv<e;bv++){bw=this[bv];if(bw.style){by=b.css(bw,"display");if(by!=="none"&&!b._data(bw,"olddisplay")){b._data(bw,"olddisplay",by)}}}for(bv=0;bv<e;bv++){if(this[bv].style){this[bv].style.display="none"}}return this}},_toggle:b.fn.toggle,toggle:function(bw,bv,bx){var e=typeof bw==="boolean";if(b.isFunction(bw)&&b.isFunction(bv)){this._toggle.apply(this,arguments)}else{if(bw==null||e){this.each(function(){var by=e?bw:b(this).is(":hidden");b(this)[by?"show":"hide"]()})}else{this.animate(a0("toggle",3),bw,bv,bx)}}return this},fadeTo:function(e,bx,bw,bv){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bx},e,bw,bv)},animate:function(bz,bw,by,bx){var e=b.speed(bw,by,bx);if(b.isEmptyObject(bz)){return this.each(e.complete,[false])}bz=b.extend({},bz);function bv(){if(e.queue===false){b._mark(this)}var bE=b.extend({},e),bK=this.nodeType===1,bI=bK&&b(this).is(":hidden"),bB,bF,bD,bJ,bH,bC,bG,bL,bA;bE.animatedProperties={};for(bD in bz){bB=b.camelCase(bD);if(bD!==bB){bz[bB]=bz[bD];delete bz[bD]}bF=bz[bB];if(b.isArray(bF)){bE.animatedProperties[bB]=bF[1];bF=bz[bB]=bF[0]}else{bE.animatedProperties[bB]=bE.specialEasing&&bE.specialEasing[bB]||bE.easing||"swing"}if(bF==="hide"&&bI||bF==="show"&&!bI){return bE.complete.call(this)}if(bK&&(bB==="height"||bB==="width")){bE.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(b.css(this,"display")==="inline"&&b.css(this,"float")==="none"){if(!b.support.inlineBlockNeedsLayout||x(this.nodeName)==="inline"){this.style.display="inline-block"}else{this.style.zoom=1}}}}if(bE.overflow!=null){this.style.overflow="hidden"}for(bD in bz){bJ=new b.fx(this,bE,bD);bF=bz[bD];if(aB.test(bF)){bA=b._data(this,"toggle"+bD)||(bF==="toggle"?bI?"show":"hide":0);if(bA){b._data(this,"toggle"+bD,bA==="show"?"hide":"show");bJ[bA]()}else{bJ[bF]()}}else{bH=aT.exec(bF);bC=bJ.cur();if(bH){bG=parseFloat(bH[2]);bL=bH[3]||(b.cssNumber[bD]?"":"px");if(bL!=="px"){b.style(this,bD,(bG||1)+bL);bC=((bG||1)/bJ.cur())*bC;b.style(this,bD,bC+bL)}if(bH[1]){bG=((bH[1]==="-="?-1:1)*bG)+bC}bJ.custom(bC,bG,bL)}else{bJ.custom(bC,bF,"")}}}return true}return e.queue===false?this.each(bv):this.queue(e.queue,bv)},stop:function(bw,bv,e){if(typeof bw!=="string"){e=bv;bv=bw;bw=L}if(bv&&bw!==false){this.queue(bw||"fx",[])}return this.each(function(){var bx,by=false,bA=b.timers,bz=b._data(this);if(!e){b._unmark(true,this)}function bB(bE,bF,bD){var bC=bF[bD];b.removeData(bE,bD,true);bC.stop(e)}if(bw==null){for(bx in bz){if(bz[bx]&&bz[bx].stop&&bx.indexOf(".run")===bx.length-4){bB(this,bz,bx)}}}else{if(bz[bx=bw+".run"]&&bz[bx].stop){bB(this,bz,bx)}}for(bx=bA.length;bx--;){if(bA[bx].elem===this&&(bw==null||bA[bx].queue===bw)){if(e){bA[bx](true)}else{bA[bx].saveState()}by=true;bA.splice(bx,1)}}if(!(e&&by)){b.dequeue(this,bw)}})}});function bh(){setTimeout(at,0);return(a4=b.now())}function at(){a4=L}function a0(bv,e){var bw={};b.each(aH.concat.apply([],aH.slice(0,e)),function(){bw[this]=bv});return bw}b.each({slideDown:a0("show",1),slideUp:a0("hide",1),slideToggle:a0("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bv){b.fn[e]=function(bw,by,bx){return this.animate(bv,bw,by,bx)}});b.extend({speed:function(bw,bx,bv){var e=bw&&typeof bw==="object"?b.extend({},bw):{complete:bv||!bv&&bx||b.isFunction(bw)&&bw,duration:bw,easing:bv&&bx||bx&&!b.isFunction(bx)&&bx};e.duration=b.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in b.fx.speeds?b.fx.speeds[e.duration]:b.fx.speeds._default;if(e.queue==null||e.queue===true){e.queue="fx"}e.old=e.complete;e.complete=function(by){if(b.isFunction(e.old)){e.old.call(this)}if(e.queue){b.dequeue(this,e.queue)}else{if(by!==false){b._unmark(this)}}};return e},easing:{linear:function(bw,bx,e,bv){return e+bv*bw},swing:function(bw,bx,e,bv){return((-Math.cos(bw*Math.PI)/2)+0.5)*bv+e}},timers:[],fx:function(bv,e,bw){this.options=e;this.elem=bv;this.prop=bw;e.orig=e.orig||{}}});b.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(b.fx.step[this.prop]||b.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bv=b.css(this.elem,this.prop);return isNaN(e=parseFloat(bv))?!bv||bv==="auto"?0:bv:e},custom:function(bz,by,bx){var e=this,bw=b.fx;this.startTime=a4||bh();this.end=by;this.now=this.start=bz;this.pos=this.state=0;this.unit=bx||this.unit||(b.cssNumber[this.prop]?"":"px");function bv(bA){return e.step(bA)}bv.queue=this.options.queue;bv.elem=this.elem;bv.saveState=function(){if(e.options.hide&&b._data(e.elem,"fxshow"+e.prop)===L){b._data(e.elem,"fxshow"+e.prop,e.start)}};if(bv()&&b.timers.push(bv)&&!a3){a3=setInterval(bw.tick,bw.interval)}},show:function(){var e=b._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=e||b.style(this.elem,this.prop);this.options.show=true;if(e!==L){this.custom(this.cur(),e)}else{this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur())}b(this.elem).show()},hide:function(){this.options.orig[this.prop]=b._data(this.elem,"fxshow"+this.prop)||b.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(by){var bA,bB,bv,bx=a4||bh(),e=true,bz=this.elem,bw=this.options;if(by||bx>=bw.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bw.animatedProperties[this.prop]=true;for(bA in bw.animatedProperties){if(bw.animatedProperties[bA]!==true){e=false}}if(e){if(bw.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bw.overflow[bC]})}if(bw.hide){b(bz).hide()}if(bw.hide||bw.show){for(bA in bw.animatedProperties){b.style(bz,bA,bw.orig[bA]);b.removeData(bz,"fxshow"+bA,true);b.removeData(bz,"toggle"+bA,true)}}bv=bw.complete;if(bv){bw.complete=false;bv.call(bz)}}return false}else{if(bw.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bw.duration;this.pos=b.easing[bw.animatedProperties[this.prop]](this.state,bB,0,1,bw.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){var bw,bv=b.timers,e=0;for(;e<bv.length;e++){bw=bv[e];if(!bw()&&bv[e]===bw){bv.splice(e--,1)}}if(!bv.length){b.fx.stop()}},interval:13,stop:function(){clearInterval(a3);a3=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){b.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=e.now+e.unit}else{e.elem[e.prop]=e.now}}}});b.each(["width","height"],function(e,bv){b.fx.step[bv]=function(bw){b.style(bw.elem,bv,Math.max(0,bw.now)+bw.unit)}});if(b.expr&&b.expr.filters){b.expr.filters.animated=function(e){return b.grep(b.timers,function(bv){return e===bv.elem}).length}}function x(bx){if(!Q[bx]){var e=av.body,bv=b("<"+bx+">").appendTo(e),bw=bv.css("display");bv.remove();if(bw==="none"||bw===""){if(!a8){a8=av.createElement("iframe");a8.frameBorder=a8.width=a8.height=0}e.appendChild(a8);if(!m||!a8.createElement){m=(a8.contentWindow||a8.contentDocument).document;m.write((av.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>");m.close()}bv=m.createElement(bx);m.body.appendChild(bv);bw=b.css(bv,"display");e.removeChild(a8)}Q[bx]=bw}return Q[bx]}var V=/^t(?:able|d|h)$/i,ad=/^(?:body|html)$/i;if("getBoundingClientRect" in av.documentElement){b.fn.offset=function(bI){var by=this[0],bB;if(bI){return this.each(function(e){b.offset.setOffset(this,bI,e)})}if(!by||!by.ownerDocument){return null}if(by===by.ownerDocument.body){return b.offset.bodyOffset(by)}try{bB=by.getBoundingClientRect()}catch(bF){}var bH=by.ownerDocument,bw=bH.documentElement;if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aK(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{b.fn.offset=function(bF){var bz=this[0];if(bF){return this.each(function(bG){b.offset.setOffset(this,bF,bG)})}if(!bz||!bz.ownerDocument){return null}if(bz===bz.ownerDocument.body){return b.offset.bodyOffset(bz)}var bC,bw=bz.offsetParent,bv=bz,bE=bz.ownerDocument,bx=bE.documentElement,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.support.fixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.support.doesNotAddBorder&&!(b.support.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.support.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.support.fixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.offset={bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;if(b.support.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ad.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||av.body;while(e&&(!ad.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each(["Left","Top"],function(bv,e){var bw="scroll"+e;b.fn[bw]=function(bz){var bx,by;if(bz===L){bx=this[0];if(!bx){return null}by=aK(bx);return by?("pageXOffset" in by)?by[bv?"pageYOffset":"pageXOffset"]:b.support.boxModel&&by.document.documentElement[bw]||by.document.body[bw]:bx[bw]}return this.each(function(){by=aK(this);if(by){by.scrollTo(!bv?bz:b(by).scrollLeft(),bv?bz:b(by).scrollTop())}else{this[bw]=bz}})}});function aK(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each(["Height","Width"],function(bv,e){var bw=e.toLowerCase();b.fn["inner"+e]=function(){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,"padding")):this[bw]():null};b.fn["outer"+e]=function(by){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,by?"margin":"border")):this[bw]():null};b.fn[bw]=function(bz){var bA=this[0];if(!bA){return bz==null?null:this}if(b.isFunction(bz)){return this.each(function(bE){var bD=b(this);bD[bw](bz.call(this,bE,bD[bw]()))})}if(b.isWindow(bA)){var bB=bA.document.documentElement["client"+e],bx=bA.document.body;return bA.document.compatMode==="CSS1Compat"&&bB||bx&&bx["client"+e]||bB}else{if(bA.nodeType===9){return Math.max(bA.documentElement["client"+e],bA.body["scroll"+e],bA.documentElement["scroll"+e],bA.body["offset"+e],bA.documentElement["offset"+e])}else{if(bz===L){var bC=b.css(bA,bw),by=parseFloat(bC);return b.isNumeric(by)?by:bC}else{return this.css(bw,typeof bz==="string"?bz:bz+"px")}}}}});bb.jQuery=bb.$=b;if(typeof define==="function"&&define.amd&&define.amd.jQuery){define("jquery",[],function(){return b})}})(window);/*! + * jQuery UI 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(a,d){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.18",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(e,f){return typeof e==="number"?this.each(function(){var g=this;setTimeout(function(){a(g).focus();if(f){f.call(g)}},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var e;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){e=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{e=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!e.length?a(document):e},zIndex:function(h){if(h!==d){return this.css("zIndex",h)}if(this.length){var f=a(this[0]),e,g;while(f.length&&f[0]!==document){e=f.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0){return g}}f=f.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){var f=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),k={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function j(m,l,i,n){a.each(f,function(){l-=parseFloat(a.curCSS(m,"padding"+this,true))||0;if(i){l-=parseFloat(a.curCSS(m,"border"+this+"Width",true))||0}if(n){l-=parseFloat(a.curCSS(m,"margin"+this,true))||0}});return l}a.fn["inner"+e]=function(i){if(i===d){return k["inner"+e].call(this)}return this.each(function(){a(this).css(h,j(this,i)+"px")})};a.fn["outer"+e]=function(i,l){if(typeof i!=="number"){return k["outer"+e].call(this,i)}return this.each(function(){a(this).css(h,j(this,i,true,l)+"px")})}});function c(g,e){var j=g.nodeName.toLowerCase();if("area"===j){var i=g.parentNode,h=i.name,f;if(!g.href||!h||i.nodeName.toLowerCase()!=="map"){return false}f=a("img[usemap=#"+h+"]")[0];return !!f&&b(f)}return(/input|select|textarea|button|object/.test(j)?!g.disabled:"a"==j?g.href||e:e)&&b(g)}function b(e){return !a(e).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(g,f,e){return !!a.data(g,e[3])},focusable:function(e){return c(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),f=isNaN(e);return(f||e>=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));f.offsetHeight;a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h<j.length;h++){if(e.options[j[h][0]]){j[h][1].apply(e.element,f)}}}},contains:function(f,e){return document.compareDocumentPosition?f.compareDocumentPosition(e)&16:f!==e&&f.contains(e)},hasScroll:function(h,f){if(a(h).css("overflow")==="hidden"){return false}var e=(f&&f==="left")?"scrollLeft":"scrollTop",g=false;if(h[e]>0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);/*! + * jQuery UI Widget 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(f){for(var g=0,h;(h=f[g])!=null;g++){try{b(h).triggerHandler("remove")}catch(j){}}c(f)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(g){}})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,f,g){var j,i,h=this.options[e];g=g||{};f=b.Event(f);f.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();f.target=this.element[0];i=f.originalEvent;if(i){for(j in i){if(!(j in f)){f[j]=i[j]}}}this.element.trigger(f,g);return !(b.isFunction(h)&&h.call(this.element[0],f,g)===false||f.isDefaultPrevented())}}})(jQuery);/*! + * jQuery UI Mouse 1.8.18 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function(b,c){var a=false;b(document).mouseup(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"&&f.target.nodeName?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g<l.length;g++){var j=c.trim(l[g]),e="ui-resizable-"+j;var h=c('<div class="ui-resizable-handle '+e+'"></div>');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(h<e.maxWidth){e.maxWidth=h}if(k<e.maxHeight){e.maxHeight=k}}this._vBoundaries=e},_updateCache:function(e){var f=this.options;this.offset=this.helper.offset();if(a(e.left)){this.position.left=e.left}if(a(e.top)){this.position.top=e.top}if(a(e.height)){this.size.height=e.height}if(a(e.width)){this.size.width=e.width}},_updateRatio:function(h,g){var i=this.options,j=this.position,f=this.size,e=this.axis;if(a(h.height)){h.width=(h.height*this.aspectRatio)}else{if(a(h.width)){h.height=(h.width/this.aspectRatio)}}if(e=="sw"){h.left=j.left+(f.width-h.width);h.top=null}if(e=="nw"){h.top=j.top+(f.height-h.height);h.left=j.left+(f.width-h.width)}return h},_respectSize:function(l,g){var j=this.helper,i=this._vBoundaries,r=this._aspectRatio||g.shiftKey,q=this.axis,t=a(l.width)&&i.maxWidth&&(i.maxWidth<l.width),m=a(l.height)&&i.maxHeight&&(i.maxHeight<l.height),h=a(l.width)&&i.minWidth&&(i.minWidth>l.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(t){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(t&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f<this._proportionallyResizeElements.length;f++){var h=this._proportionallyResizeElements[f];if(!this.borderDif){var e=[h.css("borderTopWidth"),h.css("borderRightWidth"),h.css("borderBottomWidth"),h.css("borderLeftWidth")],j=[h.css("paddingTop"),h.css("paddingRight"),h.css("paddingBottom"),h.css("paddingLeft")];this.borderDif=c.map(e,function(l,n){var m=parseInt(l,10)||0,o=parseInt(j[n],10)||0;return m+o})}if(c.browser.msie&&!(!(c(g).is(":hidden")||c(g).parents(":hidden").length))){continue}h.css({height:(g.height()-this.borderDif[0]-this.borderDif[2])||0,width:(g.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var f=this.element,i=this.options;this.elementOffset=f.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.18"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10)})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,u){var t=(r[u]||0)+(k[u]||0);if(t&&t>=0){p[u]=t||null}});q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(e,f){c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var t=c(this).data("resizable"),j=t.options,l=t.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}t.containerElement=c(k);if(/document/.test(g)||g==document){t.containerOffset={left:0,top:0};t.containerPosition={left:0,top:0};t.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});t.containerOffset=n.offset();t.containerPosition=n.position();t.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=t.containerOffset,e=t.containerSize.height,m=t.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);t.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var t=c(this).data("resizable"),i=t.options,f=t.containerSize,p=t.containerOffset,m=t.size,n=t.position,r=t._aspectRatio||g.shiftKey,e={top:0,left:0},h=t.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(t._helper?p.left:0)){t.size.width=t.size.width+(t._helper?(t.position.left-p.left):(t.position.left-e.left));if(r){t.size.height=t.size.width/i.aspectRatio}t.position.left=i.helper?p.left:0}if(n.top<(t._helper?p.top:0)){t.size.height=t.size.height+(t._helper?(t.position.top-p.top):t.position.top);if(r){t.size.width=t.size.height*i.aspectRatio}t.position.top=t._helper?p.top:0}t.offset.left=t.parentData.left+t.position.left;t.offset.top=t.parentData.top+t.position.top;var l=Math.abs((t._helper?t.offset.left-e.left:(t.offset.left-e.left))+t.sizeDiff.width),s=Math.abs((t._helper?t.offset.top-e.top:(t.offset.top-p.top))+t.sizeDiff.height);var k=t.containerElement.get(0)==t.element.parent().get(0),j=/relative|absolute/.test(t.containerElement.css("position"));if(k&&j){l-=t.parentData.left}if(l+t.size.width>=t.parentData.width){t.size.width=t.parentData.width-l;if(r){t.size.height=t.size.width/t.aspectRatio}}if(s+t.size.height>=t.parentData.height){t.size.height=t.parentData.height-s;if(r){t.size.width=t.size.height*t.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);/*! + * jQuery hashchange event - v1.3 - 7/21/2010 + * http://benalman.com/projects/jquery-hashchange-plugin/ + * + * Copyright (c) 2010 "Cowboy" Ben Alman + * Dual licensed under the MIT and GPL licenses. + * http://benalman.com/about/license/ + */ +(function($,e,b){var c="hashchange",h=document,f,g=$.event.special,i=h.documentMode,d="on"+c in e&&(i===b||i>7);function a(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}$.fn[c]=function(j){return j?this.bind(c,j):this.trigger(c)};$.fn[c].delay=50;g[c]=$.extend(g[c],{setup:function(){if(d){return false}$(f.start)},teardown:function(){if(d){return false}$(f.stop)}});f=(function(){var j={},p,m=a(),k=function(q){return q},l=k,o=k;j.start=function(){p||n()};j.stop=function(){p&&clearTimeout(p);p=b};function n(){var r=a(),q=o(m);if(r!==m){l(m=r,q);$(e).trigger(c)}else{if(q!==m){location.href=location.href.replace(/#.*/,"")+q}}p=setTimeout(n,$.fn[c].delay)}$.browser.msie&&!d&&(function(){var q,r;j.start=function(){if(!q){r=$.fn[c].src;r=r&&r+a();q=$('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){r||l(a());n()}).attr("src",r||"javascript:0").insertAfter("body")[0].contentWindow;h.onpropertychange=function(){try{if(event.propertyName==="title"){q.document.title=h.title}}catch(s){}}}};j.stop=k;o=function(){return a(q.location.href)};l=function(v,s){var u=q.document,t=$.fn[c].domain;if(v!==s){u.title=h.title;u.open();t&&u.write('<script>document.domain="'+t+'"<\/script>');u.close();q.location.hash=v}}})();return j})()})(jQuery,this);(function(c){var a=c.scrollTo=function(f,e,d){c(window).scrollTo(f,e,d)};a.defaults={axis:"xy",duration:parseFloat(c.fn.jquery)>=1.3?0:1};a.window=function(d){return c(window)._scrollable()};c.fn._scrollable=function(){return this.map(function(){var e=this,d=!e.nodeName||c.inArray(e.nodeName.toLowerCase(),["iframe","#document","html","body"])!=-1;if(!d){return e}var f=(e.contentWindow||e).document||e.ownerDocument||e;return c.browser.safari||f.compatMode=="BackCompat"?f.body:f.documentElement})};c.fn.scrollTo=function(f,e,d){if(typeof e=="object"){d=e;e=0}if(typeof d=="function"){d={onAfter:d}}if(f=="max"){f=9000000000}d=c.extend({},a.defaults,d);e=e||d.speed||d.duration;d.queue=d.queue&&d.axis.length>1;if(d.queue){e/=2}d.offset=b(d.offset);d.over=b(d.over);return this._scrollable().each(function(){var l=this,j=c(l),k=f,i,g={},m=j.is("html,body");switch(typeof k){case"number":case"string":if(/^([+-]=)?\d+(\.\d+)?(px|%)?$/.test(k)){k=b(k);break}k=c(k,this);case"object":if(k.is||k.style){i=(k=c(k)).offset()}}c.each(d.axis.split(""),function(q,r){var s=r=="x"?"Left":"Top",u=s.toLowerCase(),p="scroll"+s,o=l[p],n=a.max(l,r);if(i){g[p]=i[u]+(m?0:o-j.offset()[u]);if(d.margin){g[p]-=parseInt(k.css("margin"+s))||0;g[p]-=parseInt(k.css("border"+s+"Width"))||0}g[p]+=d.offset[u]||0;if(d.over[u]){g[p]+=k[r=="x"?"width":"height"]()*d.over[u]}}else{var t=k[u];g[p]=t.slice&&t.slice(-1)=="%"?parseFloat(t)/100*n:t}if(/^\d+$/.test(g[p])){g[p]=g[p]<=0?0:Math.min(g[p],n)}if(!q&&d.queue){if(o!=g[p]){h(d.onAfterFirst)}delete g[p]}});h(d.onAfter);function h(n){j.animate(g,e,d.easing,n&&function(){n.call(this,f,d)})}}).end()};a.max=function(j,i){var h=i=="x"?"Width":"Height",e="scroll"+h;if(!c(j).is("html,body")){return j[e]-c(j)[h.toLowerCase()]()}var g="client"+h,f=j.ownerDocument.documentElement,d=j.ownerDocument.body;return Math.max(f[e],d[e])-Math.min(f[g],d[g])};function b(d){return typeof d=="object"?d:{top:d,left:d}}})(jQuery);/*! + PowerTip - v1.2.0 - 2013-04-03 + http://stevenbenner.github.com/jquery-powertip/ + Copyright (c) 2013 Steven Benner (http://stevenbenner.com/). + Released under MIT license. + https://raw.github.com/stevenbenner/jquery-powertip/master/LICENSE.txt +*/ +(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{a(jQuery)}}(function(k){var A=k(document),s=k(window),w=k("body");var n="displayController",e="hasActiveHover",d="forcedOpen",u="hasMouseMove",f="mouseOnToPopup",g="originalTitle",y="powertip",o="powertipjq",l="powertiptarget",E=180/Math.PI;var c={isTipOpen:false,isFixedTipOpen:false,isClosing:false,tipOpenImminent:false,activeHover:null,currentX:0,currentY:0,previousX:0,previousY:0,desyncTimeout:null,mouseTrackingActive:false,delayInProgress:false,windowWidth:0,windowHeight:0,scrollTop:0,scrollLeft:0};var p={none:0,top:1,bottom:2,left:4,right:8};k.fn.powerTip=function(F,N){if(!this.length){return this}if(k.type(F)==="string"&&k.powerTip[F]){return k.powerTip[F].call(this,this,N)}var O=k.extend({},k.fn.powerTip.defaults,F),G=new x(O);h();this.each(function M(){var R=k(this),Q=R.data(y),P=R.data(o),T=R.data(l),S;if(R.data(n)){k.powerTip.destroy(R)}S=R.attr("title");if(!Q&&!T&&!P&&S){R.data(y,S);R.data(g,S);R.removeAttr("title")}R.data(n,new t(R,O,G))});if(!O.manual){this.on({"mouseenter.powertip":function J(P){k.powerTip.show(this,P)},"mouseleave.powertip":function L(){k.powerTip.hide(this)},"focus.powertip":function K(){k.powerTip.show(this)},"blur.powertip":function H(){k.powerTip.hide(this,true)},"keydown.powertip":function I(P){if(P.keyCode===27){k.powerTip.hide(this,true)}}})}return this};k.fn.powerTip.defaults={fadeInTime:200,fadeOutTime:100,followMouse:false,popupId:"powerTip",intentSensitivity:7,intentPollInterval:100,closeDelay:100,placement:"n",smartPlacement:false,offset:10,mouseOnToPopup:false,manual:false};k.fn.powerTip.smartPlacementLists={n:["n","ne","nw","s"],e:["e","ne","se","w","nw","sw","n","s","e"],s:["s","se","sw","n"],w:["w","nw","sw","e","ne","se","n","s","w"],nw:["nw","w","sw","n","s","se","nw"],ne:["ne","e","se","n","s","sw","ne"],sw:["sw","w","nw","s","n","ne","sw"],se:["se","e","ne","s","n","nw","se"],"nw-alt":["nw-alt","n","ne-alt","sw-alt","s","se-alt","w","e"],"ne-alt":["ne-alt","n","nw-alt","se-alt","s","sw-alt","e","w"],"sw-alt":["sw-alt","s","se-alt","nw-alt","n","ne-alt","w","e"],"se-alt":["se-alt","s","sw-alt","ne-alt","n","nw-alt","e","w"]};k.powerTip={show:function z(F,G){if(G){i(G);c.previousX=G.pageX;c.previousY=G.pageY;k(F).data(n).show()}else{k(F).first().data(n).show(true,true)}return F},reposition:function r(F){k(F).first().data(n).resetPosition();return F},hide:function D(G,F){if(G){k(G).first().data(n).hide(F)}else{if(c.activeHover){c.activeHover.data(n).hide(true)}}return G},destroy:function C(G){k(G).off(".powertip").each(function F(){var I=k(this),H=[g,n,e,d];if(I.data(g)){I.attr("title",I.data(g));H.push(y)}I.removeData(H)});return G}};k.powerTip.showTip=k.powerTip.show;k.powerTip.closeTip=k.powerTip.hide;function b(){var F=this;F.top="auto";F.left="auto";F.right="auto";F.bottom="auto";F.set=function(H,G){if(k.isNumeric(G)){F[H]=Math.round(G)}}}function t(K,N,F){var J=null;function L(P,Q){M();if(!K.data(e)){if(!P){c.tipOpenImminent=true;J=setTimeout(function O(){J=null;I()},N.intentPollInterval)}else{if(Q){K.data(d,true)}F.showTip(K)}}}function G(P){M();c.tipOpenImminent=false;if(K.data(e)){K.data(d,false);if(!P){c.delayInProgress=true;J=setTimeout(function O(){J=null;F.hideTip(K);c.delayInProgress=false},N.closeDelay)}else{F.hideTip(K)}}}function I(){var Q=Math.abs(c.previousX-c.currentX),O=Math.abs(c.previousY-c.currentY),P=Q+O;if(P<N.intentSensitivity){F.showTip(K)}else{c.previousX=c.currentX;c.previousY=c.currentY;L()}}function M(){J=clearTimeout(J);c.delayInProgress=false}function H(){F.resetPosition(K)}this.show=L;this.hide=G;this.cancel=M;this.resetPosition=H}function j(){function G(M,L,J,O,P){var K=L.split("-")[0],N=new b(),I;if(q(M)){I=H(M,K)}else{I=F(M,K)}switch(L){case"n":N.set("left",I.left-(J/2));N.set("bottom",c.windowHeight-I.top+P);break;case"e":N.set("left",I.left+P);N.set("top",I.top-(O/2));break;case"s":N.set("left",I.left-(J/2));N.set("top",I.top+P);break;case"w":N.set("top",I.top-(O/2));N.set("right",c.windowWidth-I.left+P);break;case"nw":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"nw-alt":N.set("left",I.left);N.set("bottom",c.windowHeight-I.top+P);break;case"ne":N.set("left",I.left-20);N.set("bottom",c.windowHeight-I.top+P);break;case"ne-alt":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left);break;case"sw":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"sw-alt":N.set("left",I.left);N.set("top",I.top+P);break;case"se":N.set("left",I.left-20);N.set("top",I.top+P);break;case"se-alt":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left);break}return N}function F(K,J){var O=K.offset(),N=K.outerWidth(),I=K.outerHeight(),M,L;switch(J){case"n":M=O.left+N/2;L=O.top;break;case"e":M=O.left+N;L=O.top+I/2;break;case"s":M=O.left+N/2;L=O.top+I;break;case"w":M=O.left;L=O.top+I/2;break;case"nw":M=O.left;L=O.top;break;case"ne":M=O.left+N;L=O.top;break;case"sw":M=O.left;L=O.top+I;break;case"se":M=O.left+N;L=O.top+I;break}return{top:L,left:M}}function H(O,K){var S=O.closest("svg")[0],N=O[0],W=S.createSVGPoint(),L=N.getBBox(),V=N.getScreenCTM(),M=L.width/2,Q=L.height/2,P=[],I=["nw","n","ne","e","se","s","sw","w"],U,X,R,T;function J(){P.push(W.matrixTransform(V))}W.x=L.x;W.y=L.y;J();W.x+=M;J();W.x+=M;J();W.y+=Q;J();W.y+=Q;J();W.x-=M;J();W.x-=M;J();W.y-=Q;J();if(P[0].y!==P[1].y||P[0].x!==P[7].x){X=Math.atan2(V.b,V.a)*E;R=Math.ceil(((X%360)-22.5)/45);if(R<1){R+=8}while(R--){I.push(I.shift())}}for(T=0;T<P.length;T++){if(I[T]===K){U=P[T];break}}return{top:U.y+c.scrollTop,left:U.x+c.scrollLeft}}this.compute=G}function x(Q){var P=new j(),O=k("#"+Q.popupId);if(O.length===0){O=k("<div/>",{id:Q.popupId});if(w.length===0){w=k("body")}w.append(O)}if(Q.followMouse){if(!O.data(u)){A.on("mousemove",M);s.on("scroll",M);O.data(u,true)}}if(Q.mouseOnToPopup){O.on({mouseenter:function L(){if(O.data(f)){if(c.activeHover){c.activeHover.data(n).cancel()}}},mouseleave:function N(){if(c.activeHover){c.activeHover.data(n).hide()}}})}function I(S){S.data(e,true);O.queue(function R(T){H(S);T()})}function H(S){var U;if(!S.data(e)){return}if(c.isTipOpen){if(!c.isClosing){K(c.activeHover)}O.delay(100).queue(function R(V){H(S);V()});return}S.trigger("powerTipPreRender");U=B(S);if(U){O.empty().append(U)}else{return}S.trigger("powerTipRender");c.activeHover=S;c.isTipOpen=true;O.data(f,Q.mouseOnToPopup);if(!Q.followMouse){G(S);c.isFixedTipOpen=true}else{M()}O.fadeIn(Q.fadeInTime,function T(){if(!c.desyncTimeout){c.desyncTimeout=setInterval(J,500)}S.trigger("powerTipOpen")})}function K(R){c.isClosing=true;c.activeHover=null;c.isTipOpen=false;c.desyncTimeout=clearInterval(c.desyncTimeout);R.data(e,false);R.data(d,false);O.fadeOut(Q.fadeOutTime,function S(){var T=new b();c.isClosing=false;c.isFixedTipOpen=false;O.removeClass();T.set("top",c.currentY+Q.offset);T.set("left",c.currentX+Q.offset);O.css(T);R.trigger("powerTipClose")})}function M(){if(!c.isFixedTipOpen&&(c.isTipOpen||(c.tipOpenImminent&&O.data(u)))){var R=O.outerWidth(),V=O.outerHeight(),U=new b(),S,T;U.set("top",c.currentY+Q.offset);U.set("left",c.currentX+Q.offset);S=m(U,R,V);if(S!==p.none){T=a(S);if(T===1){if(S===p.right){U.set("left",c.windowWidth-R)}else{if(S===p.bottom){U.set("top",c.scrollTop+c.windowHeight-V)}}}else{U.set("left",c.currentX-R-Q.offset);U.set("top",c.currentY-V-Q.offset)}}O.css(U)}}function G(S){var R,T;if(Q.smartPlacement){R=k.fn.powerTip.smartPlacementLists[Q.placement];k.each(R,function(U,W){var V=m(F(S,W),O.outerWidth(),O.outerHeight());T=W;if(V===p.none){return false}})}else{F(S,Q.placement);T=Q.placement}O.addClass(T)}function F(U,T){var R=0,S,W,V=new b();V.set("top",0);V.set("left",0);O.css(V);do{S=O.outerWidth();W=O.outerHeight();V=P.compute(U,T,S,W,Q.offset);O.css(V)}while(++R<=5&&(S!==O.outerWidth()||W!==O.outerHeight()));return V}function J(){var R=false;if(c.isTipOpen&&!c.isClosing&&!c.delayInProgress){if(c.activeHover.data(e)===false||c.activeHover.is(":disabled")){R=true}else{if(!v(c.activeHover)&&!c.activeHover.is(":focus")&&!c.activeHover.data(d)){if(O.data(f)){if(!v(O)){R=true}}else{R=true}}}if(R){K(c.activeHover)}}}this.showTip=I;this.hideTip=K;this.resetPosition=G}function q(F){return window.SVGElement&&F[0] instanceof SVGElement}function h(){if(!c.mouseTrackingActive){c.mouseTrackingActive=true;k(function H(){c.scrollLeft=s.scrollLeft();c.scrollTop=s.scrollTop();c.windowWidth=s.width();c.windowHeight=s.height()});A.on("mousemove",i);s.on({resize:function G(){c.windowWidth=s.width();c.windowHeight=s.height()},scroll:function F(){var I=s.scrollLeft(),J=s.scrollTop();if(I!==c.scrollLeft){c.currentX+=I-c.scrollLeft;c.scrollLeft=I}if(J!==c.scrollTop){c.currentY+=J-c.scrollTop;c.scrollTop=J}}})}}function i(F){c.currentX=F.pageX;c.currentY=F.pageY}function v(F){var H=F.offset(),J=F[0].getBoundingClientRect(),I=J.right-J.left,G=J.bottom-J.top;return c.currentX>=H.left&&c.currentX<=H.left+I&&c.currentY>=H.top&&c.currentY<=H.top+G}function B(I){var G=I.data(y),F=I.data(o),K=I.data(l),H,J;if(G){if(k.isFunction(G)){G=G.call(I[0])}J=G}else{if(F){if(k.isFunction(F)){F=F.call(I[0])}if(F.length>0){J=F.clone(true,true)}}else{if(K){H=k("#"+K);if(H.length>0){J=H.html()}}}}return J}function m(M,L,K){var G=c.scrollTop,J=c.scrollLeft,I=G+c.windowHeight,F=J+c.windowWidth,H=p.none;if(M.top<G||Math.abs(M.bottom-c.windowHeight)-K<G){H|=p.top}if(M.top+K>I||Math.abs(M.bottom-c.windowHeight)>I){H|=p.bottom}if(M.left<J||M.right+L>F){H|=p.left}if(M.left+L>F||M.right<J){H|=p.right}return H}function a(G){var F=0;while(G){G&=G-1;F++}return F}}));/*! + * jQuery UI Touch Punch 0.2.3 + * + * Copyright 2011–2014, Dave Furfero + * Dual licensed under the MIT or GPL Version 2 licenses. + * + * Depends: + * jquery.ui.widget.js + * jquery.ui.mouse.js + */ +(function(b){b.support.touch="ontouchend" in document;if(!b.support.touch){return}var d=b.ui.mouse.prototype,f=d._mouseInit,c=d._mouseDestroy,a;function e(h,i){if(h.originalEvent.touches.length>1){return}h.preventDefault();var j=h.originalEvent.changedTouches[0],g=document.createEvent("MouseEvents");g.initMouseEvent(i,true,true,window,1,j.screenX,j.screenY,j.clientX,j.clientY,false,false,false,false,0,null);h.target.dispatchEvent(g)}d._touchStart=function(h){var g=this;if(a||!g._mouseCapture(h.originalEvent.changedTouches[0])){return}a=true;g._touchMoved=false;e(h,"mouseover");e(h,"mousemove");e(h,"mousedown")};d._touchMove=function(g){if(!a){return}this._touchMoved=true;e(g,"mousemove")};d._touchEnd=function(g){if(!a){return}e(g,"mouseup");e(g,"mouseout");if(!this._touchMoved){e(g,"click")}a=false};d._mouseInit=function(){var g=this;g.element.bind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});f.call(g)};d._mouseDestroy=function(){var g=this;g.element.unbind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});c.call(g)}})(jQuery);/*! + * SmartMenus jQuery Plugin - v1.0.0 - January 27, 2016 + * http://www.smartmenus.org/ + * + * Copyright Vasil Dinkov, Vadikom Web Ltd. + * http://vadikom.com + * + * Licensed MIT + */ +(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{if(typeof module==="object"&&typeof module.exports==="object"){module.exports=a(require("jquery"))}else{a(jQuery)}}}(function(a){var b=[],e=!!window.createPopup,f=false,d="ontouchstart" in window,h=false,g=window.requestAnimationFrame||function(l){return setTimeout(l,1000/60)},c=window.cancelAnimationFrame||function(l){clearTimeout(l)};function k(m){var n=".smartmenus_mouse";if(!h&&!m){var o=true,l=null;a(document).bind(i([["mousemove",function(s){var t={x:s.pageX,y:s.pageY,timeStamp:new Date().getTime()};if(l){var q=Math.abs(l.x-t.x),p=Math.abs(l.y-t.y);if((q>0||p>0)&&q<=2&&p<=2&&t.timeStamp-l.timeStamp<=300){f=true;if(o){var r=a(s.target).closest("a");if(r.is("a")){a.each(b,function(){if(a.contains(this.$root[0],r[0])){this.itemEnter({currentTarget:r[0]});return false}})}o=false}}}l=t}],[d?"touchstart":"pointerover pointermove pointerout MSPointerOver MSPointerMove MSPointerOut",function(p){if(j(p.originalEvent)){f=false}}]],n));h=true}else{if(h&&m){a(document).unbind(n);h=false}}}function j(l){return !/^(4|mouse)$/.test(l.pointerType)}function i(l,n){if(!n){n=""}var m={};a.each(l,function(o,p){m[p[0].split(" ").join(n+" ")+n]=p[1]});return m}a.SmartMenus=function(m,l){this.$root=a(m);this.opts=l;this.rootId="";this.accessIdPrefix="";this.$subArrow=null;this.activatedItems=[];this.visibleSubMenus=[];this.showTimeout=0;this.hideTimeout=0;this.scrollTimeout=0;this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.idInc=0;this.$firstLink=null;this.$firstSub=null;this.disabled=false;this.$disableOverlay=null;this.$touchScrollingSub=null;this.cssTransforms3d="perspective" in m.style||"webkitPerspective" in m.style;this.wasCollapsible=false;this.init()};a.extend(a.SmartMenus,{hideAll:function(){a.each(b,function(){this.menuHideAll()})},destroy:function(){while(b.length){b[0].destroy()}k(true)},prototype:{init:function(n){var l=this;if(!n){b.push(this);this.rootId=(new Date().getTime()+Math.random()+"").replace(/\D/g,"");this.accessIdPrefix="sm-"+this.rootId+"-";if(this.$root.hasClass("sm-rtl")){this.opts.rightToLeftSubMenus=true}var r=".smartmenus";this.$root.data("smartmenus",this).attr("data-smartmenus-id",this.rootId).dataSM("level",1).bind(i([["mouseover focusin",a.proxy(this.rootOver,this)],["mouseout focusout",a.proxy(this.rootOut,this)],["keydown",a.proxy(this.rootKeyDown,this)]],r)).delegate("a",i([["mouseenter",a.proxy(this.itemEnter,this)],["mouseleave",a.proxy(this.itemLeave,this)],["mousedown",a.proxy(this.itemDown,this)],["focus",a.proxy(this.itemFocus,this)],["blur",a.proxy(this.itemBlur,this)],["click",a.proxy(this.itemClick,this)]],r));r+=this.rootId;if(this.opts.hideOnClick){a(document).bind(i([["touchstart",a.proxy(this.docTouchStart,this)],["touchmove",a.proxy(this.docTouchMove,this)],["touchend",a.proxy(this.docTouchEnd,this)],["click",a.proxy(this.docClick,this)]],r))}a(window).bind(i([["resize orientationchange",a.proxy(this.winResize,this)]],r));if(this.opts.subIndicators){this.$subArrow=a("<span/>").addClass("sub-arrow");if(this.opts.subIndicatorsText){this.$subArrow.html(this.opts.subIndicatorsText)}}k()}this.$firstSub=this.$root.find("ul").each(function(){l.menuInit(a(this))}).eq(0);this.$firstLink=this.$root.find("a").eq(0);if(this.opts.markCurrentItem){var p=/(index|default)\.[^#\?\/]*/i,m=/#.*/,q=window.location.href.replace(p,""),o=q.replace(m,"");this.$root.find("a").each(function(){var s=this.href.replace(p,""),t=a(this);if(s==q||s==o){t.addClass("current");if(l.opts.markCurrentTree){t.parentsUntil("[data-smartmenus-id]","ul").each(function(){a(this).dataSM("parent-a").addClass("current")})}}})}this.wasCollapsible=this.isCollapsible()},destroy:function(m){if(!m){var n=".smartmenus";this.$root.removeData("smartmenus").removeAttr("data-smartmenus-id").removeDataSM("level").unbind(n).undelegate(n);n+=this.rootId;a(document).unbind(n);a(window).unbind(n);if(this.opts.subIndicators){this.$subArrow=null}}this.menuHideAll();var l=this;this.$root.find("ul").each(function(){var o=a(this);if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}if(o.dataSM("shown-before")){if(l.opts.subMenusMinWidth||l.opts.subMenusMaxWidth){o.css({width:"",minWidth:"",maxWidth:""}).removeClass("sm-nowrap")}if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}o.css({zIndex:"",top:"",left:"",marginLeft:"",marginTop:"",display:""})}if((o.attr("id")||"").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeDataSM("in-mega").removeDataSM("shown-before").removeDataSM("ie-shim").removeDataSM("scroll-arrows").removeDataSM("parent-a").removeDataSM("level").removeDataSM("beforefirstshowfired").removeAttr("role").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeAttr("aria-expanded");this.$root.find("a.has-submenu").each(function(){var o=a(this);if(o.attr("id").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeClass("has-submenu").removeDataSM("sub").removeAttr("aria-haspopup").removeAttr("aria-controls").removeAttr("aria-expanded").closest("li").removeDataSM("sub");if(this.opts.subIndicators){this.$root.find("span.sub-arrow").remove()}if(this.opts.markCurrentItem){this.$root.find("a.current").removeClass("current")}if(!m){this.$root=null;this.$firstLink=null;this.$firstSub=null;if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}b.splice(a.inArray(this,b),1)}},disable:function(l){if(!this.disabled){this.menuHideAll();if(!l&&!this.opts.isPopup&&this.$root.is(":visible")){var m=this.$root.offset();this.$disableOverlay=a('<div class="sm-jquery-disable-overlay"/>').css({position:"absolute",top:m.top,left:m.left,width:this.$root.outerWidth(),height:this.$root.outerHeight(),zIndex:this.getStartZIndex(true),opacity:0}).appendTo(document.body)}this.disabled=true}},docClick:function(l){if(this.$touchScrollingSub){this.$touchScrollingSub=null;return}if(this.visibleSubMenus.length&&!a.contains(this.$root[0],l.target)||a(l.target).is("a")){this.menuHideAll()}},docTouchEnd:function(m){if(!this.lastTouch){return}if(this.visibleSubMenus.length&&(this.lastTouch.x2===undefined||this.lastTouch.x1==this.lastTouch.x2)&&(this.lastTouch.y2===undefined||this.lastTouch.y1==this.lastTouch.y2)&&(!this.lastTouch.target||!a.contains(this.$root[0],this.lastTouch.target))){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},350)}this.lastTouch=null},docTouchMove:function(m){if(!this.lastTouch){return}var l=m.originalEvent.touches[0];this.lastTouch.x2=l.pageX;this.lastTouch.y2=l.pageY},docTouchStart:function(m){var l=m.originalEvent.touches[0];this.lastTouch={x1:l.pageX,y1:l.pageY,target:l.target}},enable:function(){if(this.disabled){if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}this.disabled=false}},getClosestMenu:function(m){var l=a(m).closest("ul");while(l.dataSM("in-mega")){l=l.parent().closest("ul")}return l[0]||null},getHeight:function(l){return this.getOffset(l,true)},getOffset:function(n,l){var m;if(n.css("display")=="none"){m={position:n[0].style.position,visibility:n[0].style.visibility};n.css({position:"absolute",visibility:"hidden"}).show()}var o=n[0].getBoundingClientRect&&n[0].getBoundingClientRect(),p=o&&(l?o.height||o.bottom-o.top:o.width||o.right-o.left);if(!p&&p!==0){p=l?n[0].offsetHeight:n[0].offsetWidth}if(m){n.hide().css(m)}return p},getStartZIndex:function(l){var m=parseInt(this[l?"$root":"$firstSub"].css("z-index"));if(!l&&isNaN(m)){m=parseInt(this.$root.css("z-index"))}return !isNaN(m)?m:1},getTouchPoint:function(l){return l.touches&&l.touches[0]||l.changedTouches&&l.changedTouches[0]||l},getViewport:function(l){var m=l?"Height":"Width",o=document.documentElement["client"+m],n=window["inner"+m];if(n){o=Math.min(o,n)}return o},getViewportHeight:function(){return this.getViewport(true)},getViewportWidth:function(){return this.getViewport()},getWidth:function(l){return this.getOffset(l)},handleEvents:function(){return !this.disabled&&this.isCSSOn()},handleItemEvents:function(l){return this.handleEvents()&&!this.isLinkInMegaMenu(l)},isCollapsible:function(){return this.$firstSub.css("position")=="static"},isCSSOn:function(){return this.$firstLink.css("display")=="block"},isFixed:function(){var l=this.$root.css("position")=="fixed";if(!l){this.$root.parentsUntil("body").each(function(){if(a(this).css("position")=="fixed"){l=true;return false}})}return l},isLinkInMegaMenu:function(l){return a(this.getClosestMenu(l[0])).hasClass("mega-menu")},isTouchMode:function(){return !f||this.opts.noMouseOver||this.isCollapsible()},itemActivate:function(p,l){var n=p.closest("ul"),q=n.dataSM("level");if(q>1&&(!this.activatedItems[q-2]||this.activatedItems[q-2][0]!=n.dataSM("parent-a")[0])){var m=this;a(n.parentsUntil("[data-smartmenus-id]","ul").get().reverse()).add(n).each(function(){m.itemActivate(a(this).dataSM("parent-a"))})}if(!this.isCollapsible()||l){this.menuHideSubMenus(!this.activatedItems[q-1]||this.activatedItems[q-1][0]!=p[0]?q-1:q)}this.activatedItems[q-1]=p;if(this.$root.triggerHandler("activate.smapi",p[0])===false){return}var o=p.dataSM("sub");if(o&&(this.isTouchMode()||(!this.opts.showOnClick||this.clickActivated))){this.menuShow(o)}},itemBlur:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}this.$root.triggerHandler("blur.smapi",l[0])},itemClick:function(o){var n=a(o.currentTarget);if(!this.handleItemEvents(n)){return}if(this.$touchScrollingSub&&this.$touchScrollingSub[0]==n.closest("ul")[0]){this.$touchScrollingSub=null;o.stopPropagation();return false}if(this.$root.triggerHandler("click.smapi",n[0])===false){return false}var p=a(o.target).is("span.sub-arrow"),m=n.dataSM("sub"),l=m?m.dataSM("level")==2:false;if(m&&!m.is(":visible")){if(this.opts.showOnClick&&l){this.clickActivated=true}this.itemActivate(n);if(m.is(":visible")){this.focusActivated=true;return false}}else{if(this.isCollapsible()&&p){this.itemActivate(n);this.menuHide(m);return false}}if(this.opts.showOnClick&&l||n.hasClass("disabled")||this.$root.triggerHandler("select.smapi",n[0])===false){return false}},itemDown:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}l.dataSM("mousedown",true)},itemEnter:function(n){var m=a(n.currentTarget);if(!this.handleItemEvents(m)){return}if(!this.isTouchMode()){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var l=this;this.showTimeout=setTimeout(function(){l.itemActivate(m)},this.opts.showOnClick&&m.closest("ul").dataSM("level")==1?1:this.opts.showTimeout)}this.$root.triggerHandler("mouseenter.smapi",m[0])},itemFocus:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(this.focusActivated&&(!this.isTouchMode()||!l.dataSM("mousedown"))&&(!this.activatedItems.length||this.activatedItems[this.activatedItems.length-1][0]!=l[0])){this.itemActivate(l,true)}this.$root.triggerHandler("focus.smapi",l[0])},itemLeave:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(!this.isTouchMode()){l[0].blur();if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}}l.removeDataSM("mousedown");this.$root.triggerHandler("mouseleave.smapi",l[0])},menuHide:function(m){if(this.$root.triggerHandler("beforehide.smapi",m[0])===false){return}m.stop(true,true);if(m.css("display")!="none"){var l=function(){m.css("z-index","")};if(this.isCollapsible()){if(this.opts.collapsibleHideFunction){this.opts.collapsibleHideFunction.call(this,m,l)}else{m.hide(this.opts.collapsibleHideDuration,l)}}else{if(this.opts.hideFunction){this.opts.hideFunction.call(this,m,l)}else{m.hide(this.opts.hideDuration,l)}}if(m.dataSM("ie-shim")){m.dataSM("ie-shim").remove().css({"-webkit-transform":"",transform:""})}if(m.dataSM("scroll")){this.menuScrollStop(m);m.css({"touch-action":"","-ms-touch-action":"","-webkit-transform":"",transform:""}).unbind(".smartmenus_scroll").removeDataSM("scroll").dataSM("scroll-arrows").hide()}m.dataSM("parent-a").removeClass("highlighted").attr("aria-expanded","false");m.attr({"aria-expanded":"false","aria-hidden":"true"});var n=m.dataSM("level");this.activatedItems.splice(n-1,1);this.visibleSubMenus.splice(a.inArray(m,this.visibleSubMenus),1);this.$root.triggerHandler("hide.smapi",m[0])}},menuHideAll:function(){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var m=this.opts.isPopup?1:0;for(var l=this.visibleSubMenus.length-1;l>=m;l--){this.menuHide(this.visibleSubMenus[l])}if(this.opts.isPopup){this.$root.stop(true,true);if(this.$root.is(":visible")){if(this.opts.hideFunction){this.opts.hideFunction.call(this,this.$root)}else{this.$root.hide(this.opts.hideDuration)}if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").remove()}}}this.activatedItems=[];this.visibleSubMenus=[];this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.$root.triggerHandler("hideAll.smapi")},menuHideSubMenus:function(n){for(var l=this.activatedItems.length-1;l>=n;l--){var m=this.activatedItems[l].dataSM("sub");if(m){this.menuHide(m)}}},menuIframeShim:function(l){if(e&&this.opts.overlapControlsInIE&&!l.dataSM("ie-shim")){l.dataSM("ie-shim",a("<iframe/>").attr({src:"javascript:0",tabindex:-9}).css({position:"absolute",top:"auto",left:"0",opacity:0,border:"0"}))}},menuInit:function(l){if(!l.dataSM("in-mega")){if(l.hasClass("mega-menu")){l.find("ul").dataSM("in-mega",true)}var q=2,m=l[0];while((m=m.parentNode.parentNode)!=this.$root[0]){q++}var n=l.prevAll("a").eq(-1);if(!n.length){n=l.prevAll().find("a").eq(-1)}n.addClass("has-submenu").dataSM("sub",l);l.dataSM("parent-a",n).dataSM("level",q).parent().dataSM("sub",l);var o=n.attr("id")||this.accessIdPrefix+(++this.idInc),p=l.attr("id")||this.accessIdPrefix+(++this.idInc);n.attr({id:o,"aria-haspopup":"true","aria-controls":p,"aria-expanded":"false"});l.attr({id:p,role:"group","aria-hidden":"true","aria-labelledby":o,"aria-expanded":"false"});if(this.opts.subIndicators){n[this.opts.subIndicatorsPos](this.$subArrow.clone())}}},menuPosition:function(K){var r=K.dataSM("parent-a"),D=r.closest("li"),E=D.parent(),l=K.dataSM("level"),t=this.getWidth(K),J=this.getHeight(K),u=r.offset(),o=u.left,m=u.top,q=this.getWidth(r),F=this.getHeight(r),H=a(window),v=H.scrollLeft(),s=H.scrollTop(),z=this.getViewportWidth(),L=this.getViewportHeight(),w=E.parent().is("[data-sm-horizontal-sub]")||l==2&&!E.hasClass("sm-vertical"),B=this.opts.rightToLeftSubMenus&&!D.is("[data-sm-reverse]")||!this.opts.rightToLeftSubMenus&&D.is("[data-sm-reverse]"),p=l==2?this.opts.mainMenuSubOffsetX:this.opts.subMenusSubOffsetX,n=l==2?this.opts.mainMenuSubOffsetY:this.opts.subMenusSubOffsetY,C,A;if(w){C=B?q-t-p:p;A=this.opts.bottomToTopSubMenus?-J-n:F+n}else{C=B?p-t:q-p;A=this.opts.bottomToTopSubMenus?F-n-J:n}if(this.opts.keepInViewport){var N=o+C,M=m+A;if(B&&N<v){C=w?v-N+C:q-p}else{if(!B&&N+t>v+z){C=w?v+z-t-N+C:p-t}}if(!w){if(J<L&&M+J>s+L){A+=s+L-J-M}else{if(J>=L||M<s){A+=s-M}}}if(w&&(M+J>s+L+0.49||M<s)||!w&&J>L+0.49){var G=this;if(!K.dataSM("scroll-arrows")){K.dataSM("scroll-arrows",a([a('<span class="scroll-up"><span class="scroll-up-arrow"></span></span>')[0],a('<span class="scroll-down"><span class="scroll-down-arrow"></span></span>')[0]]).bind({mouseenter:function(){K.dataSM("scroll").up=a(this).hasClass("scroll-up");G.menuScroll(K)},mouseleave:function(x){G.menuScrollStop(K);G.menuScrollOut(K,x)},"mousewheel DOMMouseScroll":function(x){x.preventDefault()}}).insertAfter(K))}var I=".smartmenus_scroll";K.dataSM("scroll",{y:this.cssTransforms3d?0:A-F,step:1,itemH:F,subH:J,arrowDownH:this.getHeight(K.dataSM("scroll-arrows").eq(1))}).bind(i([["mouseover",function(x){G.menuScrollOver(K,x)}],["mouseout",function(x){G.menuScrollOut(K,x)}],["mousewheel DOMMouseScroll",function(x){G.menuScrollMousewheel(K,x)}]],I)).dataSM("scroll-arrows").css({top:"auto",left:"0",marginLeft:C+(parseInt(K.css("border-left-width"))||0),width:t-(parseInt(K.css("border-left-width"))||0)-(parseInt(K.css("border-right-width"))||0),zIndex:K.css("z-index")}).eq(w&&this.opts.bottomToTopSubMenus?0:1).show();if(this.isFixed()){K.css({"touch-action":"none","-ms-touch-action":"none"}).bind(i([[d?"touchstart touchmove touchend":"pointerdown pointermove pointerup MSPointerDown MSPointerMove MSPointerUp",function(x){G.menuScrollTouch(K,x)}]],I))}}}K.css({top:"auto",left:"0",marginLeft:C,marginTop:A-F});this.menuIframeShim(K);if(K.dataSM("ie-shim")){K.dataSM("ie-shim").css({zIndex:K.css("z-index"),width:t,height:J,marginLeft:C,marginTop:A-F})}},menuScroll:function(r,m,n){var p=r.dataSM("scroll"),q=r.dataSM("scroll-arrows"),o=p.up?p.upEnd:p.downEnd,s;if(!m&&p.momentum){p.momentum*=0.92;s=p.momentum;if(s<0.5){this.menuScrollStop(r);return}}else{s=n||(m||!this.opts.scrollAccelerate?this.opts.scrollStep:Math.floor(p.step))}var l=r.dataSM("level");if(this.activatedItems[l-1]&&this.activatedItems[l-1].dataSM("sub")&&this.activatedItems[l-1].dataSM("sub").is(":visible")){this.menuHideSubMenus(l-1)}p.y=p.up&&o<=p.y||!p.up&&o>=p.y?p.y:(Math.abs(o-p.y)>s?p.y+(p.up?s:-s):o);r.add(r.dataSM("ie-shim")).css(this.cssTransforms3d?{"-webkit-transform":"translate3d(0, "+p.y+"px, 0)",transform:"translate3d(0, "+p.y+"px, 0)"}:{marginTop:p.y});if(f&&(p.up&&p.y>p.downEnd||!p.up&&p.y<p.upEnd)){q.eq(p.up?1:0).show()}if(p.y==o){if(f){q.eq(p.up?0:1).hide()}this.menuScrollStop(r)}else{if(!m){if(this.opts.scrollAccelerate&&p.step<this.opts.scrollStep){p.step+=0.2}var t=this;this.scrollTimeout=g(function(){t.menuScroll(r)})}}},menuScrollMousewheel:function(m,n){if(this.getClosestMenu(n.target)==m[0]){n=n.originalEvent;var l=(n.wheelDelta||-n.detail)>0;if(m.dataSM("scroll-arrows").eq(l?0:1).is(":visible")){m.dataSM("scroll").up=l;this.menuScroll(m,true)}}n.preventDefault()},menuScrollOut:function(l,m){if(f){if(!/^scroll-(up|down)/.test((m.relatedTarget||"").className)&&(l[0]!=m.relatedTarget&&!a.contains(l[0],m.relatedTarget)||this.getClosestMenu(m.relatedTarget)!=l[0])){l.dataSM("scroll-arrows").css("visibility","hidden")}}},menuScrollOver:function(n,o){if(f){if(!/^scroll-(up|down)/.test(o.target.className)&&this.getClosestMenu(o.target)==n[0]){this.menuScrollRefreshData(n);var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;n.dataSM("scroll-arrows").eq(0).css("margin-top",l).end().eq(1).css("margin-top",l+this.getViewportHeight()-m.arrowDownH).end().css("visibility","visible")}}},menuScrollRefreshData:function(n){var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;if(this.cssTransforms3d){l=-(parseFloat(n.css("margin-top"))-l)}a.extend(m,{upEnd:l,downEnd:l+this.getViewportHeight()-m.subH})},menuScrollStop:function(l){if(this.scrollTimeout){c(this.scrollTimeout);this.scrollTimeout=0;l.dataSM("scroll").step=1;return true}},menuScrollTouch:function(p,q){q=q.originalEvent;if(j(q)){var m=this.getTouchPoint(q);if(this.getClosestMenu(m.target)==p[0]){var o=p.dataSM("scroll");if(/(start|down)$/i.test(q.type)){if(this.menuScrollStop(p)){q.preventDefault();this.$touchScrollingSub=p}else{this.$touchScrollingSub=null}this.menuScrollRefreshData(p);a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}else{if(/move$/i.test(q.type)){var n=o.touchY!==undefined?o.touchY:o.touchStartY;if(n!==undefined&&n!=m.pageY){this.$touchScrollingSub=p;var l=n<m.pageY;if(o.up!==undefined&&o.up!=l){a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}a.extend(o,{up:l,touchY:m.pageY});this.menuScroll(p,true,Math.abs(m.pageY-n))}q.preventDefault()}else{if(o.touchY!==undefined){if(o.momentum=Math.pow(Math.abs(m.pageY-o.touchStartY)/(q.timeStamp-o.touchStartTime),2)*15){this.menuScrollStop(p);this.menuScroll(p);q.preventDefault()}delete o.touchY}}}}}},menuShow:function(n){if(!n.dataSM("beforefirstshowfired")){n.dataSM("beforefirstshowfired",true);if(this.$root.triggerHandler("beforefirstshow.smapi",n[0])===false){return}}if(this.$root.triggerHandler("beforeshow.smapi",n[0])===false){return}n.dataSM("shown-before",true).stop(true,true);if(!n.is(":visible")){var m=n.dataSM("parent-a");if(this.opts.keepHighlighted||this.isCollapsible()){m.addClass("highlighted")}if(this.isCollapsible()){n.removeClass("sm-nowrap").css({zIndex:"",width:"auto",minWidth:"",maxWidth:"",top:"",left:"",marginLeft:"",marginTop:""})}else{n.css("z-index",this.zIndexInc=(this.zIndexInc||this.getStartZIndex())+1);if(this.opts.subMenusMinWidth||this.opts.subMenusMaxWidth){n.css({width:"auto",minWidth:"",maxWidth:""}).addClass("sm-nowrap");if(this.opts.subMenusMinWidth){n.css("min-width",this.opts.subMenusMinWidth)}if(this.opts.subMenusMaxWidth){var o=this.getWidth(n);n.css("max-width",this.opts.subMenusMaxWidth);if(o>this.getWidth(n)){n.removeClass("sm-nowrap").css("width",this.opts.subMenusMaxWidth)}}}this.menuPosition(n);if(n.dataSM("ie-shim")){n.dataSM("ie-shim").insertBefore(n)}}var l=function(){n.css("overflow","")};if(this.isCollapsible()){if(this.opts.collapsibleShowFunction){this.opts.collapsibleShowFunction.call(this,n,l)}else{n.show(this.opts.collapsibleShowDuration,l)}}else{if(this.opts.showFunction){this.opts.showFunction.call(this,n,l)}else{n.show(this.opts.showDuration,l)}}m.attr("aria-expanded","true");n.attr({"aria-expanded":"true","aria-hidden":"false"});this.visibleSubMenus.push(n);this.$root.triggerHandler("show.smapi",n[0])}},popupHide:function(l){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var m=this;this.hideTimeout=setTimeout(function(){m.menuHideAll()},l?1:this.opts.hideTimeout)},popupShow:function(o,n){if(!this.opts.isPopup){alert('SmartMenus jQuery Error:\n\nIf you want to show this menu via the "popupShow" method, set the isPopup:true option.');return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}this.$root.dataSM("shown-before",true).stop(true,true);if(!this.$root.is(":visible")){this.$root.css({left:o,top:n});this.menuIframeShim(this.$root);if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").css({zIndex:this.$root.css("z-index"),width:this.getWidth(this.$root),height:this.getHeight(this.$root),left:o,top:n}).insertBefore(this.$root)}var m=this,l=function(){m.$root.css("overflow","")};if(this.opts.showFunction){this.opts.showFunction.call(this,this.$root,l)}else{this.$root.show(this.opts.showDuration,l)}this.visibleSubMenus[0]=this.$root}},refresh:function(){this.destroy(true);this.init(true)},rootKeyDown:function(o){if(!this.handleEvents()){return}switch(o.keyCode){case 27:var m=this.activatedItems[0];if(m){this.menuHideAll();m[0].focus();var n=m.dataSM("sub");if(n){this.menuHide(n)}}break;case 32:var l=a(o.target);if(l.is("a")&&this.handleItemEvents(l)){var n=l.dataSM("sub");if(n&&!n.is(":visible")){this.itemClick({currentTarget:o.target});o.preventDefault()}}break}},rootOut:function(m){if(!this.handleEvents()||this.isTouchMode()||m.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}if(!this.opts.showOnClick||!this.opts.hideOnClick){var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},this.opts.hideTimeout)}},rootOver:function(l){if(!this.handleEvents()||this.isTouchMode()||l.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}},winResize:function(m){if(!this.handleEvents()){if(this.$disableOverlay){var n=this.$root.offset();this.$disableOverlay.css({top:n.top,left:n.left,width:this.$root.outerWidth(),height:this.$root.outerHeight()})}return}if(!("onorientationchange" in window)||m.type=="orientationchange"){var l=this.isCollapsible();if(!(this.wasCollapsible&&l)){if(this.activatedItems.length){this.activatedItems[this.activatedItems.length-1][0].blur()}this.menuHideAll()}this.wasCollapsible=l}}}});a.fn.dataSM=function(l,m){if(m){return this.data(l+"_smartmenus",m)}return this.data(l+"_smartmenus")};a.fn.removeDataSM=function(l){return this.removeData(l+"_smartmenus")};a.fn.smartmenus=function(m){if(typeof m=="string"){var l=arguments,o=m;Array.prototype.shift.call(l);return this.each(function(){var p=a(this).data("smartmenus");if(p&&p[o]){p[o].apply(p,l)}})}var n=a.extend({},a.fn.smartmenus.defaults,m);return this.each(function(){new a.SmartMenus(this,n)})};a.fn.smartmenus.defaults={isPopup:false,mainMenuSubOffsetX:0,mainMenuSubOffsetY:0,subMenusSubOffsetX:0,subMenusSubOffsetY:0,subMenusMinWidth:"10em",subMenusMaxWidth:"20em",subIndicators:true,subIndicatorsPos:"prepend",subIndicatorsText:"+",scrollStep:30,scrollAccelerate:true,showTimeout:250,hideTimeout:500,showDuration:0,showFunction:null,hideDuration:0,hideFunction:function(m,l){m.fadeOut(200,l)},collapsibleShowDuration:0,collapsibleShowFunction:function(m,l){m.slideDown(200,l)},collapsibleHideDuration:0,collapsibleHideFunction:function(m,l){m.slideUp(200,l)},showOnClick:false,hideOnClick:true,noMouseOver:false,keepInViewport:true,keepHighlighted:true,markCurrentItem:false,markCurrentTree:true,rightToLeftSubMenus:false,bottomToTopSubMenus:false,overlapControlsInIE:true};return a})); \ No newline at end of file diff --git a/docs/Doxygen/html/md_README.html b/docs/Doxygen/html/md_README.html new file mode 100644 index 0000000000000000000000000000000000000000..100e2228c8f8de51f5d51a680682109c7bbd2b7f --- /dev/null +++ b/docs/Doxygen/html/md_README.html @@ -0,0 +1,96 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Python module for binary_c</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +</div><!-- top --> +<div class="header"> + <div class="headertitle"> +<div class="title">Python module for binary_c </div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock"><p>Based on a original work by Jeff Andrews (can be found in old_solution/ directory) updated and extended for Python3 by Robert Izzard, David hendriks</p> +<p>Warning : THIS CODE IS EXPERIMENTAL!</p> +<p><a href="#" onclick="location.href='mai'+'lto:'+'r.i'+'zz'+'ard'+'@s'+'urr'+'ey'+'.ac'+'.u'+'k'; return false;">r.izz<span style="display: none;">.nosp@m.</span>ard@<span style="display: none;">.nosp@m.</span>surre<span style="display: none;">.nosp@m.</span>y.ac<span style="display: none;">.nosp@m.</span>.uk</a> <a href="http://personal.ph.surrey.ac.uk/~ri0005/binary_c.html">http://personal.ph.surrey.ac.uk/~ri0005/binary_c.html</a> 09/06/2019</p> +<h2>Requirements </h2> +<ul> +<li>Python3</li> +<li>binary_c version 2.1+</li> +<li>requirements.txt (no?)</li> +</ul> +<h2>Environment variables </h2> +<p>Before compilation you should set the following environment variables:</p> +<ul> +<li>required: <code>BINARY_C</code> should point to the root directory of your binary_c installation</li> +<li>recommended: <code>LD_LIBRARY_PATH</code> should include $BINARY_C/src and whatever directories are required to run binary_c (e.g. locations of libgsl, libmemoize, librinterpolate, etc.)</li> +<li>recommended: <code>LIBRARY_PATH</code> should include whatever directories are required to build binary_c (e.g. locations of libgsl, libmemoize, librinterpolate, etc.)</li> +</ul> +<h2>Build instructions </h2> +<p>To build the module, make sure you have built binary_c (with <code>make</code> in the binary_c root directory), its shared library (with <code>make libbinary_c.so</code> in the binary_c root directory), and set environment variables as described above, then run the following code in t: </p><div class="fragment"><div class="line">make clean</div><div class="line">make</div></div><!-- fragment --><p> Then to test the Python module:</p> +<div class="fragment"><div class="line">python3 ./python_API_test.py</div></div><!-- fragment --><p> You will require whatever libraries with which binary_c was compiled, as well as the compiler with which Python was built (usually gcc, which is easily installed on most systems).</p> +<p>If you want to be able to import the binary_c module correctly for child directories (or anywhere for that matter), execute or put the following code in your .bashrc/.zshrc: </p><div class="fragment"><div class="line">export LD_LIBRARY_PATH=<full path to directory containing libbinary_c_api.so>:$LD_LIBRARY_PATH</div><div class="line">export PYTHONPATH=<full path to directory containing libbinary_c_api.so>:$PYTHONPATH</div></div><!-- fragment --><h2>Usage notes </h2> +<p>When running a jupyter notebook and importing binary_c, it might happen that the module binary_c cannot be found. I experienced this when I executed Jupyter Notebook from a virtual environment which didnt use the same python (version/binary/shim) as the one I built this library with. Make sure jupyter does use the same underlying python version/binary/shim. That resolved the issue for me.</p> +<p>Also: I figured that having binaryc output the log like "<LOG HEADER> t=10e4 ..." (i.e. printing the parameter names as well as their values) would be useful because in that way one can easily have python read that out automatically instead of having to manually copy the list of parameter names.</p> +<p>See examples/ dir for some working examples </p> +</div></div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/menu.js b/docs/Doxygen/html/menu.js new file mode 100644 index 0000000000000000000000000000000000000000..97db4c2392278bf9ddbdff3e8d05ac757cb06db9 --- /dev/null +++ b/docs/Doxygen/html/menu.js @@ -0,0 +1,26 @@ +function initMenu(relPath,searchEnabled,serverSide,searchPage,search) { + function makeTree(data,relPath) { + var result=''; + if ('children' in data) { + result+='<ul>'; + for (var i in data.children) { + result+='<li><a href="'+relPath+data.children[i].url+'">'+ + data.children[i].text+'</a>'+ + makeTree(data.children[i],relPath)+'</li>'; + } + result+='</ul>'; + } + return result; + } + + $('#main-nav').append(makeTree(menudata,relPath)); + $('#main-nav').children(':first').addClass('sm sm-dox').attr('id','main-menu'); + if (searchEnabled) { + if (serverSide) { + $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><div class="left"><form id="FSearchBox" action="'+searchPage+'" method="get"><img id="MSearchSelect" src="'+relPath+'search/mag.png" alt=""/><input type="text" id="MSearchField" name="query" value="'+search+'" size="20" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)"></form></div><div class="right"></div></div></li>'); + } else { + $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><span class="left"><img id="MSearchSelect" src="'+relPath+'search/mag_sel.png" onmouseover="return searchBox.OnSearchSelectShow()" onmouseout="return searchBox.OnSearchSelectHide()" alt=""/><input type="text" id="MSearchField" value="'+search+'" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)" onkeyup="searchBox.OnSearchFieldChange(event)"/></span><span class="right"><a id="MSearchClose" href="javascript:searchBox.CloseResultsWindow()"><img id="MSearchCloseImg" border="0" src="'+relPath+'search/close.png" alt=""/></a></span></div></li>'); + } + } + $('#main-menu').smartmenus(); +} diff --git a/docs/Doxygen/html/menudata.js b/docs/Doxygen/html/menudata.js new file mode 100644 index 0000000000000000000000000000000000000000..19c56ccd425bcd19406d0b910e4ac74e7cbbc3fb --- /dev/null +++ b/docs/Doxygen/html/menudata.js @@ -0,0 +1,11 @@ +var menudata={children:[ +{text:"Main Page",url:"index.html"}, +{text:"Related Pages",url:"pages.html"}, +{text:"Classes",url:"annotated.html",children:[ +{text:"Class List",url:"annotated.html"}, +{text:"Class Index",url:"classes.html"}, +{text:"Class Members",url:"functions.html",children:[ +{text:"All",url:"functions.html"}, +{text:"Variables",url:"functions_vars.html"}]}]}, +{text:"Files",url:"files.html",children:[ +{text:"File List",url:"files.html"}]}]} diff --git a/docs/Doxygen/html/nav_f.png b/docs/Doxygen/html/nav_f.png new file mode 100644 index 0000000000000000000000000000000000000000..72a58a529ed3a9ed6aa0c51a79cf207e026deee2 Binary files /dev/null and b/docs/Doxygen/html/nav_f.png differ diff --git a/docs/Doxygen/html/nav_g.png b/docs/Doxygen/html/nav_g.png new file mode 100644 index 0000000000000000000000000000000000000000..2093a237a94f6c83e19ec6e5fd42f7ddabdafa81 Binary files /dev/null and b/docs/Doxygen/html/nav_g.png differ diff --git a/docs/Doxygen/html/nav_h.png b/docs/Doxygen/html/nav_h.png new file mode 100644 index 0000000000000000000000000000000000000000..33389b101d9cd9b4c98ad286b5d9c46a6671f650 Binary files /dev/null and b/docs/Doxygen/html/nav_h.png differ diff --git a/docs/Doxygen/html/open.png b/docs/Doxygen/html/open.png new file mode 100644 index 0000000000000000000000000000000000000000..30f75c7efe2dd0c9e956e35b69777a02751f048b Binary files /dev/null and b/docs/Doxygen/html/open.png differ diff --git a/docs/Doxygen/html/pages.html b/docs/Doxygen/html/pages.html new file mode 100644 index 0000000000000000000000000000000000000000..0bd43bc015aea8dcbc7fb22755c8c6496c432195 --- /dev/null +++ b/docs/Doxygen/html/pages.html @@ -0,0 +1,78 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Related Pages</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +</div><!-- top --> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div class="header"> + <div class="headertitle"> +<div class="title">Related Pages</div> </div> +</div><!--header--> +<div class="contents"> +<div class="textblock">Here is a list of all related documentation pages:</div><div class="directory"> +<table class="directory"> +<tr id="row_0_" class="even"><td class="entry"><span style="width:16px;display:inline-block;"> </span><a class="el" href="md_README.html" target="_self">Python module for binary_c</a></td><td class="desc"></td></tr> +</table> +</div><!-- directory --> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_0.html b/docs/Doxygen/html/search/all_0.html new file mode 100644 index 0000000000000000000000000000000000000000..f25360b71b0466ad657ea813f4503fd5af0c610f --- /dev/null +++ b/docs/Doxygen/html/search/all_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_0.js b/docs/Doxygen/html/search/all_0.js new file mode 100644 index 0000000000000000000000000000000000000000..35d98a2f991faa820b343af73cad1099bf164d16 --- /dev/null +++ b/docs/Doxygen/html/search/all_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['a',['a',['../structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6',1,'BoxStruct_struct']]] +]; diff --git a/docs/Doxygen/html/search/all_1.html b/docs/Doxygen/html/search/all_1.html new file mode 100644 index 0000000000000000000000000000000000000000..b13f0f7f38526ad07c057f6fe19d89c825f6dcc7 --- /dev/null +++ b/docs/Doxygen/html/search/all_1.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_1.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_1.js b/docs/Doxygen/html/search/all_1.js new file mode 100644 index 0000000000000000000000000000000000000000..2f4a5735cdfefd62d1e75f5e64659ca830632984 --- /dev/null +++ b/docs/Doxygen/html/search/all_1.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['b',['b',['../structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197',1,'BoxStruct_struct']]], + ['boxstruct_5fstruct',['BoxStruct_struct',['../structBoxStruct__struct.html',1,'']]] +]; diff --git a/docs/Doxygen/html/search/all_2.html b/docs/Doxygen/html/search/all_2.html new file mode 100644 index 0000000000000000000000000000000000000000..9543c57b1d268fbd22a0d71b0df96e0223cf633e --- /dev/null +++ b/docs/Doxygen/html/search/all_2.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_2.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_2.js b/docs/Doxygen/html/search/all_2.js new file mode 100644 index 0000000000000000000000000000000000000000..da91247c17f977d9ea04cb4d159fe72eace1f8cb --- /dev/null +++ b/docs/Doxygen/html/search/all_2.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['c',['c',['../structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6',1,'BoxStruct_struct']]] +]; diff --git a/docs/Doxygen/html/search/all_3.html b/docs/Doxygen/html/search/all_3.html new file mode 100644 index 0000000000000000000000000000000000000000..03405c0fb220c4f68ac1cb184cb7e256588449cd --- /dev/null +++ b/docs/Doxygen/html/search/all_3.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_3.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_3.js b/docs/Doxygen/html/search/all_3.js new file mode 100644 index 0000000000000000000000000000000000000000..82516cdf8bba85773dd187f5fb70c56d6a9c054b --- /dev/null +++ b/docs/Doxygen/html/search/all_3.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['name',['name',['../structpoint3d.html#afb9519af724fab8e88b239b60c864a6d',1,'point3d']]], + ['namelength',['namelength',['../structpoint3d.html#a809caeed7433b4f182554ef12f8705a9',1,'point3d']]] +]; diff --git a/docs/Doxygen/html/search/all_4.html b/docs/Doxygen/html/search/all_4.html new file mode 100644 index 0000000000000000000000000000000000000000..8e1f4b9cd9d6012635eab86c12ef5adf015dcf8f --- /dev/null +++ b/docs/Doxygen/html/search/all_4.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_4.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_4.js b/docs/Doxygen/html/search/all_4.js new file mode 100644 index 0000000000000000000000000000000000000000..3a9ae56a4c3ffc6d0f4c25a528c02e2892f2b80f --- /dev/null +++ b/docs/Doxygen/html/search/all_4.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['python_20module_20for_20binary_5fc',['Python module for binary_c',['../md_README.html',1,'']]], + ['point3d',['point3d',['../structpoint3d.html',1,'']]] +]; diff --git a/docs/Doxygen/html/search/all_5.html b/docs/Doxygen/html/search/all_5.html new file mode 100644 index 0000000000000000000000000000000000000000..89a879ea9b6aa5e5dc663a2fc3fbdcbd0aadb888 --- /dev/null +++ b/docs/Doxygen/html/search/all_5.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_5.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_5.js b/docs/Doxygen/html/search/all_5.js new file mode 100644 index 0000000000000000000000000000000000000000..26684035563aecb107e4c87d8e1f801f9466e343 --- /dev/null +++ b/docs/Doxygen/html/search/all_5.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['x',['x',['../structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9',1,'point3d']]] +]; diff --git a/docs/Doxygen/html/search/all_6.html b/docs/Doxygen/html/search/all_6.html new file mode 100644 index 0000000000000000000000000000000000000000..6afac066223c120bce6381514f25c49be32d226c --- /dev/null +++ b/docs/Doxygen/html/search/all_6.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_6.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_6.js b/docs/Doxygen/html/search/all_6.js new file mode 100644 index 0000000000000000000000000000000000000000..0938c2f46df614248f6e1c7940e2f99765968794 --- /dev/null +++ b/docs/Doxygen/html/search/all_6.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['y',['y',['../structpoint3d.html#af76302f192767fd9546392affbe5631c',1,'point3d']]] +]; diff --git a/docs/Doxygen/html/search/all_7.html b/docs/Doxygen/html/search/all_7.html new file mode 100644 index 0000000000000000000000000000000000000000..de1910770531c54e423e2b3a88095bd205a78739 --- /dev/null +++ b/docs/Doxygen/html/search/all_7.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="all_7.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/all_7.js b/docs/Doxygen/html/search/all_7.js new file mode 100644 index 0000000000000000000000000000000000000000..3af16c7c3352bd606e920ce535800febb96abe43 --- /dev/null +++ b/docs/Doxygen/html/search/all_7.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['z',['z',['../structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1',1,'point3d']]] +]; diff --git a/docs/Doxygen/html/search/classes_0.html b/docs/Doxygen/html/search/classes_0.html new file mode 100644 index 0000000000000000000000000000000000000000..1c3e406ac8e46c5191ec2645d9c4b113e60f8a77 --- /dev/null +++ b/docs/Doxygen/html/search/classes_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="classes_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/classes_0.js b/docs/Doxygen/html/search/classes_0.js new file mode 100644 index 0000000000000000000000000000000000000000..e455745a94d0dcf479745c991d853e7758c1df7d --- /dev/null +++ b/docs/Doxygen/html/search/classes_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['boxstruct_5fstruct',['BoxStruct_struct',['../structBoxStruct__struct.html',1,'']]] +]; diff --git a/docs/Doxygen/html/search/classes_1.html b/docs/Doxygen/html/search/classes_1.html new file mode 100644 index 0000000000000000000000000000000000000000..a8e706950879357872801afbe089184c16409b33 --- /dev/null +++ b/docs/Doxygen/html/search/classes_1.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="classes_1.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/classes_1.js b/docs/Doxygen/html/search/classes_1.js new file mode 100644 index 0000000000000000000000000000000000000000..fc8fa20982d0e2aa030ffb6ca0fc54c59955d3d0 --- /dev/null +++ b/docs/Doxygen/html/search/classes_1.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['point3d',['point3d',['../structpoint3d.html',1,'']]] +]; diff --git a/docs/Doxygen/html/search/close.png b/docs/Doxygen/html/search/close.png new file mode 100644 index 0000000000000000000000000000000000000000..9342d3dfeea7b7c4ee610987e717804b5a42ceb9 Binary files /dev/null and b/docs/Doxygen/html/search/close.png differ diff --git a/docs/Doxygen/html/search/mag_sel.png b/docs/Doxygen/html/search/mag_sel.png new file mode 100644 index 0000000000000000000000000000000000000000..81f6040a2092402b4d98f9ffa8855d12a0d4ca17 Binary files /dev/null and b/docs/Doxygen/html/search/mag_sel.png differ diff --git a/docs/Doxygen/html/search/nomatches.html b/docs/Doxygen/html/search/nomatches.html new file mode 100644 index 0000000000000000000000000000000000000000..b1ded27e9ad6af3a2ac11e6b21ce159dcaf87e0c --- /dev/null +++ b/docs/Doxygen/html/search/nomatches.html @@ -0,0 +1,12 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="NoMatches">No Matches</div> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/pages_0.html b/docs/Doxygen/html/search/pages_0.html new file mode 100644 index 0000000000000000000000000000000000000000..4955b9e4f8ae5a81615d4061e19e097c457498ba --- /dev/null +++ b/docs/Doxygen/html/search/pages_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="pages_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/pages_0.js b/docs/Doxygen/html/search/pages_0.js new file mode 100644 index 0000000000000000000000000000000000000000..c39d59ce593c158707f7ad77eb8481d7838c2b5f --- /dev/null +++ b/docs/Doxygen/html/search/pages_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['python_20module_20for_20binary_5fc',['Python module for binary_c',['../md_README.html',1,'']]] +]; diff --git a/docs/Doxygen/html/search/search.css b/docs/Doxygen/html/search/search.css new file mode 100644 index 0000000000000000000000000000000000000000..3cf9df94a419c3175edbf2ca1719a2deb7a497dd --- /dev/null +++ b/docs/Doxygen/html/search/search.css @@ -0,0 +1,271 @@ +/*---------------- Search Box */ + +#FSearchBox { + float: left; +} + +#MSearchBox { + white-space : nowrap; + float: none; + margin-top: 8px; + right: 0px; + width: 170px; + height: 24px; + z-index: 102; +} + +#MSearchBox .left +{ + display:block; + position:absolute; + left:10px; + width:20px; + height:19px; + background:url('search_l.png') no-repeat; + background-position:right; +} + +#MSearchSelect { + display:block; + position:absolute; + width:20px; + height:19px; +} + +.left #MSearchSelect { + left:4px; +} + +.right #MSearchSelect { + right:5px; +} + +#MSearchField { + display:block; + position:absolute; + height:19px; + background:url('search_m.png') repeat-x; + border:none; + width:115px; + margin-left:20px; + padding-left:4px; + color: #909090; + outline: none; + font: 9pt Arial, Verdana, sans-serif; + -webkit-border-radius: 0px; +} + +#FSearchBox #MSearchField { + margin-left:15px; +} + +#MSearchBox .right { + display:block; + position:absolute; + right:10px; + top:8px; + width:20px; + height:19px; + background:url('search_r.png') no-repeat; + background-position:left; +} + +#MSearchClose { + display: none; + position: absolute; + top: 4px; + background : none; + border: none; + margin: 0px 4px 0px 0px; + padding: 0px 0px; + outline: none; +} + +.left #MSearchClose { + left: 6px; +} + +.right #MSearchClose { + right: 2px; +} + +.MSearchBoxActive #MSearchField { + color: #000000; +} + +/*---------------- Search filter selection */ + +#MSearchSelectWindow { + display: none; + position: absolute; + left: 0; top: 0; + border: 1px solid #90A5CE; + background-color: #F9FAFC; + z-index: 10001; + padding-top: 4px; + padding-bottom: 4px; + -moz-border-radius: 4px; + -webkit-border-top-left-radius: 4px; + -webkit-border-top-right-radius: 4px; + -webkit-border-bottom-left-radius: 4px; + -webkit-border-bottom-right-radius: 4px; + -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); +} + +.SelectItem { + font: 8pt Arial, Verdana, sans-serif; + padding-left: 2px; + padding-right: 12px; + border: 0px; +} + +span.SelectionMark { + margin-right: 4px; + font-family: monospace; + outline-style: none; + text-decoration: none; +} + +a.SelectItem { + display: block; + outline-style: none; + color: #000000; + text-decoration: none; + padding-left: 6px; + padding-right: 12px; +} + +a.SelectItem:focus, +a.SelectItem:active { + color: #000000; + outline-style: none; + text-decoration: none; +} + +a.SelectItem:hover { + color: #FFFFFF; + background-color: #3D578C; + outline-style: none; + text-decoration: none; + cursor: pointer; + display: block; +} + +/*---------------- Search results window */ + +iframe#MSearchResults { + width: 60ex; + height: 15em; +} + +#MSearchResultsWindow { + display: none; + position: absolute; + left: 0; top: 0; + border: 1px solid #000; + background-color: #EEF1F7; + z-index:10000; +} + +/* ----------------------------------- */ + + +#SRIndex { + clear:both; + padding-bottom: 15px; +} + +.SREntry { + font-size: 10pt; + padding-left: 1ex; +} + +.SRPage .SREntry { + font-size: 8pt; + padding: 1px 5px; +} + +body.SRPage { + margin: 5px 2px; +} + +.SRChildren { + padding-left: 3ex; padding-bottom: .5em +} + +.SRPage .SRChildren { + display: none; +} + +.SRSymbol { + font-weight: bold; + color: #425E97; + font-family: Arial, Verdana, sans-serif; + text-decoration: none; + outline: none; +} + +a.SRScope { + display: block; + color: #425E97; + font-family: Arial, Verdana, sans-serif; + text-decoration: none; + outline: none; +} + +a.SRSymbol:focus, a.SRSymbol:active, +a.SRScope:focus, a.SRScope:active { + text-decoration: underline; +} + +span.SRScope { + padding-left: 4px; +} + +.SRPage .SRStatus { + padding: 2px 5px; + font-size: 8pt; + font-style: italic; +} + +.SRResult { + display: none; +} + +DIV.searchresults { + margin-left: 10px; + margin-right: 10px; +} + +/*---------------- External search page results */ + +.searchresult { + background-color: #F0F3F8; +} + +.pages b { + color: white; + padding: 5px 5px 3px 5px; + background-image: url("../tab_a.png"); + background-repeat: repeat-x; + text-shadow: 0 1px 1px #000000; +} + +.pages { + line-height: 17px; + margin-left: 4px; + text-decoration: none; +} + +.hl { + font-weight: bold; +} + +#searchresults { + margin-bottom: 20px; +} + +.searchpages { + margin-top: 10px; +} + diff --git a/docs/Doxygen/html/search/search.js b/docs/Doxygen/html/search/search.js new file mode 100644 index 0000000000000000000000000000000000000000..dedce3bf093890b8693ec9b110414855542fb79b --- /dev/null +++ b/docs/Doxygen/html/search/search.js @@ -0,0 +1,791 @@ +function convertToId(search) +{ + var result = ''; + for (i=0;i<search.length;i++) + { + var c = search.charAt(i); + var cn = c.charCodeAt(0); + if (c.match(/[a-z0-9\u0080-\uFFFF]/)) + { + result+=c; + } + else if (cn<16) + { + result+="_0"+cn.toString(16); + } + else + { + result+="_"+cn.toString(16); + } + } + return result; +} + +function getXPos(item) +{ + var x = 0; + if (item.offsetWidth) + { + while (item && item!=document.body) + { + x += item.offsetLeft; + item = item.offsetParent; + } + } + return x; +} + +function getYPos(item) +{ + var y = 0; + if (item.offsetWidth) + { + while (item && item!=document.body) + { + y += item.offsetTop; + item = item.offsetParent; + } + } + return y; +} + +/* A class handling everything associated with the search panel. + + Parameters: + name - The name of the global variable that will be + storing this instance. Is needed to be able to set timeouts. + resultPath - path to use for external files +*/ +function SearchBox(name, resultsPath, inFrame, label) +{ + if (!name || !resultsPath) { alert("Missing parameters to SearchBox."); } + + // ---------- Instance variables + this.name = name; + this.resultsPath = resultsPath; + this.keyTimeout = 0; + this.keyTimeoutLength = 500; + this.closeSelectionTimeout = 300; + this.lastSearchValue = ""; + this.lastResultsPage = ""; + this.hideTimeout = 0; + this.searchIndex = 0; + this.searchActive = false; + this.insideFrame = inFrame; + this.searchLabel = label; + + // ----------- DOM Elements + + this.DOMSearchField = function() + { return document.getElementById("MSearchField"); } + + this.DOMSearchSelect = function() + { return document.getElementById("MSearchSelect"); } + + this.DOMSearchSelectWindow = function() + { return document.getElementById("MSearchSelectWindow"); } + + this.DOMPopupSearchResults = function() + { return document.getElementById("MSearchResults"); } + + this.DOMPopupSearchResultsWindow = function() + { return document.getElementById("MSearchResultsWindow"); } + + this.DOMSearchClose = function() + { return document.getElementById("MSearchClose"); } + + this.DOMSearchBox = function() + { return document.getElementById("MSearchBox"); } + + // ------------ Event Handlers + + // Called when focus is added or removed from the search field. + this.OnSearchFieldFocus = function(isActive) + { + this.Activate(isActive); + } + + this.OnSearchSelectShow = function() + { + var searchSelectWindow = this.DOMSearchSelectWindow(); + var searchField = this.DOMSearchSelect(); + + if (this.insideFrame) + { + var left = getXPos(searchField); + var top = getYPos(searchField); + left += searchField.offsetWidth + 6; + top += searchField.offsetHeight; + + // show search selection popup + searchSelectWindow.style.display='block'; + left -= searchSelectWindow.offsetWidth; + searchSelectWindow.style.left = left + 'px'; + searchSelectWindow.style.top = top + 'px'; + } + else + { + var left = getXPos(searchField); + var top = getYPos(searchField); + top += searchField.offsetHeight; + + // show search selection popup + searchSelectWindow.style.display='block'; + searchSelectWindow.style.left = left + 'px'; + searchSelectWindow.style.top = top + 'px'; + } + + // stop selection hide timer + if (this.hideTimeout) + { + clearTimeout(this.hideTimeout); + this.hideTimeout=0; + } + return false; // to avoid "image drag" default event + } + + this.OnSearchSelectHide = function() + { + this.hideTimeout = setTimeout(this.name +".CloseSelectionWindow()", + this.closeSelectionTimeout); + } + + // Called when the content of the search field is changed. + this.OnSearchFieldChange = function(evt) + { + if (this.keyTimeout) // kill running timer + { + clearTimeout(this.keyTimeout); + this.keyTimeout = 0; + } + + var e = (evt) ? evt : window.event; // for IE + if (e.keyCode==40 || e.keyCode==13) + { + if (e.shiftKey==1) + { + this.OnSearchSelectShow(); + var win=this.DOMSearchSelectWindow(); + for (i=0;i<win.childNodes.length;i++) + { + var child = win.childNodes[i]; // get span within a + if (child.className=='SelectItem') + { + child.focus(); + return; + } + } + return; + } + else if (window.frames.MSearchResults.searchResults) + { + var elem = window.frames.MSearchResults.searchResults.NavNext(0); + if (elem) elem.focus(); + } + } + else if (e.keyCode==27) // Escape out of the search field + { + this.DOMSearchField().blur(); + this.DOMPopupSearchResultsWindow().style.display = 'none'; + this.DOMSearchClose().style.display = 'none'; + this.lastSearchValue = ''; + this.Activate(false); + return; + } + + // strip whitespaces + var searchValue = this.DOMSearchField().value.replace(/ +/g, ""); + + if (searchValue != this.lastSearchValue) // search value has changed + { + if (searchValue != "") // non-empty search + { + // set timer for search update + this.keyTimeout = setTimeout(this.name + '.Search()', + this.keyTimeoutLength); + } + else // empty search field + { + this.DOMPopupSearchResultsWindow().style.display = 'none'; + this.DOMSearchClose().style.display = 'none'; + this.lastSearchValue = ''; + } + } + } + + this.SelectItemCount = function(id) + { + var count=0; + var win=this.DOMSearchSelectWindow(); + for (i=0;i<win.childNodes.length;i++) + { + var child = win.childNodes[i]; // get span within a + if (child.className=='SelectItem') + { + count++; + } + } + return count; + } + + this.SelectItemSet = function(id) + { + var i,j=0; + var win=this.DOMSearchSelectWindow(); + for (i=0;i<win.childNodes.length;i++) + { + var child = win.childNodes[i]; // get span within a + if (child.className=='SelectItem') + { + var node = child.firstChild; + if (j==id) + { + node.innerHTML='•'; + } + else + { + node.innerHTML=' '; + } + j++; + } + } + } + + // Called when an search filter selection is made. + // set item with index id as the active item + this.OnSelectItem = function(id) + { + this.searchIndex = id; + this.SelectItemSet(id); + var searchValue = this.DOMSearchField().value.replace(/ +/g, ""); + if (searchValue!="" && this.searchActive) // something was found -> do a search + { + this.Search(); + } + } + + this.OnSearchSelectKey = function(evt) + { + var e = (evt) ? evt : window.event; // for IE + if (e.keyCode==40 && this.searchIndex<this.SelectItemCount()) // Down + { + this.searchIndex++; + this.OnSelectItem(this.searchIndex); + } + else if (e.keyCode==38 && this.searchIndex>0) // Up + { + this.searchIndex--; + this.OnSelectItem(this.searchIndex); + } + else if (e.keyCode==13 || e.keyCode==27) + { + this.OnSelectItem(this.searchIndex); + this.CloseSelectionWindow(); + this.DOMSearchField().focus(); + } + return false; + } + + // --------- Actions + + // Closes the results window. + this.CloseResultsWindow = function() + { + this.DOMPopupSearchResultsWindow().style.display = 'none'; + this.DOMSearchClose().style.display = 'none'; + this.Activate(false); + } + + this.CloseSelectionWindow = function() + { + this.DOMSearchSelectWindow().style.display = 'none'; + } + + // Performs a search. + this.Search = function() + { + this.keyTimeout = 0; + + // strip leading whitespace + var searchValue = this.DOMSearchField().value.replace(/^ +/, ""); + + var code = searchValue.toLowerCase().charCodeAt(0); + var idxChar = searchValue.substr(0, 1).toLowerCase(); + if ( 0xD800 <= code && code <= 0xDBFF && searchValue > 1) // surrogate pair + { + idxChar = searchValue.substr(0, 2); + } + + var resultsPage; + var resultsPageWithSearch; + var hasResultsPage; + + var idx = indexSectionsWithContent[this.searchIndex].indexOf(idxChar); + if (idx!=-1) + { + var hexCode=idx.toString(16); + resultsPage = this.resultsPath + '/' + indexSectionNames[this.searchIndex] + '_' + hexCode + '.html'; + resultsPageWithSearch = resultsPage+'?'+escape(searchValue); + hasResultsPage = true; + } + else // nothing available for this search term + { + resultsPage = this.resultsPath + '/nomatches.html'; + resultsPageWithSearch = resultsPage; + hasResultsPage = false; + } + + window.frames.MSearchResults.location = resultsPageWithSearch; + var domPopupSearchResultsWindow = this.DOMPopupSearchResultsWindow(); + + if (domPopupSearchResultsWindow.style.display!='block') + { + var domSearchBox = this.DOMSearchBox(); + this.DOMSearchClose().style.display = 'inline'; + if (this.insideFrame) + { + var domPopupSearchResults = this.DOMPopupSearchResults(); + domPopupSearchResultsWindow.style.position = 'relative'; + domPopupSearchResultsWindow.style.display = 'block'; + var width = document.body.clientWidth - 8; // the -8 is for IE :-( + domPopupSearchResultsWindow.style.width = width + 'px'; + domPopupSearchResults.style.width = width + 'px'; + } + else + { + var domPopupSearchResults = this.DOMPopupSearchResults(); + var left = getXPos(domSearchBox) + 150; // domSearchBox.offsetWidth; + var top = getYPos(domSearchBox) + 20; // domSearchBox.offsetHeight + 1; + domPopupSearchResultsWindow.style.display = 'block'; + left -= domPopupSearchResults.offsetWidth; + domPopupSearchResultsWindow.style.top = top + 'px'; + domPopupSearchResultsWindow.style.left = left + 'px'; + } + } + + this.lastSearchValue = searchValue; + this.lastResultsPage = resultsPage; + } + + // -------- Activation Functions + + // Activates or deactivates the search panel, resetting things to + // their default values if necessary. + this.Activate = function(isActive) + { + if (isActive || // open it + this.DOMPopupSearchResultsWindow().style.display == 'block' + ) + { + this.DOMSearchBox().className = 'MSearchBoxActive'; + + var searchField = this.DOMSearchField(); + + if (searchField.value == this.searchLabel) // clear "Search" term upon entry + { + searchField.value = ''; + this.searchActive = true; + } + } + else if (!isActive) // directly remove the panel + { + this.DOMSearchBox().className = 'MSearchBoxInactive'; + this.DOMSearchField().value = this.searchLabel; + this.searchActive = false; + this.lastSearchValue = '' + this.lastResultsPage = ''; + } + } +} + +// ----------------------------------------------------------------------- + +// The class that handles everything on the search results page. +function SearchResults(name) +{ + // The number of matches from the last run of <Search()>. + this.lastMatchCount = 0; + this.lastKey = 0; + this.repeatOn = false; + + // Toggles the visibility of the passed element ID. + this.FindChildElement = function(id) + { + var parentElement = document.getElementById(id); + var element = parentElement.firstChild; + + while (element && element!=parentElement) + { + if (element.nodeName == 'DIV' && element.className == 'SRChildren') + { + return element; + } + + if (element.nodeName == 'DIV' && element.hasChildNodes()) + { + element = element.firstChild; + } + else if (element.nextSibling) + { + element = element.nextSibling; + } + else + { + do + { + element = element.parentNode; + } + while (element && element!=parentElement && !element.nextSibling); + + if (element && element!=parentElement) + { + element = element.nextSibling; + } + } + } + } + + this.Toggle = function(id) + { + var element = this.FindChildElement(id); + if (element) + { + if (element.style.display == 'block') + { + element.style.display = 'none'; + } + else + { + element.style.display = 'block'; + } + } + } + + // Searches for the passed string. If there is no parameter, + // it takes it from the URL query. + // + // Always returns true, since other documents may try to call it + // and that may or may not be possible. + this.Search = function(search) + { + if (!search) // get search word from URL + { + search = window.location.search; + search = search.substring(1); // Remove the leading '?' + search = unescape(search); + } + + search = search.replace(/^ +/, ""); // strip leading spaces + search = search.replace(/ +$/, ""); // strip trailing spaces + search = search.toLowerCase(); + search = convertToId(search); + + var resultRows = document.getElementsByTagName("div"); + var matches = 0; + + var i = 0; + while (i < resultRows.length) + { + var row = resultRows.item(i); + if (row.className == "SRResult") + { + var rowMatchName = row.id.toLowerCase(); + rowMatchName = rowMatchName.replace(/^sr\d*_/, ''); // strip 'sr123_' + + if (search.length<=rowMatchName.length && + rowMatchName.substr(0, search.length)==search) + { + row.style.display = 'block'; + matches++; + } + else + { + row.style.display = 'none'; + } + } + i++; + } + document.getElementById("Searching").style.display='none'; + if (matches == 0) // no results + { + document.getElementById("NoMatches").style.display='block'; + } + else // at least one result + { + document.getElementById("NoMatches").style.display='none'; + } + this.lastMatchCount = matches; + return true; + } + + // return the first item with index index or higher that is visible + this.NavNext = function(index) + { + var focusItem; + while (1) + { + var focusName = 'Item'+index; + focusItem = document.getElementById(focusName); + if (focusItem && focusItem.parentNode.parentNode.style.display=='block') + { + break; + } + else if (!focusItem) // last element + { + break; + } + focusItem=null; + index++; + } + return focusItem; + } + + this.NavPrev = function(index) + { + var focusItem; + while (1) + { + var focusName = 'Item'+index; + focusItem = document.getElementById(focusName); + if (focusItem && focusItem.parentNode.parentNode.style.display=='block') + { + break; + } + else if (!focusItem) // last element + { + break; + } + focusItem=null; + index--; + } + return focusItem; + } + + this.ProcessKeys = function(e) + { + if (e.type == "keydown") + { + this.repeatOn = false; + this.lastKey = e.keyCode; + } + else if (e.type == "keypress") + { + if (!this.repeatOn) + { + if (this.lastKey) this.repeatOn = true; + return false; // ignore first keypress after keydown + } + } + else if (e.type == "keyup") + { + this.lastKey = 0; + this.repeatOn = false; + } + return this.lastKey!=0; + } + + this.Nav = function(evt,itemIndex) + { + var e = (evt) ? evt : window.event; // for IE + if (e.keyCode==13) return true; + if (!this.ProcessKeys(e)) return false; + + if (this.lastKey==38) // Up + { + var newIndex = itemIndex-1; + var focusItem = this.NavPrev(newIndex); + if (focusItem) + { + var child = this.FindChildElement(focusItem.parentNode.parentNode.id); + if (child && child.style.display == 'block') // children visible + { + var n=0; + var tmpElem; + while (1) // search for last child + { + tmpElem = document.getElementById('Item'+newIndex+'_c'+n); + if (tmpElem) + { + focusItem = tmpElem; + } + else // found it! + { + break; + } + n++; + } + } + } + if (focusItem) + { + focusItem.focus(); + } + else // return focus to search field + { + parent.document.getElementById("MSearchField").focus(); + } + } + else if (this.lastKey==40) // Down + { + var newIndex = itemIndex+1; + var focusItem; + var item = document.getElementById('Item'+itemIndex); + var elem = this.FindChildElement(item.parentNode.parentNode.id); + if (elem && elem.style.display == 'block') // children visible + { + focusItem = document.getElementById('Item'+itemIndex+'_c0'); + } + if (!focusItem) focusItem = this.NavNext(newIndex); + if (focusItem) focusItem.focus(); + } + else if (this.lastKey==39) // Right + { + var item = document.getElementById('Item'+itemIndex); + var elem = this.FindChildElement(item.parentNode.parentNode.id); + if (elem) elem.style.display = 'block'; + } + else if (this.lastKey==37) // Left + { + var item = document.getElementById('Item'+itemIndex); + var elem = this.FindChildElement(item.parentNode.parentNode.id); + if (elem) elem.style.display = 'none'; + } + else if (this.lastKey==27) // Escape + { + parent.searchBox.CloseResultsWindow(); + parent.document.getElementById("MSearchField").focus(); + } + else if (this.lastKey==13) // Enter + { + return true; + } + return false; + } + + this.NavChild = function(evt,itemIndex,childIndex) + { + var e = (evt) ? evt : window.event; // for IE + if (e.keyCode==13) return true; + if (!this.ProcessKeys(e)) return false; + + if (this.lastKey==38) // Up + { + if (childIndex>0) + { + var newIndex = childIndex-1; + document.getElementById('Item'+itemIndex+'_c'+newIndex).focus(); + } + else // already at first child, jump to parent + { + document.getElementById('Item'+itemIndex).focus(); + } + } + else if (this.lastKey==40) // Down + { + var newIndex = childIndex+1; + var elem = document.getElementById('Item'+itemIndex+'_c'+newIndex); + if (!elem) // last child, jump to parent next parent + { + elem = this.NavNext(itemIndex+1); + } + if (elem) + { + elem.focus(); + } + } + else if (this.lastKey==27) // Escape + { + parent.searchBox.CloseResultsWindow(); + parent.document.getElementById("MSearchField").focus(); + } + else if (this.lastKey==13) // Enter + { + return true; + } + return false; + } +} + +function setKeyActions(elem,action) +{ + elem.setAttribute('onkeydown',action); + elem.setAttribute('onkeypress',action); + elem.setAttribute('onkeyup',action); +} + +function setClassAttr(elem,attr) +{ + elem.setAttribute('class',attr); + elem.setAttribute('className',attr); +} + +function createResults() +{ + var results = document.getElementById("SRResults"); + for (var e=0; e<searchData.length; e++) + { + var id = searchData[e][0]; + var srResult = document.createElement('div'); + srResult.setAttribute('id','SR_'+id); + setClassAttr(srResult,'SRResult'); + var srEntry = document.createElement('div'); + setClassAttr(srEntry,'SREntry'); + var srLink = document.createElement('a'); + srLink.setAttribute('id','Item'+e); + setKeyActions(srLink,'return searchResults.Nav(event,'+e+')'); + setClassAttr(srLink,'SRSymbol'); + srLink.innerHTML = searchData[e][1][0]; + srEntry.appendChild(srLink); + if (searchData[e][1].length==2) // single result + { + srLink.setAttribute('href',searchData[e][1][1][0]); + if (searchData[e][1][1][1]) + { + srLink.setAttribute('target','_parent'); + } + var srScope = document.createElement('span'); + setClassAttr(srScope,'SRScope'); + srScope.innerHTML = searchData[e][1][1][2]; + srEntry.appendChild(srScope); + } + else // multiple results + { + srLink.setAttribute('href','javascript:searchResults.Toggle("SR_'+id+'")'); + var srChildren = document.createElement('div'); + setClassAttr(srChildren,'SRChildren'); + for (var c=0; c<searchData[e][1].length-1; c++) + { + var srChild = document.createElement('a'); + srChild.setAttribute('id','Item'+e+'_c'+c); + setKeyActions(srChild,'return searchResults.NavChild(event,'+e+','+c+')'); + setClassAttr(srChild,'SRScope'); + srChild.setAttribute('href',searchData[e][1][c+1][0]); + if (searchData[e][1][c+1][1]) + { + srChild.setAttribute('target','_parent'); + } + srChild.innerHTML = searchData[e][1][c+1][2]; + srChildren.appendChild(srChild); + } + srEntry.appendChild(srChildren); + } + srResult.appendChild(srEntry); + results.appendChild(srResult); + } +} + +function init_search() +{ + var results = document.getElementById("MSearchSelectWindow"); + for (var key in indexSectionLabels) + { + var link = document.createElement('a'); + link.setAttribute('class','SelectItem'); + link.setAttribute('onclick','searchBox.OnSelectItem('+key+')'); + link.href='javascript:void(0)'; + link.innerHTML='<span class="SelectionMark"> </span>'+indexSectionLabels[key]; + results.appendChild(link); + } + searchBox.OnSelectItem(0); +} + diff --git a/docs/Doxygen/html/search/search_l.png b/docs/Doxygen/html/search/search_l.png new file mode 100644 index 0000000000000000000000000000000000000000..c872f4da4a01d0754f923e6c94fd8159c0621bd1 Binary files /dev/null and b/docs/Doxygen/html/search/search_l.png differ diff --git a/docs/Doxygen/html/search/search_m.png b/docs/Doxygen/html/search/search_m.png new file mode 100644 index 0000000000000000000000000000000000000000..b429a16ba641960da1e52e5da85dc80fd82635c8 Binary files /dev/null and b/docs/Doxygen/html/search/search_m.png differ diff --git a/docs/Doxygen/html/search/search_r.png b/docs/Doxygen/html/search/search_r.png new file mode 100644 index 0000000000000000000000000000000000000000..97ee8b439687084201b79c6f776a41f495c6392a Binary files /dev/null and b/docs/Doxygen/html/search/search_r.png differ diff --git a/docs/Doxygen/html/search/searchdata.js b/docs/Doxygen/html/search/searchdata.js new file mode 100644 index 0000000000000000000000000000000000000000..c383be261493e2b86361242455bb8627f3e6d71f --- /dev/null +++ b/docs/Doxygen/html/search/searchdata.js @@ -0,0 +1,24 @@ +var indexSectionsWithContent = +{ + 0: "abcnpxyz", + 1: "bp", + 2: "abcnxyz", + 3: "p" +}; + +var indexSectionNames = +{ + 0: "all", + 1: "classes", + 2: "variables", + 3: "pages" +}; + +var indexSectionLabels = +{ + 0: "All", + 1: "Classes", + 2: "Variables", + 3: "Pages" +}; + diff --git a/docs/Doxygen/html/search/variables_0.html b/docs/Doxygen/html/search/variables_0.html new file mode 100644 index 0000000000000000000000000000000000000000..74ce80724871dc2f9f04151a60a432f8114f9256 --- /dev/null +++ b/docs/Doxygen/html/search/variables_0.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_0.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/variables_0.js b/docs/Doxygen/html/search/variables_0.js new file mode 100644 index 0000000000000000000000000000000000000000..35d98a2f991faa820b343af73cad1099bf164d16 --- /dev/null +++ b/docs/Doxygen/html/search/variables_0.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['a',['a',['../structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6',1,'BoxStruct_struct']]] +]; diff --git a/docs/Doxygen/html/search/variables_1.html b/docs/Doxygen/html/search/variables_1.html new file mode 100644 index 0000000000000000000000000000000000000000..84237b6e770e5969d0f8a730b2e4c5ae69d6180d --- /dev/null +++ b/docs/Doxygen/html/search/variables_1.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_1.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/variables_1.js b/docs/Doxygen/html/search/variables_1.js new file mode 100644 index 0000000000000000000000000000000000000000..38107d0268798d18eb36065dea804ae718d20687 --- /dev/null +++ b/docs/Doxygen/html/search/variables_1.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['b',['b',['../structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197',1,'BoxStruct_struct']]] +]; diff --git a/docs/Doxygen/html/search/variables_2.html b/docs/Doxygen/html/search/variables_2.html new file mode 100644 index 0000000000000000000000000000000000000000..5c9de1aabf5af8455dee5449836b057c2e9c70ad --- /dev/null +++ b/docs/Doxygen/html/search/variables_2.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_2.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/variables_2.js b/docs/Doxygen/html/search/variables_2.js new file mode 100644 index 0000000000000000000000000000000000000000..da91247c17f977d9ea04cb4d159fe72eace1f8cb --- /dev/null +++ b/docs/Doxygen/html/search/variables_2.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['c',['c',['../structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6',1,'BoxStruct_struct']]] +]; diff --git a/docs/Doxygen/html/search/variables_3.html b/docs/Doxygen/html/search/variables_3.html new file mode 100644 index 0000000000000000000000000000000000000000..f95e34c60f4834a1425889fa4e083ac02fc2d8ef --- /dev/null +++ b/docs/Doxygen/html/search/variables_3.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_3.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/variables_3.js b/docs/Doxygen/html/search/variables_3.js new file mode 100644 index 0000000000000000000000000000000000000000..82516cdf8bba85773dd187f5fb70c56d6a9c054b --- /dev/null +++ b/docs/Doxygen/html/search/variables_3.js @@ -0,0 +1,5 @@ +var searchData= +[ + ['name',['name',['../structpoint3d.html#afb9519af724fab8e88b239b60c864a6d',1,'point3d']]], + ['namelength',['namelength',['../structpoint3d.html#a809caeed7433b4f182554ef12f8705a9',1,'point3d']]] +]; diff --git a/docs/Doxygen/html/search/variables_4.html b/docs/Doxygen/html/search/variables_4.html new file mode 100644 index 0000000000000000000000000000000000000000..d7db285eee2492847e1cf8aa04dcbd57174d4075 --- /dev/null +++ b/docs/Doxygen/html/search/variables_4.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_4.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/variables_4.js b/docs/Doxygen/html/search/variables_4.js new file mode 100644 index 0000000000000000000000000000000000000000..26684035563aecb107e4c87d8e1f801f9466e343 --- /dev/null +++ b/docs/Doxygen/html/search/variables_4.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['x',['x',['../structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9',1,'point3d']]] +]; diff --git a/docs/Doxygen/html/search/variables_5.html b/docs/Doxygen/html/search/variables_5.html new file mode 100644 index 0000000000000000000000000000000000000000..7bbceeb0db72eb840715b8e61e0e892aeae9c7a8 --- /dev/null +++ b/docs/Doxygen/html/search/variables_5.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_5.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/variables_5.js b/docs/Doxygen/html/search/variables_5.js new file mode 100644 index 0000000000000000000000000000000000000000..0938c2f46df614248f6e1c7940e2f99765968794 --- /dev/null +++ b/docs/Doxygen/html/search/variables_5.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['y',['y',['../structpoint3d.html#af76302f192767fd9546392affbe5631c',1,'point3d']]] +]; diff --git a/docs/Doxygen/html/search/variables_6.html b/docs/Doxygen/html/search/variables_6.html new file mode 100644 index 0000000000000000000000000000000000000000..4eb162d6742a3c17390d93084f152f6c3be56bc9 --- /dev/null +++ b/docs/Doxygen/html/search/variables_6.html @@ -0,0 +1,26 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html><head><title></title> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<link rel="stylesheet" type="text/css" href="search.css"/> +<script type="text/javascript" src="variables_6.js"></script> +<script type="text/javascript" src="search.js"></script> +</head> +<body class="SRPage"> +<div id="SRIndex"> +<div class="SRStatus" id="Loading">Loading...</div> +<div id="SRResults"></div> +<script type="text/javascript"><!-- +createResults(); +--></script> +<div class="SRStatus" id="Searching">Searching...</div> +<div class="SRStatus" id="NoMatches">No Matches</div> +<script type="text/javascript"><!-- +document.getElementById("Loading").style.display="none"; +document.getElementById("NoMatches").style.display="none"; +var searchResults = new SearchResults("searchResults"); +searchResults.Search(); +--></script> +</div> +</body> +</html> diff --git a/docs/Doxygen/html/search/variables_6.js b/docs/Doxygen/html/search/variables_6.js new file mode 100644 index 0000000000000000000000000000000000000000..3af16c7c3352bd606e920ce535800febb96abe43 --- /dev/null +++ b/docs/Doxygen/html/search/variables_6.js @@ -0,0 +1,4 @@ +var searchData= +[ + ['z',['z',['../structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1',1,'point3d']]] +]; diff --git a/docs/Doxygen/html/splitbar.png b/docs/Doxygen/html/splitbar.png new file mode 100644 index 0000000000000000000000000000000000000000..fe895f2c58179b471a22d8320b39a4bd7312ec8e Binary files /dev/null and b/docs/Doxygen/html/splitbar.png differ diff --git a/docs/Doxygen/html/structBoxStruct__struct-members.html b/docs/Doxygen/html/structBoxStruct__struct-members.html new file mode 100644 index 0000000000000000000000000000000000000000..f7f268f6efa1766b7af017f747d632ea2228b984 --- /dev/null +++ b/docs/Doxygen/html/structBoxStruct__struct-members.html @@ -0,0 +1,79 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Member List</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +</div><!-- top --> +<div class="header"> + <div class="headertitle"> +<div class="title">BoxStruct_struct Member List</div> </div> +</div><!--header--> +<div class="contents"> + +<p>This is the complete list of members for <a class="el" href="structBoxStruct__struct.html">BoxStruct_struct</a>, including all inherited members.</p> +<table class="directory"> + <tr class="even"><td class="entry"><a class="el" href="structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6">a</a></td><td class="entry"><a class="el" href="structBoxStruct__struct.html">BoxStruct_struct</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197">b</a></td><td class="entry"><a class="el" href="structBoxStruct__struct.html">BoxStruct_struct</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6">c</a></td><td class="entry"><a class="el" href="structBoxStruct__struct.html">BoxStruct_struct</a></td><td class="entry"></td></tr> +</table></div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/structBoxStruct__struct.html b/docs/Doxygen/html/structBoxStruct__struct.html new file mode 100644 index 0000000000000000000000000000000000000000..0b582a6323c58dab26c8534da72310a4d5a9b409 --- /dev/null +++ b/docs/Doxygen/html/structBoxStruct__struct.html @@ -0,0 +1,143 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: BoxStruct_struct Struct Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +</div><!-- top --> +<div class="header"> + <div class="summary"> +<a href="#pub-attribs">Public Attributes</a> | +<a href="structBoxStruct__struct-members.html">List of all members</a> </div> + <div class="headertitle"> +<div class="title">BoxStruct_struct Struct Reference</div> </div> +</div><!--header--> +<div class="contents"> + +<p>Use brief, otherwise the index won't have a brief explanation. + <a href="structBoxStruct__struct.html#details">More...</a></p> + +<p><code>#include <<a class="el" href="ding_8h_source.html">ding.h</a>></code></p> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a> +Public Attributes</h2></td></tr> +<tr class="memitem:a4593938c5e90f024e7971bdb1392d9d6"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6">a</a></td></tr> +<tr class="separator:a4593938c5e90f024e7971bdb1392d9d6"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:aee44748dc579c5d794853ee8b133d197"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197">b</a></td></tr> +<tr class="separator:aee44748dc579c5d794853ee8b133d197"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a4543370ed67b2cf5ae3f55201bea11e6"><td class="memItemLeft" align="right" valign="top">double </td><td class="memItemRight" valign="bottom"><a class="el" href="structBoxStruct__struct.html#a4543370ed67b2cf5ae3f55201bea11e6">c</a></td></tr> +<tr class="separator:a4543370ed67b2cf5ae3f55201bea11e6"><td class="memSeparator" colspan="2"> </td></tr> +</table> +<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> +<div class="textblock"><p>Use brief, otherwise the index won't have a brief explanation. </p> +<p>Detailed explanation. </p> +</div><h2 class="groupheader">Member Data Documentation</h2> +<a id="a4593938c5e90f024e7971bdb1392d9d6"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a4593938c5e90f024e7971bdb1392d9d6">◆ </a></span>a</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int BoxStruct_struct::a</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Some documentation for the member <a class="el" href="structBoxStruct__struct.html#a4593938c5e90f024e7971bdb1392d9d6">BoxStruct::a</a>. </p> + +</div> +</div> +<a id="aee44748dc579c5d794853ee8b133d197"></a> +<h2 class="memtitle"><span class="permalink"><a href="#aee44748dc579c5d794853ee8b133d197">◆ </a></span>b</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int BoxStruct_struct::b</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Some documentation for the member <a class="el" href="structBoxStruct__struct.html#aee44748dc579c5d794853ee8b133d197">BoxStruct::b</a>. </p> + +</div> +</div> +<a id="a4543370ed67b2cf5ae3f55201bea11e6"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a4543370ed67b2cf5ae3f55201bea11e6">◆ </a></span>c</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double BoxStruct_struct::c</td> + </tr> + </table> +</div><div class="memdoc"> +<p>Etc. </p> + +</div> +</div> +<hr/>The documentation for this struct was generated from the following file:<ul> +<li>testing_doxygen/<a class="el" href="ding_8h_source.html">ding.h</a></li> +</ul> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/structpoint3d-members.html b/docs/Doxygen/html/structpoint3d-members.html new file mode 100644 index 0000000000000000000000000000000000000000..4a409928cee1720339567e73af89ead4a0e66361 --- /dev/null +++ b/docs/Doxygen/html/structpoint3d-members.html @@ -0,0 +1,81 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: Member List</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +</div><!-- top --> +<div class="header"> + <div class="headertitle"> +<div class="title">point3d Member List</div> </div> +</div><!--header--> +<div class="contents"> + +<p>This is the complete list of members for <a class="el" href="structpoint3d.html">point3d</a>, including all inherited members.</p> +<table class="directory"> + <tr class="even"><td class="entry"><a class="el" href="structpoint3d.html#afb9519af724fab8e88b239b60c864a6d">name</a></td><td class="entry"><a class="el" href="structpoint3d.html">point3d</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="structpoint3d.html#a809caeed7433b4f182554ef12f8705a9">namelength</a></td><td class="entry"><a class="el" href="structpoint3d.html">point3d</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9">x</a></td><td class="entry"><a class="el" href="structpoint3d.html">point3d</a></td><td class="entry"></td></tr> + <tr><td class="entry"><a class="el" href="structpoint3d.html#af76302f192767fd9546392affbe5631c">y</a></td><td class="entry"><a class="el" href="structpoint3d.html">point3d</a></td><td class="entry"></td></tr> + <tr class="even"><td class="entry"><a class="el" href="structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1">z</a></td><td class="entry"><a class="el" href="structpoint3d.html">point3d</a></td><td class="entry"></td></tr> +</table></div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/structpoint3d.html b/docs/Doxygen/html/structpoint3d.html new file mode 100644 index 0000000000000000000000000000000000000000..e022bb8e42d4dcf32d292c8f01b192d6c4690897 --- /dev/null +++ b/docs/Doxygen/html/structpoint3d.html @@ -0,0 +1,174 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: point3d Struct Reference</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +</div><!-- top --> +<div class="header"> + <div class="summary"> +<a href="structpoint3d-members.html">List of all members</a> </div> + <div class="headertitle"> +<div class="title">point3d Struct Reference</div> </div> +</div><!--header--> +<div class="contents"> + +<p><code>#include <<a class="el" href="test_8h_source.html">test.h</a>></code></p> +<table class="memberdecls"> +<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="pub-attribs"></a> +Public Attributes</h2></td></tr> +<tr><td colspan="2"><div class="groupHeader"></div></td></tr> +<tr class="memitem:ac16dfc549efe0bd9b819ea4a9a8462a9"><td class="memItemLeft" align="right" valign="top">double </td><td class="memItemRight" valign="bottom"><a class="el" href="structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9">x</a></td></tr> +<tr class="separator:ac16dfc549efe0bd9b819ea4a9a8462a9"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:af76302f192767fd9546392affbe5631c"><td class="memItemLeft" align="right" valign="top">double </td><td class="memItemRight" valign="bottom"><a class="el" href="structpoint3d.html#af76302f192767fd9546392affbe5631c">y</a></td></tr> +<tr class="separator:af76302f192767fd9546392affbe5631c"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a96e63d7cd720242d2f79287b04a503e1"><td class="memItemLeft" align="right" valign="top">double </td><td class="memItemRight" valign="bottom"><a class="el" href="structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1">z</a></td></tr> +<tr class="separator:a96e63d7cd720242d2f79287b04a503e1"><td class="memSeparator" colspan="2"> </td></tr> +<tr><td colspan="2"><div class="groupHeader">group 2</div></td></tr> +<tr class="memitem:afb9519af724fab8e88b239b60c864a6d"><td class="memItemLeft" align="right" valign="top">char * </td><td class="memItemRight" valign="bottom"><a class="el" href="structpoint3d.html#afb9519af724fab8e88b239b60c864a6d">name</a></td></tr> +<tr class="separator:afb9519af724fab8e88b239b60c864a6d"><td class="memSeparator" colspan="2"> </td></tr> +<tr class="memitem:a809caeed7433b4f182554ef12f8705a9"><td class="memItemLeft" align="right" valign="top">int </td><td class="memItemRight" valign="bottom"><a class="el" href="structpoint3d.html#a809caeed7433b4f182554ef12f8705a9">namelength</a></td></tr> +<tr class="separator:a809caeed7433b4f182554ef12f8705a9"><td class="memSeparator" colspan="2"> </td></tr> +</table> +<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2> +<div class="textblock"><p>A structure to represent 3d vectors </p> +</div><h2 class="groupheader">Member Data Documentation</h2> +<a id="afb9519af724fab8e88b239b60c864a6d"></a> +<h2 class="memtitle"><span class="permalink"><a href="#afb9519af724fab8e88b239b60c864a6d">◆ </a></span>name</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">char* point3d::name</td> + </tr> + </table> +</div><div class="memdoc"> +<p>the name of the point </p> + +</div> +</div> +<a id="a809caeed7433b4f182554ef12f8705a9"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a809caeed7433b4f182554ef12f8705a9">◆ </a></span>namelength</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">int point3d::namelength</td> + </tr> + </table> +</div><div class="memdoc"> +<p>the size of the point name </p> + +</div> +</div> +<a id="ac16dfc549efe0bd9b819ea4a9a8462a9"></a> +<h2 class="memtitle"><span class="permalink"><a href="#ac16dfc549efe0bd9b819ea4a9a8462a9">◆ </a></span>x</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double point3d::x</td> + </tr> + </table> +</div><div class="memdoc"> +<p>the x coordinate </p> + +</div> +</div> +<a id="af76302f192767fd9546392affbe5631c"></a> +<h2 class="memtitle"><span class="permalink"><a href="#af76302f192767fd9546392affbe5631c">◆ </a></span>y</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double point3d::y</td> + </tr> + </table> +</div><div class="memdoc"> +<p>the y coordinate </p> + +</div> +</div> +<a id="a96e63d7cd720242d2f79287b04a503e1"></a> +<h2 class="memtitle"><span class="permalink"><a href="#a96e63d7cd720242d2f79287b04a503e1">◆ </a></span>z</h2> + +<div class="memitem"> +<div class="memproto"> + <table class="memname"> + <tr> + <td class="memname">double point3d::z</td> + </tr> + </table> +</div><div class="memdoc"> +<p>the z coordinate </p> + +</div> +</div> +<hr/>The documentation for this struct was generated from the following file:<ul> +<li>testing_doxygen/<a class="el" href="test_8h_source.html">test.h</a></li> +</ul> +</div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/html/sync_off.png b/docs/Doxygen/html/sync_off.png new file mode 100644 index 0000000000000000000000000000000000000000..3b443fc62892114406e3d399421b2a881b897acc Binary files /dev/null and b/docs/Doxygen/html/sync_off.png differ diff --git a/docs/Doxygen/html/sync_on.png b/docs/Doxygen/html/sync_on.png new file mode 100644 index 0000000000000000000000000000000000000000..e08320fb64e6fa33b573005ed6d8fe294e19db76 Binary files /dev/null and b/docs/Doxygen/html/sync_on.png differ diff --git a/docs/Doxygen/html/tab_a.png b/docs/Doxygen/html/tab_a.png new file mode 100644 index 0000000000000000000000000000000000000000..3b725c41c5a527a3a3e40097077d0e206a681247 Binary files /dev/null and b/docs/Doxygen/html/tab_a.png differ diff --git a/docs/Doxygen/html/tab_b.png b/docs/Doxygen/html/tab_b.png new file mode 100644 index 0000000000000000000000000000000000000000..e2b4a8638cb3496a016eaed9e16ffc12846dea18 Binary files /dev/null and b/docs/Doxygen/html/tab_b.png differ diff --git a/docs/Doxygen/html/tab_h.png b/docs/Doxygen/html/tab_h.png new file mode 100644 index 0000000000000000000000000000000000000000..fd5cb705488e60fcf30f56fcc951dee74f3b095b Binary files /dev/null and b/docs/Doxygen/html/tab_h.png differ diff --git a/docs/Doxygen/html/tab_s.png b/docs/Doxygen/html/tab_s.png new file mode 100644 index 0000000000000000000000000000000000000000..ab478c95b67371d700a20869f7de1ddd73522d50 Binary files /dev/null and b/docs/Doxygen/html/tab_s.png differ diff --git a/docs/Doxygen/html/tabs.css b/docs/Doxygen/html/tabs.css new file mode 100644 index 0000000000000000000000000000000000000000..bbde11ed9bf3df9ce42aad9c2149f1e7e8576ad1 --- /dev/null +++ b/docs/Doxygen/html/tabs.css @@ -0,0 +1 @@ +.sm{position:relative;z-index:9999}.sm,.sm ul,.sm li{display:block;list-style:none;margin:0;padding:0;line-height:normal;direction:ltr;text-align:left;-webkit-tap-highlight-color:transparent}.sm-rtl,.sm-rtl ul,.sm-rtl li{direction:rtl;text-align:right}.sm>li>h1,.sm>li>h2,.sm>li>h3,.sm>li>h4,.sm>li>h5,.sm>li>h6{margin:0;padding:0}.sm ul{display:none}.sm li,.sm a{position:relative}.sm a{display:block}.sm a.disabled{cursor:not-allowed}.sm:after{content:"\00a0";display:block;height:0;font:0px/0 serif;clear:both;visibility:hidden;overflow:hidden}.sm,.sm *,.sm *:before,.sm *:after{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.sm-dox{background-image:url("tab_b.png")}.sm-dox a,.sm-dox a:focus,.sm-dox a:hover,.sm-dox a:active{padding:0px 12px;padding-right:43px;font-family:"Lucida Grande","Geneva","Helvetica",Arial,sans-serif;font-size:13px;font-weight:bold;line-height:36px;text-decoration:none;text-shadow:0px 1px 1px rgba(255,255,255,0.9);color:#283A5D;outline:none}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:#fff;text-shadow:0px 1px 1px #000}.sm-dox a.current{color:#D23600}.sm-dox a.disabled{color:#bbb}.sm-dox a span.sub-arrow{position:absolute;top:50%;margin-top:-14px;left:auto;right:3px;width:28px;height:28px;overflow:hidden;font:bold 12px/28px monospace !important;text-align:center;text-shadow:none;background:rgba(255,255,255,0.5);border-radius:5px}.sm-dox a.highlighted span.sub-arrow:before{display:block;content:'-'}.sm-dox>li:first-child>a,.sm-dox>li:first-child>:not(ul) a{border-radius:5px 5px 0 0}.sm-dox>li:last-child>a,.sm-dox>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul{border-radius:0 0 5px 5px}.sm-dox>li:last-child>a.highlighted,.sm-dox>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted{border-radius:0}.sm-dox ul{background:rgba(162,162,162,0.1)}.sm-dox ul a,.sm-dox ul a:focus,.sm-dox ul a:hover,.sm-dox ul a:active{font-size:12px;border-left:8px solid transparent;line-height:36px;text-shadow:none;background-color:white;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:#fff;text-shadow:0px 1px 1px #000}.sm-dox ul ul a,.sm-dox ul ul a:hover,.sm-dox ul ul a:focus,.sm-dox ul ul a:active{border-left:16px solid transparent}.sm-dox ul ul ul a,.sm-dox ul ul ul a:hover,.sm-dox ul ul ul a:focus,.sm-dox ul ul ul a:active{border-left:24px solid transparent}.sm-dox ul ul ul ul a,.sm-dox ul ul ul ul a:hover,.sm-dox ul ul ul ul a:focus,.sm-dox ul ul ul ul a:active{border-left:32px solid transparent}.sm-dox ul ul ul ul ul a,.sm-dox ul ul ul ul ul a:hover,.sm-dox ul ul ul ul ul a:focus,.sm-dox ul ul ul ul ul a:active{border-left:40px solid transparent}@media (min-width: 768px){.sm-dox ul{position:absolute;width:12em}.sm-dox li{float:left}.sm-dox.sm-rtl li{float:right}.sm-dox ul li,.sm-dox.sm-rtl ul li,.sm-dox.sm-vertical li{float:none}.sm-dox a{white-space:nowrap}.sm-dox ul a,.sm-dox.sm-vertical a{white-space:normal}.sm-dox .sm-nowrap>li>a,.sm-dox .sm-nowrap>li>:not(ul) a{white-space:nowrap}.sm-dox{padding:0 10px;background-image:url("tab_b.png");line-height:36px}.sm-dox a span.sub-arrow{top:50%;margin-top:-2px;right:12px;width:0;height:0;border-width:4px;border-style:solid dashed dashed dashed;border-color:#283A5D transparent transparent transparent;background:transparent;border-radius:0}.sm-dox a,.sm-dox a:focus,.sm-dox a:active,.sm-dox a:hover,.sm-dox a.highlighted{padding:0px 12px;background-image:url("tab_s.png");background-repeat:no-repeat;background-position:right;border-radius:0 !important}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:#fff;text-shadow:0px 1px 1px #000}.sm-dox a:hover span.sub-arrow{border-color:#fff transparent transparent transparent}.sm-dox a.has-submenu{padding-right:24px}.sm-dox li{border-top:0}.sm-dox>li>ul:before,.sm-dox>li>ul:after{content:'';position:absolute;top:-18px;left:30px;width:0;height:0;overflow:hidden;border-width:9px;border-style:dashed dashed solid dashed;border-color:transparent transparent #bbb transparent}.sm-dox>li>ul:after{top:-16px;left:31px;border-width:8px;border-color:transparent transparent #fff transparent}.sm-dox ul{border:1px solid #bbb;padding:5px 0;background:#fff;border-radius:5px !important;box-shadow:0 5px 9px rgba(0,0,0,0.2)}.sm-dox ul a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-color:transparent transparent transparent #555;border-style:dashed dashed dashed solid}.sm-dox ul a,.sm-dox ul a:hover,.sm-dox ul a:focus,.sm-dox ul a:active,.sm-dox ul a.highlighted{color:#555;background-image:none;border:0 !important;color:#555;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:#fff;text-shadow:0px 1px 1px #000}.sm-dox ul a:hover span.sub-arrow{border-color:transparent transparent transparent #fff}.sm-dox span.scroll-up,.sm-dox span.scroll-down{position:absolute;display:none;visibility:hidden;overflow:hidden;background:#fff;height:36px}.sm-dox span.scroll-up:hover,.sm-dox span.scroll-down:hover{background:#eee}.sm-dox span.scroll-up:hover span.scroll-up-arrow,.sm-dox span.scroll-up:hover span.scroll-down-arrow{border-color:transparent transparent #D23600 transparent}.sm-dox span.scroll-down:hover span.scroll-down-arrow{border-color:#D23600 transparent transparent transparent}.sm-dox span.scroll-up-arrow,.sm-dox span.scroll-down-arrow{position:absolute;top:0;left:50%;margin-left:-6px;width:0;height:0;overflow:hidden;border-width:6px;border-style:dashed dashed solid dashed;border-color:transparent transparent #555 transparent}.sm-dox span.scroll-down-arrow{top:8px;border-style:solid dashed dashed dashed;border-color:#555 transparent transparent transparent}.sm-dox.sm-rtl a.has-submenu{padding-right:12px;padding-left:24px}.sm-dox.sm-rtl a span.sub-arrow{right:auto;left:12px}.sm-dox.sm-rtl.sm-vertical a.has-submenu{padding:10px 20px}.sm-dox.sm-rtl.sm-vertical a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-rtl>li>ul:before{left:auto;right:30px}.sm-dox.sm-rtl>li>ul:after{left:auto;right:31px}.sm-dox.sm-rtl ul a.has-submenu{padding:10px 20px !important}.sm-dox.sm-rtl ul a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-vertical{padding:10px 0;border-radius:5px}.sm-dox.sm-vertical a{padding:10px 20px}.sm-dox.sm-vertical a:hover,.sm-dox.sm-vertical a:focus,.sm-dox.sm-vertical a:active,.sm-dox.sm-vertical a.highlighted{background:#fff}.sm-dox.sm-vertical a.disabled{background-image:url("tab_b.png")}.sm-dox.sm-vertical a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-style:dashed dashed dashed solid;border-color:transparent transparent transparent #555}.sm-dox.sm-vertical>li>ul:before,.sm-dox.sm-vertical>li>ul:after{display:none}.sm-dox.sm-vertical ul a{padding:10px 20px}.sm-dox.sm-vertical ul a:hover,.sm-dox.sm-vertical ul a:focus,.sm-dox.sm-vertical ul a:active,.sm-dox.sm-vertical ul a.highlighted{background:#eee}.sm-dox.sm-vertical ul a.disabled{background:#fff}} diff --git a/docs/Doxygen/html/test_8h_source.html b/docs/Doxygen/html/test_8h_source.html new file mode 100644 index 0000000000000000000000000000000000000000..f9d978557ca282824bd3523b5e5ee704dd302618 --- /dev/null +++ b/docs/Doxygen/html/test_8h_source.html @@ -0,0 +1,83 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> +<meta http-equiv="Content-Type" content="text/xhtml;charset=UTF-8"/> +<meta http-equiv="X-UA-Compatible" content="IE=9"/> +<meta name="generator" content="Doxygen 1.8.13"/> +<meta name="viewport" content="width=device-width, initial-scale=1"/> +<title>My Project: testing_doxygen/test.h Source File</title> +<link href="tabs.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="jquery.js"></script> +<script type="text/javascript" src="dynsections.js"></script> +<link href="search/search.css" rel="stylesheet" type="text/css"/> +<script type="text/javascript" src="search/searchdata.js"></script> +<script type="text/javascript" src="search/search.js"></script> +<link href="doxygen.css" rel="stylesheet" type="text/css" /> +</head> +<body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> +<div id="titlearea"> +<table cellspacing="0" cellpadding="0"> + <tbody> + <tr style="height: 56px;"> + <td id="projectalign" style="padding-left: 0.5em;"> + <div id="projectname">My Project + </div> + </td> + </tr> + </tbody> +</table> +</div> +<!-- end header part --> +<!-- Generated by Doxygen 1.8.13 --> +<script type="text/javascript"> +var searchBox = new SearchBox("searchBox", "search",false,'Search'); +</script> +<script type="text/javascript" src="menudata.js"></script> +<script type="text/javascript" src="menu.js"></script> +<script type="text/javascript"> +$(function() { + initMenu('',true,false,'search.php','Search'); + $(document).ready(function() { init_search(); }); +}); +</script> +<div id="main-nav"></div> +<!-- window showing the filter options --> +<div id="MSearchSelectWindow" + onmouseover="return searchBox.OnSearchSelectShow()" + onmouseout="return searchBox.OnSearchSelectHide()" + onkeydown="return searchBox.OnSearchSelectKey(event)"> +</div> + +<!-- iframe showing the search results (closed by default) --> +<div id="MSearchResultsWindow"> +<iframe src="javascript:void(0)" frameborder="0" + name="MSearchResults" id="MSearchResults"> +</iframe> +</div> + +<div id="nav-path" class="navpath"> + <ul> +<li class="navelem"><a class="el" href="dir_eedb883b3a90ccdfffd3f135939cac7c.html">testing_doxygen</a></li> </ul> +</div> +</div><!-- top --> +<div class="header"> + <div class="headertitle"> +<div class="title">test.h</div> </div> +</div><!--header--> +<div class="contents"> +<div class="fragment"><div class="line"><a name="l00001"></a><span class="lineno"> 1</span> <span class="preprocessor">#pragma once</span></div><div class="line"><a name="l00002"></a><span class="lineno"> 2</span> <span class="preprocessor">#ifndef BINARY_C_PYTHON_H</span></div><div class="line"><a name="l00003"></a><span class="lineno"> 3</span> <span class="preprocessor">#define BINARY_C_PYTHON_H</span></div><div class="line"><a name="l00004"></a><span class="lineno"> 4</span> </div><div class="line"><a name="l00008"></a><span class="lineno"><a class="line" href="structpoint3d.html"> 8</a></span> <span class="keyword">typedef</span> <span class="keyword">struct</span></div><div class="line"><a name="l00009"></a><span class="lineno"> 9</span> {</div><div class="line"><a name="l00011"></a><span class="lineno"><a class="line" href="structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9"> 11</a></span>  <span class="keywordtype">double</span> <a class="code" href="structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9">x</a> ; </div><div class="line"><a name="l00012"></a><span class="lineno"><a class="line" href="structpoint3d.html#af76302f192767fd9546392affbe5631c"> 12</a></span>  <span class="keywordtype">double</span> <a class="code" href="structpoint3d.html#af76302f192767fd9546392affbe5631c">y</a> ; </div><div class="line"><a name="l00013"></a><span class="lineno"><a class="line" href="structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1"> 13</a></span>  <span class="keywordtype">double</span> <a class="code" href="structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1">z</a> ; </div><div class="line"><a name="l00019"></a><span class="lineno"><a class="line" href="structpoint3d.html#afb9519af724fab8e88b239b60c864a6d"> 19</a></span>  <span class="keywordtype">char</span> * <a class="code" href="structpoint3d.html#afb9519af724fab8e88b239b60c864a6d">name</a> ; </div><div class="line"><a name="l00020"></a><span class="lineno"><a class="line" href="structpoint3d.html#a809caeed7433b4f182554ef12f8705a9"> 20</a></span>  <span class="keywordtype">int</span> <a class="code" href="structpoint3d.html#a809caeed7433b4f182554ef12f8705a9">namelength</a> ; </div><div class="line"><a name="l00022"></a><span class="lineno"> 22</span> } <a class="code" href="structpoint3d.html">point3d</a> ;</div><div class="line"><a name="l00023"></a><span class="lineno"> 23</span> </div><div class="line"><a name="l00024"></a><span class="lineno"> 24</span> </div><div class="line"><a name="l00025"></a><span class="lineno"> 25</span> <span class="comment">/*</span></div><div class="line"><a name="l00026"></a><span class="lineno"> 26</span> <span class="comment"> * Include binary_C's API</span></div><div class="line"><a name="l00027"></a><span class="lineno"> 27</span> <span class="comment"> */</span></div><div class="line"><a name="l00028"></a><span class="lineno"> 28</span> <span class="comment">//#include "binary_c_API.h"</span></div><div class="line"><a name="l00029"></a><span class="lineno"> 29</span> <span class="comment">//#include "binary_c_API_prototypes.h"</span></div><div class="line"><a name="l00030"></a><span class="lineno"> 30</span> </div><div class="line"><a name="l00031"></a><span class="lineno"> 31</span> <span class="comment">/* Binary_c's python API prototypes */</span></div><div class="line"><a name="l00035"></a><span class="lineno"> 35</span> <span class="keywordtype">int</span> run_binary (<span class="keywordtype">char</span> * argstring,</div><div class="line"><a name="l00036"></a><span class="lineno"> 36</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> outstring,</div><div class="line"><a name="l00037"></a><span class="lineno"> 37</span>  <span class="keywordtype">char</span> ** <span class="keyword">const</span> errorstring);</div><div class="line"><a name="l00038"></a><span class="lineno"> 38</span> </div><div class="line"><a name="l00039"></a><span class="lineno"> 39</span>  <span class="comment">// size_t * const nbytes);</span></div><div class="line"><a name="l00040"></a><span class="lineno"> 40</span> </div><div class="line"><a name="l00041"></a><span class="lineno"> 41</span> <span class="comment">// int run_binary_with_logfile (char * argstring,</span></div><div class="line"><a name="l00042"></a><span class="lineno"> 42</span> <span class="comment">// char ** const outstring,</span></div><div class="line"><a name="l00043"></a><span class="lineno"> 43</span> <span class="comment">// char ** const errorstring,</span></div><div class="line"><a name="l00044"></a><span class="lineno"> 44</span> <span class="comment">// size_t * const nbytes);</span></div><div class="line"><a name="l00045"></a><span class="lineno"> 45</span> </div><div class="line"><a name="l00046"></a><span class="lineno"> 46</span> <span class="comment">// int run_binary_custom_logging(char * argstring,</span></div><div class="line"><a name="l00047"></a><span class="lineno"> 47</span> <span class="comment">// long int func_memaddr,</span></div><div class="line"><a name="l00048"></a><span class="lineno"> 48</span> <span class="comment">// char ** const buffer,</span></div><div class="line"><a name="l00049"></a><span class="lineno"> 49</span> <span class="comment">// char ** const error_buffer,</span></div><div class="line"><a name="l00050"></a><span class="lineno"> 50</span> <span class="comment">// size_t * const nbytes);</span></div><div class="line"><a name="l00051"></a><span class="lineno"> 51</span> </div><div class="line"><a name="l00052"></a><span class="lineno"> 52</span> <span class="comment">// int return_arglines(char ** const outstring,</span></div><div class="line"><a name="l00053"></a><span class="lineno"> 53</span> <span class="comment">// char ** const errorstring, </span></div><div class="line"><a name="l00054"></a><span class="lineno"> 54</span> <span class="comment">// size_t * const nbytes);</span></div><div class="line"><a name="l00055"></a><span class="lineno"> 55</span> </div><div class="line"><a name="l00056"></a><span class="lineno"> 56</span> <span class="comment">/* C macros */</span></div><div class="line"><a name="l00057"></a><span class="lineno"> 57</span> <span class="preprocessor">#define BINARY_C_APITEST_VERSION 0.1</span></div><div class="line"><a name="l00058"></a><span class="lineno"> 58</span> <span class="preprocessor">#define APIprint(...) APIprintf(__VA_ARGS__);</span></div><div class="line"><a name="l00059"></a><span class="lineno"> 59</span> <span class="preprocessor">#define NO_OUTPUT</span></div><div class="line"><a name="l00060"></a><span class="lineno"> 60</span> </div><div class="line"><a name="l00061"></a><span class="lineno"> 61</span> <span class="preprocessor">#endif // BINARY_C_C_PYTHON_H</span></div><div class="ttc" id="structpoint3d_html"><div class="ttname"><a href="structpoint3d.html">point3d</a></div><div class="ttdef"><b>Definition:</b> test.h:8</div></div> +<div class="ttc" id="structpoint3d_html_a96e63d7cd720242d2f79287b04a503e1"><div class="ttname"><a href="structpoint3d.html#a96e63d7cd720242d2f79287b04a503e1">point3d::z</a></div><div class="ttdeci">double z</div><div class="ttdef"><b>Definition:</b> test.h:13</div></div> +<div class="ttc" id="structpoint3d_html_ac16dfc549efe0bd9b819ea4a9a8462a9"><div class="ttname"><a href="structpoint3d.html#ac16dfc549efe0bd9b819ea4a9a8462a9">point3d::x</a></div><div class="ttdeci">double x</div><div class="ttdef"><b>Definition:</b> test.h:11</div></div> +<div class="ttc" id="structpoint3d_html_af76302f192767fd9546392affbe5631c"><div class="ttname"><a href="structpoint3d.html#af76302f192767fd9546392affbe5631c">point3d::y</a></div><div class="ttdeci">double y</div><div class="ttdef"><b>Definition:</b> test.h:12</div></div> +<div class="ttc" id="structpoint3d_html_afb9519af724fab8e88b239b60c864a6d"><div class="ttname"><a href="structpoint3d.html#afb9519af724fab8e88b239b60c864a6d">point3d::name</a></div><div class="ttdeci">char * name</div><div class="ttdef"><b>Definition:</b> test.h:19</div></div> +<div class="ttc" id="structpoint3d_html_a809caeed7433b4f182554ef12f8705a9"><div class="ttname"><a href="structpoint3d.html#a809caeed7433b4f182554ef12f8705a9">point3d::namelength</a></div><div class="ttdeci">int namelength</div><div class="ttdef"><b>Definition:</b> test.h:20</div></div> +</div><!-- fragment --></div><!-- contents --> +<!-- start footer part --> +<hr class="footer"/><address class="footer"><small> +Generated by  <a href="http://www.doxygen.org/index.html"> +<img class="footer" src="doxygen.png" alt="doxygen"/> +</a> 1.8.13 +</small></address> +</body> +</html> diff --git a/docs/Doxygen/latex/Makefile b/docs/Doxygen/latex/Makefile new file mode 100644 index 0000000000000000000000000000000000000000..8cc3866f4a039e77b793bd33774ce84e52a9ae16 --- /dev/null +++ b/docs/Doxygen/latex/Makefile @@ -0,0 +1,21 @@ +all: refman.pdf + +pdf: refman.pdf + +refman.pdf: clean refman.tex + pdflatex refman + makeindex refman.idx + pdflatex refman + latex_count=8 ; \ + while egrep -s 'Rerun (LaTeX|to get cross-references right)' refman.log && [ $$latex_count -gt 0 ] ;\ + do \ + echo "Rerunning latex...." ;\ + pdflatex refman ;\ + latex_count=`expr $$latex_count - 1` ;\ + done + makeindex refman.idx + pdflatex refman + + +clean: + rm -f *.ps *.dvi *.aux *.toc *.idx *.ind *.ilg *.log *.out *.brf *.blg *.bbl refman.pdf diff --git a/docs/Doxygen/latex/annotated.tex b/docs/Doxygen/latex/annotated.tex new file mode 100644 index 0000000000000000000000000000000000000000..cfcf6a056eecb3902c73204d8e3dd8b5b6eb009c --- /dev/null +++ b/docs/Doxygen/latex/annotated.tex @@ -0,0 +1,5 @@ +\section{Class List} +Here are the classes, structs, unions and interfaces with brief descriptions\+:\begin{DoxyCompactList} +\item\contentsline{section}{\hyperlink{structBoxStruct__struct}{Box\+Struct\+\_\+struct} \\*Use brief, otherwise the index won\textquotesingle{}t have a brief explanation }{\pageref{structBoxStruct__struct}}{} +\item\contentsline{section}{\hyperlink{structpoint3d}{point3d} }{\pageref{structpoint3d}}{} +\end{DoxyCompactList} diff --git a/docs/Doxygen/latex/dir_eedb883b3a90ccdfffd3f135939cac7c.tex b/docs/Doxygen/latex/dir_eedb883b3a90ccdfffd3f135939cac7c.tex new file mode 100644 index 0000000000000000000000000000000000000000..eaa9887ff7767da215e8688130627d135e29268b --- /dev/null +++ b/docs/Doxygen/latex/dir_eedb883b3a90ccdfffd3f135939cac7c.tex @@ -0,0 +1,2 @@ +\hypertarget{dir_eedb883b3a90ccdfffd3f135939cac7c}{}\section{testing\+\_\+doxygen Directory Reference} +\label{dir_eedb883b3a90ccdfffd3f135939cac7c}\index{testing\+\_\+doxygen Directory Reference@{testing\+\_\+doxygen Directory Reference}} diff --git a/docs/Doxygen/latex/doxygen.sty b/docs/Doxygen/latex/doxygen.sty new file mode 100644 index 0000000000000000000000000000000000000000..e457acc1b89ef5cd0844b70a8db5eb29a0a57c75 --- /dev/null +++ b/docs/Doxygen/latex/doxygen.sty @@ -0,0 +1,503 @@ +\NeedsTeXFormat{LaTeX2e} +\ProvidesPackage{doxygen} + +% Packages used by this style file +\RequirePackage{alltt} +\RequirePackage{array} +\RequirePackage{calc} +\RequirePackage{float} +\RequirePackage{ifthen} +\RequirePackage{verbatim} +\RequirePackage[table]{xcolor} +\RequirePackage{longtable} +\RequirePackage{tabu} +\RequirePackage{tabularx} +\RequirePackage{multirow} + +%---------- Internal commands used in this style file ---------------- + +\newcommand{\ensurespace}[1]{% + \begingroup% + \setlength{\dimen@}{#1}% + \vskip\z@\@plus\dimen@% + \penalty -100\vskip\z@\@plus -\dimen@% + \vskip\dimen@% + \penalty 9999% + \vskip -\dimen@% + \vskip\z@skip% hide the previous |\vskip| from |\addvspace| + \endgroup% +} + +\newcommand{\DoxyLabelFont}{} +\newcommand{\entrylabel}[1]{% + {% + \parbox[b]{\labelwidth-4pt}{% + \makebox[0pt][l]{\DoxyLabelFont#1}% + \vspace{1.5\baselineskip}% + }% + }% +} + +\newenvironment{DoxyDesc}[1]{% + \ensurespace{4\baselineskip}% + \begin{list}{}{% + \settowidth{\labelwidth}{20pt}% + \setlength{\parsep}{0pt}% + \setlength{\itemsep}{0pt}% + \setlength{\leftmargin}{\labelwidth+\labelsep}% + \renewcommand{\makelabel}{\entrylabel}% + }% + \item[#1]% +}{% + \end{list}% +} + +\newsavebox{\xrefbox} +\newlength{\xreflength} +\newcommand{\xreflabel}[1]{% + \sbox{\xrefbox}{#1}% + \setlength{\xreflength}{\wd\xrefbox}% + \ifthenelse{\xreflength>\labelwidth}{% + \begin{minipage}{\textwidth}% + \setlength{\parindent}{0pt}% + \hangindent=15pt\bfseries #1\vspace{1.2\itemsep}% + \end{minipage}% + }{% + \parbox[b]{\labelwidth}{\makebox[0pt][l]{\textbf{#1}}}% + }% +} + +%---------- Commands used by doxygen LaTeX output generator ---------- + +% Used by <pre> ... </pre> +\newenvironment{DoxyPre}{% + \small% + \begin{alltt}% +}{% + \end{alltt}% + \normalsize% +} + +% Used by @code ... @endcode +\newenvironment{DoxyCode}{% + \par% + \scriptsize% + \begin{alltt}% +}{% + \end{alltt}% + \normalsize% +} + +% Used by @example, @include, @includelineno and @dontinclude +\newenvironment{DoxyCodeInclude}{% + \DoxyCode% +}{% + \endDoxyCode% +} + +% Used by @verbatim ... @endverbatim +\newenvironment{DoxyVerb}{% + \footnotesize% + \verbatim% +}{% + \endverbatim% + \normalsize% +} + +% Used by @verbinclude +\newenvironment{DoxyVerbInclude}{% + \DoxyVerb% +}{% + \endDoxyVerb% +} + +% Used by numbered lists (using '-#' or <ol> ... </ol>) +\newenvironment{DoxyEnumerate}{% + \enumerate% +}{% + \endenumerate% +} + +% Used by bullet lists (using '-', @li, @arg, or <ul> ... </ul>) +\newenvironment{DoxyItemize}{% + \itemize% +}{% + \enditemize% +} + +% Used by description lists (using <dl> ... </dl>) +\newenvironment{DoxyDescription}{% + \description% +}{% + \enddescription% +} + +% Used by @image, @dotfile, @dot ... @enddot, and @msc ... @endmsc +% (only if caption is specified) +\newenvironment{DoxyImage}{% + \begin{figure}[H]% + \begin{center}% +}{% + \end{center}% + \end{figure}% +} + +% Used by @image, @dotfile, @dot ... @enddot, and @msc ... @endmsc +% (only if no caption is specified) +\newenvironment{DoxyImageNoCaption}{% + \begin{center}% +}{% + \end{center}% +} + +% Used by @attention +\newenvironment{DoxyAttention}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @author and @authors +\newenvironment{DoxyAuthor}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @date +\newenvironment{DoxyDate}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @invariant +\newenvironment{DoxyInvariant}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @note +\newenvironment{DoxyNote}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @post +\newenvironment{DoxyPostcond}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @pre +\newenvironment{DoxyPrecond}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @copyright +\newenvironment{DoxyCopyright}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @remark +\newenvironment{DoxyRemark}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @return and @returns +\newenvironment{DoxyReturn}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @since +\newenvironment{DoxySince}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @see +\newenvironment{DoxySeeAlso}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @version +\newenvironment{DoxyVersion}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @warning +\newenvironment{DoxyWarning}[1]{% + \begin{DoxyDesc}{#1}% +}{% + \end{DoxyDesc}% +} + +% Used by @internal +\newenvironment{DoxyInternal}[1]{% + \paragraph*{#1}% +}{% +} + +% Used by @par and @paragraph +\newenvironment{DoxyParagraph}[1]{% + \begin{list}{}{% + \settowidth{\labelwidth}{40pt}% + \setlength{\leftmargin}{\labelwidth}% + \setlength{\parsep}{0pt}% + \setlength{\itemsep}{-4pt}% + \renewcommand{\makelabel}{\entrylabel}% + }% + \item[#1]% +}{% + \end{list}% +} + +% Used by parameter lists +\newenvironment{DoxyParams}[2][]{% + \tabulinesep=1mm% + \par% + \ifthenelse{\equal{#1}{}}% + {\begin{longtabu} spread 0pt [l]{|X[-1,l]|X[-1,l]|}}% name + description + {\ifthenelse{\equal{#1}{1}}% + {\begin{longtabu} spread 0pt [l]{|X[-1,l]|X[-1,l]|X[-1,l]|}}% in/out + name + desc + {\begin{longtabu} spread 0pt [l]{|X[-1,l]|X[-1,l]|X[-1,l]|X[-1,l]|}}% in/out + type + name + desc + } + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]% + \hline% + \endfirsthead% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #2}\\[1ex]% + \hline% + \endhead% +}{% + \end{longtabu}% + \vspace{6pt}% +} + +% Used for fields of simple structs +\newenvironment{DoxyFields}[1]{% + \tabulinesep=1mm% + \par% + \begin{longtabu} spread 0pt [l]{|X[-1,r]|X[-1,l]|X[-1,l]|}% + \multicolumn{3}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endfirsthead% + \multicolumn{3}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endhead% +}{% + \end{longtabu}% + \vspace{6pt}% +} + +% Used for fields simple class style enums +\newenvironment{DoxyEnumFields}[1]{% + \tabulinesep=1mm% + \par% + \begin{longtabu} spread 0pt [l]{|X[-1,r]|X[-1,l]|}% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endfirsthead% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endhead% +}{% + \end{longtabu}% + \vspace{6pt}% +} + +% Used for parameters within a detailed function description +\newenvironment{DoxyParamCaption}{% + \renewcommand{\item}[2][]{\\ \hspace*{2.0cm} ##1 {\em ##2}}% +}{% +} + +% Used by return value lists +\newenvironment{DoxyRetVals}[1]{% + \tabulinesep=1mm% + \par% + \begin{longtabu} spread 0pt [l]{|X[-1,r]|X[-1,l]|}% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endfirsthead% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endhead% +}{% + \end{longtabu}% + \vspace{6pt}% +} + +% Used by exception lists +\newenvironment{DoxyExceptions}[1]{% + \tabulinesep=1mm% + \par% + \begin{longtabu} spread 0pt [l]{|X[-1,r]|X[-1,l]|}% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endfirsthead% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endhead% +}{% + \end{longtabu}% + \vspace{6pt}% +} + +% Used by template parameter lists +\newenvironment{DoxyTemplParams}[1]{% + \tabulinesep=1mm% + \par% + \begin{longtabu} spread 0pt [l]{|X[-1,r]|X[-1,l]|}% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endfirsthead% + \multicolumn{2}{l}{\hspace{-6pt}\bfseries\fontseries{bc}\selectfont\color{darkgray} #1}\\[1ex]% + \hline% + \endhead% +}{% + \end{longtabu}% + \vspace{6pt}% +} + +% Used for member lists +\newenvironment{DoxyCompactItemize}{% + \begin{itemize}% + \setlength{\itemsep}{-3pt}% + \setlength{\parsep}{0pt}% + \setlength{\topsep}{0pt}% + \setlength{\partopsep}{0pt}% +}{% + \end{itemize}% +} + +% Used for member descriptions +\newenvironment{DoxyCompactList}{% + \begin{list}{}{% + \setlength{\leftmargin}{0.5cm}% + \setlength{\itemsep}{0pt}% + \setlength{\parsep}{0pt}% + \setlength{\topsep}{0pt}% + \renewcommand{\makelabel}{\hfill}% + }% +}{% + \end{list}% +} + +% Used for reference lists (@bug, @deprecated, @todo, etc.) +\newenvironment{DoxyRefList}{% + \begin{list}{}{% + \setlength{\labelwidth}{10pt}% + \setlength{\leftmargin}{\labelwidth}% + \addtolength{\leftmargin}{\labelsep}% + \renewcommand{\makelabel}{\xreflabel}% + }% +}{% + \end{list}% +} + +% Used by @bug, @deprecated, @todo, etc. +\newenvironment{DoxyRefDesc}[1]{% + \begin{list}{}{% + \renewcommand\makelabel[1]{\textbf{##1}}% + \settowidth\labelwidth{\makelabel{#1}}% + \setlength\leftmargin{\labelwidth+\labelsep}% + }% +}{% + \end{list}% +} + +% Used by parameter lists and simple sections +\newenvironment{Desc} +{\begin{list}{}{% + \settowidth{\labelwidth}{20pt}% + \setlength{\parsep}{0pt}% + \setlength{\itemsep}{0pt}% + \setlength{\leftmargin}{\labelwidth+\labelsep}% + \renewcommand{\makelabel}{\entrylabel}% + } +}{% + \end{list}% +} + +% Used by tables +\newcommand{\PBS}[1]{\let\temp=\\#1\let\\=\temp}% +\newenvironment{TabularC}[1]% +{\tabulinesep=1mm +\begin{longtabu} spread 0pt [c]{*#1{|X[-1]}|}}% +{\end{longtabu}\par}% + +\newenvironment{TabularNC}[1]% +{\begin{tabu} spread 0pt [l]{*#1{|X[-1]}|}}% +{\end{tabu}\par}% + +% Used for member group headers +\newenvironment{Indent}{% + \begin{list}{}{% + \setlength{\leftmargin}{0.5cm}% + }% + \item[]\ignorespaces% +}{% + \unskip% + \end{list}% +} + +% Used when hyperlinks are turned off +\newcommand{\doxyref}[3]{% + \textbf{#1} (\textnormal{#2}\,\pageref{#3})% +} + +% Used to link to a table when hyperlinks are turned on +\newcommand{\doxytablelink}[2]{% + \ref{#1}% +} + +% Used to link to a table when hyperlinks are turned off +\newcommand{\doxytableref}[3]{% + \ref{#3}% +} + +% Used by @addindex +\newcommand{\lcurly}{\{} +\newcommand{\rcurly}{\}} + +% Colors used for syntax highlighting +\definecolor{comment}{rgb}{0.5,0.0,0.0} +\definecolor{keyword}{rgb}{0.0,0.5,0.0} +\definecolor{keywordtype}{rgb}{0.38,0.25,0.125} +\definecolor{keywordflow}{rgb}{0.88,0.5,0.0} +\definecolor{preprocessor}{rgb}{0.5,0.38,0.125} +\definecolor{stringliteral}{rgb}{0.0,0.125,0.25} +\definecolor{charliteral}{rgb}{0.0,0.5,0.5} +\definecolor{vhdldigit}{rgb}{1.0,0.0,1.0} +\definecolor{vhdlkeyword}{rgb}{0.43,0.0,0.43} +\definecolor{vhdllogic}{rgb}{1.0,0.0,0.0} +\definecolor{vhdlchar}{rgb}{0.0,0.0,0.0} + +% Color used for table heading +\newcommand{\tableheadbgcolor}{lightgray}% + +% Version of hypertarget with correct landing location +\newcommand{\Hypertarget}[1]{\Hy@raisedlink{\hypertarget{#1}{}}} + +% Define caption that is also suitable in a table +\makeatletter +\def\doxyfigcaption{% +\refstepcounter{figure}% +\@dblarg{\@caption{figure}}} +\makeatother diff --git a/docs/Doxygen/latex/md_README.tex b/docs/Doxygen/latex/md_README.tex new file mode 100644 index 0000000000000000000000000000000000000000..a947d8fbb37db4a6682b8c68d762e49c49a88be1 --- /dev/null +++ b/docs/Doxygen/latex/md_README.tex @@ -0,0 +1,55 @@ +Based on a original work by Jeff Andrews (can be found in old\+\_\+solution/ directory) updated and extended for Python3 by Robert Izzard, David hendriks + +Warning \+: T\+H\+IS C\+O\+DE IS E\+X\+P\+E\+R\+I\+M\+E\+N\+T\+A\+L! + +\href{mailto:r.izzard@surrey.ac.uk}{\tt r.\+izzard@surrey.\+ac.\+uk} \href{http://personal.ph.surrey.ac.uk/~ri0005/binary_c.html}{\tt http\+://personal.\+ph.\+surrey.\+ac.\+uk/$\sim$ri0005/binary\+\_\+c.\+html} 09/06/2019 + +\subsection*{Requirements } + + +\begin{DoxyItemize} +\item Python3 +\item binary\+\_\+c version 2.\+1+ +\item requirements.\+txt (no?) +\end{DoxyItemize} + +\subsection*{Environment variables } + +Before compilation you should set the following environment variables\+: + + +\begin{DoxyItemize} +\item required\+: {\ttfamily B\+I\+N\+A\+R\+Y\+\_\+C} should point to the root directory of your binary\+\_\+c installation +\item recommended\+: {\ttfamily L\+D\+\_\+\+L\+I\+B\+R\+A\+R\+Y\+\_\+\+P\+A\+TH} should include \$\+B\+I\+N\+A\+R\+Y\+\_\+C/src and whatever directories are required to run binary\+\_\+c (e.\+g. locations of libgsl, libmemoize, librinterpolate, etc.) +\item recommended\+: {\ttfamily L\+I\+B\+R\+A\+R\+Y\+\_\+\+P\+A\+TH} should include whatever directories are required to build binary\+\_\+c (e.\+g. locations of libgsl, libmemoize, librinterpolate, etc.) +\end{DoxyItemize} + +\subsection*{Build instructions } + +To build the module, make sure you have built binary\+\_\+c (with {\ttfamily make} in the binary\+\_\+c root directory), its shared library (with {\ttfamily make libbinary\+\_\+c.\+so} in the binary\+\_\+c root directory), and set environment variables as described above, then run the following code in t\+: +\begin{DoxyCode} +make clean +make +\end{DoxyCode} + Then to test the Python module\+: + + +\begin{DoxyCode} +python3 ./python\_API\_test.py +\end{DoxyCode} + You will require whatever libraries with which binary\+\_\+c was compiled, as well as the compiler with which Python was built (usually gcc, which is easily installed on most systems). + +If you want to be able to import the binary\+\_\+c module correctly for child directories (or anywhere for that matter), execute or put the following code in your .bashrc/.zshrc\+: +\begin{DoxyCode} +export LD\_LIBRARY\_PATH=<full path to directory containing libbinary\_c\_api.so>:$LD\_LIBRARY\_PATH +export PYTHONPATH=<full path to directory containing libbinary\_c\_api.so>:$PYTHONPATH +\end{DoxyCode} + + +\subsection*{Usage notes } + +When running a jupyter notebook and importing binary\+\_\+c, it might happen that the module binary\+\_\+c cannot be found. I experienced this when I executed Jupyter Notebook from a virtual environment which didnt use the same python (version/binary/shim) as the one I built this library with. Make sure jupyter does use the same underlying python version/binary/shim. That resolved the issue for me. + +Also\+: I figured that having binaryc output the log like \char`\"{}$<$\+L\+O\+G H\+E\+A\+D\+E\+R$>$ t=10e4 ...\char`\"{} (i.\+e. printing the parameter names as well as their values) would be useful because in that way one can easily have python read that out automatically instead of having to manually copy the list of parameter names. + +See examples/ dir for some working examples \ No newline at end of file diff --git a/docs/Doxygen/latex/refman.aux b/docs/Doxygen/latex/refman.aux new file mode 100644 index 0000000000000000000000000000000000000000..6414e708c86e97a3b6f35ed0228fd6e4886db863 --- /dev/null +++ b/docs/Doxygen/latex/refman.aux @@ -0,0 +1,23 @@ +\relax +\providecommand\hyper@newdestlabel[2]{} +\providecommand\HyperFirstAtBeginDocument{\AtBeginDocument} +\HyperFirstAtBeginDocument{\ifx\hyper@anchor\@undefined +\global\let\oldcontentsline\contentsline +\gdef\contentsline#1#2#3#4{\oldcontentsline{#1}{#2}{#3}} +\global\let\oldnewlabel\newlabel +\gdef\newlabel#1#2{\newlabelxx{#1}#2} +\gdef\newlabelxx#1#2#3#4#5#6{\oldnewlabel{#1}{{#2}{#3}}} +\AtEndDocument{\ifx\hyper@anchor\@undefined +\let\contentsline\oldcontentsline +\let\newlabel\oldnewlabel +\fi} +\fi} +\global\let\hyper@last\relax +\gdef\HyperFirstAtBeginDocument#1{#1} +\providecommand\HyField@AuxAddToFields[1]{} +\providecommand\HyField@AuxAddToCoFields[2]{} +\providecommand \oddpage@label [2]{} +\@writefile{toc}{\contentsline {chapter}{\numberline {1}Python module for binary\discretionary {\unhbox \voidb@x \hbox {\relax \fontsize {7}{8}\selectfont $\leftarrow \joinrel \rhook $}}{}{}\_\discretionary {\unhbox \voidb@x \hbox {\relax \fontsize {7}{8}\selectfont $\leftarrow \joinrel \rhook $}}{}{}c}{1}{chapter.1}} +\@writefile{lof}{\addvspace {10\p@ }} +\@writefile{lot}{\addvspace {10\p@ }} +\newlabel{md_README}{{1}{1}{Python module for binary\+\_\+c}{chapter.1}{}} diff --git a/docs/Doxygen/latex/refman.idx b/docs/Doxygen/latex/refman.idx new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/docs/Doxygen/latex/refman.ilg b/docs/Doxygen/latex/refman.ilg new file mode 100644 index 0000000000000000000000000000000000000000..8f11783edf58934d200eaff20400752212da4072 --- /dev/null +++ b/docs/Doxygen/latex/refman.ilg @@ -0,0 +1,4 @@ +This is makeindex, version 2.15 [TeX Live 2017] (kpathsea + Thai support). +Scanning input file refman.idx...done (0 entries accepted, 0 rejected). +Nothing written in refman.ind. +Transcript written in refman.ilg. diff --git a/docs/Doxygen/latex/refman.ind b/docs/Doxygen/latex/refman.ind new file mode 100644 index 0000000000000000000000000000000000000000..e69de29bb2d1d6434b8b29ae775ad8c2e48c5391 diff --git a/docs/Doxygen/latex/refman.log b/docs/Doxygen/latex/refman.log new file mode 100644 index 0000000000000000000000000000000000000000..f8074fe97e0bf8f29d7b949a5d0544ea5b240e68 --- /dev/null +++ b/docs/Doxygen/latex/refman.log @@ -0,0 +1,1278 @@ +This is pdfTeX, Version 3.14159265-2.6-1.40.18 (TeX Live 2017/Debian) (preloaded format=pdflatex 2019.10.24) 11 NOV 2019 23:49 +entering extended mode + restricted \write18 enabled. + %&-line parsing enabled. +**refman +(./refman.tex +LaTeX2e <2017-04-15> +Babel <3.18> and hyphenation patterns for 84 language(s) loaded. +(/usr/share/texlive/texmf-dist/tex/latex/base/book.cls +Document Class: book 2014/09/29 v1.4h Standard LaTeX document class +(/usr/share/texlive/texmf-dist/tex/latex/base/bk10.clo +File: bk10.clo 2014/09/29 v1.4h Standard LaTeX file (size option) +) +\c@part=\count79 +\c@chapter=\count80 +\c@section=\count81 +\c@subsection=\count82 +\c@subsubsection=\count83 +\c@paragraph=\count84 +\c@subparagraph=\count85 +\c@figure=\count86 +\c@table=\count87 +\abovecaptionskip=\skip41 +\belowcaptionskip=\skip42 +\bibindent=\dimen102 +) +(/usr/share/texlive/texmf-dist/tex/latex/base/fixltx2e.sty +Package: fixltx2e 2016/12/29 v2.1a fixes to LaTeX (obsolete) +Applying: [2015/01/01] Old fixltx2e package on input line 46. + + +Package fixltx2e Warning: fixltx2e is not required with releases after 2015 +(fixltx2e) All fixes are now in the LaTeX kernel. +(fixltx2e) See the latexrelease package for details. + +Already applied: [0000/00/00] Old fixltx2e package on input line 53. +) (/usr/share/texlive/texmf-dist/tex/latex/tools/calc.sty +Package: calc 2014/10/28 v4.3 Infix arithmetic (KKT,FJ) +\calc@Acount=\count88 +\calc@Bcount=\count89 +\calc@Adimen=\dimen103 +\calc@Bdimen=\dimen104 +\calc@Askip=\skip43 +\calc@Bskip=\skip44 +LaTeX Info: Redefining \setlength on input line 80. +LaTeX Info: Redefining \addtolength on input line 81. +\calc@Ccount=\count90 +\calc@Cskip=\skip45 +) (./doxygen.sty +Package: doxygen + +(/usr/share/texlive/texmf-dist/tex/latex/base/alltt.sty +Package: alltt 1997/06/16 v2.0g defines alltt environment +) +(/usr/share/texlive/texmf-dist/tex/latex/tools/array.sty +Package: array 2016/10/06 v2.4d Tabular extension package (FMi) +\col@sep=\dimen105 +\extrarowheight=\dimen106 +\NC@list=\toks14 +\extratabsurround=\skip46 +\backup@length=\skip47 +) +(/usr/share/texlive/texmf-dist/tex/latex/float/float.sty +Package: float 2001/11/08 v1.3d Float enhancements (AL) +\c@float@type=\count91 +\float@exts=\toks15 +\float@box=\box26 +\@float@everytoks=\toks16 +\@floatcapt=\box27 +) +(/usr/share/texlive/texmf-dist/tex/latex/base/ifthen.sty +Package: ifthen 2014/09/29 v1.1c Standard LaTeX ifthen package (DPC) +) +(/usr/share/texlive/texmf-dist/tex/latex/tools/verbatim.sty +Package: verbatim 2014/10/28 v1.5q LaTeX2e package for verbatim enhancements +\every@verbatim=\toks17 +\verbatim@line=\toks18 +\verbatim@in@stream=\read1 +) +(/usr/share/texlive/texmf-dist/tex/latex/xcolor/xcolor.sty +Package: xcolor 2016/05/11 v2.12 LaTeX color extensions (UK) + +(/usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/color.cfg +File: color.cfg 2016/01/02 v1.6 sample color configuration +) +Package xcolor Info: Driver file: pdftex.def on input line 225. + +(/usr/share/texlive/texmf-dist/tex/latex/graphics-def/pdftex.def +File: pdftex.def 2018/01/08 v1.0l Graphics/color driver for pdftex +) +(/usr/share/texlive/texmf-dist/tex/latex/colortbl/colortbl.sty +Package: colortbl 2012/02/13 v1.0a Color table columns (DPC) +\everycr=\toks19 +\minrowclearance=\skip48 +) +\rownum=\count92 +Package xcolor Info: Model `cmy' substituted by `cmy0' on input line 1348. +Package xcolor Info: Model `hsb' substituted by `rgb' on input line 1352. +Package xcolor Info: Model `RGB' extended on input line 1364. +Package xcolor Info: Model `HTML' substituted by `rgb' on input line 1366. +Package xcolor Info: Model `Hsb' substituted by `hsb' on input line 1367. +Package xcolor Info: Model `tHsb' substituted by `hsb' on input line 1368. +Package xcolor Info: Model `HSB' substituted by `hsb' on input line 1369. +Package xcolor Info: Model `Gray' substituted by `gray' on input line 1370. +Package xcolor Info: Model `wave' substituted by `hsb' on input line 1371. +) +(/usr/share/texlive/texmf-dist/tex/latex/tools/longtable.sty +Package: longtable 2014/10/28 v4.11 Multi-page Table package (DPC) +\LTleft=\skip49 +\LTright=\skip50 +\LTpre=\skip51 +\LTpost=\skip52 +\LTchunksize=\count93 +\LTcapwidth=\dimen107 +\LT@head=\box28 +\LT@firsthead=\box29 +\LT@foot=\box30 +\LT@lastfoot=\box31 +\LT@cols=\count94 +\LT@rows=\count95 +\c@LT@tables=\count96 +\c@LT@chunks=\count97 +\LT@p@ftn=\toks20 +) +(/usr/share/texlive/texmf-dist/tex/latex/tabu/tabu.sty +Package: tabu 2011/02/26 v2.8 - flexible LaTeX tabulars (FC) + +(/usr/share/texlive/texmf-dist/tex/latex/varwidth/varwidth.sty +Package: varwidth 2009/03/30 ver 0.92; Variable-width minipages +\@vwid@box=\box32 +\sift@deathcycles=\count98 +\@vwid@loff=\dimen108 +\@vwid@roff=\dimen109 +) +\c@taburow=\count99 +\tabu@nbcols=\count100 +\tabu@cnt=\count101 +\tabu@Xcol=\count102 +\tabu@alloc=\count103 +\tabu@nested=\count104 +\tabu@target=\dimen110 +\tabu@spreadtarget=\dimen111 +\tabu@naturalX=\dimen112 +\tabucolX=\dimen113 +\tabu@Xsum=\dimen114 +\extrarowdepth=\dimen115 +\abovetabulinesep=\dimen116 +\belowtabulinesep=\dimen117 +\tabustrutrule=\dimen118 +\tabu@thebody=\toks21 +\tabu@footnotes=\toks22 +\tabu@box=\box33 +\tabu@arstrutbox=\box34 +\tabu@hleads=\box35 +\tabu@vleads=\box36 +\tabu@cellskip=\skip53 +) +(/usr/share/texlive/texmf-dist/tex/latex/tools/tabularx.sty +Package: tabularx 2016/02/03 v2.11 `tabularx' package (DPC) +\TX@col@width=\dimen119 +\TX@old@table=\dimen120 +\TX@old@col=\dimen121 +\TX@target=\dimen122 +\TX@delta=\dimen123 +\TX@cols=\count105 +\TX@ftn=\toks23 +) +(/usr/share/texlive/texmf-dist/tex/latex/multirow/multirow.sty +Package: multirow 2016/11/25 v2.2 Span multiple rows of a table +\multirow@colwidth=\skip54 +\multirow@cntb=\count106 +\multirow@dima=\skip55 +\bigstrutjot=\dimen124 +) +\xrefbox=\box37 +\xreflength=\skip56 +) +(/usr/share/texlive/texmf-dist/tex/latex/adjustbox/adjustbox.sty +Package: adjustbox 2012/05/21 v1.0 Adjusting TeX boxes (trim, clip, ...) + +(/usr/share/texlive/texmf-dist/tex/latex/xkeyval/xkeyval.sty +Package: xkeyval 2014/12/03 v2.7a package option processing (HA) + +(/usr/share/texlive/texmf-dist/tex/generic/xkeyval/xkeyval.tex +(/usr/share/texlive/texmf-dist/tex/generic/xkeyval/xkvutils.tex +\XKV@toks=\toks24 +\XKV@tempa@toks=\toks25 + +(/usr/share/texlive/texmf-dist/tex/generic/xkeyval/keyval.tex)) +\XKV@depth=\count107 +File: xkeyval.tex 2014/12/03 v2.7a key=value parser (HA) +)) +(/usr/share/texlive/texmf-dist/tex/latex/adjustbox/adjcalc.sty +Package: adjcalc 2012/05/16 v1.1 Provides advanced setlength with multiple back +-ends (calc, etex, pgfmath) +) +(/usr/share/texlive/texmf-dist/tex/latex/adjustbox/trimclip.sty +Package: trimclip 2012/05/16 v1.0 Trim and clip general TeX material + +(/usr/share/texlive/texmf-dist/tex/latex/graphics/graphicx.sty +Package: graphicx 2017/06/01 v1.1a Enhanced LaTeX Graphics (DPC,SPQR) + +(/usr/share/texlive/texmf-dist/tex/latex/graphics/graphics.sty +Package: graphics 2017/06/25 v1.2c Standard LaTeX Graphics (DPC,SPQR) + +(/usr/share/texlive/texmf-dist/tex/latex/graphics/trig.sty +Package: trig 2016/01/03 v1.10 sin cos tan (DPC) +) +(/usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/graphics.cfg +File: graphics.cfg 2016/06/04 v1.11 sample graphics configuration +) +Package graphics Info: Driver file: pdftex.def on input line 99. +) +\Gin@req@height=\dimen125 +\Gin@req@width=\dimen126 +) +(/usr/share/texlive/texmf-dist/tex/latex/collectbox/collectbox.sty +Package: collectbox 2012/05/17 v0.4b Collect macro arguments as boxes +\collectedbox=\box38 +) +\tc@llx=\dimen127 +\tc@lly=\dimen128 +\tc@urx=\dimen129 +\tc@ury=\dimen130 +Package trimclip Info: Using driver 'tc-pdftex.def'. + +(/usr/share/texlive/texmf-dist/tex/latex/adjustbox/tc-pdftex.def +File: tc-pdftex.def 2012/05/13 v1.0 Clipping driver for pdftex +)) +\adjbox@Width=\dimen131 +\adjbox@Height=\dimen132 +\adjbox@Depth=\dimen133 +\adjbox@Totalheight=\dimen134 + +(/usr/share/texlive/texmf-dist/tex/latex/ifoddpage/ifoddpage.sty +Package: ifoddpage 2016/04/23 v1.1 Conditionals for odd/even page detection +\c@checkoddpage=\count108 +)) +(/usr/share/texlive/texmf-dist/tex/latex/base/inputenc.sty +Package: inputenc 2015/03/17 v1.2c Input encoding file +\inpenc@prehook=\toks26 +\inpenc@posthook=\toks27 + +(/usr/share/texlive/texmf-dist/tex/latex/base/utf8.def +File: utf8.def 2017/01/28 v1.1t UTF-8 support for inputenc +Now handling font encoding OML ... +... no UTF-8 mapping file for font encoding OML +Now handling font encoding T1 ... +... processing UTF-8 mapping file for font encoding T1 + +(/usr/share/texlive/texmf-dist/tex/latex/base/t1enc.dfu +File: t1enc.dfu 2017/01/28 v1.1t UTF-8 support for inputenc + defining Unicode char U+00A0 (decimal 160) + defining Unicode char U+00A1 (decimal 161) + defining Unicode char U+00A3 (decimal 163) + defining Unicode char U+00AB (decimal 171) + defining Unicode char U+00AD (decimal 173) + defining Unicode char U+00BB (decimal 187) + defining Unicode char U+00BF (decimal 191) + defining Unicode char U+00C0 (decimal 192) + defining Unicode char U+00C1 (decimal 193) + defining Unicode char U+00C2 (decimal 194) + defining Unicode char U+00C3 (decimal 195) + defining Unicode char U+00C4 (decimal 196) + defining Unicode char U+00C5 (decimal 197) + defining Unicode char U+00C6 (decimal 198) + defining Unicode char U+00C7 (decimal 199) + defining Unicode char U+00C8 (decimal 200) + defining Unicode char U+00C9 (decimal 201) + defining Unicode char U+00CA (decimal 202) + defining Unicode char U+00CB (decimal 203) + defining Unicode char U+00CC (decimal 204) + defining Unicode char U+00CD (decimal 205) + defining Unicode char U+00CE (decimal 206) + defining Unicode char U+00CF (decimal 207) + defining Unicode char U+00D0 (decimal 208) + defining Unicode char U+00D1 (decimal 209) + defining Unicode char U+00D2 (decimal 210) + defining Unicode char U+00D3 (decimal 211) + defining Unicode char U+00D4 (decimal 212) + defining Unicode char U+00D5 (decimal 213) + defining Unicode char U+00D6 (decimal 214) + defining Unicode char U+00D8 (decimal 216) + defining Unicode char U+00D9 (decimal 217) + defining Unicode char U+00DA (decimal 218) + defining Unicode char U+00DB (decimal 219) + defining Unicode char U+00DC (decimal 220) + defining Unicode char U+00DD (decimal 221) + defining Unicode char U+00DE (decimal 222) + defining Unicode char U+00DF (decimal 223) + defining Unicode char U+00E0 (decimal 224) + defining Unicode char U+00E1 (decimal 225) + defining Unicode char U+00E2 (decimal 226) + defining Unicode char U+00E3 (decimal 227) + defining Unicode char U+00E4 (decimal 228) + defining Unicode char U+00E5 (decimal 229) + defining Unicode char U+00E6 (decimal 230) + defining Unicode char U+00E7 (decimal 231) + defining Unicode char U+00E8 (decimal 232) + defining Unicode char U+00E9 (decimal 233) + defining Unicode char U+00EA (decimal 234) + defining Unicode char U+00EB (decimal 235) + defining Unicode char U+00EC (decimal 236) + defining Unicode char U+00ED (decimal 237) + defining Unicode char U+00EE (decimal 238) + defining Unicode char U+00EF (decimal 239) + defining Unicode char U+00F0 (decimal 240) + defining Unicode char U+00F1 (decimal 241) + defining Unicode char U+00F2 (decimal 242) + defining Unicode char U+00F3 (decimal 243) + defining Unicode char U+00F4 (decimal 244) + defining Unicode char U+00F5 (decimal 245) + defining Unicode char U+00F6 (decimal 246) + defining Unicode char U+00F8 (decimal 248) + defining Unicode char U+00F9 (decimal 249) + defining Unicode char U+00FA (decimal 250) + defining Unicode char U+00FB (decimal 251) + defining Unicode char U+00FC (decimal 252) + defining Unicode char U+00FD (decimal 253) + defining Unicode char U+00FE (decimal 254) + defining Unicode char U+00FF (decimal 255) + defining Unicode char U+0100 (decimal 256) + defining Unicode char U+0101 (decimal 257) + defining Unicode char U+0102 (decimal 258) + defining Unicode char U+0103 (decimal 259) + defining Unicode char U+0104 (decimal 260) + defining Unicode char U+0105 (decimal 261) + defining Unicode char U+0106 (decimal 262) + defining Unicode char U+0107 (decimal 263) + defining Unicode char U+0108 (decimal 264) + defining Unicode char U+0109 (decimal 265) + defining Unicode char U+010A (decimal 266) + defining Unicode char U+010B (decimal 267) + defining Unicode char U+010C (decimal 268) + defining Unicode char U+010D (decimal 269) + defining Unicode char U+010E (decimal 270) + defining Unicode char U+010F (decimal 271) + defining Unicode char U+0110 (decimal 272) + defining Unicode char U+0111 (decimal 273) + defining Unicode char U+0112 (decimal 274) + defining Unicode char U+0113 (decimal 275) + defining Unicode char U+0114 (decimal 276) + defining Unicode char U+0115 (decimal 277) + defining Unicode char U+0116 (decimal 278) + defining Unicode char U+0117 (decimal 279) + defining Unicode char U+0118 (decimal 280) + defining Unicode char U+0119 (decimal 281) + defining Unicode char U+011A (decimal 282) + defining Unicode char U+011B (decimal 283) + defining Unicode char U+011C (decimal 284) + defining Unicode char U+011D (decimal 285) + defining Unicode char U+011E (decimal 286) + defining Unicode char U+011F (decimal 287) + defining Unicode char U+0120 (decimal 288) + defining Unicode char U+0121 (decimal 289) + defining Unicode char U+0122 (decimal 290) + defining Unicode char U+0123 (decimal 291) + defining Unicode char U+0124 (decimal 292) + defining Unicode char U+0125 (decimal 293) + defining Unicode char U+0128 (decimal 296) + defining Unicode char U+0129 (decimal 297) + defining Unicode char U+012A (decimal 298) + defining Unicode char U+012B (decimal 299) + defining Unicode char U+012C (decimal 300) + defining Unicode char U+012D (decimal 301) + defining Unicode char U+012E (decimal 302) + defining Unicode char U+012F (decimal 303) + defining Unicode char U+0130 (decimal 304) + defining Unicode char U+0131 (decimal 305) + defining Unicode char U+0132 (decimal 306) + defining Unicode char U+0133 (decimal 307) + defining Unicode char U+0134 (decimal 308) + defining Unicode char U+0135 (decimal 309) + defining Unicode char U+0136 (decimal 310) + defining Unicode char U+0137 (decimal 311) + defining Unicode char U+0139 (decimal 313) + defining Unicode char U+013A (decimal 314) + defining Unicode char U+013B (decimal 315) + defining Unicode char U+013C (decimal 316) + defining Unicode char U+013D (decimal 317) + defining Unicode char U+013E (decimal 318) + defining Unicode char U+0141 (decimal 321) + defining Unicode char U+0142 (decimal 322) + defining Unicode char U+0143 (decimal 323) + defining Unicode char U+0144 (decimal 324) + defining Unicode char U+0145 (decimal 325) + defining Unicode char U+0146 (decimal 326) + defining Unicode char U+0147 (decimal 327) + defining Unicode char U+0148 (decimal 328) + defining Unicode char U+014A (decimal 330) + defining Unicode char U+014B (decimal 331) + defining Unicode char U+014C (decimal 332) + defining Unicode char U+014D (decimal 333) + defining Unicode char U+014E (decimal 334) + defining Unicode char U+014F (decimal 335) + defining Unicode char U+0150 (decimal 336) + defining Unicode char U+0151 (decimal 337) + defining Unicode char U+0152 (decimal 338) + defining Unicode char U+0153 (decimal 339) + defining Unicode char U+0154 (decimal 340) + defining Unicode char U+0155 (decimal 341) + defining Unicode char U+0156 (decimal 342) + defining Unicode char U+0157 (decimal 343) + defining Unicode char U+0158 (decimal 344) + defining Unicode char U+0159 (decimal 345) + defining Unicode char U+015A (decimal 346) + defining Unicode char U+015B (decimal 347) + defining Unicode char U+015C (decimal 348) + defining Unicode char U+015D (decimal 349) + defining Unicode char U+015E (decimal 350) + defining Unicode char U+015F (decimal 351) + defining Unicode char U+0160 (decimal 352) + defining Unicode char U+0161 (decimal 353) + defining Unicode char U+0162 (decimal 354) + defining Unicode char U+0163 (decimal 355) + defining Unicode char U+0164 (decimal 356) + defining Unicode char U+0165 (decimal 357) + defining Unicode char U+0168 (decimal 360) + defining Unicode char U+0169 (decimal 361) + defining Unicode char U+016A (decimal 362) + defining Unicode char U+016B (decimal 363) + defining Unicode char U+016C (decimal 364) + defining Unicode char U+016D (decimal 365) + defining Unicode char U+016E (decimal 366) + defining Unicode char U+016F (decimal 367) + defining Unicode char U+0170 (decimal 368) + defining Unicode char U+0171 (decimal 369) + defining Unicode char U+0172 (decimal 370) + defining Unicode char U+0173 (decimal 371) + defining Unicode char U+0174 (decimal 372) + defining Unicode char U+0175 (decimal 373) + defining Unicode char U+0176 (decimal 374) + defining Unicode char U+0177 (decimal 375) + defining Unicode char U+0178 (decimal 376) + defining Unicode char U+0179 (decimal 377) + defining Unicode char U+017A (decimal 378) + defining Unicode char U+017B (decimal 379) + defining Unicode char U+017C (decimal 380) + defining Unicode char U+017D (decimal 381) + defining Unicode char U+017E (decimal 382) + defining Unicode char U+01CD (decimal 461) + defining Unicode char U+01CE (decimal 462) + defining Unicode char U+01CF (decimal 463) + defining Unicode char U+01D0 (decimal 464) + defining Unicode char U+01D1 (decimal 465) + defining Unicode char U+01D2 (decimal 466) + defining Unicode char U+01D3 (decimal 467) + defining Unicode char U+01D4 (decimal 468) + defining Unicode char U+01E2 (decimal 482) + defining Unicode char U+01E3 (decimal 483) + defining Unicode char U+01E6 (decimal 486) + defining Unicode char U+01E7 (decimal 487) + defining Unicode char U+01E8 (decimal 488) + defining Unicode char U+01E9 (decimal 489) + defining Unicode char U+01EA (decimal 490) + defining Unicode char U+01EB (decimal 491) + defining Unicode char U+01F0 (decimal 496) + defining Unicode char U+01F4 (decimal 500) + defining Unicode char U+01F5 (decimal 501) + defining Unicode char U+0218 (decimal 536) + defining Unicode char U+0219 (decimal 537) + defining Unicode char U+021A (decimal 538) + defining Unicode char U+021B (decimal 539) + defining Unicode char U+0232 (decimal 562) + defining Unicode char U+0233 (decimal 563) + defining Unicode char U+1E02 (decimal 7682) + defining Unicode char U+1E03 (decimal 7683) + defining Unicode char U+200C (decimal 8204) + defining Unicode char U+2010 (decimal 8208) + defining Unicode char U+2011 (decimal 8209) + defining Unicode char U+2012 (decimal 8210) + defining Unicode char U+2013 (decimal 8211) + defining Unicode char U+2014 (decimal 8212) + defining Unicode char U+2015 (decimal 8213) + defining Unicode char U+2018 (decimal 8216) + defining Unicode char U+2019 (decimal 8217) + defining Unicode char U+201A (decimal 8218) + defining Unicode char U+201C (decimal 8220) + defining Unicode char U+201D (decimal 8221) + defining Unicode char U+201E (decimal 8222) + defining Unicode char U+2030 (decimal 8240) + defining Unicode char U+2031 (decimal 8241) + defining Unicode char U+2039 (decimal 8249) + defining Unicode char U+203A (decimal 8250) + defining Unicode char U+2423 (decimal 9251) + defining Unicode char U+1E20 (decimal 7712) + defining Unicode char U+1E21 (decimal 7713) +) +Now handling font encoding OT1 ... +... processing UTF-8 mapping file for font encoding OT1 + +(/usr/share/texlive/texmf-dist/tex/latex/base/ot1enc.dfu +File: ot1enc.dfu 2017/01/28 v1.1t UTF-8 support for inputenc + defining Unicode char U+00A0 (decimal 160) + defining Unicode char U+00A1 (decimal 161) + defining Unicode char U+00A3 (decimal 163) + defining Unicode char U+00AD (decimal 173) + defining Unicode char U+00B8 (decimal 184) + defining Unicode char U+00BF (decimal 191) + defining Unicode char U+00C5 (decimal 197) + defining Unicode char U+00C6 (decimal 198) + defining Unicode char U+00D8 (decimal 216) + defining Unicode char U+00DF (decimal 223) + defining Unicode char U+00E6 (decimal 230) + defining Unicode char U+00EC (decimal 236) + defining Unicode char U+00ED (decimal 237) + defining Unicode char U+00EE (decimal 238) + defining Unicode char U+00EF (decimal 239) + defining Unicode char U+00F8 (decimal 248) + defining Unicode char U+0131 (decimal 305) + defining Unicode char U+0141 (decimal 321) + defining Unicode char U+0142 (decimal 322) + defining Unicode char U+0152 (decimal 338) + defining Unicode char U+0153 (decimal 339) + defining Unicode char U+0174 (decimal 372) + defining Unicode char U+0175 (decimal 373) + defining Unicode char U+0176 (decimal 374) + defining Unicode char U+0177 (decimal 375) + defining Unicode char U+0218 (decimal 536) + defining Unicode char U+0219 (decimal 537) + defining Unicode char U+021A (decimal 538) + defining Unicode char U+021B (decimal 539) + defining Unicode char U+2013 (decimal 8211) + defining Unicode char U+2014 (decimal 8212) + defining Unicode char U+2018 (decimal 8216) + defining Unicode char U+2019 (decimal 8217) + defining Unicode char U+201C (decimal 8220) + defining Unicode char U+201D (decimal 8221) +) +Now handling font encoding OMS ... +... processing UTF-8 mapping file for font encoding OMS + +(/usr/share/texlive/texmf-dist/tex/latex/base/omsenc.dfu +File: omsenc.dfu 2017/01/28 v1.1t UTF-8 support for inputenc + defining Unicode char U+00A7 (decimal 167) + defining Unicode char U+00B6 (decimal 182) + defining Unicode char U+00B7 (decimal 183) + defining Unicode char U+2020 (decimal 8224) + defining Unicode char U+2021 (decimal 8225) + defining Unicode char U+2022 (decimal 8226) +) +Now handling font encoding OMX ... +... no UTF-8 mapping file for font encoding OMX +Now handling font encoding U ... +... no UTF-8 mapping file for font encoding U + defining Unicode char U+00A9 (decimal 169) + defining Unicode char U+00AA (decimal 170) + defining Unicode char U+00AE (decimal 174) + defining Unicode char U+00BA (decimal 186) + defining Unicode char U+02C6 (decimal 710) + defining Unicode char U+02DC (decimal 732) + defining Unicode char U+200C (decimal 8204) + defining Unicode char U+2026 (decimal 8230) + defining Unicode char U+2122 (decimal 8482) + defining Unicode char U+2423 (decimal 9251) +)) +(/usr/share/texlive/texmf-dist/tex/latex/base/makeidx.sty +Package: makeidx 2014/09/29 v1.0m Standard LaTeX package +) +(/usr/share/texlive/texmf-dist/tex/latex/tools/multicol.sty +Package: multicol 2017/04/11 v1.8q multicolumn formatting (FMi) +\c@tracingmulticols=\count109 +\mult@box=\box39 +\multicol@leftmargin=\dimen135 +\c@unbalance=\count110 +\c@collectmore=\count111 +\doublecol@number=\count112 +\multicoltolerance=\count113 +\multicolpretolerance=\count114 +\full@width=\dimen136 +\page@free=\dimen137 +\premulticols=\dimen138 +\postmulticols=\dimen139 +\multicolsep=\skip57 +\multicolbaselineskip=\skip58 +\partial@page=\box40 +\last@line=\box41 +\maxbalancingoverflow=\dimen140 +\mult@rightbox=\box42 +\mult@grightbox=\box43 +\mult@gfirstbox=\box44 +\mult@firstbox=\box45 +\@tempa=\box46 +\@tempa=\box47 +\@tempa=\box48 +\@tempa=\box49 +\@tempa=\box50 +\@tempa=\box51 +\@tempa=\box52 +\@tempa=\box53 +\@tempa=\box54 +\@tempa=\box55 +\@tempa=\box56 +\@tempa=\box57 +\@tempa=\box58 +\@tempa=\box59 +\@tempa=\box60 +\@tempa=\box61 +\@tempa=\box62 +\c@columnbadness=\count115 +\c@finalcolumnbadness=\count116 +\last@try=\dimen141 +\multicolovershoot=\dimen142 +\multicolundershoot=\dimen143 +\mult@nat@firstbox=\box63 +\colbreak@box=\box64 +\mc@col@check@num=\count117 +) +(/usr/share/texlive/texmf-dist/tex/latex/base/textcomp.sty +Package: textcomp 2017/04/05 v2.0i Standard LaTeX package +Package textcomp Info: Sub-encoding information: +(textcomp) 5 = only ISO-Adobe without \textcurrency +(textcomp) 4 = 5 + \texteuro +(textcomp) 3 = 4 + \textohm +(textcomp) 2 = 3 + \textestimated + \textcurrency +(textcomp) 1 = TS1 - \textcircled - \t +(textcomp) 0 = TS1 (full) +(textcomp) Font families with sub-encoding setting implement +(textcomp) only a restricted character set as indicated. +(textcomp) Family '?' is the default used for unknown fonts. +(textcomp) See the documentation for details. +Package textcomp Info: Setting ? sub-encoding to TS1/1 on input line 79. + +(/usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.def +File: ts1enc.def 2001/06/05 v3.0e (jk/car/fm) Standard LaTeX file +Now handling font encoding TS1 ... +... processing UTF-8 mapping file for font encoding TS1 + +(/usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.dfu +File: ts1enc.dfu 2017/01/28 v1.1t UTF-8 support for inputenc + defining Unicode char U+00A2 (decimal 162) + defining Unicode char U+00A3 (decimal 163) + defining Unicode char U+00A4 (decimal 164) + defining Unicode char U+00A5 (decimal 165) + defining Unicode char U+00A6 (decimal 166) + defining Unicode char U+00A7 (decimal 167) + defining Unicode char U+00A8 (decimal 168) + defining Unicode char U+00A9 (decimal 169) + defining Unicode char U+00AA (decimal 170) + defining Unicode char U+00AC (decimal 172) + defining Unicode char U+00AE (decimal 174) + defining Unicode char U+00AF (decimal 175) + defining Unicode char U+00B0 (decimal 176) + defining Unicode char U+00B1 (decimal 177) + defining Unicode char U+00B2 (decimal 178) + defining Unicode char U+00B3 (decimal 179) + defining Unicode char U+00B4 (decimal 180) + defining Unicode char U+00B5 (decimal 181) + defining Unicode char U+00B6 (decimal 182) + defining Unicode char U+00B7 (decimal 183) + defining Unicode char U+00B9 (decimal 185) + defining Unicode char U+00BA (decimal 186) + defining Unicode char U+00BC (decimal 188) + defining Unicode char U+00BD (decimal 189) + defining Unicode char U+00BE (decimal 190) + defining Unicode char U+00D7 (decimal 215) + defining Unicode char U+00F7 (decimal 247) + defining Unicode char U+0192 (decimal 402) + defining Unicode char U+02C7 (decimal 711) + defining Unicode char U+02D8 (decimal 728) + defining Unicode char U+02DD (decimal 733) + defining Unicode char U+0E3F (decimal 3647) + defining Unicode char U+2016 (decimal 8214) + defining Unicode char U+2020 (decimal 8224) + defining Unicode char U+2021 (decimal 8225) + defining Unicode char U+2022 (decimal 8226) + defining Unicode char U+2030 (decimal 8240) + defining Unicode char U+2031 (decimal 8241) + defining Unicode char U+203B (decimal 8251) + defining Unicode char U+203D (decimal 8253) + defining Unicode char U+2044 (decimal 8260) + defining Unicode char U+204E (decimal 8270) + defining Unicode char U+2052 (decimal 8274) + defining Unicode char U+20A1 (decimal 8353) + defining Unicode char U+20A4 (decimal 8356) + defining Unicode char U+20A6 (decimal 8358) + defining Unicode char U+20A9 (decimal 8361) + defining Unicode char U+20AB (decimal 8363) + defining Unicode char U+20AC (decimal 8364) + defining Unicode char U+20B1 (decimal 8369) + defining Unicode char U+2103 (decimal 8451) + defining Unicode char U+2116 (decimal 8470) + defining Unicode char U+2117 (decimal 8471) + defining Unicode char U+211E (decimal 8478) + defining Unicode char U+2120 (decimal 8480) + defining Unicode char U+2122 (decimal 8482) + defining Unicode char U+2126 (decimal 8486) + defining Unicode char U+2127 (decimal 8487) + defining Unicode char U+212E (decimal 8494) + defining Unicode char U+2190 (decimal 8592) + defining Unicode char U+2191 (decimal 8593) + defining Unicode char U+2192 (decimal 8594) + defining Unicode char U+2193 (decimal 8595) + defining Unicode char U+2329 (decimal 9001) + defining Unicode char U+232A (decimal 9002) + defining Unicode char U+2422 (decimal 9250) + defining Unicode char U+25E6 (decimal 9702) + defining Unicode char U+25EF (decimal 9711) + defining Unicode char U+266A (decimal 9834) +)) +LaTeX Info: Redefining \oldstylenums on input line 334. +Package textcomp Info: Setting cmr sub-encoding to TS1/0 on input line 349. +Package textcomp Info: Setting cmss sub-encoding to TS1/0 on input line 350. +Package textcomp Info: Setting cmtt sub-encoding to TS1/0 on input line 351. +Package textcomp Info: Setting cmvtt sub-encoding to TS1/0 on input line 352. +Package textcomp Info: Setting cmbr sub-encoding to TS1/0 on input line 353. +Package textcomp Info: Setting cmtl sub-encoding to TS1/0 on input line 354. +Package textcomp Info: Setting ccr sub-encoding to TS1/0 on input line 355. +Package textcomp Info: Setting ptm sub-encoding to TS1/4 on input line 356. +Package textcomp Info: Setting pcr sub-encoding to TS1/4 on input line 357. +Package textcomp Info: Setting phv sub-encoding to TS1/4 on input line 358. +Package textcomp Info: Setting ppl sub-encoding to TS1/3 on input line 359. +Package textcomp Info: Setting pag sub-encoding to TS1/4 on input line 360. +Package textcomp Info: Setting pbk sub-encoding to TS1/4 on input line 361. +Package textcomp Info: Setting pnc sub-encoding to TS1/4 on input line 362. +Package textcomp Info: Setting pzc sub-encoding to TS1/4 on input line 363. +Package textcomp Info: Setting bch sub-encoding to TS1/4 on input line 364. +Package textcomp Info: Setting put sub-encoding to TS1/5 on input line 365. +Package textcomp Info: Setting uag sub-encoding to TS1/5 on input line 366. +Package textcomp Info: Setting ugq sub-encoding to TS1/5 on input line 367. +Package textcomp Info: Setting ul8 sub-encoding to TS1/4 on input line 368. +Package textcomp Info: Setting ul9 sub-encoding to TS1/4 on input line 369. +Package textcomp Info: Setting augie sub-encoding to TS1/5 on input line 370. +Package textcomp Info: Setting dayrom sub-encoding to TS1/3 on input line 371. +Package textcomp Info: Setting dayroms sub-encoding to TS1/3 on input line 372. + +Package textcomp Info: Setting pxr sub-encoding to TS1/0 on input line 373. +Package textcomp Info: Setting pxss sub-encoding to TS1/0 on input line 374. +Package textcomp Info: Setting pxtt sub-encoding to TS1/0 on input line 375. +Package textcomp Info: Setting txr sub-encoding to TS1/0 on input line 376. +Package textcomp Info: Setting txss sub-encoding to TS1/0 on input line 377. +Package textcomp Info: Setting txtt sub-encoding to TS1/0 on input line 378. +Package textcomp Info: Setting lmr sub-encoding to TS1/0 on input line 379. +Package textcomp Info: Setting lmdh sub-encoding to TS1/0 on input line 380. +Package textcomp Info: Setting lmss sub-encoding to TS1/0 on input line 381. +Package textcomp Info: Setting lmssq sub-encoding to TS1/0 on input line 382. +Package textcomp Info: Setting lmvtt sub-encoding to TS1/0 on input line 383. +Package textcomp Info: Setting lmtt sub-encoding to TS1/0 on input line 384. +Package textcomp Info: Setting qhv sub-encoding to TS1/0 on input line 385. +Package textcomp Info: Setting qag sub-encoding to TS1/0 on input line 386. +Package textcomp Info: Setting qbk sub-encoding to TS1/0 on input line 387. +Package textcomp Info: Setting qcr sub-encoding to TS1/0 on input line 388. +Package textcomp Info: Setting qcs sub-encoding to TS1/0 on input line 389. +Package textcomp Info: Setting qpl sub-encoding to TS1/0 on input line 390. +Package textcomp Info: Setting qtm sub-encoding to TS1/0 on input line 391. +Package textcomp Info: Setting qzc sub-encoding to TS1/0 on input line 392. +Package textcomp Info: Setting qhvc sub-encoding to TS1/0 on input line 393. +Package textcomp Info: Setting futs sub-encoding to TS1/4 on input line 394. +Package textcomp Info: Setting futx sub-encoding to TS1/4 on input line 395. +Package textcomp Info: Setting futj sub-encoding to TS1/4 on input line 396. +Package textcomp Info: Setting hlh sub-encoding to TS1/3 on input line 397. +Package textcomp Info: Setting hls sub-encoding to TS1/3 on input line 398. +Package textcomp Info: Setting hlst sub-encoding to TS1/3 on input line 399. +Package textcomp Info: Setting hlct sub-encoding to TS1/5 on input line 400. +Package textcomp Info: Setting hlx sub-encoding to TS1/5 on input line 401. +Package textcomp Info: Setting hlce sub-encoding to TS1/5 on input line 402. +Package textcomp Info: Setting hlcn sub-encoding to TS1/5 on input line 403. +Package textcomp Info: Setting hlcw sub-encoding to TS1/5 on input line 404. +Package textcomp Info: Setting hlcf sub-encoding to TS1/5 on input line 405. +Package textcomp Info: Setting pplx sub-encoding to TS1/3 on input line 406. +Package textcomp Info: Setting pplj sub-encoding to TS1/3 on input line 407. +Package textcomp Info: Setting ptmx sub-encoding to TS1/4 on input line 408. +Package textcomp Info: Setting ptmj sub-encoding to TS1/4 on input line 409. +) +(/usr/share/texlive/texmf-dist/tex/latex/wasysym/wasysym.sty +Package: wasysym 2003/10/30 v2.0 Wasy-2 symbol support package +\symwasy=\mathgroup4 +LaTeX Font Info: Overwriting symbol font `wasy' in version `bold' +(Font) U/wasy/m/n --> U/wasy/b/n on input line 90. +) +(/usr/share/texlive/texmf-dist/tex/latex/base/fontenc.sty +Package: fontenc 2017/04/05 v2.0i Standard LaTeX package + +(/usr/share/texlive/texmf-dist/tex/latex/base/t1enc.def +File: t1enc.def 2017/04/05 v2.0i Standard LaTeX file +LaTeX Font Info: Redeclaring font encoding T1 on input line 48. +)) +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/helvet.sty +Package: helvet 2005/04/12 PSNFSS-v9.2a (WaS) +) +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/courier.sty +Package: courier 2005/04/12 PSNFSS-v9.2a (WaS) +) +(/usr/share/texlive/texmf-dist/tex/latex/amsfonts/amssymb.sty +Package: amssymb 2013/01/14 v3.01 AMS font symbols + +(/usr/share/texlive/texmf-dist/tex/latex/amsfonts/amsfonts.sty +Package: amsfonts 2013/01/14 v3.01 Basic AMSFonts support +\@emptytoks=\toks28 +\symAMSa=\mathgroup5 +\symAMSb=\mathgroup6 +LaTeX Font Info: Overwriting math alphabet `\mathfrak' in version `bold' +(Font) U/euf/m/n --> U/euf/b/n on input line 106. +)) +(/usr/share/texlive/texmf-dist/tex/latex/sectsty/sectsty.sty +Package: sectsty 2002/02/25 v2.0.2 Commands to change all sectional heading sty +les +) +(/usr/share/texlive/texmf-dist/tex/latex/geometry/geometry.sty +Package: geometry 2010/09/12 v5.6 Page Geometry + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifpdf.sty +Package: ifpdf 2017/03/15 v3.2 Provides the ifpdf switch +) +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifvtex.sty +Package: ifvtex 2016/05/16 v1.6 Detect VTeX and its facilities (HO) +Package ifvtex Info: VTeX not detected. +) +(/usr/share/texlive/texmf-dist/tex/generic/ifxetex/ifxetex.sty +Package: ifxetex 2010/09/12 v0.6 Provides ifxetex conditional +) +\Gm@cnth=\count118 +\Gm@cntv=\count119 +\c@Gm@tempcnt=\count120 +\Gm@bindingoffset=\dimen144 +\Gm@wd@mp=\dimen145 +\Gm@odd@mp=\dimen146 +\Gm@even@mp=\dimen147 +\Gm@layoutwidth=\dimen148 +\Gm@layoutheight=\dimen149 +\Gm@layouthoffset=\dimen150 +\Gm@layoutvoffset=\dimen151 +\Gm@dimlist=\toks29 +) +(/usr/share/texlive/texmf-dist/tex/latex/fancyhdr/fancyhdr.sty +Package: fancyhdr 2017/06/30 v3.9a Extensive control of page headers and footer +s +\f@nch@headwidth=\skip59 +\f@nch@O@elh=\skip60 +\f@nch@O@erh=\skip61 +\f@nch@O@olh=\skip62 +\f@nch@O@orh=\skip63 +\f@nch@O@elf=\skip64 +\f@nch@O@erf=\skip65 +\f@nch@O@olf=\skip66 +\f@nch@O@orf=\skip67 +) +(/usr/share/texlive/texmf-dist/tex/latex/natbib/natbib.sty +Package: natbib 2010/09/13 8.31b (PWD, AO) +\bibhang=\skip68 +\bibsep=\skip69 +LaTeX Info: Redefining \cite on input line 694. +\c@NAT@ctr=\count121 +) +(/usr/share/texlive/texmf-dist/tex/latex/tocloft/tocloft.sty +Package: tocloft 2017/08/31 v2.3i parameterised ToC, etc., typesetting +Package tocloft Info: The document has chapter divisions on input line 51. +\cftparskip=\skip70 +\cftbeforetoctitleskip=\skip71 +\cftaftertoctitleskip=\skip72 +\cftbeforepartskip=\skip73 +\cftpartnumwidth=\skip74 +\cftpartindent=\skip75 +\cftbeforechapskip=\skip76 +\cftchapindent=\skip77 +\cftchapnumwidth=\skip78 +\cftbeforesecskip=\skip79 +\cftsecindent=\skip80 +\cftsecnumwidth=\skip81 +\cftbeforesubsecskip=\skip82 +\cftsubsecindent=\skip83 +\cftsubsecnumwidth=\skip84 +\cftbeforesubsubsecskip=\skip85 +\cftsubsubsecindent=\skip86 +\cftsubsubsecnumwidth=\skip87 +\cftbeforeparaskip=\skip88 +\cftparaindent=\skip89 +\cftparanumwidth=\skip90 +\cftbeforesubparaskip=\skip91 +\cftsubparaindent=\skip92 +\cftsubparanumwidth=\skip93 +\cftbeforeloftitleskip=\skip94 +\cftafterloftitleskip=\skip95 +\cftbeforefigskip=\skip96 +\cftfigindent=\skip97 +\cftfignumwidth=\skip98 +\c@lofdepth=\count122 +\c@lotdepth=\count123 +\cftbeforelottitleskip=\skip99 +\cftafterlottitleskip=\skip100 +\cftbeforetabskip=\skip101 +\cfttabindent=\skip102 +\cfttabnumwidth=\skip103 +) +\@indexfile=\write3 +\openout3 = `refman.idx'. + + +Writing index file refman.idx +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/hyperref.sty +Package: hyperref 2018/02/06 v6.86b Hypertext links for LaTeX + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-hyperref.sty +Package: hobsub-hyperref 2016/05/16 v1.14 Bundle oberdiek, subset hyperref (HO) + + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-generic.sty +Package: hobsub-generic 2016/05/16 v1.14 Bundle oberdiek, subset generic (HO) +Package: hobsub 2016/05/16 v1.14 Construct package bundles (HO) +Package: infwarerr 2016/05/16 v1.4 Providing info/warning/error messages (HO) +Package: ltxcmds 2016/05/16 v1.23 LaTeX kernel commands for general use (HO) +Package: ifluatex 2016/05/16 v1.4 Provides the ifluatex switch (HO) +Package ifluatex Info: LuaTeX not detected. +Package hobsub Info: Skipping package `ifvtex' (already loaded). +Package: intcalc 2016/05/16 v1.2 Expandable calculations with integers (HO) +Package hobsub Info: Skipping package `ifpdf' (already loaded). +Package: etexcmds 2016/05/16 v1.6 Avoid name clashes with e-TeX commands (HO) +Package etexcmds Info: Could not find \expanded. +(etexcmds) That can mean that you are not using pdfTeX 1.50 or +(etexcmds) that some package has redefined \expanded. +(etexcmds) In the latter case, load this package earlier. +Package: kvsetkeys 2016/05/16 v1.17 Key value parser (HO) +Package: kvdefinekeys 2016/05/16 v1.4 Define keys (HO) +Package: pdftexcmds 2018/01/21 v0.26 Utility functions of pdfTeX for LuaTeX (HO +) +Package pdftexcmds Info: LuaTeX not detected. +Package pdftexcmds Info: \pdf@primitive is available. +Package pdftexcmds Info: \pdf@ifprimitive is available. +Package pdftexcmds Info: \pdfdraftmode found. +Package: pdfescape 2016/05/16 v1.14 Implements pdfTeX's escape features (HO) +Package: bigintcalc 2016/05/16 v1.4 Expandable calculations on big integers (HO +) +Package: bitset 2016/05/16 v1.2 Handle bit-vector datatype (HO) +Package: uniquecounter 2016/05/16 v1.3 Provide unlimited unique counter (HO) +) +Package hobsub Info: Skipping package `hobsub' (already loaded). +Package: letltxmacro 2016/05/16 v1.5 Let assignment for LaTeX macros (HO) +Package: hopatch 2016/05/16 v1.3 Wrapper for package hooks (HO) +Package: xcolor-patch 2016/05/16 xcolor patch +Package: atveryend 2016/05/16 v1.9 Hooks at the very end of document (HO) +Package atveryend Info: \enddocument detected (standard20110627). +Package: atbegshi 2016/06/09 v1.18 At begin shipout hook (HO) +Package: refcount 2016/05/16 v3.5 Data extraction from label references (HO) +Package: hycolor 2016/05/16 v1.8 Color options for hyperref/bookmark (HO) +) +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/auxhook.sty +Package: auxhook 2016/05/16 v1.4 Hooks for auxiliary files (HO) +) +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/kvoptions.sty +Package: kvoptions 2016/05/16 v3.12 Key value format for package options (HO) +) +\@linkdim=\dimen152 +\Hy@linkcounter=\count124 +\Hy@pagecounter=\count125 + +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/pd1enc.def +File: pd1enc.def 2018/02/06 v6.86b Hyperref: PDFDocEncoding definition (HO) +Now handling font encoding PD1 ... +... no UTF-8 mapping file for font encoding PD1 +) +\Hy@SavedSpaceFactor=\count126 + +(/usr/share/texlive/texmf-dist/tex/latex/latexconfig/hyperref.cfg +File: hyperref.cfg 2002/06/06 v1.2 hyperref configuration of TeXLive +) +Package hyperref Info: Hyper figures OFF on input line 4509. +Package hyperref Info: Link nesting OFF on input line 4514. +Package hyperref Info: Hyper index ON on input line 4517. +Package hyperref Info: Plain pages OFF on input line 4524. +Package hyperref Info: Backreferencing ON on input line 4527. +Package hyperref Info: Implicit mode ON; LaTeX internals redefined. +Package hyperref Info: Bookmarks ON on input line 4762. + +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/backref.sty +Package: backref 2016/05/21 v1.39 Bibliographical back referencing + +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/rerunfilecheck.sty +Package: rerunfilecheck 2016/05/16 v1.8 Rerun checks for auxiliary files (HO) +Package uniquecounter Info: New unique counter `rerunfilecheck' on input line 2 +82. +)) +\c@Hy@tempcnt=\count127 + +(/usr/share/texlive/texmf-dist/tex/latex/url/url.sty +\Urlmuskip=\muskip10 +Package: url 2013/09/16 ver 3.4 Verb mode for urls, etc. +) +LaTeX Info: Redefining \url on input line 5115. +\XeTeXLinkMargin=\dimen153 +\Fld@menulength=\count128 +\Field@Width=\dimen154 +\Fld@charsize=\dimen155 +Package hyperref Info: Hyper figures OFF on input line 6369. +Package hyperref Info: Link nesting OFF on input line 6374. +Package hyperref Info: Hyper index ON on input line 6377. +Package hyperref Info: backreferencing ON on input line 6382. +Package hyperref Info: Link coloring OFF on input line 6389. +Package hyperref Info: Link coloring with OCG OFF on input line 6394. +Package hyperref Info: PDF/A mode OFF on input line 6399. +LaTeX Info: Redefining \ref on input line 6439. +LaTeX Info: Redefining \pageref on input line 6443. +\Hy@abspage=\count129 +\c@Item=\count130 +\c@Hfootnote=\count131 +) +Package hyperref Info: Driver: hpdftex. + +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/hpdftex.def +File: hpdftex.def 2018/02/06 v6.86b Hyperref driver for pdfTeX +\Fld@listcount=\count132 +\c@bookmark@seq@number=\count133 +\Hy@SectionHShift=\skip104 +) +Package hyperref Info: Option `colorlinks' set `true' on input line 105. +Package hyperref Info: Option `unicode' set `true' on input line 105. + +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/puenc.def +File: puenc.def 2018/02/06 v6.86b Hyperref: PDF Unicode definition (HO) +Now handling font encoding PU ... +... no UTF-8 mapping file for font encoding PU +) +(/usr/share/texlive/texmf-dist/tex/latex/caption/caption.sty +Package: caption 2016/02/21 v3.3-144 Customizing captions (AR) + +(/usr/share/texlive/texmf-dist/tex/latex/caption/caption3.sty +Package: caption3 2016/05/22 v1.7-166 caption3 kernel (AR) +Package caption3 Info: TeX engine: e-TeX on input line 67. +\captionmargin=\dimen156 +\captionmargin@=\dimen157 +\captionwidth=\dimen158 +\caption@tempdima=\dimen159 +\caption@indent=\dimen160 +\caption@parindent=\dimen161 +\caption@hangindent=\dimen162 +) +\c@ContinuedFloat=\count134 +Package caption Info: float package is loaded. +Package caption Info: hyperref package is loaded. +Package caption Info: longtable package is loaded. + +(/usr/share/texlive/texmf-dist/tex/latex/caption/ltcaption.sty +Package: ltcaption 2013/06/09 v1.4-94 longtable captions (AR) +)) (./refman.aux) +\openout1 = `refman.aux'. + +LaTeX Font Info: Checking defaults for OML/cmm/m/it on input line 117. +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Checking defaults for T1/cmr/m/n on input line 117. +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Checking defaults for OT1/cmr/m/n on input line 117. +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Checking defaults for OMS/cmsy/m/n on input line 117. +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Checking defaults for OMX/cmex/m/n on input line 117. +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Checking defaults for U/cmr/m/n on input line 117. +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Checking defaults for TS1/cmr/m/n on input line 117. +LaTeX Font Info: Try loading font information for TS1+cmr on input line 117. + +(/usr/share/texlive/texmf-dist/tex/latex/base/ts1cmr.fd +File: ts1cmr.fd 2014/09/29 v2.5h Standard LaTeX font definitions +) +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Checking defaults for PD1/pdf/m/n on input line 117. +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Checking defaults for PU/pdf/m/n on input line 117. +LaTeX Font Info: ... okay on input line 117. +LaTeX Font Info: Try loading font information for T1+phv on input line 117. + +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/t1phv.fd +File: t1phv.fd 2001/06/04 scalable font definitions for T1/phv. +) +LaTeX Font Info: Font shape `T1/phv/m/n' will be +(Font) scaled to size 8.99994pt on input line 117. + +(/usr/share/texlive/texmf-dist/tex/context/base/mkii/supp-pdf.mkii +[Loading MPS to PDF converter (version 2006.09.02).] +\scratchcounter=\count135 +\scratchdimen=\dimen163 +\scratchbox=\box65 +\nofMPsegments=\count136 +\nofMParguments=\count137 +\everyMPshowfont=\toks30 +\MPscratchCnt=\count138 +\MPscratchDim=\dimen164 +\MPnumerator=\count139 +\makeMPintoPDFobject=\count140 +\everyMPtoPDFconversion=\toks31 +) (/usr/share/texlive/texmf-dist/tex/latex/oberdiek/epstopdf-base.sty +Package: epstopdf-base 2016/05/15 v2.6 Base part for package epstopdf + +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/grfext.sty +Package: grfext 2016/05/16 v1.2 Manage graphics extensions (HO) +) +Package epstopdf-base Info: Redefining graphics rule for `.eps' on input line 4 +38. +Package grfext Info: Graphics extension search list: +(grfext) [.pdf,.png,.jpg,.mps,.jpeg,.jbig2,.jb2,.PDF,.PNG,.JPG,.JPE +G,.JBIG2,.JB2,.eps] +(grfext) \AppendGraphicsExtensions on input line 456. + +(/usr/share/texlive/texmf-dist/tex/latex/latexconfig/epstopdf-sys.cfg +File: epstopdf-sys.cfg 2010/07/13 v1.3 Configuration of (r)epstopdf for TeX Liv +e +)) +*geometry* driver: auto-detecting +*geometry* detected driver: pdftex +*geometry* verbose mode - [ preamble ] result: +* driver: pdftex +* paper: a4paper +* layout: <same size as paper> +* layoutoffset:(h,v)=(0.0pt,0.0pt) +* modes: twoside +* h-part:(L,W,R)=(71.13188pt, 455.24411pt, 71.13188pt) +* v-part:(T,H,B)=(71.13188pt, 702.78308pt, 71.13188pt) +* \paperwidth=597.50787pt +* \paperheight=845.04684pt +* \textwidth=455.24411pt +* \textheight=702.78308pt +* \oddsidemargin=-1.1381pt +* \evensidemargin=-1.1381pt +* \topmargin=-31.2056pt +* \headheight=12.0pt +* \headsep=18.06749pt +* \topskip=10.0pt +* \footskip=25.29494pt +* \marginparwidth=125.0pt +* \marginparsep=7.0pt +* \columnsep=10.0pt +* \skip\footins=9.0pt plus 4.0pt minus 2.0pt +* \hoffset=0.0pt +* \voffset=0.0pt +* \mag=1000 +* \@twocolumnfalse +* \@twosidetrue +* \@mparswitchtrue +* \@reversemarginfalse +* (1in=72.27pt=25.4mm, 1cm=28.453pt) + +\AtBeginShipoutBox=\box66 +Package backref Info: ** backref set up for natbib ** on input line 117. +Package hyperref Info: Link coloring ON on input line 117. +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/nameref.sty +Package: nameref 2016/05/21 v2.44 Cross-referencing by name of section + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/gettitlestring.sty +Package: gettitlestring 2016/05/16 v1.5 Cleanup title references (HO) +) +\c@section@level=\count141 +) +LaTeX Info: Redefining \ref on input line 117. +LaTeX Info: Redefining \pageref on input line 117. +LaTeX Info: Redefining \nameref on input line 117. + +(./refman.out) (./refman.out) +\@outlinefile=\write4 +\openout4 = `refman.out'. + +Package caption Info: Begin \AtBeginDocument code. +Package caption Info: End \AtBeginDocument code. +Package hyperref Info: Option `pageanchor' set `false' on input line 123. +Package hyperref Info: Option `bookmarksnumbered' set `true' on input line 123. + +Package hyperref Info: Option `unicode' set `true' on input line 123. +LaTeX Font Info: Font shape `T1/phv/m/n' will be +(Font) scaled to size 12.9599pt on input line 128. +LaTeX Font Info: Font shape `T1/phv/m/n' will be +(Font) scaled to size 10.79993pt on input line 130. + [1 + + +{/var/lib/texmf/fonts/map/pdftex/updmap/pdftex.map}] [2 + +] +LaTeX Font Info: Font shape `T1/phv/m/n' will be +(Font) scaled to size 22.39185pt on input line 135. +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <24.88> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 135. +LaTeX Font Info: Font shape `T1/phv/b/n' will be +(Font) scaled to size 22.39185pt on input line 135. +LaTeX Font Info: Font shape `T1/phv/bc/n' will be +(Font) scaled to size 22.39185pt on input line 135. + (./refman.toc +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <10> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 1. +LaTeX Font Info: Font shape `T1/phv/b/n' will be +(Font) scaled to size 8.99994pt on input line 1. +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <7> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 1. +LaTeX Font Info: Font shape `T1/phv/b/n' will be +(Font) scaled to size 6.29996pt on input line 1. +LaTeX Font Info: Try loading font information for U+wasy on input line 1. + +(/usr/share/texlive/texmf-dist/tex/latex/wasysym/uwasy.fd +File: uwasy.fd 2003/10/30 v2.0 Wasy-2 symbol font definitions +) +LaTeX Font Info: Try loading font information for U+msa on input line 1. + +(/usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsa.fd +File: umsa.fd 2013/01/14 v3.01 AMS symbols A +) +LaTeX Font Info: Try loading font information for U+msb on input line 1. + +(/usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsb.fd +File: umsb.fd 2013/01/14 v3.01 AMS symbols B +)) +\tf@toc=\write5 +\openout5 = `refman.toc'. + + [1 + +] [2 + +] +Package hyperref Info: Option `pageanchor' set `true' on input line 138. + +Chapter 1. +LaTeX Font Info: Font shape `T1/phv/m/n' will be +(Font) scaled to size 18.66588pt on input line 141. +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <20.74> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 141. +LaTeX Font Info: Font shape `T1/phv/b/n' will be +(Font) scaled to size 18.66588pt on input line 141. +LaTeX Font Info: Font shape `T1/phv/bc/n' will be +(Font) scaled to size 18.66588pt on input line 141. +LaTeX Font Info: Font shape `T1/phv/bc/n' will be +(Font) scaled to size 6.29996pt on input line 141. +(./md_README.tex +LaTeX Font Info: Font shape `T1/phv/m/n' will be +(Font) scaled to size 6.29996pt on input line 1. +LaTeX Font Info: Try loading font information for T1+pcr on input line 5. + (/usr/share/texlive/texmf-dist/tex/latex/psnfss/t1pcr.fd +File: t1pcr.fd 2001/06/04 font definitions for T1/pcr. +) +Underfull \hbox (badness 10000) in paragraph at lines 5--6 +[][][]\T1/pcr/m/n/10 r.[]izzard@surrey.[]ac.[]uk[][] [][]http[]://personal.[]ph +.[]surrey.[]ac.[]uk/$\OMS/cmsy/m/n/10 ^^X$\T1/pcr/m/n/10 ri0005/binary[]_[]c.[] +html[][] + [] + +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <12> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 7. +LaTeX Font Info: Font shape `T1/phv/b/n' will be +(Font) scaled to size 10.79993pt on input line 7. +LaTeX Font Info: Font shape `T1/phv/bc/n' will be +(Font) scaled to size 10.79993pt on input line 7. +LaTeX Font Info: Try loading font information for TS1+phv on input line 11. +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1phv.fd +File: ts1phv.fd 2001/06/04 scalable font definitions for TS1/phv. +) +LaTeX Font Info: Font shape `TS1/phv/m/n' will be +(Font) scaled to size 8.99994pt on input line 11. + [1 + +]) [2] +(./refman.ind) +Package atveryend Info: Empty hook `BeforeClearDocument' on input line 155. +Package atveryend Info: Empty hook `AfterLastShipout' on input line 155. + (./refman.aux) +Package atveryend Info: Executing hook `AtVeryEndDocument' on input line 155. +Package atveryend Info: Executing hook `AtEndAfterFileList' on input line 155. +Package rerunfilecheck Info: File `refman.out' has not changed. +(rerunfilecheck) Checksum: BA43EE143F7822171D9BCC79120186C6;198. +Package atveryend Info: Empty hook `AtVeryVeryEnd' on input line 155. + ) +Here is how much of TeX's memory you used: + 14732 strings out of 492982 + 208188 string characters out of 6134895 + 301808 words of memory out of 5000000 + 18059 multiletter control sequences out of 15000+600000 + 42362 words of font info for 54 fonts, out of 8000000 for 9000 + 1141 hyphenation exceptions out of 8191 + 53i,15n,92p,465b,485s stack positions out of 5000i,500n,10000p,200000b,80000s +{/usr/share/texlive/texmf-dist/fonts/enc/dvips/base/8r.enc}</usr/share/texliv +e/texmf-dist/fonts/type1/public/amsfonts/cm/cmmi10.pfb></usr/share/texlive/texm +f-dist/fonts/type1/public/amsfonts/cm/cmsy10.pfb></usr/share/texlive/texmf-dist +/fonts/type1/urw/courier/ucrr8a.pfb></usr/share/texlive/texmf-dist/fonts/type1/ +urw/helvetic/uhvb8a.pfb></usr/share/texlive/texmf-dist/fonts/type1/urw/helvetic +/uhvb8ac.pfb></usr/share/texlive/texmf-dist/fonts/type1/urw/helvetic/uhvr8a.pfb +> +Output written on refman.pdf (6 pages, 61324 bytes). +PDF statistics: + 70 PDF objects out of 1000 (max. 8388607) + 55 compressed objects within 1 object stream + 10 named destinations out of 1000 (max. 500000) + 9 words of extra memory for PDF output out of 10000 (max. 10000000) + diff --git a/docs/Doxygen/latex/refman.out b/docs/Doxygen/latex/refman.out new file mode 100644 index 0000000000000000000000000000000000000000..9b77aceb837745a4083e064f6a79d76fedc6b410 --- /dev/null +++ b/docs/Doxygen/latex/refman.out @@ -0,0 +1 @@ +\BOOKMARK [0][-]{chapter.1}{\376\377\0001\000\040\000P\000y\000t\000h\000o\000n\000\040\000m\000o\000d\000u\000l\000e\000\040\000f\000o\000r\000\040\000b\000i\000n\000a\000r\000y\000\137\000c}{}% 1 diff --git a/docs/Doxygen/latex/refman.pdf b/docs/Doxygen/latex/refman.pdf new file mode 100644 index 0000000000000000000000000000000000000000..739c7dda4d47b91ba68b36636ff81b565da53f95 Binary files /dev/null and b/docs/Doxygen/latex/refman.pdf differ diff --git a/docs/Doxygen/latex/refman.tex b/docs/Doxygen/latex/refman.tex new file mode 100644 index 0000000000000000000000000000000000000000..966b997c4828e22bba77abfd0af11d4f049c0135 --- /dev/null +++ b/docs/Doxygen/latex/refman.tex @@ -0,0 +1,160 @@ +\documentclass[twoside]{book} + +% Packages required by doxygen +\usepackage{fixltx2e} +\usepackage{calc} +\usepackage{doxygen} +\usepackage[export]{adjustbox} % also loads graphicx +\usepackage{graphicx} +\usepackage[utf8]{inputenc} +\usepackage{makeidx} +\usepackage{multicol} +\usepackage{multirow} +\PassOptionsToPackage{warn}{textcomp} +\usepackage{textcomp} +\usepackage[nointegrals]{wasysym} +\usepackage[table]{xcolor} + +% Font selection +\usepackage[T1]{fontenc} +\usepackage[scaled=.90]{helvet} +\usepackage{courier} +\usepackage{amssymb} +\usepackage{sectsty} +\renewcommand{\familydefault}{\sfdefault} +\allsectionsfont{% + \fontseries{bc}\selectfont% + \color{darkgray}% +} +\renewcommand{\DoxyLabelFont}{% + \fontseries{bc}\selectfont% + \color{darkgray}% +} +\newcommand{\+}{\discretionary{\mbox{\scriptsize$\hookleftarrow$}}{}{}} + +% Page & text layout +\usepackage{geometry} +\geometry{% + a4paper,% + top=2.5cm,% + bottom=2.5cm,% + left=2.5cm,% + right=2.5cm% +} +\tolerance=750 +\hfuzz=15pt +\hbadness=750 +\setlength{\emergencystretch}{15pt} +\setlength{\parindent}{0cm} +\setlength{\parskip}{3ex plus 2ex minus 2ex} +\makeatletter +\renewcommand{\paragraph}{% + \@startsection{paragraph}{4}{0ex}{-1.0ex}{1.0ex}{% + \normalfont\normalsize\bfseries\SS@parafont% + }% +} +\renewcommand{\subparagraph}{% + \@startsection{subparagraph}{5}{0ex}{-1.0ex}{1.0ex}{% + \normalfont\normalsize\bfseries\SS@subparafont% + }% +} +\makeatother + +% Headers & footers +\usepackage{fancyhdr} +\pagestyle{fancyplain} +\fancyhead[LE]{\fancyplain{}{\bfseries\thepage}} +\fancyhead[CE]{\fancyplain{}{}} +\fancyhead[RE]{\fancyplain{}{\bfseries\leftmark}} +\fancyhead[LO]{\fancyplain{}{\bfseries\rightmark}} +\fancyhead[CO]{\fancyplain{}{}} +\fancyhead[RO]{\fancyplain{}{\bfseries\thepage}} +\fancyfoot[LE]{\fancyplain{}{}} +\fancyfoot[CE]{\fancyplain{}{}} +\fancyfoot[RE]{\fancyplain{}{\bfseries\scriptsize Generated by Doxygen }} +\fancyfoot[LO]{\fancyplain{}{\bfseries\scriptsize Generated by Doxygen }} +\fancyfoot[CO]{\fancyplain{}{}} +\fancyfoot[RO]{\fancyplain{}{}} +\renewcommand{\footrulewidth}{0.4pt} +\renewcommand{\chaptermark}[1]{% + \markboth{#1}{}% +} +\renewcommand{\sectionmark}[1]{% + \markright{\thesection\ #1}% +} + +% Indices & bibliography +\usepackage{natbib} +\usepackage[titles]{tocloft} +\setcounter{tocdepth}{3} +\setcounter{secnumdepth}{5} +\makeindex + +% Hyperlinks (required, but should be loaded last) +\usepackage{ifpdf} +\ifpdf + \usepackage[pdftex,pagebackref=true]{hyperref} +\else + \usepackage[ps2pdf,pagebackref=true]{hyperref} +\fi +\hypersetup{% + colorlinks=true,% + linkcolor=blue,% + citecolor=blue,% + unicode% +} + +% Custom commands +\newcommand{\clearemptydoublepage}{% + \newpage{\pagestyle{empty}\cleardoublepage}% +} + +\usepackage{caption} +\captionsetup{labelsep=space,justification=centering,font={bf},singlelinecheck=off,skip=4pt,position=top} + +%===== C O N T E N T S ===== + +\begin{document} + +% Titlepage & ToC +\hypersetup{pageanchor=false, + bookmarksnumbered=true, + pdfencoding=unicode + } +\pagenumbering{alph} +\begin{titlepage} +\vspace*{7cm} +\begin{center}% +{\Large My Project }\\ +\vspace*{1cm} +{\large Generated by Doxygen 1.8.13}\\ +\end{center} +\end{titlepage} +\clearemptydoublepage +\pagenumbering{roman} +\tableofcontents +\clearemptydoublepage +\pagenumbering{arabic} +\hypersetup{pageanchor=true} + +%--- Begin generated contents --- +\chapter{Python module for binary\+\_\+c} +\label{md_README} +\Hypertarget{md_README} +\input{md_README} +\chapter{Class Index} +\input{annotated} +\chapter{Class Documentation} +\input{structBoxStruct__struct} +\input{structpoint3d} +%--- End generated contents --- + +% Index +\backmatter +\newpage +\phantomsection +\clearemptydoublepage +\addcontentsline{toc}{chapter}{Index} +\printindex + +\end{document} diff --git a/docs/Doxygen/latex/refman.toc b/docs/Doxygen/latex/refman.toc new file mode 100644 index 0000000000000000000000000000000000000000..a606a1e9d2a8aa3db79e176e9dcdecf3f884d291 --- /dev/null +++ b/docs/Doxygen/latex/refman.toc @@ -0,0 +1 @@ +\contentsline {chapter}{\numberline {1}Python module for binary\discretionary {\unhbox \voidb@x \hbox {\relax \fontsize {7}{8}\selectfont $\leftarrow \joinrel \rhook $}}{}{}\_\discretionary {\unhbox \voidb@x \hbox {\relax \fontsize {7}{8}\selectfont $\leftarrow \joinrel \rhook $}}{}{}c}{1}{chapter.1} diff --git a/docs/Doxygen/latex/structBoxStruct__struct.tex b/docs/Doxygen/latex/structBoxStruct__struct.tex new file mode 100644 index 0000000000000000000000000000000000000000..9fa2d3c9ff2819fbda8dc0be2ec088b659376cbe --- /dev/null +++ b/docs/Doxygen/latex/structBoxStruct__struct.tex @@ -0,0 +1,51 @@ +\hypertarget{structBoxStruct__struct}{}\section{Box\+Struct\+\_\+struct Struct Reference} +\label{structBoxStruct__struct}\index{Box\+Struct\+\_\+struct@{Box\+Struct\+\_\+struct}} + + +Use brief, otherwise the index won\textquotesingle{}t have a brief explanation. + + + + +{\ttfamily \#include $<$ding.\+h$>$} + +\subsection*{Public Attributes} +\begin{DoxyCompactItemize} +\item +int \hyperlink{structBoxStruct__struct_a4593938c5e90f024e7971bdb1392d9d6}{a} +\item +int \hyperlink{structBoxStruct__struct_aee44748dc579c5d794853ee8b133d197}{b} +\item +double \hyperlink{structBoxStruct__struct_a4543370ed67b2cf5ae3f55201bea11e6}{c} +\end{DoxyCompactItemize} + + +\subsection{Detailed Description} +Use brief, otherwise the index won\textquotesingle{}t have a brief explanation. + +Detailed explanation. + +\subsection{Member Data Documentation} +\mbox{\Hypertarget{structBoxStruct__struct_a4593938c5e90f024e7971bdb1392d9d6}\label{structBoxStruct__struct_a4593938c5e90f024e7971bdb1392d9d6}} +\index{Box\+Struct\+\_\+struct@{Box\+Struct\+\_\+struct}!a@{a}} +\index{a@{a}!Box\+Struct\+\_\+struct@{Box\+Struct\+\_\+struct}} +\subsubsection{\texorpdfstring{a}{a}} +{\footnotesize\ttfamily int Box\+Struct\+\_\+struct\+::a} + +Some documentation for the member \hyperlink{structBoxStruct__struct_a4593938c5e90f024e7971bdb1392d9d6}{Box\+Struct\+::a}. \mbox{\Hypertarget{structBoxStruct__struct_aee44748dc579c5d794853ee8b133d197}\label{structBoxStruct__struct_aee44748dc579c5d794853ee8b133d197}} +\index{Box\+Struct\+\_\+struct@{Box\+Struct\+\_\+struct}!b@{b}} +\index{b@{b}!Box\+Struct\+\_\+struct@{Box\+Struct\+\_\+struct}} +\subsubsection{\texorpdfstring{b}{b}} +{\footnotesize\ttfamily int Box\+Struct\+\_\+struct\+::b} + +Some documentation for the member \hyperlink{structBoxStruct__struct_aee44748dc579c5d794853ee8b133d197}{Box\+Struct\+::b}. \mbox{\Hypertarget{structBoxStruct__struct_a4543370ed67b2cf5ae3f55201bea11e6}\label{structBoxStruct__struct_a4543370ed67b2cf5ae3f55201bea11e6}} +\index{Box\+Struct\+\_\+struct@{Box\+Struct\+\_\+struct}!c@{c}} +\index{c@{c}!Box\+Struct\+\_\+struct@{Box\+Struct\+\_\+struct}} +\subsubsection{\texorpdfstring{c}{c}} +{\footnotesize\ttfamily double Box\+Struct\+\_\+struct\+::c} + +Etc. + +The documentation for this struct was generated from the following file\+:\begin{DoxyCompactItemize} +\item +testing\+\_\+doxygen/ding.\+h\end{DoxyCompactItemize} diff --git a/docs/Doxygen/latex/structpoint3d.tex b/docs/Doxygen/latex/structpoint3d.tex new file mode 100644 index 0000000000000000000000000000000000000000..b22fc49e63bceb0d822d8896a3ee406a5f556ac9 --- /dev/null +++ b/docs/Doxygen/latex/structpoint3d.tex @@ -0,0 +1,66 @@ +\hypertarget{structpoint3d}{}\section{point3d Struct Reference} +\label{structpoint3d}\index{point3d@{point3d}} + + +{\ttfamily \#include $<$test.\+h$>$} + +\subsection*{Public Attributes} +\textbf{ }\par +\begin{DoxyCompactItemize} +\item +double \hyperlink{structpoint3d_ac16dfc549efe0bd9b819ea4a9a8462a9}{x} +\item +double \hyperlink{structpoint3d_af76302f192767fd9546392affbe5631c}{y} +\item +double \hyperlink{structpoint3d_a96e63d7cd720242d2f79287b04a503e1}{z} +\end{DoxyCompactItemize} + +\begin{Indent}\textbf{ group 2}\par +\begin{DoxyCompactItemize} +\item +char $\ast$ \hyperlink{structpoint3d_afb9519af724fab8e88b239b60c864a6d}{name} +\item +int \hyperlink{structpoint3d_a809caeed7433b4f182554ef12f8705a9}{namelength} +\end{DoxyCompactItemize} +\end{Indent} + + +\subsection{Detailed Description} +A structure to represent 3d vectors + +\subsection{Member Data Documentation} +\mbox{\Hypertarget{structpoint3d_afb9519af724fab8e88b239b60c864a6d}\label{structpoint3d_afb9519af724fab8e88b239b60c864a6d}} +\index{point3d@{point3d}!name@{name}} +\index{name@{name}!point3d@{point3d}} +\subsubsection{\texorpdfstring{name}{name}} +{\footnotesize\ttfamily char$\ast$ point3d\+::name} + +the name of the point \mbox{\Hypertarget{structpoint3d_a809caeed7433b4f182554ef12f8705a9}\label{structpoint3d_a809caeed7433b4f182554ef12f8705a9}} +\index{point3d@{point3d}!namelength@{namelength}} +\index{namelength@{namelength}!point3d@{point3d}} +\subsubsection{\texorpdfstring{namelength}{namelength}} +{\footnotesize\ttfamily int point3d\+::namelength} + +the size of the point name \mbox{\Hypertarget{structpoint3d_ac16dfc549efe0bd9b819ea4a9a8462a9}\label{structpoint3d_ac16dfc549efe0bd9b819ea4a9a8462a9}} +\index{point3d@{point3d}!x@{x}} +\index{x@{x}!point3d@{point3d}} +\subsubsection{\texorpdfstring{x}{x}} +{\footnotesize\ttfamily double point3d\+::x} + +the x coordinate \mbox{\Hypertarget{structpoint3d_af76302f192767fd9546392affbe5631c}\label{structpoint3d_af76302f192767fd9546392affbe5631c}} +\index{point3d@{point3d}!y@{y}} +\index{y@{y}!point3d@{point3d}} +\subsubsection{\texorpdfstring{y}{y}} +{\footnotesize\ttfamily double point3d\+::y} + +the y coordinate \mbox{\Hypertarget{structpoint3d_a96e63d7cd720242d2f79287b04a503e1}\label{structpoint3d_a96e63d7cd720242d2f79287b04a503e1}} +\index{point3d@{point3d}!z@{z}} +\index{z@{z}!point3d@{point3d}} +\subsubsection{\texorpdfstring{z}{z}} +{\footnotesize\ttfamily double point3d\+::z} + +the z coordinate + +The documentation for this struct was generated from the following file\+:\begin{DoxyCompactItemize} +\item +testing\+\_\+doxygen/test.\+h\end{DoxyCompactItemize} diff --git a/docs/Doxygen/xml/README_8md.xml b/docs/Doxygen/xml/README_8md.xml new file mode 100644 index 0000000000000000000000000000000000000000..b508c82a403b0bb25abe2bca7ccd206d96a4f95c --- /dev/null +++ b/docs/Doxygen/xml/README_8md.xml @@ -0,0 +1,65 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="README_8md" kind="file" language="Markdown"> + <compoundname>README.md</compoundname> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> +<codeline><highlight class="normal">#<sp/>Python<sp/>module<sp/>for<sp/>binary_c</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">Based<sp/>on<sp/>a<sp/>original<sp/>work<sp/>by<sp/>Jeff<sp/>Andrews<sp/>(can<sp/>be<sp/>found<sp/>in<sp/>old_solution/<sp/>directory)</highlight></codeline> +<codeline><highlight class="normal">updated<sp/>and<sp/>extended<sp/>for<sp/>Python3<sp/>by<sp/>Robert<sp/>Izzard,<sp/>David<sp/>hendriks</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">Warning<sp/>:<sp/>THIS<sp/>CODE<sp/>IS<sp/>EXPERIMENTAL!</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">r.izzard@surrey.ac.uk</highlight></codeline> +<codeline><highlight class="normal">http://personal.ph.surrey.ac.uk/~ri0005/binary_c.html</highlight></codeline> +<codeline><highlight class="normal">09/06/2019</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">Requirements</highlight></codeline> +<codeline><highlight class="normal">---------------------</highlight></codeline> +<codeline><highlight class="normal">-<sp/>Python3</highlight></codeline> +<codeline><highlight class="normal">-<sp/>binary_c<sp/>version<sp/>2.1+</highlight></codeline> +<codeline><highlight class="normal">-<sp/>requirements.txt<sp/>(no?)</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">Environment<sp/>variables</highlight></codeline> +<codeline><highlight class="normal">---------------------</highlight></codeline> +<codeline><highlight class="normal">Before<sp/>compilation<sp/>you<sp/>should<sp/>set<sp/>the<sp/>following<sp/>environment<sp/>variables:</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">-<sp/>required:<sp/>`BINARY_C`<sp/>should<sp/>point<sp/>to<sp/>the<sp/>root<sp/>directory<sp/>of<sp/>your<sp/>binary_c<sp/>installation</highlight></codeline> +<codeline><highlight class="normal">-<sp/>recommended:<sp/>`LD_LIBRARY_PATH`<sp/>should<sp/>include<sp/>$BINARY_C/src<sp/>and<sp/>whatever<sp/>directories<sp/>are<sp/>required<sp/>to<sp/>run<sp/>binary_c<sp/>(e.g.<sp/>locations<sp/>of<sp/>libgsl,<sp/>libmemoize,<sp/>librinterpolate,<sp/>etc.)</highlight></codeline> +<codeline><highlight class="normal">-<sp/>recommended:<sp/>`LIBRARY_PATH`<sp/>should<sp/>include<sp/>whatever<sp/>directories<sp/>are<sp/>required<sp/>to<sp/>build<sp/>binary_c<sp/>(e.g.<sp/>locations<sp/>of<sp/>libgsl,<sp/>libmemoize,<sp/>librinterpolate,<sp/>etc.)</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">Build<sp/>instructions</highlight></codeline> +<codeline><highlight class="normal">---------------------</highlight></codeline> +<codeline><highlight class="normal">To<sp/>build<sp/>the<sp/>module,<sp/>make<sp/>sure<sp/>you<sp/>have<sp/>built<sp/>binary_c<sp/>(with<sp/>`make`<sp/>in<sp/>the<sp/>binary_c<sp/>root<sp/>directory),<sp/>its<sp/>shared<sp/>library<sp/>(with<sp/>`make<sp/>libbinary_c.so`<sp/>in<sp/>the<sp/>binary_c<sp/>root<sp/>directory),<sp/>and<sp/>set<sp/>environment<sp/>variables<sp/>as<sp/>described<sp/>above,<sp/>then<sp/>run<sp/>the<sp/>following<sp/>code<sp/>in<sp/>t:</highlight></codeline> +<codeline><highlight class="normal">```</highlight></codeline> +<codeline><highlight class="normal"><sp/>make<sp/>clean</highlight></codeline> +<codeline><highlight class="normal"><sp/>make</highlight></codeline> +<codeline><highlight class="normal">```</highlight></codeline> +<codeline><highlight class="normal">Then<sp/>to<sp/>test<sp/>the<sp/>Python<sp/>module:</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">```</highlight></codeline> +<codeline><highlight class="normal"><sp/>python3<sp/>./python_API_test.py</highlight></codeline> +<codeline><highlight class="normal">```</highlight></codeline> +<codeline><highlight class="normal">You<sp/>will<sp/>require<sp/>whatever<sp/>libraries<sp/>with<sp/>which<sp/>binary_c<sp/>was<sp/>compiled,<sp/>as<sp/>well<sp/>as<sp/>the<sp/>compiler<sp/>with<sp/>which<sp/>Python<sp/>was<sp/>built<sp/>(usually<sp/>gcc,<sp/>which<sp/>is<sp/>easily<sp/>installed<sp/>on<sp/>most<sp/>systems).</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">If<sp/>you<sp/>want<sp/>to<sp/>be<sp/>able<sp/>to<sp/>import<sp/>the<sp/>binary_c<sp/>module<sp/>correctly<sp/>for<sp/>child<sp/>directories<sp/>(or<sp/>anywhere<sp/>for<sp/>that<sp/>matter),<sp/>execute<sp/>or<sp/>put<sp/>the<sp/>following<sp/>code<sp/>in<sp/>your<sp/>.bashrc/.zshrc:<sp/></highlight></codeline> +<codeline><highlight class="normal">```</highlight></codeline> +<codeline><highlight class="normal">export<sp/>LD_LIBRARY_PATH=<full<sp/>path<sp/>to<sp/>directory<sp/>containing<sp/>libbinary_c_api.so>:$LD_LIBRARY_PATH</highlight></codeline> +<codeline><highlight class="normal">export<sp/>PYTHONPATH=<full<sp/>path<sp/>to<sp/>directory<sp/>containing<sp/>libbinary_c_api.so>:$PYTHONPATH</highlight></codeline> +<codeline><highlight class="normal">```</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">Usage<sp/>notes</highlight></codeline> +<codeline><highlight class="normal">---------------------</highlight></codeline> +<codeline><highlight class="normal">When<sp/>running<sp/>a<sp/>jupyter<sp/>notebook<sp/>and<sp/>importing<sp/>binary_c,<sp/>it<sp/>might<sp/>happen<sp/>that<sp/>the<sp/>module<sp/>binary_c<sp/>cannot<sp/>be<sp/>found.<sp/>I<sp/>experienced<sp/>this<sp/>when<sp/>I<sp/>executed<sp/>Jupyter<sp/>Notebook<sp/>from<sp/>a<sp/>virtual<sp/>environment<sp/>which<sp/>didnt<sp/>use<sp/>the<sp/>same<sp/>python<sp/>(version/binary/shim)<sp/>as<sp/>the<sp/>one<sp/>I<sp/>built<sp/>this<sp/>library<sp/>with.<sp/>Make<sp/>sure<sp/>jupyter<sp/>does<sp/>use<sp/>the<sp/>same<sp/>underlying<sp/>python<sp/>version/binary/shim.<sp/>That<sp/>resolved<sp/>the<sp/>issue<sp/>for<sp/>me.</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">Also:<sp/>I<sp/>figured<sp/>that<sp/>having<sp/>binaryc<sp/>output<sp/>the<sp/>log<sp/>like<sp/>"<LOG<sp/>HEADER><sp/>t=10e4<sp/>..."<sp/>(i.e.<sp/>printing<sp/>the<sp/>parameter<sp/>names<sp/>as<sp/>well<sp/>as<sp/>their<sp/>values)<sp/>would<sp/>be<sp/>useful<sp/>because<sp/>in<sp/>that<sp/>way<sp/>one<sp/>can<sp/>easily<sp/>have<sp/>python<sp/>read<sp/>that<sp/>out<sp/>automatically<sp/>instead<sp/>of<sp/>having<sp/>to<sp/>manually<sp/>copy<sp/>the<sp/>list<sp/>of<sp/>parameter<sp/>names.</highlight></codeline> +<codeline></codeline> +<codeline><highlight class="normal">See<sp/>examples/<sp/>dir<sp/>for<sp/>some<sp/>working<sp/>examples</highlight></codeline> + </programlisting> + <location file="README.md"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/____init_____8py.xml b/docs/Doxygen/xml/____init_____8py.xml new file mode 100644 index 0000000000000000000000000000000000000000..017f5be9fd76639ebadd488e3985dd661f03867a --- /dev/null +++ b/docs/Doxygen/xml/____init_____8py.xml @@ -0,0 +1,14 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="____init_____8py" kind="file" language="Python"> + <compoundname>__init__.py</compoundname> + <innernamespace refid="namespacebinary__c-python">binary_c-python</innernamespace> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> + </programlisting> + <location file="__init__.py"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/binary__c__python_8c.xml b/docs/Doxygen/xml/binary__c__python_8c.xml new file mode 100644 index 0000000000000000000000000000000000000000..8cc7c45fe204e44a928e0812bc2cde841e2435fb --- /dev/null +++ b/docs/Doxygen/xml/binary__c__python_8c.xml @@ -0,0 +1,670 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="binary__c__python_8c" kind="file" language="C++"> + <compoundname>binary_c_python.c</compoundname> + <includes local="no">Python.h</includes> + <includes refid="binary__c__python_8h" local="yes">binary_c_python.h</includes> + <incdepgraph> + <node id="6"> + <label>binary_c_API_prototypes.h</label> + </node> + <node id="3"> + <label>Python.h</label> + </node> + <node id="5"> + <label>binary_c_API.h</label> + </node> + <node id="2"> + <label>binary_c_python.c</label> + <link refid="binary__c__python_8c"/> + <childnode refid="3" relation="include"> + </childnode> + <childnode refid="4" relation="include"> + </childnode> + </node> + <node id="4"> + <label>binary_c_python.h</label> + <link refid="binary__c__python_8h_source"/> + <childnode refid="5" relation="include"> + </childnode> + <childnode refid="6" relation="include"> + </childnode> + </node> + </incdepgraph> + <sectiondef kind="var"> + <memberdef kind="variable" id="binary__c__python_8c_1a96eecd753426f64250c860477b14b76d" prot="public" static="yes" mutable="no"> + <type>char module_docstring []</type> + <definition>char module_docstring [] MAYBE_UNUSED</definition> + <argsstring></argsstring> + <name>MAYBE_UNUSED</name> + <initializer>= + "This module is a python wrapper around binary_c"</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="26" column="1" bodyfile="binary_c_python.c" bodystart="26" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python_8c_1abef09ae9b0e98b48ee64a5b8898c0934" prot="public" static="yes" mutable="no"> + <type>char</type> + <definition>char run_binary_docstring[]</definition> + <argsstring>[]</argsstring> + <name>run_binary_docstring</name> + <initializer>= + "Run one binary using binary_c"</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="32" column="1" bodyfile="binary_c_python.c" bodystart="32" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python_8c_1a71fbab2704c5a989132bbc3374de3ac6" prot="public" static="yes" mutable="no"> + <type>char</type> + <definition>char run_binary_with_logdocstring[]</definition> + <argsstring>[]</argsstring> + <name>run_binary_with_logdocstring</name> + <initializer>= + "Run one binary using binary_c and allow the logfile to be written. Do not use for populations!"</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="34" column="1" bodyfile="binary_c_python.c" bodystart="34" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python_8c_1acd24c10503704c9aa1c7139eabd8be8d" prot="public" static="yes" mutable="no"> + <type>char</type> + <definition>char run_binary_custom_loggingdocstring[]</definition> + <argsstring>[]</argsstring> + <name>run_binary_custom_loggingdocstring</name> + <initializer>= + "TODO"</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="36" column="1" bodyfile="binary_c_python.c" bodystart="36" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python_8c_1a48934ebaaa619338286d601df71c410f" prot="public" static="yes" mutable="no"> + <type>char</type> + <definition>char new_binary_system_docstring[]</definition> + <argsstring>[]</argsstring> + <name>new_binary_system_docstring</name> + <initializer>= + "Return an object containing a binary, ready for evolution"</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="38" column="1" bodyfile="binary_c_python.c" bodystart="38" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python_8c_1a3aa0ba793de1db3cbc48c344310cd91e" prot="public" static="yes" mutable="no"> + <type>char</type> + <definition>char function_prototype_docstring[]</definition> + <argsstring>[]</argsstring> + <name>function_prototype_docstring</name> + <initializer>= + "The prototype for a binary_c python function"</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="40" column="1" bodyfile="binary_c_python.c" bodystart="40" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python_8c_1a9fae61892a92ac21d69be86e41322580" prot="public" static="yes" mutable="no"> + <type>char</type> + <definition>char return_arglines_docstring[]</definition> + <argsstring>[]</argsstring> + <name>return_arglines_docstring</name> + <initializer>= + "Return the default args for a binary_c system"</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="42" column="1" bodyfile="binary_c_python.c" bodystart="42" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python_8c_1a940779b99fd9dae3bce10134c5d9edb2" prot="public" static="yes" mutable="no"> + <type>struct libbinary_c_store_t *</type> + <definition>struct libbinary_c_store_t* store</definition> + <argsstring></argsstring> + <name>store</name> + <initializer>= NULL</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="44" column="1" bodyfile="binary_c_python.c" bodystart="44" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python_8c_1afcd2b5e08091d3973eb552badcfec160" prot="public" static="yes" mutable="no"> + <type>PyMethodDef</type> + <definition>PyMethodDef module_methods[]</definition> + <argsstring>[]</argsstring> + <name>module_methods</name> + <initializer>= { + + + + + + + + {"run_binary", binary_c_run_binary, METH_VARARGS, run_binary_docstring}, + {"run_binary_with_logfile", binary_c_run_binary_with_logfile, METH_VARARGS, run_binary_with_logdocstring}, + {"run_binary_custom_logging", binary_c_run_binary_custom_logging, METH_VARARGS, run_binary_custom_loggingdocstring}, + {"function_prototype", binary_c_function_prototype, METH_VARARGS, function_prototype_docstring}, + {"new_system", binary_c_new_binary_system, METH_VARARGS, new_binary_system_docstring}, + {"return_arglines", binary_c_return_arglines, METH_VARARGS, return_arglines_docstring}, + + {NULL, NULL, 0, NULL} +}</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="64" column="1" bodyfile="binary_c_python.c" bodystart="64" bodyend="-1"/> + </memberdef> + </sectiondef> + <sectiondef kind="func"> + <memberdef kind="function" id="binary__c__python_8c_1a6d4d643c46a2daece60a9bd028631ba3" prot="public" static="yes" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>PyObject *</type> + <definition>static PyObject * binary_c_run_binary</definition> + <argsstring>(PyObject *self, PyObject *args)</argsstring> + <name>binary_c_run_binary</name> + <param> + <type>PyObject *</type> + <declname>self</declname> + </param> + <param> + <type>PyObject *</type> + <declname>args</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="50" column="1" bodyfile="binary_c_python.c" bodystart="182" bodyend="220"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8c_1a0aa1357151a7e1cbf44b3c47f52d4796" prot="public" static="yes" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>PyObject *</type> + <definition>static PyObject * binary_c_run_binary_with_logfile</definition> + <argsstring>(PyObject *self, PyObject *args)</argsstring> + <name>binary_c_run_binary_with_logfile</name> + <param> + <type>PyObject *</type> + <declname>self</declname> + </param> + <param> + <type>PyObject *</type> + <declname>args</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="51" column="1" bodyfile="binary_c_python.c" bodystart="264" bodyend="303"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8c_1ae65c00f695567279ad4cd5f9aa6efd31" prot="public" static="yes" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>PyObject *</type> + <definition>static PyObject * binary_c_run_binary_custom_logging</definition> + <argsstring>(PyObject *self, PyObject *args)</argsstring> + <name>binary_c_run_binary_custom_logging</name> + <param> + <type>PyObject *</type> + <declname>self</declname> + </param> + <param> + <type>PyObject *</type> + <declname>args</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="52" column="1" bodyfile="binary_c_python.c" bodystart="222" bodyend="262"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8c_1a0a58cc76e5fd871157e87eb0c8621f37" prot="public" static="yes" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>PyObject *</type> + <definition>static PyObject * binary_c_function_prototype</definition> + <argsstring>(PyObject *self, PyObject *args)</argsstring> + <name>binary_c_function_prototype</name> + <param> + <type>PyObject *</type> + <declname>self</declname> + </param> + <param> + <type>PyObject *</type> + <declname>args</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="53" column="1" bodyfile="binary_c_python.c" bodystart="162" bodyend="180"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8c_1a1ecf6504fb58dc9305382349df1e9574" prot="public" static="yes" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>PyObject *</type> + <definition>static PyObject * binary_c_new_binary_system</definition> + <argsstring>(PyObject *self, PyObject *args)</argsstring> + <name>binary_c_new_binary_system</name> + <param> + <type>PyObject *</type> + <declname>self</declname> + </param> + <param> + <type>PyObject *</type> + <declname>args</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="54" column="1" bodyfile="binary_c_python.c" bodystart="147" bodyend="160"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8c_1a533a791a652638d95e6a50a14470b436" prot="public" static="yes" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>PyObject *</type> + <definition>static PyObject * binary_c_return_arglines</definition> + <argsstring>(PyObject *self, PyObject *args)</argsstring> + <name>binary_c_return_arglines</name> + <param> + <type>PyObject *</type> + <declname>self</declname> + </param> + <param> + <type>PyObject *</type> + <declname>args</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="55" column="1" bodyfile="binary_c_python.c" bodystart="305" bodyend="333"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8c_1abc8e10822e5c0270ef1ea36a557fbe1b" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>PyMODINIT_FUNC</type> + <definition>PyMODINIT_FUNC initbinary_c</definition> + <argsstring>(void)</argsstring> + <name>initbinary_c</name> + <param> + <type>void</type> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.c" line="107" column="1" bodyfile="binary_c_python.c" bodystart="107" bodyend="112"/> + </memberdef> + </sectiondef> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> +<codeline lineno="1"><highlight class="preprocessor">#include<sp/><Python.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="2"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/>"binary_c_python.h"</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="3"><highlight class="normal"></highlight></codeline> +<codeline lineno="4"><highlight class="normal"></highlight><highlight class="comment">/*</highlight></codeline> +<codeline lineno="5"><highlight class="comment"><sp/>*<sp/>binary_c/PYTHON<sp/>API<sp/>interface<sp/>functions</highlight></codeline> +<codeline lineno="6"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="7"><highlight class="comment"><sp/>*<sp/>Remember:<sp/>variables<sp/>must<sp/>be<sp/>passed<sp/>by<sp/>references</highlight></codeline> +<codeline lineno="8"><highlight class="comment"><sp/>*<sp/>(i.e.<sp/>as<sp/>pointers).</highlight></codeline> +<codeline lineno="9"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="10"><highlight class="comment"><sp/>*<sp/>See<sp/>apitest.py<sp/>for<sp/>an<sp/>example<sp/>of<sp/>how<sp/>to<sp/>use<sp/>these<sp/>functions.</highlight></codeline> +<codeline lineno="11"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="12"><highlight class="comment"><sp/>*<sp/>See<sp/>also</highlight></codeline> +<codeline lineno="13"><highlight class="comment"><sp/>*<sp/>http://www-h.eng.cam.ac.uk/help/tpl/languages/mixinglanguages.html</highlight></codeline> +<codeline lineno="14"><highlight class="comment"><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="15"><highlight class="normal"></highlight></codeline> +<codeline lineno="16"><highlight class="normal"></highlight><highlight class="comment">/*<sp/>list<sp/>of<sp/>variables<sp/>used<sp/>in<sp/>the<sp/>Py<>C<sp/>interface<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="17"><highlight class="normal"></highlight></codeline> +<codeline lineno="18"><highlight class="normal"></highlight><highlight class="comment">/************************************************************/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="19"><highlight class="normal"></highlight><highlight class="comment">/*</highlight></codeline> +<codeline lineno="20"><highlight class="comment"><sp/>*<sp/>function<sp/>prototypes<sp/>:<sp/>these<sp/>are<sp/>the<sp/>functions</highlight></codeline> +<codeline lineno="21"><highlight class="comment"><sp/>*<sp/>called<sp/>by<sp/>PYTHON<sp/>code,<sp/>without<sp/>the<sp/>trailing<sp/>underscore.</highlight></codeline> +<codeline lineno="22"><highlight class="comment"><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="23"><highlight class="normal"></highlight><highlight class="comment">/************************************************************/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="24"><highlight class="normal"></highlight></codeline> +<codeline lineno="25"><highlight class="normal"></highlight><highlight class="comment">//<sp/>Docstrings</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="26"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>module_docstring[]<sp/>MAYBE_UNUSED<sp/>=</highlight></codeline> +<codeline lineno="27"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"This<sp/>module<sp/>is<sp/>a<sp/>python<sp/>wrapper<sp/>around<sp/>binary_c"</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="28"><highlight class="normal"></highlight><highlight class="preprocessor">#ifdef<sp/>__DEPRECATED</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="29"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>create_binary_docstring[]<sp/>=</highlight></codeline> +<codeline lineno="30"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Allocate<sp/>memory<sp/>for<sp/>a<sp/>binary"</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="31"><highlight class="normal"></highlight><highlight class="preprocessor">#endif</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="32"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>run_binary_docstring[]<sp/>=</highlight></codeline> +<codeline lineno="33"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Run<sp/>one<sp/>binary<sp/>using<sp/>binary_c"</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="34"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>run_binary_with_logdocstring[]<sp/>=</highlight></codeline> +<codeline lineno="35"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Run<sp/>one<sp/>binary<sp/>using<sp/>binary_c<sp/>and<sp/>allow<sp/>the<sp/>logfile<sp/>to<sp/>be<sp/>written.<sp/>Do<sp/>not<sp/>use<sp/>for<sp/>populations!"</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="36"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>run_binary_custom_loggingdocstring[]<sp/>=</highlight></codeline> +<codeline lineno="37"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"TODO"</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="38"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>new_binary_system_docstring[]<sp/>=</highlight></codeline> +<codeline lineno="39"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Return<sp/>an<sp/>object<sp/>containing<sp/>a<sp/>binary,<sp/>ready<sp/>for<sp/>evolution"</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="40"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>function_prototype_docstring[]<sp/>=</highlight></codeline> +<codeline lineno="41"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"The<sp/>prototype<sp/>for<sp/>a<sp/>binary_c<sp/>python<sp/>function"</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="42"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>return_arglines_docstring[]<sp/>=</highlight></codeline> +<codeline lineno="43"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Return<sp/>the<sp/>default<sp/>args<sp/>for<sp/>a<sp/>binary_c<sp/>system"</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="44"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_store_t<sp/>*store<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="45"><highlight class="normal"></highlight></codeline> +<codeline lineno="46"><highlight class="normal"></highlight><highlight class="comment">//<sp/>Initialize<sp/>pyobjects</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="47"><highlight class="normal"></highlight><highlight class="preprocessor">#ifdef<sp/>__DEPRECATED</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="48"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_create_binary(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args);</highlight></codeline> +<codeline lineno="49"><highlight class="normal"></highlight><highlight class="preprocessor">#endif</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="50"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_run_binary(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args);</highlight></codeline> +<codeline lineno="51"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_run_binary_with_logfile(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args);</highlight></codeline> +<codeline lineno="52"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_run_binary_custom_logging(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args);</highlight></codeline> +<codeline lineno="53"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_function_prototype(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args);</highlight></codeline> +<codeline lineno="54"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_new_binary_system(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args);</highlight></codeline> +<codeline lineno="55"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_return_arglines(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args);</highlight></codeline> +<codeline lineno="56"><highlight class="normal"></highlight></codeline> +<codeline lineno="57"><highlight class="normal"></highlight><highlight class="comment">/*</highlight></codeline> +<codeline lineno="58"><highlight class="comment"><sp/>*<sp/>Python<sp/>3<sp/>interface<sp/>is<sp/>described<sp/>at</highlight></codeline> +<codeline lineno="59"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="60"><highlight class="comment"><sp/>*<sp/>http://scipy-lectures.org/advanced/interfacing_with_c/interfacing_with_c.html</highlight></codeline> +<codeline lineno="61"><highlight class="comment"><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="62"><highlight class="normal"></highlight></codeline> +<codeline lineno="63"><highlight class="normal"></highlight></codeline> +<codeline lineno="64"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyMethodDef<sp/>module_methods[]<sp/>=<sp/>{</highlight></codeline> +<codeline lineno="65"><highlight class="normal"></highlight><highlight class="preprocessor">#ifdef<sp/>__DEPRECATED</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="66"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight><highlight class="stringliteral">"create_binary"</highlight><highlight class="normal">,<sp/></highlight></codeline> +<codeline lineno="67"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>binary_c_create_binary,<sp/></highlight></codeline> +<codeline lineno="68"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>METH_VARARGS,<sp/></highlight></codeline> +<codeline lineno="69"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>create_binary_docstring</highlight></codeline> +<codeline lineno="70"><highlight class="normal"><sp/><sp/><sp/><sp/>},</highlight></codeline> +<codeline lineno="71"><highlight class="normal"></highlight><highlight class="preprocessor">#endif</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="72"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight><highlight class="stringliteral">"run_binary"</highlight><highlight class="normal">,<sp/>binary_c_run_binary,<sp/>METH_VARARGS,<sp/>run_binary_docstring},</highlight></codeline> +<codeline lineno="73"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight><highlight class="stringliteral">"run_binary_with_logfile"</highlight><highlight class="normal">,<sp/>binary_c_run_binary_with_logfile,<sp/>METH_VARARGS,<sp/>run_binary_with_logdocstring},</highlight></codeline> +<codeline lineno="74"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight><highlight class="stringliteral">"run_binary_custom_logging"</highlight><highlight class="normal">,<sp/>binary_c_run_binary_custom_logging,<sp/>METH_VARARGS,<sp/>run_binary_custom_loggingdocstring},</highlight></codeline> +<codeline lineno="75"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight><highlight class="stringliteral">"function_prototype"</highlight><highlight class="normal">,<sp/>binary_c_function_prototype,<sp/>METH_VARARGS,<sp/>function_prototype_docstring},</highlight></codeline> +<codeline lineno="76"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight><highlight class="stringliteral">"new_system"</highlight><highlight class="normal">,<sp/>binary_c_new_binary_system,<sp/>METH_VARARGS,<sp/>new_binary_system_docstring},</highlight></codeline> +<codeline lineno="77"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight><highlight class="stringliteral">"return_arglines"</highlight><highlight class="normal">,<sp/>binary_c_return_arglines,<sp/>METH_VARARGS,<sp/>return_arglines_docstring},</highlight></codeline> +<codeline lineno="78"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="79"><highlight class="normal"><sp/><sp/><sp/><sp/>{NULL,<sp/>NULL,<sp/>0,<sp/>NULL}</highlight></codeline> +<codeline lineno="80"><highlight class="normal">};</highlight></codeline> +<codeline lineno="81"><highlight class="normal"></highlight></codeline> +<codeline lineno="82"><highlight class="normal"></highlight><highlight class="preprocessor">#if<sp/>PY_MAJOR_VERSION<sp/>>=<sp/>3</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="83"><highlight class="normal"></highlight></codeline> +<codeline lineno="84"><highlight class="normal"></highlight><highlight class="comment">/*<sp/>Python<sp/>3+<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="85"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">PyModuleDef<sp/>Py_binary_c<sp/>=</highlight></codeline> +<codeline lineno="86"><highlight class="normal">{</highlight></codeline> +<codeline lineno="87"><highlight class="normal"><sp/><sp/><sp/><sp/>PyModuleDef_HEAD_INIT,</highlight></codeline> +<codeline lineno="88"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"binary_c"</highlight><highlight class="normal">,<sp/></highlight><highlight class="comment">/*<sp/>name<sp/>of<sp/>module<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="89"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"binary_c<sp/>docs"</highlight><highlight class="normal">,<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>module<sp/>documentation,<sp/>may<sp/>be<sp/>NULL<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="90"><highlight class="normal"><sp/><sp/><sp/><sp/>-1,<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>size<sp/>of<sp/>per-interpreter<sp/>state<sp/>of<sp/>the<sp/>module,<sp/>or<sp/>-1<sp/>if<sp/>the<sp/>module<sp/>keeps<sp/>state<sp/>in<sp/>global<sp/>variables.<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="91"><highlight class="normal"><sp/><sp/><sp/><sp/>module_methods</highlight></codeline> +<codeline lineno="92"><highlight class="normal">};</highlight></codeline> +<codeline lineno="93"><highlight class="normal"></highlight></codeline> +<codeline lineno="94"><highlight class="normal">PyMODINIT_FUNC<sp/>PyInit_binary_c(</highlight><highlight class="keywordtype">void</highlight><highlight class="normal">)</highlight></codeline> +<codeline lineno="95"><highlight class="normal">{</highlight></codeline> +<codeline lineno="96"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>PyModule_Create(&Py_binary_c);</highlight></codeline> +<codeline lineno="97"><highlight class="normal">}</highlight></codeline> +<codeline lineno="98"><highlight class="normal"></highlight></codeline> +<codeline lineno="99"><highlight class="normal"></highlight><highlight class="preprocessor">#else</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="100"><highlight class="normal"></highlight></codeline> +<codeline lineno="101"><highlight class="normal"></highlight><highlight class="comment">/*</highlight></codeline> +<codeline lineno="102"><highlight class="comment"><sp/>*<sp/>Python<sp/>pre-V3</highlight></codeline> +<codeline lineno="103"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="104"><highlight class="comment"><sp/>*<sp/>NOT<sp/>TESTED<sp/>THOROUGHLY!</highlight></codeline> +<codeline lineno="105"><highlight class="comment"><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="106"><highlight class="normal"></highlight></codeline> +<codeline lineno="107"><highlight class="normal">PyMODINIT_FUNC<sp/>initbinary_c(</highlight><highlight class="keywordtype">void</highlight><highlight class="normal">)</highlight></codeline> +<codeline lineno="108"><highlight class="normal">{</highlight></codeline> +<codeline lineno="109"><highlight class="normal"><sp/><sp/><sp/><sp/>PyObject<sp/>*m<sp/>=<sp/>Py_InitModule3(</highlight><highlight class="stringliteral">"binary_c"</highlight><highlight class="normal">,<sp/>module_methods,<sp/>module_docstring);</highlight></codeline> +<codeline lineno="110"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(m<sp/>==<sp/>NULL)</highlight></codeline> +<codeline lineno="111"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="112"><highlight class="normal">}</highlight></codeline> +<codeline lineno="113"><highlight class="normal"></highlight><highlight class="preprocessor">#endif<sp/>//<sp/>Python<sp/>version<sp/>check</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="114"><highlight class="normal"></highlight></codeline> +<codeline lineno="115"><highlight class="normal"></highlight></codeline> +<codeline lineno="116"><highlight class="normal"></highlight><highlight class="preprocessor">#ifdef<sp/>__DEPRECATED</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="117"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_create_binary(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args){</highlight></codeline> +<codeline lineno="118"><highlight class="normal"></highlight></codeline> +<codeline lineno="119"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">double</highlight><highlight class="normal"><sp/>var1,<sp/>var2;</highlight></codeline> +<codeline lineno="120"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>empty_str<sp/>=<sp/></highlight><highlight class="stringliteral">""</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="121"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>i;</highlight></codeline> +<codeline lineno="122"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>N<sp/>=<sp/>1;</highlight></codeline> +<codeline lineno="123"><highlight class="normal"></highlight></codeline> +<codeline lineno="124"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Parse<sp/>the<sp/>input<sp/>tuple<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="125"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(!PyArg_ParseTuple(args,<sp/></highlight><highlight class="stringliteral">"dd"</highlight><highlight class="normal">,<sp/>&var1,<sp/>&var2))</highlight></codeline> +<codeline lineno="126"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>NULL;</highlight></codeline> +<codeline lineno="127"><highlight class="normal"></highlight></codeline> +<codeline lineno="128"><highlight class="normal"></highlight></codeline> +<codeline lineno="129"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Binary<sp/>structures<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="130"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_stardata_t<sp/>*stardata[N];</highlight></codeline> +<codeline lineno="131"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_store_t<sp/>*store<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="132"><highlight class="normal"></highlight></codeline> +<codeline lineno="133"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Allocate<sp/>memory<sp/>for<sp/>binaries<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="134"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">for</highlight><highlight class="normal">(i=0;i<N;i++){</highlight></codeline> +<codeline lineno="135"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>stardata[i]<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="136"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>binary_c_new_system(&stardata[i],<sp/>NULL,<sp/>NULL,<sp/>&store,<sp/>&empty_str,<sp/>-1);</highlight></codeline> +<codeline lineno="137"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="138"><highlight class="normal"></highlight></codeline> +<codeline lineno="139"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Return<sp/>the<sp/>evolved<sp/>binary<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="140"><highlight class="normal"><sp/><sp/><sp/><sp/>PyObject<sp/>*ret<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">""</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="141"><highlight class="normal"></highlight></codeline> +<codeline lineno="142"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>ret;</highlight></codeline> +<codeline lineno="143"><highlight class="normal">}</highlight></codeline> +<codeline lineno="144"><highlight class="normal"></highlight><highlight class="preprocessor">#endif</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="145"><highlight class="normal"></highlight></codeline> +<codeline lineno="146"><highlight class="normal"></highlight></codeline> +<codeline lineno="147"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_new_binary_system(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args)</highlight></codeline> +<codeline lineno="148"><highlight class="normal">{</highlight></codeline> +<codeline lineno="149"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Binary<sp/>structures<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="150"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_stardata_t<sp/>*stardata;</highlight></codeline> +<codeline lineno="151"><highlight class="normal"></highlight></codeline> +<codeline lineno="152"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Allocate<sp/>memory<sp/>for<sp/>binaries<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="153"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>empty_str<sp/>=<sp/></highlight><highlight class="stringliteral">""</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="154"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="155"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_new_system(&stardata,<sp/>NULL,<sp/>NULL,<sp/>&store,<sp/>&empty_str,<sp/>-1);</highlight></codeline> +<codeline lineno="156"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="157"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Return<sp/>an<sp/>object<sp/>containing<sp/>the<sp/>stardata<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="158"><highlight class="normal"><sp/><sp/><sp/><sp/>PyObject<sp/>*ret<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">""</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="159"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>ret;</highlight></codeline> +<codeline lineno="160"><highlight class="normal">}</highlight></codeline> +<codeline lineno="161"><highlight class="normal"></highlight></codeline> +<codeline lineno="162"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_function_prototype(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args)</highlight></codeline> +<codeline lineno="163"><highlight class="normal">{</highlight></codeline> +<codeline lineno="164"><highlight class="normal"></highlight></codeline> +<codeline lineno="165"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">//<sp/>This<sp/>function<sp/>is<sp/>an<sp/>very<sp/>bare<sp/>example<sp/>of<sp/>how<sp/>a<sp/>function<sp/>would<sp/>look<sp/>like.</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="166"><highlight class="normal"></highlight></codeline> +<codeline lineno="167"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">double</highlight><highlight class="normal"><sp/>var1,<sp/>var2;</highlight></codeline> +<codeline lineno="168"><highlight class="normal"></highlight></codeline> +<codeline lineno="169"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Parse<sp/>the<sp/>input<sp/>tuple<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="170"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(!PyArg_ParseTuple(args,<sp/></highlight><highlight class="stringliteral">"dd"</highlight><highlight class="normal">,<sp/>&var1,<sp/>&var2))</highlight></codeline> +<codeline lineno="171"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="172"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>NULL;</highlight></codeline> +<codeline lineno="173"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="174"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">else</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="175"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="176"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Return<sp/>the<sp/>evolved<sp/>binary<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="177"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>PyObject<sp/>*ret<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">""</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="178"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>ret;</highlight></codeline> +<codeline lineno="179"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="180"><highlight class="normal">}</highlight></codeline> +<codeline lineno="181"><highlight class="normal"></highlight></codeline> +<codeline lineno="182"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_run_binary(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args)</highlight></codeline> +<codeline lineno="183"><highlight class="normal">{</highlight></codeline> +<codeline lineno="184"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Parse<sp/>the<sp/>input<sp/>tuple<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="185"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*argstring;</highlight></codeline> +<codeline lineno="186"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="187"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(!PyArg_ParseTuple(args,<sp/></highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>&argstring))</highlight></codeline> +<codeline lineno="188"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="189"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>NULL;</highlight></codeline> +<codeline lineno="190"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="191"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">else</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="192"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="193"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>buffer;</highlight></codeline> +<codeline lineno="194"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>error_buffer;</highlight></codeline> +<codeline lineno="195"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>nbytes;</highlight></codeline> +<codeline lineno="196"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>out<sp/>MAYBE_UNUSED<sp/>=<sp/>run_binary(argstring,</highlight></codeline> +<codeline lineno="197"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&buffer,</highlight></codeline> +<codeline lineno="198"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&error_buffer,</highlight></codeline> +<codeline lineno="199"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&nbytes);</highlight></codeline> +<codeline lineno="200"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>copy<sp/>the<sp/>buffer<sp/>to<sp/>a<sp/>python<sp/>string<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="201"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>PyObject<sp/>*<sp/>return_string<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>buffer);</highlight></codeline> +<codeline lineno="202"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>PyObject<sp/>*<sp/>return_error_string<sp/>MAYBE_UNUSED<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>error_buffer);</highlight></codeline> +<codeline lineno="203"><highlight class="normal"></highlight></codeline> +<codeline lineno="204"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(error_buffer<sp/>!=<sp/>NULL<sp/>&&<sp/>strlen(error_buffer)>0)</highlight></codeline> +<codeline lineno="205"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="206"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>fprintf(stderr,</highlight></codeline> +<codeline lineno="207"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Error<sp/>in<sp/>binary_c<sp/>run<sp/>:<sp/>%s\n"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="208"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>error_buffer);</highlight></codeline> +<codeline lineno="209"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="210"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="211"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>Safe_free(buffer);</highlight></codeline> +<codeline lineno="212"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>Safe_free(error_buffer);</highlight></codeline> +<codeline lineno="213"><highlight class="normal"></highlight></codeline> +<codeline lineno="214"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/></highlight></codeline> +<codeline lineno="215"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*<sp/>TODO</highlight></codeline> +<codeline lineno="216"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*<sp/>return<sp/>the<sp/>return_error_string<sp/>as<sp/>well!</highlight></codeline> +<codeline lineno="217"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="218"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>return_string;</highlight></codeline> +<codeline lineno="219"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="220"><highlight class="normal">}</highlight></codeline> +<codeline lineno="221"><highlight class="normal"></highlight></codeline> +<codeline lineno="222"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_run_binary_custom_logging(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args)</highlight></codeline> +<codeline lineno="223"><highlight class="normal">{</highlight></codeline> +<codeline lineno="224"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Parse<sp/>the<sp/>input<sp/>tuple<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="225"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*argstring;</highlight></codeline> +<codeline lineno="226"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">long</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>func_memaddr;</highlight></codeline> +<codeline lineno="227"><highlight class="normal"></highlight></codeline> +<codeline lineno="228"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(!PyArg_ParseTuple(args,<sp/></highlight><highlight class="stringliteral">"sl"</highlight><highlight class="normal">,<sp/>&argstring,<sp/>&func_memaddr))</highlight></codeline> +<codeline lineno="229"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="230"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>NULL;</highlight></codeline> +<codeline lineno="231"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="232"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">else</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="233"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="234"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>buffer;</highlight></codeline> +<codeline lineno="235"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>error_buffer;</highlight></codeline> +<codeline lineno="236"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>nbytes;</highlight></codeline> +<codeline lineno="237"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>out<sp/>MAYBE_UNUSED<sp/>=<sp/>run_binary_custom_logging(argstring,</highlight></codeline> +<codeline lineno="238"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>func_memaddr,<sp/></highlight></codeline> +<codeline lineno="239"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&buffer,</highlight></codeline> +<codeline lineno="240"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&error_buffer,</highlight></codeline> +<codeline lineno="241"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&nbytes);</highlight></codeline> +<codeline lineno="242"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>copy<sp/>the<sp/>buffer<sp/>to<sp/>a<sp/>python<sp/>string<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="243"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>PyObject<sp/>*<sp/>return_string<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>buffer);</highlight></codeline> +<codeline lineno="244"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>PyObject<sp/>*<sp/>return_error_string<sp/>MAYBE_UNUSED<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>error_buffer);</highlight></codeline> +<codeline lineno="245"><highlight class="normal"></highlight></codeline> +<codeline lineno="246"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(error_buffer<sp/>!=<sp/>NULL<sp/>&&<sp/>strlen(error_buffer)>0)</highlight></codeline> +<codeline lineno="247"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="248"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>fprintf(stderr,</highlight></codeline> +<codeline lineno="249"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Error<sp/>in<sp/>binary_c<sp/>run<sp/>:<sp/>%s\n"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="250"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>error_buffer);</highlight></codeline> +<codeline lineno="251"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="252"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="253"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>Safe_free(buffer);</highlight></codeline> +<codeline lineno="254"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>Safe_free(error_buffer);</highlight></codeline> +<codeline lineno="255"><highlight class="normal"></highlight></codeline> +<codeline lineno="256"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/></highlight></codeline> +<codeline lineno="257"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*<sp/>TODO</highlight></codeline> +<codeline lineno="258"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*<sp/>return<sp/>the<sp/>return_error_string<sp/>as<sp/>well!</highlight></codeline> +<codeline lineno="259"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="260"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>return_string;</highlight></codeline> +<codeline lineno="261"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="262"><highlight class="normal">}</highlight></codeline> +<codeline lineno="263"><highlight class="normal"></highlight></codeline> +<codeline lineno="264"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_run_binary_with_logfile(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args)</highlight></codeline> +<codeline lineno="265"><highlight class="normal">{</highlight></codeline> +<codeline lineno="266"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>Parse<sp/>the<sp/>input<sp/>tuple<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="267"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*argstring;</highlight></codeline> +<codeline lineno="268"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="269"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(!PyArg_ParseTuple(args,<sp/></highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>&argstring))</highlight></codeline> +<codeline lineno="270"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="271"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>NULL;</highlight></codeline> +<codeline lineno="272"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="273"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">else</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="274"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="275"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>buffer;</highlight></codeline> +<codeline lineno="276"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>error_buffer;</highlight></codeline> +<codeline lineno="277"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>nbytes;</highlight></codeline> +<codeline lineno="278"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>out<sp/>MAYBE_UNUSED<sp/>=<sp/>run_binary_with_logfile(argstring,</highlight></codeline> +<codeline lineno="279"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&buffer,</highlight></codeline> +<codeline lineno="280"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&error_buffer,</highlight></codeline> +<codeline lineno="281"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&nbytes);</highlight></codeline> +<codeline lineno="282"><highlight class="normal"></highlight></codeline> +<codeline lineno="283"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>copy<sp/>the<sp/>buffer<sp/>to<sp/>a<sp/>python<sp/>string<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="284"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>PyObject<sp/>*<sp/>return_string<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>buffer);</highlight></codeline> +<codeline lineno="285"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>PyObject<sp/>*<sp/>return_error_string<sp/>MAYBE_UNUSED<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>error_buffer);</highlight></codeline> +<codeline lineno="286"><highlight class="normal"></highlight></codeline> +<codeline lineno="287"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(error_buffer<sp/>!=<sp/>NULL<sp/>&&<sp/>strlen(error_buffer)>0)</highlight></codeline> +<codeline lineno="288"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="289"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>fprintf(stderr,</highlight></codeline> +<codeline lineno="290"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Error<sp/>in<sp/>binary_c<sp/>run<sp/>:<sp/>%s\n"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="291"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>error_buffer);</highlight></codeline> +<codeline lineno="292"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="293"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="294"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>Safe_free(buffer);</highlight></codeline> +<codeline lineno="295"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>Safe_free(error_buffer);</highlight></codeline> +<codeline lineno="296"><highlight class="normal"></highlight></codeline> +<codeline lineno="297"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/></highlight></codeline> +<codeline lineno="298"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*<sp/>TODO</highlight></codeline> +<codeline lineno="299"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*<sp/>return<sp/>the<sp/>return_error_string<sp/>as<sp/>well!</highlight></codeline> +<codeline lineno="300"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="301"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>return_string;</highlight></codeline> +<codeline lineno="302"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="303"><highlight class="normal">}</highlight></codeline> +<codeline lineno="304"><highlight class="normal"></highlight></codeline> +<codeline lineno="305"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/>PyObject*<sp/>binary_c_return_arglines(PyObject<sp/>*</highlight><highlight class="keyword">self</highlight><highlight class="normal">,<sp/>PyObject<sp/>*args)</highlight></codeline> +<codeline lineno="306"><highlight class="normal">{</highlight></codeline> +<codeline lineno="307"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>buffer;</highlight></codeline> +<codeline lineno="308"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>error_buffer;</highlight></codeline> +<codeline lineno="309"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>nbytes;</highlight></codeline> +<codeline lineno="310"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>out<sp/>MAYBE_UNUSED<sp/>=<sp/>return_arglines(&buffer,</highlight></codeline> +<codeline lineno="311"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&error_buffer,</highlight></codeline> +<codeline lineno="312"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&nbytes);</highlight></codeline> +<codeline lineno="313"><highlight class="normal"></highlight></codeline> +<codeline lineno="314"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>copy<sp/>the<sp/>buffer<sp/>to<sp/>a<sp/>python<sp/>string<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="315"><highlight class="normal"><sp/><sp/><sp/><sp/>PyObject<sp/>*<sp/>return_string<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>buffer);</highlight></codeline> +<codeline lineno="316"><highlight class="normal"><sp/><sp/><sp/><sp/>PyObject<sp/>*<sp/>return_error_string<sp/>MAYBE_UNUSED<sp/>=<sp/>Py_BuildValue(</highlight><highlight class="stringliteral">"s"</highlight><highlight class="normal">,<sp/>error_buffer);</highlight></codeline> +<codeline lineno="317"><highlight class="normal"></highlight></codeline> +<codeline lineno="318"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">if</highlight><highlight class="normal">(error_buffer<sp/>!=<sp/>NULL<sp/>&&<sp/>strlen(error_buffer)>0)</highlight></codeline> +<codeline lineno="319"><highlight class="normal"><sp/><sp/><sp/><sp/>{</highlight></codeline> +<codeline lineno="320"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>fprintf(stderr,</highlight></codeline> +<codeline lineno="321"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"Error<sp/>in<sp/>binary_c<sp/>run<sp/>:<sp/>%s\n"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="322"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>error_buffer);</highlight></codeline> +<codeline lineno="323"><highlight class="normal"><sp/><sp/><sp/><sp/>}</highlight></codeline> +<codeline lineno="324"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="325"><highlight class="normal"><sp/><sp/><sp/><sp/>Safe_free(buffer);</highlight></codeline> +<codeline lineno="326"><highlight class="normal"><sp/><sp/><sp/><sp/>Safe_free(error_buffer);</highlight></codeline> +<codeline lineno="327"><highlight class="normal"></highlight></codeline> +<codeline lineno="328"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/></highlight></codeline> +<codeline lineno="329"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/>*<sp/>TODO</highlight></codeline> +<codeline lineno="330"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/>*<sp/>return<sp/>the<sp/>return_error_string<sp/>as<sp/>well!</highlight></codeline> +<codeline lineno="331"><highlight class="comment"><sp/><sp/><sp/><sp/><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="332"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>return_string;</highlight></codeline> +<codeline lineno="333"><highlight class="normal">}</highlight></codeline> + </programlisting> + <location file="binary_c_python.c"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/binary__c__python_8h.xml b/docs/Doxygen/xml/binary__c__python_8h.xml new file mode 100644 index 0000000000000000000000000000000000000000..b11d0a43441e9d3f8eef70f8c66795ba10cf6e6d --- /dev/null +++ b/docs/Doxygen/xml/binary__c__python_8h.xml @@ -0,0 +1,233 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="binary__c__python_8h" kind="file" language="C++"> + <compoundname>binary_c_python.h</compoundname> + <includes local="yes">binary_c_API.h</includes> + <includes local="yes">binary_c_API_prototypes.h</includes> + <includedby refid="binary__c__python_8c" local="yes">binary_c_python.c</includedby> + <includedby refid="binary__c__python__api_8c" local="yes">binary_c_python_api.c</includedby> + <incdepgraph> + <node id="10"> + <label>binary_c_API_prototypes.h</label> + </node> + <node id="9"> + <label>binary_c_API.h</label> + </node> + <node id="8"> + <label>binary_c_python.h</label> + <link refid="binary__c__python_8h"/> + <childnode refid="9" relation="include"> + </childnode> + <childnode refid="10" relation="include"> + </childnode> + </node> + </incdepgraph> + <sectiondef kind="define"> + <memberdef kind="define" id="binary__c__python_8h_1a38ee349162bf908751d46fe7b21204e1" prot="public" static="no"> + <name>BINARY_C_PYTHON_H</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.h" line="3" column="9" bodyfile="binary_c_python.h" bodystart="3" bodyend="-1"/> + </memberdef> + <memberdef kind="define" id="binary__c__python_8h_1ab3a75b19ea9b28f47fcfc0012c06715c" prot="public" static="no"> + <name>BINARY_C_APITEST_VERSION</name> + <initializer>0.1</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.h" line="33" column="9" bodyfile="binary_c_python.h" bodystart="33" bodyend="-1"/> + </memberdef> + <memberdef kind="define" id="binary__c__python_8h_1a01f02a9dd2aeb8df6a0e319ff60589f8" prot="public" static="no"> + <name>APIprint</name> + <param><defname>...</defname></param> + <initializer>APIprintf(__VA_ARGS__);</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.h" line="34" column="9" bodyfile="binary_c_python.h" bodystart="34" bodyend="-1"/> + </memberdef> + <memberdef kind="define" id="binary__c__python_8h_1a0b64516451f088cc73b3a76d07e50cee" prot="public" static="no"> + <name>NO_OUTPUT</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.h" line="35" column="9" bodyfile="binary_c_python.h" bodystart="35" bodyend="-1"/> + </memberdef> + </sectiondef> + <sectiondef kind="func"> + <memberdef kind="function" id="binary__c__python_8h_1ace9c83eff223e1ceae820171f3398b3f" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int run_binary</definition> + <argsstring>(char *argstring, char **const outstring, char **const errorstring, size_t *const nbytes)</argsstring> + <name>run_binary</name> + <param> + <type>char *</type> + <declname>argstring</declname> + </param> + <param> + <type>char **const</type> + <declname>outstring</declname> + </param> + <param> + <type>char **const</type> + <declname>errorstring</declname> + </param> + <param> + <type>size_t *const</type> + <declname>nbytes</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.h" line="12" column="1" bodyfile="binary_c_python_api.c" bodystart="48" bodyend="97"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8h_1a9f0348a1a042139f4d9322febd572e64" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int run_binary_with_logfile</definition> + <argsstring>(char *argstring, char **const outstring, char **const errorstring, size_t *const nbytes)</argsstring> + <name>run_binary_with_logfile</name> + <param> + <type>char *</type> + <declname>argstring</declname> + </param> + <param> + <type>char **const</type> + <declname>outstring</declname> + </param> + <param> + <type>char **const</type> + <declname>errorstring</declname> + </param> + <param> + <type>size_t *const</type> + <declname>nbytes</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.h" line="17" column="1" bodyfile="binary_c_python_api.c" bodystart="203" bodyend="242"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8h_1a61495de6862edf96e3687fe962f21da4" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int run_binary_custom_logging</definition> + <argsstring>(char *argstring, long int func_memaddr, char **const buffer, char **const error_buffer, size_t *const nbytes)</argsstring> + <name>run_binary_custom_logging</name> + <param> + <type>char *</type> + <declname>argstring</declname> + </param> + <param> + <type>long int</type> + <declname>func_memaddr</declname> + </param> + <param> + <type>char **const</type> + <declname>buffer</declname> + </param> + <param> + <type>char **const</type> + <declname>error_buffer</declname> + </param> + <param> + <type>size_t *const</type> + <declname>nbytes</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.h" line="22" column="1" bodyfile="binary_c_python_api.c" bodystart="99" bodyend="150"/> + </memberdef> + <memberdef kind="function" id="binary__c__python_8h_1afcf0243ae54eae72022879581a9e4d2b" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int return_arglines</definition> + <argsstring>(char **const outstring, char **const errorstring, size_t *const nbytes)</argsstring> + <name>return_arglines</name> + <param> + <type>char **const</type> + <declname>outstring</declname> + </param> + <param> + <type>char **const</type> + <declname>errorstring</declname> + </param> + <param> + <type>size_t *const</type> + <declname>nbytes</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python.h" line="28" column="1" bodyfile="binary_c_python_api.c" bodystart="152" bodyend="201"/> + </memberdef> + </sectiondef> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> +<codeline lineno="1"><highlight class="preprocessor">#pragma<sp/>once</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="2"><highlight class="normal"></highlight><highlight class="preprocessor">#ifndef<sp/>BINARY_C_PYTHON_H</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="3"><highlight class="normal"></highlight><highlight class="preprocessor">#define<sp/>BINARY_C_PYTHON_H</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="4"><highlight class="normal"></highlight></codeline> +<codeline lineno="5"><highlight class="normal"></highlight><highlight class="comment">/*</highlight></codeline> +<codeline lineno="6"><highlight class="comment"><sp/>*<sp/>Include<sp/>binary_C's<sp/>API</highlight></codeline> +<codeline lineno="7"><highlight class="comment"><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="8"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/>"binary_c_API.h"</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="9"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/>"binary_c_API_prototypes.h"</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="10"><highlight class="normal"></highlight></codeline> +<codeline lineno="11"><highlight class="normal"></highlight><highlight class="comment">/*<sp/>Binary_c's<sp/>python<sp/>API<sp/>prototypes<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="12"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>run_binary<sp/>(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>argstring,</highlight></codeline> +<codeline lineno="13"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>outstring,</highlight></codeline> +<codeline lineno="14"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>errorstring,</highlight></codeline> +<codeline lineno="15"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>*<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>nbytes);</highlight></codeline> +<codeline lineno="16"><highlight class="normal"></highlight></codeline> +<codeline lineno="17"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>run_binary_with_logfile<sp/>(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>argstring,</highlight></codeline> +<codeline lineno="18"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>outstring,</highlight></codeline> +<codeline lineno="19"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>errorstring,</highlight></codeline> +<codeline lineno="20"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>*<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>nbytes);</highlight></codeline> +<codeline lineno="21"><highlight class="normal"></highlight></codeline> +<codeline lineno="22"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>run_binary_custom_logging(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>argstring,</highlight></codeline> +<codeline lineno="23"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">long</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>func_memaddr,</highlight></codeline> +<codeline lineno="24"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>buffer,</highlight></codeline> +<codeline lineno="25"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>error_buffer,</highlight></codeline> +<codeline lineno="26"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>*<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>nbytes);</highlight></codeline> +<codeline lineno="27"><highlight class="normal"></highlight></codeline> +<codeline lineno="28"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>return_arglines(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>outstring,</highlight></codeline> +<codeline lineno="29"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>errorstring,<sp/><sp/></highlight></codeline> +<codeline lineno="30"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>*<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>nbytes);</highlight></codeline> +<codeline lineno="31"><highlight class="normal"></highlight></codeline> +<codeline lineno="32"><highlight class="normal"></highlight><highlight class="comment">/*<sp/>C<sp/>macros<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="33"><highlight class="normal"></highlight><highlight class="preprocessor">#define<sp/>BINARY_C_APITEST_VERSION<sp/>0.1</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="34"><highlight class="normal"></highlight><highlight class="preprocessor">#define<sp/>APIprint(...)<sp/>APIprintf(__VA_ARGS__);</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="35"><highlight class="normal"></highlight><highlight class="preprocessor">#define<sp/>NO_OUTPUT</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="36"><highlight class="normal"></highlight></codeline> +<codeline lineno="37"><highlight class="normal"></highlight><highlight class="preprocessor">#endif<sp/>//<sp/>BINARY_C_C_PYTHON_H</highlight></codeline> + </programlisting> + <location file="binary_c_python.h"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/binary__c__python__api_8c.xml b/docs/Doxygen/xml/binary__c__python__api_8c.xml new file mode 100644 index 0000000000000000000000000000000000000000..d1ebb7f54ea0b44d21de00d4a4adba320cfe4b75 --- /dev/null +++ b/docs/Doxygen/xml/binary__c__python__api_8c.xml @@ -0,0 +1,460 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="binary__c__python__api_8c" kind="file" language="C++"> + <compoundname>binary_c_python_api.c</compoundname> + <includes refid="binary__c__python_8h" local="yes">binary_c_python.h</includes> + <includes local="no">time.h</includes> + <includes local="no">sys/timeb.h</includes> + <includes local="no">stdarg.h</includes> + <includes local="no">stdio.h</includes> + <includes local="no">stdlib.h</includes> + <includes local="no">unistd.h</includes> + <incdepgraph> + <node id="18"> + <label>stdarg.h</label> + </node> + <node id="15"> + <label>binary_c_API_prototypes.h</label> + </node> + <node id="20"> + <label>stdlib.h</label> + </node> + <node id="12"> + <label>binary_c_python_api.c</label> + <link refid="binary__c__python__api_8c"/> + <childnode refid="13" relation="include"> + </childnode> + <childnode refid="16" relation="include"> + </childnode> + <childnode refid="17" relation="include"> + </childnode> + <childnode refid="18" relation="include"> + </childnode> + <childnode refid="19" relation="include"> + </childnode> + <childnode refid="20" relation="include"> + </childnode> + <childnode refid="21" relation="include"> + </childnode> + </node> + <node id="21"> + <label>unistd.h</label> + </node> + <node id="14"> + <label>binary_c_API.h</label> + </node> + <node id="16"> + <label>time.h</label> + </node> + <node id="17"> + <label>sys/timeb.h</label> + </node> + <node id="13"> + <label>binary_c_python.h</label> + <link refid="binary__c__python_8h_source"/> + <childnode refid="14" relation="include"> + </childnode> + <childnode refid="15" relation="include"> + </childnode> + </node> + <node id="19"> + <label>stdio.h</label> + </node> + </incdepgraph> + <sectiondef kind="var"> + <memberdef kind="variable" id="binary__c__python__api_8c_1a7585f58c2cc99092d759440e455c402b" prot="public" static="no" mutable="no"> + <type>int</type> + <definition>int out_pipe[2]</definition> + <argsstring>[2]</argsstring> + <name>out_pipe</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python_api.c" line="45" column="1" bodyfile="binary_c_python_api.c" bodystart="45" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="binary__c__python__api_8c_1a0ecee3f382d2832184b83f828a847ebc" prot="public" static="no" mutable="no"> + <type>int</type> + <definition>int stdoutwas</definition> + <argsstring></argsstring> + <name>stdoutwas</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python_api.c" line="46" column="1" bodyfile="binary_c_python_api.c" bodystart="46" bodyend="-1"/> + </memberdef> + </sectiondef> + <sectiondef kind="func"> + <memberdef kind="function" id="binary__c__python__api_8c_1a9cf1110dc5965ce4553af25faeed0016" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int run_binary</definition> + <argsstring>(char *argstring, char **const buffer, char **const error_buffer, size_t *const nbytes)</argsstring> + <name>run_binary</name> + <param> + <type>char *</type> + <declname>argstring</declname> + </param> + <param> + <type>char **const</type> + <declname>buffer</declname> + </param> + <param> + <type>char **const</type> + <declname>error_buffer</declname> + </param> + <param> + <type>size_t *const</type> + <declname>nbytes</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python_api.c" line="48" column="1" bodyfile="binary_c_python_api.c" bodystart="48" bodyend="97"/> + </memberdef> + <memberdef kind="function" id="binary__c__python__api_8c_1a61495de6862edf96e3687fe962f21da4" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int run_binary_custom_logging</definition> + <argsstring>(char *argstring, long int func_memaddr, char **const buffer, char **const error_buffer, size_t *const nbytes)</argsstring> + <name>run_binary_custom_logging</name> + <param> + <type>char *</type> + <declname>argstring</declname> + </param> + <param> + <type>long int</type> + <declname>func_memaddr</declname> + </param> + <param> + <type>char **const</type> + <declname>buffer</declname> + </param> + <param> + <type>char **const</type> + <declname>error_buffer</declname> + </param> + <param> + <type>size_t *const</type> + <declname>nbytes</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python_api.c" line="99" column="1" bodyfile="binary_c_python_api.c" bodystart="99" bodyend="150"/> + </memberdef> + <memberdef kind="function" id="binary__c__python__api_8c_1a3a84ae972c9a076b44b11536521f95d5" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int return_arglines</definition> + <argsstring>(char **const buffer, char **const error_buffer, size_t *const nbytes)</argsstring> + <name>return_arglines</name> + <param> + <type>char **const</type> + <declname>buffer</declname> + </param> + <param> + <type>char **const</type> + <declname>error_buffer</declname> + </param> + <param> + <type>size_t *const</type> + <declname>nbytes</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python_api.c" line="152" column="1" bodyfile="binary_c_python_api.c" bodystart="152" bodyend="201"/> + </memberdef> + <memberdef kind="function" id="binary__c__python__api_8c_1ab3c7f69d58d2ad92d556accd53a38ca7" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int run_binary_with_logfile</definition> + <argsstring>(char *argstring, char **const buffer, char **const error_buffer, size_t *const nbytes)</argsstring> + <name>run_binary_with_logfile</name> + <param> + <type>char *</type> + <declname>argstring</declname> + </param> + <param> + <type>char **const</type> + <declname>buffer</declname> + </param> + <param> + <type>char **const</type> + <declname>error_buffer</declname> + </param> + <param> + <type>size_t *const</type> + <declname>nbytes</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="binary_c_python_api.c" line="203" column="1" bodyfile="binary_c_python_api.c" bodystart="203" bodyend="242"/> + </memberdef> + </sectiondef> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> +<codeline lineno="1"><highlight class="preprocessor">#include<sp/>"binary_c_python.h"</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="2"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/><time.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="3"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/><sys/timeb.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="4"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/><stdarg.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="5"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/><stdio.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="6"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/><stdlib.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="7"><highlight class="normal"></highlight><highlight class="preprocessor">#include<sp/><unistd.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="8"><highlight class="normal"></highlight></codeline> +<codeline lineno="9"><highlight class="normal"></highlight></codeline> +<codeline lineno="10"><highlight class="normal"></highlight><highlight class="comment">/*</highlight></codeline> +<codeline lineno="11"><highlight class="comment"><sp/>*<sp/>apitest</highlight></codeline> +<codeline lineno="12"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="13"><highlight class="comment"><sp/>*<sp/>Short<sp/>test<sp/>programme<sp/>to<sp/>throw<sp/>random<sp/>binary<sp/>systems<sp/>at<sp/>binary_c's</highlight></codeline> +<codeline lineno="14"><highlight class="comment"><sp/>*<sp/>library<sp/>via<sp/>its<sp/>API.</highlight></codeline> +<codeline lineno="15"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="16"><highlight class="comment"><sp/>*<sp/>Note<sp/>that<sp/>it<sp/>looks<sp/>more<sp/>complicated<sp/>than<sp/>it<sp/>is<sp/>because<sp/>I<sp/>have<sp/>included</highlight></codeline> +<codeline lineno="17"><highlight class="comment"><sp/>*<sp/>code<sp/>to<sp/>capture<sp/>binary_c's<sp/>stdout<sp/>stream<sp/>and<sp/>output<sp/>it<sp/>here.</highlight></codeline> +<codeline lineno="18"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="19"><highlight class="comment"><sp/>*<sp/>This<sp/>code<sp/>sends<sp/>output<sp/>to<sp/>stderr<sp/>:<sp/>you<sp/>should<sp/>use<sp/>apitest.sh<sp/>to<sp/>run<sp/>it</highlight></codeline> +<codeline lineno="20"><highlight class="comment"><sp/>*<sp/>and<sp/>hence<sp/>force<sp/>output<sp/>to<sp/>your<sp/>terminal's<sp/>stdout.</highlight></codeline> +<codeline lineno="21"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="22"><highlight class="comment"><sp/>*<sp/>Output<sp/>lines:</highlight></codeline> +<codeline lineno="23"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="24"><highlight class="comment"><sp/>*<sp/>APITEST<sp/>....<sp/><sp/>is<sp/>information<sp/>about<sp/>what<sp/>this<sp/>code<sp/>is<sp/>doing.</highlight></codeline> +<codeline lineno="25"><highlight class="comment"><sp/>*<sp/>STATUS<sp/><sp/>....<sp/><sp/>is<sp/>information<sp/>about<sp/>the<sp/>binary<sp/>system.</highlight></codeline> +<codeline lineno="26"><highlight class="comment"><sp/>*<sp/>BINARY_C<sp/>....<sp/>is<sp/>output<sp/>from<sp/>binary_c<sp/>(see<sp/>iterate_logging.c<sp/>etc.)</highlight></codeline> +<codeline lineno="27"><highlight class="comment"><sp/>*<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>which<sp/>would<sp/>have<sp/>gone<sp/>to<sp/>stdout</highlight></codeline> +<codeline lineno="28"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="29"><highlight class="comment"><sp/>*<sp/>If<sp/>you<sp/>define<sp/>the<sp/>NO_OUTPUT<sp/>macro,<sp/>there<sp/>will<sp/>be<sp/>no<sp/>output<sp/>except</highlight></codeline> +<codeline lineno="30"><highlight class="comment"><sp/>*<sp/>the<sp/>memory<sp/>allocation<sp/>and<sp/>test<sp/>system<sp/>information.<sp/>This<sp/>is<sp/>useful<sp/>for<sp/>speed<sp/>tests,</highlight></codeline> +<codeline lineno="31"><highlight class="comment"><sp/>*<sp/>but<sp/>note<sp/>that<sp/>you<sp/>may<sp/>end<sp/>up<sp/>in<sp/>a<sp/>race<sp/>condition<sp/>where<sp/>the<sp/>pipe<sp/>which<sp/>replaces</highlight></codeline> +<codeline lineno="32"><highlight class="comment"><sp/>*<sp/>stdout's<sp/>buffer<sp/>fills<sp/>and<sp/>hence<sp/>the<sp/>code<sp/>stops.</highlight></codeline> +<codeline lineno="33"><highlight class="comment"><sp/>*</highlight></codeline> +<codeline lineno="34"><highlight class="comment"><sp/>*<sp/>Note:</highlight></codeline> +<codeline lineno="35"><highlight class="comment"><sp/>*<sp/>I<sp/>have<sp/>tested<sp/>this<sp/>with<sp/>gcc<sp/>4.7.2<sp/>(Ubuntu<sp/>12.10)<sp/>only.</highlight></codeline> +<codeline lineno="36"><highlight class="comment"><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="37"><highlight class="normal"></highlight></codeline> +<codeline lineno="38"><highlight class="normal"></highlight><highlight class="comment">//<sp/>#define<sp/>_CAPTURE</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="39"><highlight class="normal"></highlight><highlight class="preprocessor">#ifdef<sp/>_CAPTURE</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="40"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">void</highlight><highlight class="normal"><sp/>show_stdout(</highlight><highlight class="keywordtype">void</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="41"><highlight class="normal"></highlight><highlight class="keyword">static</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">void</highlight><highlight class="normal"><sp/>capture_stdout(</highlight><highlight class="keywordtype">void</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="42"><highlight class="normal"></highlight><highlight class="preprocessor">#endif</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="43"><highlight class="normal"></highlight></codeline> +<codeline lineno="44"><highlight class="normal"></highlight><highlight class="comment">/*<sp/>global<sp/>variables<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="45"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>out_pipe[2];</highlight></codeline> +<codeline lineno="46"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>stdoutwas;</highlight></codeline> +<codeline lineno="47"><highlight class="normal"></highlight></codeline> +<codeline lineno="48"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>run_binary(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>argstring,</highlight></codeline> +<codeline lineno="49"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>buffer,</highlight></codeline> +<codeline lineno="50"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>error_buffer,</highlight></codeline> +<codeline lineno="51"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>*<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>nbytes)</highlight></codeline> +<codeline lineno="52"><highlight class="normal">{</highlight></codeline> +<codeline lineno="53"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>memory<sp/>for<sp/>N<sp/>binary<sp/>systems<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="54"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_stardata_t<sp/>*stardata;</highlight></codeline> +<codeline lineno="55"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_store_t<sp/>*<sp/>store<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="56"><highlight class="normal"></highlight></codeline> +<codeline lineno="57"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>make<sp/>new<sp/>stardata<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="58"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="59"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_new_system(&stardata,</highlight></codeline> +<codeline lineno="60"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>NULL,</highlight></codeline> +<codeline lineno="61"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>NULL,</highlight></codeline> +<codeline lineno="62"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&store,</highlight></codeline> +<codeline lineno="63"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&argstring,</highlight></codeline> +<codeline lineno="64"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>-1);</highlight></codeline> +<codeline lineno="65"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="66"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>disable<sp/>logging<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="67"><highlight class="normal"><sp/><sp/><sp/><sp/>snprintf(stardata->preferences->log_filename,</highlight></codeline> +<codeline lineno="68"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>STRING_LENGTH-1,</highlight></codeline> +<codeline lineno="69"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"%s"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="70"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"/dev/null"</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="71"><highlight class="normal"><sp/><sp/><sp/><sp/>snprintf(stardata->preferences->api_log_filename_prefix,</highlight></codeline> +<codeline lineno="72"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>STRING_LENGTH-1,</highlight></codeline> +<codeline lineno="73"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"%s"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="74"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"/dev/null"</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="75"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>output<sp/>to<sp/>strings<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="76"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->internal_buffering<sp/>=<sp/>INTERNAL_BUFFERING_STORE;</highlight></codeline> +<codeline lineno="77"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->batchmode<sp/>=<sp/>BATCHMODE_LIBRARY;</highlight></codeline> +<codeline lineno="78"><highlight class="normal"></highlight></codeline> +<codeline lineno="79"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>do<sp/>binary<sp/>evolution<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="80"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_evolve_for_dt(stardata,</highlight></codeline> +<codeline lineno="81"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>stardata->model.max_evolution_time);</highlight></codeline> +<codeline lineno="82"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="83"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>get<sp/>buffer<sp/>pointer<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="84"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_buffer_info(stardata,buffer,nbytes);</highlight></codeline> +<codeline lineno="85"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="86"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>get<sp/>error<sp/>buffer<sp/>pointer<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="87"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_error_buffer(stardata,error_buffer);</highlight></codeline> +<codeline lineno="88"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="89"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>set<sp/>raw_buffer_size<sp/>=<sp/>-1<sp/>to<sp/>prevent<sp/>it<sp/>being<sp/>freed<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="90"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->tmpstore->raw_buffer_size<sp/>=<sp/>-1;</highlight></codeline> +<codeline lineno="91"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="92"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>free<sp/>stardata<sp/>(except<sp/>the<sp/>buffer)<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="93"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_free_memory(&stardata,TRUE,TRUE,FALSE,FALSE);</highlight></codeline> +<codeline lineno="94"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_free_store_contents(store);</highlight></codeline> +<codeline lineno="95"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="96"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>0;</highlight></codeline> +<codeline lineno="97"><highlight class="normal">}</highlight></codeline> +<codeline lineno="98"><highlight class="normal"></highlight></codeline> +<codeline lineno="99"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>run_binary_custom_logging(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>argstring,</highlight></codeline> +<codeline lineno="100"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">long</highlight><highlight class="normal"><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>func_memaddr,</highlight></codeline> +<codeline lineno="101"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>buffer,</highlight></codeline> +<codeline lineno="102"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>error_buffer,</highlight></codeline> +<codeline lineno="103"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>*<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>nbytes)</highlight></codeline> +<codeline lineno="104"><highlight class="normal">{</highlight></codeline> +<codeline lineno="105"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>memory<sp/>for<sp/>N<sp/>binary<sp/>systems<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="106"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_stardata_t<sp/>*stardata;</highlight></codeline> +<codeline lineno="107"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_store_t<sp/>*<sp/>store<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="108"><highlight class="normal"></highlight></codeline> +<codeline lineno="109"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>make<sp/>new<sp/>stardata<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="110"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="111"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_new_system(&stardata,</highlight></codeline> +<codeline lineno="112"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>NULL,</highlight></codeline> +<codeline lineno="113"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>NULL,</highlight></codeline> +<codeline lineno="114"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&store,</highlight></codeline> +<codeline lineno="115"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&argstring,</highlight></codeline> +<codeline lineno="116"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>-1);</highlight></codeline> +<codeline lineno="117"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="118"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>disable<sp/>logging<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="119"><highlight class="normal"><sp/><sp/><sp/><sp/>snprintf(stardata->preferences->log_filename,</highlight></codeline> +<codeline lineno="120"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>STRING_LENGTH-1,</highlight></codeline> +<codeline lineno="121"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"%s"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="122"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"/dev/null"</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="123"><highlight class="normal"><sp/><sp/><sp/><sp/>snprintf(stardata->preferences->api_log_filename_prefix,</highlight></codeline> +<codeline lineno="124"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>STRING_LENGTH-1,</highlight></codeline> +<codeline lineno="125"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"%s"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="126"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"/dev/null"</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="127"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>output<sp/>to<sp/>strings<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="128"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->internal_buffering<sp/>=<sp/>INTERNAL_BUFFERING_STORE;</highlight></codeline> +<codeline lineno="129"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->batchmode<sp/>=<sp/>BATCHMODE_LIBRARY;</highlight></codeline> +<codeline lineno="130"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->custom_output_function<sp/>=<sp/>(</highlight><highlight class="keywordtype">void</highlight><highlight class="normal">*)(</highlight><highlight class="keyword">struct</highlight><highlight class="normal"><sp/>stardata_t<sp/>*)func_memaddr;</highlight></codeline> +<codeline lineno="131"><highlight class="normal"></highlight></codeline> +<codeline lineno="132"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>do<sp/>binary<sp/>evolution<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="133"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_evolve_for_dt(stardata,</highlight></codeline> +<codeline lineno="134"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>stardata->model.max_evolution_time);</highlight></codeline> +<codeline lineno="135"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="136"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>get<sp/>buffer<sp/>pointer<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="137"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_buffer_info(stardata,buffer,nbytes);</highlight></codeline> +<codeline lineno="138"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="139"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>get<sp/>error<sp/>buffer<sp/>pointer<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="140"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_error_buffer(stardata,error_buffer);</highlight></codeline> +<codeline lineno="141"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="142"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>set<sp/>raw_buffer_size<sp/>=<sp/>-1<sp/>to<sp/>prevent<sp/>it<sp/>being<sp/>freed<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="143"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->tmpstore->raw_buffer_size<sp/>=<sp/>-1;</highlight></codeline> +<codeline lineno="144"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="145"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>free<sp/>stardata<sp/>(except<sp/>the<sp/>buffer)<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="146"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_free_memory(&stardata,TRUE,TRUE,FALSE,FALSE);</highlight></codeline> +<codeline lineno="147"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_free_store_contents(store);</highlight></codeline> +<codeline lineno="148"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="149"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>0;</highlight></codeline> +<codeline lineno="150"><highlight class="normal">}</highlight></codeline> +<codeline lineno="151"><highlight class="normal"></highlight></codeline> +<codeline lineno="152"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>return_arglines(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>buffer,</highlight></codeline> +<codeline lineno="153"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>error_buffer,</highlight></codeline> +<codeline lineno="154"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>*<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>nbytes)</highlight></codeline> +<codeline lineno="155"><highlight class="normal">{</highlight></codeline> +<codeline lineno="156"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>memory<sp/>for<sp/>N<sp/>binary<sp/>systems<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="157"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_stardata_t<sp/>*stardata;</highlight></codeline> +<codeline lineno="158"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_store_t<sp/>*<sp/>store<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="159"><highlight class="normal"></highlight></codeline> +<codeline lineno="160"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>make<sp/>new<sp/>stardata<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="161"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="162"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>empty_str<sp/>=<sp/></highlight><highlight class="stringliteral">""</highlight><highlight class="normal">;</highlight></codeline> +<codeline lineno="163"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_new_system(&stardata,</highlight></codeline> +<codeline lineno="164"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>NULL,</highlight></codeline> +<codeline lineno="165"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>NULL,</highlight></codeline> +<codeline lineno="166"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&store,</highlight></codeline> +<codeline lineno="167"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&empty_str,</highlight></codeline> +<codeline lineno="168"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>-1);</highlight></codeline> +<codeline lineno="169"><highlight class="normal"></highlight></codeline> +<codeline lineno="170"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>disable<sp/>logging<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="171"><highlight class="normal"><sp/><sp/><sp/><sp/>snprintf(stardata->preferences->log_filename,</highlight></codeline> +<codeline lineno="172"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>STRING_LENGTH-1,</highlight></codeline> +<codeline lineno="173"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"%s"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="174"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"/dev/null"</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="175"><highlight class="normal"><sp/><sp/><sp/><sp/>snprintf(stardata->preferences->api_log_filename_prefix,</highlight></codeline> +<codeline lineno="176"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>STRING_LENGTH-1,</highlight></codeline> +<codeline lineno="177"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"%s"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="178"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="stringliteral">"/dev/null"</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="179"><highlight class="normal"></highlight></codeline> +<codeline lineno="180"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>output<sp/>to<sp/>strings<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="181"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->internal_buffering<sp/>=<sp/>INTERNAL_BUFFERING_STORE;</highlight></codeline> +<codeline lineno="182"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->batchmode<sp/>=<sp/>BATCHMODE_LIBRARY;</highlight></codeline> +<codeline lineno="183"><highlight class="normal"></highlight></codeline> +<codeline lineno="184"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>List<sp/>available<sp/>arguments<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="185"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_list_args(stardata);</highlight></codeline> +<codeline lineno="186"><highlight class="normal"></highlight></codeline> +<codeline lineno="187"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>get<sp/>buffer<sp/>pointer<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="188"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_buffer_info(stardata,buffer,nbytes);</highlight></codeline> +<codeline lineno="189"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="190"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>get<sp/>error<sp/>buffer<sp/>pointer<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="191"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_error_buffer(stardata,error_buffer);</highlight></codeline> +<codeline lineno="192"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="193"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>set<sp/>raw_buffer_size<sp/>=<sp/>-1<sp/>to<sp/>prevent<sp/>it<sp/>being<sp/>freed<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="194"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->tmpstore->raw_buffer_size<sp/>=<sp/>-1;</highlight></codeline> +<codeline lineno="195"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="196"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>free<sp/>stardata<sp/>(except<sp/>the<sp/>buffer)<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="197"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_free_memory(&stardata,TRUE,TRUE,FALSE,FALSE);</highlight></codeline> +<codeline lineno="198"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_free_store_contents(store);</highlight></codeline> +<codeline lineno="199"><highlight class="normal"></highlight></codeline> +<codeline lineno="200"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>0;</highlight></codeline> +<codeline lineno="201"><highlight class="normal">}</highlight></codeline> +<codeline lineno="202"><highlight class="normal"></highlight></codeline> +<codeline lineno="203"><highlight class="normal"></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>run_binary_with_logfile(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>argstring,</highlight></codeline> +<codeline lineno="204"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>buffer,</highlight></codeline> +<codeline lineno="205"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>error_buffer,</highlight></codeline> +<codeline lineno="206"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">size_t</highlight><highlight class="normal"><sp/>*<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>nbytes)</highlight></codeline> +<codeline lineno="207"><highlight class="normal">{</highlight></codeline> +<codeline lineno="208"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>memory<sp/>for<sp/>N<sp/>binary<sp/>systems<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="209"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_stardata_t<sp/>*stardata;</highlight></codeline> +<codeline lineno="210"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal">libbinary_c_store_t<sp/>*<sp/>store<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="211"><highlight class="normal"></highlight></codeline> +<codeline lineno="212"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>make<sp/>new<sp/>stardata<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="213"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata<sp/>=<sp/>NULL;</highlight></codeline> +<codeline lineno="214"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_new_system(&stardata,</highlight></codeline> +<codeline lineno="215"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>NULL,</highlight></codeline> +<codeline lineno="216"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>NULL,</highlight></codeline> +<codeline lineno="217"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&store,</highlight></codeline> +<codeline lineno="218"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>&argstring,</highlight></codeline> +<codeline lineno="219"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>-1);</highlight></codeline> +<codeline lineno="220"><highlight class="normal"></highlight></codeline> +<codeline lineno="221"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>output<sp/>to<sp/>strings<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="222"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->internal_buffering<sp/>=<sp/>INTERNAL_BUFFERING_STORE;</highlight></codeline> +<codeline lineno="223"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->preferences->batchmode<sp/>=<sp/>BATCHMODE_LIBRARY;</highlight></codeline> +<codeline lineno="224"><highlight class="normal"></highlight></codeline> +<codeline lineno="225"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>do<sp/>binary<sp/>evolution<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="226"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_evolve_for_dt(stardata,</highlight></codeline> +<codeline lineno="227"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>stardata->model.max_evolution_time);</highlight></codeline> +<codeline lineno="228"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="229"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>get<sp/>buffer<sp/>pointer<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="230"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_buffer_info(stardata,buffer,nbytes);</highlight></codeline> +<codeline lineno="231"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="232"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>get<sp/>error<sp/>buffer<sp/>pointer<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="233"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_error_buffer(stardata,error_buffer);</highlight></codeline> +<codeline lineno="234"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="235"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>set<sp/>raw_buffer_size<sp/>=<sp/>-1<sp/>to<sp/>prevent<sp/>it<sp/>being<sp/>freed<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="236"><highlight class="normal"><sp/><sp/><sp/><sp/>stardata->tmpstore->raw_buffer_size<sp/>=<sp/>-1;</highlight></codeline> +<codeline lineno="237"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="238"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="comment">/*<sp/>free<sp/>stardata<sp/>(except<sp/>the<sp/>buffer)<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="239"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_free_memory(&stardata,TRUE,TRUE,FALSE,FALSE);</highlight></codeline> +<codeline lineno="240"><highlight class="normal"><sp/><sp/><sp/><sp/>binary_c_free_store_contents(store);</highlight></codeline> +<codeline lineno="241"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">return</highlight><highlight class="normal"><sp/>0;</highlight></codeline> +<codeline lineno="242"><highlight class="normal">}</highlight></codeline> + </programlisting> + <location file="binary_c_python_api.c"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/combine.xslt b/docs/Doxygen/xml/combine.xslt new file mode 100644 index 0000000000000000000000000000000000000000..c148ee4f2f0aa93015c19a2868bcc017c41334c1 --- /dev/null +++ b/docs/Doxygen/xml/combine.xslt @@ -0,0 +1,15 @@ +<!-- XSLT script to combine the generated output into a single file. + If you have xsltproc you could use: + xsltproc combine.xslt index.xml >all.xml +--> +<xsl:stylesheet xmlns:xsl="http://www.w3.org/1999/XSL/Transform" version="1.0"> + <xsl:output method="xml" version="1.0" indent="no" standalone="yes" /> + <xsl:template match="/"> + <doxygen version="{doxygenindex/@version}"> + <!-- Load all doxgen generated xml files --> + <xsl:for-each select="doxygenindex/compound"> + <xsl:copy-of select="document( concat( @refid, '.xml' ) )/doxygen/*" /> + </xsl:for-each> + </doxygen> + </xsl:template> +</xsl:stylesheet> diff --git a/docs/Doxygen/xml/compound.xsd b/docs/Doxygen/xml/compound.xsd new file mode 100644 index 0000000000000000000000000000000000000000..60653abb02ec2e9a3fe42b75f6e5b2f92d41d8e4 --- /dev/null +++ b/docs/Doxygen/xml/compound.xsd @@ -0,0 +1,1124 @@ +<?xml version='1.0' encoding='utf-8' ?> +<xsd:schema xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <xsd:element name="doxygen" type="DoxygenType"/> + + <!-- Complex types --> + + <xsd:complexType name="DoxygenType"> + <xsd:sequence maxOccurs="unbounded"> + <xsd:element name="compounddef" type="compounddefType" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="version" type="DoxVersionNumber" use="required" /> + </xsd:complexType> + + <xsd:complexType name="compounddefType"> + <xsd:sequence> + <xsd:element name="compoundname" type="xsd:string"/> + <xsd:element name="title" type="xsd:string" minOccurs="0" /> + <xsd:element name="basecompoundref" type="compoundRefType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="derivedcompoundref" type="compoundRefType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="includes" type="incType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="includedby" type="incType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="incdepgraph" type="graphType" minOccurs="0" /> + <xsd:element name="invincdepgraph" type="graphType" minOccurs="0" /> + <xsd:element name="innerdir" type="refType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="innerfile" type="refType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="innerclass" type="refType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="innernamespace" type="refType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="innerpage" type="refType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="innergroup" type="refType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="templateparamlist" type="templateparamlistType" minOccurs="0" /> + <xsd:element name="sectiondef" type="sectiondefType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="briefdescription" type="descriptionType" minOccurs="0" /> + <xsd:element name="detaileddescription" type="descriptionType" minOccurs="0" /> + <xsd:element name="inheritancegraph" type="graphType" minOccurs="0" /> + <xsd:element name="collaborationgraph" type="graphType" minOccurs="0" /> + <xsd:element name="programlisting" type="listingType" minOccurs="0" /> + <xsd:element name="location" type="locationType" minOccurs="0" /> + <xsd:element name="listofallmembers" type="listofallmembersType" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="id" type="xsd:string" /> + <xsd:attribute name="kind" type="DoxCompoundKind" /> + <xsd:attribute name="language" type="DoxLanguage" use="optional"/> + <xsd:attribute name="prot" type="DoxProtectionKind" /> + <xsd:attribute name="final" type="DoxBool" use="optional"/> + <xsd:attribute name="sealed" type="DoxBool" use="optional"/> + <xsd:attribute name="abstract" type="DoxBool" use="optional"/> + </xsd:complexType> + + <xsd:complexType name="listofallmembersType"> + <xsd:sequence> + <xsd:element name="member" type="memberRefType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="memberRefType"> + <xsd:sequence> + <xsd:element name="scope" /> + <xsd:element name="name" /> + </xsd:sequence> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="prot" type="DoxProtectionKind" /> + <xsd:attribute name="virt" type="DoxVirtualKind" /> + <xsd:attribute name="ambiguityscope" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="compoundRefType"> + <xsd:simpleContent> + <xsd:extension base="xsd:string"> + <xsd:attribute name="refid" type="xsd:string" use="optional" /> + <xsd:attribute name="prot" type="DoxProtectionKind" /> + <xsd:attribute name="virt" type="DoxVirtualKind" /> + </xsd:extension> + </xsd:simpleContent> + </xsd:complexType> + + <xsd:complexType name="reimplementType"> + <xsd:simpleContent> + <xsd:extension base="xsd:string"> + <xsd:attribute name="refid" type="xsd:string" /> + </xsd:extension> + </xsd:simpleContent> + </xsd:complexType> + + <xsd:complexType name="incType"> + <xsd:simpleContent> + <xsd:extension base="xsd:string"> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="local" type="DoxBool" /> + </xsd:extension> + </xsd:simpleContent> + </xsd:complexType> + + <xsd:complexType name="refType"> + <xsd:simpleContent> + <xsd:extension base="xsd:string"> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="prot" type="DoxProtectionKind" use="optional"/> + </xsd:extension> + </xsd:simpleContent> + </xsd:complexType> + + <xsd:complexType name="refTextType"> + <xsd:simpleContent> + <xsd:extension base="xsd:string"> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="kindref" type="DoxRefKind" /> + <xsd:attribute name="external" type="xsd:string" use="optional"/> + <xsd:attribute name="tooltip" type="xsd:string" use="optional"/> + </xsd:extension> + </xsd:simpleContent> + </xsd:complexType> + + <xsd:complexType name="sectiondefType"> + <xsd:sequence> + <xsd:element name="header" type="xsd:string" minOccurs="0" /> + <xsd:element name="description" type="descriptionType" minOccurs="0" /> + <xsd:element name="memberdef" type="memberdefType" maxOccurs="unbounded" /> + </xsd:sequence> + <xsd:attribute name="kind" type="DoxSectionKind" /> + </xsd:complexType> + + <xsd:complexType name="memberdefType"> + <xsd:sequence> + <xsd:element name="templateparamlist" type="templateparamlistType" minOccurs="0" /> + <xsd:element name="type" type="linkedTextType" minOccurs="0" /> + <xsd:element name="definition" minOccurs="0" /> + <xsd:element name="argsstring" minOccurs="0" /> + <xsd:element name="name" /> + <xsd:element name="read" minOccurs="0" /> + <xsd:element name="write" minOccurs="0" /> + <xsd:element name="bitfield" minOccurs="0" /> + <xsd:element name="reimplements" type="reimplementType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="reimplementedby" type="reimplementType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="param" type="paramType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="enumvalue" type="enumvalueType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="initializer" type="linkedTextType" minOccurs="0" /> + <xsd:element name="exceptions" type="linkedTextType" minOccurs="0" /> + <xsd:element name="briefdescription" type="descriptionType" minOccurs="0" /> + <xsd:element name="detaileddescription" type="descriptionType" minOccurs="0" /> + <xsd:element name="inbodydescription" type="descriptionType" minOccurs="0" /> + <xsd:element name="location" type="locationType" /> + <xsd:element name="references" type="referenceType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="referencedby" type="referenceType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + <xsd:attribute name="kind" type="DoxMemberKind" /> + <xsd:attribute name="id" type="xsd:string" /> + <xsd:attribute name="prot" type="DoxProtectionKind" /> + <xsd:attribute name="static" type="DoxBool" /> + <xsd:attribute name="const" type="DoxBool" use="optional"/> + <xsd:attribute name="explicit" type="DoxBool" use="optional"/> + <xsd:attribute name="inline" type="DoxBool" use="optional"/> + <xsd:attribute name="refqual" type="DoxRefQualifierKind" use="optional"/> + <xsd:attribute name="virt" type="DoxVirtualKind" use="optional"/> + <xsd:attribute name="volatile" type="DoxBool" use="optional"/> + <xsd:attribute name="mutable" type="DoxBool" use="optional"/> + <!-- Qt property --> + <xsd:attribute name="readable" type="DoxBool" use="optional"/> + <xsd:attribute name="writable" type="DoxBool" use="optional"/> + <!-- C++/CLI variable --> + <xsd:attribute name="initonly" type="DoxBool" use="optional"/> + <!-- C++/CLI and C# property --> + <xsd:attribute name="settable" type="DoxBool" use="optional"/> + <xsd:attribute name="gettable" type="DoxBool" use="optional"/> + <!-- C++/CLI function --> + <xsd:attribute name="final" type="DoxBool" use="optional"/> + <xsd:attribute name="sealed" type="DoxBool" use="optional"/> + <xsd:attribute name="new" type="DoxBool" use="optional"/> + <!-- C++/CLI event --> + <xsd:attribute name="add" type="DoxBool" use="optional"/> + <xsd:attribute name="remove" type="DoxBool" use="optional"/> + <xsd:attribute name="raise" type="DoxBool" use="optional"/> + <!-- Objective-C 2.0 protocol method --> + <xsd:attribute name="optional" type="DoxBool" use="optional"/> + <xsd:attribute name="required" type="DoxBool" use="optional"/> + <!-- Objective-C 2.0 property accessor --> + <xsd:attribute name="accessor" type="DoxAccessor" use="optional"/> + <!-- UNO IDL --> + <xsd:attribute name="attribute" type="DoxBool" use="optional"/> + <xsd:attribute name="property" type="DoxBool" use="optional"/> + <xsd:attribute name="readonly" type="DoxBool" use="optional"/> + <xsd:attribute name="bound" type="DoxBool" use="optional"/> + <xsd:attribute name="removable" type="DoxBool" use="optional"/> + <xsd:attribute name="contrained" type="DoxBool" use="optional"/> + <xsd:attribute name="transient" type="DoxBool" use="optional"/> + <xsd:attribute name="maybevoid" type="DoxBool" use="optional"/> + <xsd:attribute name="maybedefault" type="DoxBool" use="optional"/> + <xsd:attribute name="maybeambiguous" type="DoxBool" use="optional"/> + + </xsd:complexType> + + <xsd:complexType name="descriptionType" mixed="true"> + <xsd:sequence> + <xsd:element name="title" type="xsd:string" minOccurs="0"/> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect1" type="docSect1Type" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="internal" type="docInternalType" minOccurs="0" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="enumvalueType" mixed="true"> + <xsd:sequence> + <xsd:element name="name" /> + <xsd:element name="initializer" type="linkedTextType" minOccurs="0" /> + <xsd:element name="briefdescription" type="descriptionType" minOccurs="0" /> + <xsd:element name="detaileddescription" type="descriptionType" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="id" type="xsd:string" /> + <xsd:attribute name="prot" type="DoxProtectionKind" /> + </xsd:complexType> + + <xsd:complexType name="templateparamlistType"> + <xsd:sequence> + <xsd:element name="param" type="paramType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="paramType"> + <xsd:sequence> + <xsd:element name="type" type="linkedTextType" minOccurs="0" /> + <xsd:element name="declname" minOccurs="0" /> + <xsd:element name="defname" minOccurs="0" /> + <xsd:element name="array" minOccurs="0" /> + <xsd:element name="defval" type="linkedTextType" minOccurs="0" /> + <xsd:element name="typeconstraint" type="linkedTextType" minOccurs="0" /> + <xsd:element name="briefdescription" type="descriptionType" minOccurs="0" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="linkedTextType" mixed="true"> + <xsd:sequence> + <xsd:element name="ref" type="refTextType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="graphType"> + <xsd:sequence> + <xsd:element name="node" type="nodeType" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="nodeType"> + <xsd:sequence> + <xsd:element name="label" /> + <xsd:element name="link" type="linkType" minOccurs="0" /> + <xsd:element name="childnode" type="childnodeType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="childnodeType"> + <xsd:sequence> + <xsd:element name="edgelabel" minOccurs="0" maxOccurs="unbounded"/> + </xsd:sequence> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="relation" type="DoxGraphRelation" /> + </xsd:complexType> + + <xsd:complexType name="linkType"> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="external" type="xsd:string" use="optional"/> + </xsd:complexType> + + <xsd:complexType name="listingType"> + <xsd:sequence> + <xsd:element name="codeline" type="codelineType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="codelineType"> + <xsd:sequence> + <xsd:element name="highlight" type="highlightType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + <xsd:attribute name="lineno" type="xsd:integer" /> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="refkind" type="DoxRefKind" /> + <xsd:attribute name="external" type="DoxBool" /> + </xsd:complexType> + + <xsd:complexType name="highlightType" mixed="true"> + <xsd:choice minOccurs="0" maxOccurs="unbounded"> + <xsd:element name="sp" /> + <xsd:element name="ref" type="refTextType" /> + </xsd:choice> + <xsd:attribute name="class" type="DoxHighlightClass" /> + </xsd:complexType> + + <xsd:complexType name="referenceType" mixed="true"> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="compoundref" type="xsd:string" use="optional" /> + <xsd:attribute name="startline" type="xsd:integer" /> + <xsd:attribute name="endline" type="xsd:integer" /> + </xsd:complexType> + + <xsd:complexType name="locationType"> + <xsd:attribute name="file" type="xsd:string" /> + <xsd:attribute name="line" type="xsd:integer" /> + <xsd:attribute name="column" type="xsd:integer" use="optional"/> + <xsd:attribute name="bodyfile" type="xsd:string" /> + <xsd:attribute name="bodystart" type="xsd:integer" /> + <xsd:attribute name="bodyend" type="xsd:integer" /> + </xsd:complexType> + + <xsd:complexType name="docSect1Type" mixed="true"> + <xsd:sequence> + <xsd:element name="title" type="xsd:string" /> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect2" type="docSect2Type" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="internal" type="docInternalS1Type" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docSect2Type" mixed="true"> + <xsd:sequence> + <xsd:element name="title" type="xsd:string" /> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect3" type="docSect3Type" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="internal" type="docInternalS2Type" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docSect3Type" mixed="true"> + <xsd:sequence> + <xsd:element name="title" type="xsd:string" /> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect4" type="docSect4Type" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="internal" type="docInternalS3Type" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docSect4Type" mixed="true"> + <xsd:sequence> + <xsd:element name="title" type="xsd:string" /> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="internal" type="docInternalS4Type" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docInternalType" mixed="true"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect1" type="docSect1Type" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docInternalS1Type" mixed="true"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect2" type="docSect2Type" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docInternalS2Type" mixed="true"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect3" type="docSect3Type" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docInternalS3Type" mixed="true"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect3" type="docSect4Type" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docInternalS4Type" mixed="true"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:group name="docTitleCmdGroup"> + <xsd:choice> + <xsd:element name="ulink" type="docURLLink" /> + <xsd:element name="bold" type="docMarkupType" /> + <xsd:element name="emphasis" type="docMarkupType" /> + <xsd:element name="computeroutput" type="docMarkupType" /> + <xsd:element name="subscript" type="docMarkupType" /> + <xsd:element name="superscript" type="docMarkupType" /> + <xsd:element name="center" type="docMarkupType" /> + <xsd:element name="small" type="docMarkupType" /> + <xsd:element name="htmlonly" type="xsd:string" /> + <xsd:element name="manonly" type="xsd:string" /> + <xsd:element name="xmlonly" type="xsd:string" /> + <xsd:element name="rtfonly" type="xsd:string" /> + <xsd:element name="latexonly" type="xsd:string" /> + <xsd:element name="dot" type="xsd:string" /> + <xsd:element name="plantuml" type="xsd:string" /> + <xsd:element name="anchor" type="docAnchorType" /> + <xsd:element name="formula" type="docFormulaType" /> + <xsd:element name="ref" type="docRefTextType" /> + <xsd:element name="nonbreakablespace" type="docEmptyType" /> + <xsd:element name="iexcl" type="docEmptyType" /> + <xsd:element name="cent" type="docEmptyType" /> + <xsd:element name="pound" type="docEmptyType" /> + <xsd:element name="curren" type="docEmptyType" /> + <xsd:element name="yen" type="docEmptyType" /> + <xsd:element name="brvbar" type="docEmptyType" /> + <xsd:element name="sect" type="docEmptyType" /> + <xsd:element name="umlaut" type="docEmptyType" /> + <xsd:element name="copy" type="docEmptyType" /> + <xsd:element name="ordf" type="docEmptyType" /> + <xsd:element name="laquo" type="docEmptyType" /> + <xsd:element name="not" type="docEmptyType" /> + <xsd:element name="shy" type="docEmptyType" /> + <xsd:element name="registered" type="docEmptyType" /> + <xsd:element name="macr" type="docEmptyType" /> + <xsd:element name="deg" type="docEmptyType" /> + <xsd:element name="plusmn" type="docEmptyType" /> + <xsd:element name="sup2" type="docEmptyType" /> + <xsd:element name="sup3" type="docEmptyType" /> + <xsd:element name="acute" type="docEmptyType" /> + <xsd:element name="micro" type="docEmptyType" /> + <xsd:element name="para" type="docEmptyType" /> + <xsd:element name="middot" type="docEmptyType" /> + <xsd:element name="cedil" type="docEmptyType" /> + <xsd:element name="sup1" type="docEmptyType" /> + <xsd:element name="ordm" type="docEmptyType" /> + <xsd:element name="raquo" type="docEmptyType" /> + <xsd:element name="frac14" type="docEmptyType" /> + <xsd:element name="frac12" type="docEmptyType" /> + <xsd:element name="frac34" type="docEmptyType" /> + <xsd:element name="iquest" type="docEmptyType" /> + <xsd:element name="Agrave" type="docEmptyType" /> + <xsd:element name="Aacute" type="docEmptyType" /> + <xsd:element name="Acirc" type="docEmptyType" /> + <xsd:element name="Atilde" type="docEmptyType" /> + <xsd:element name="Aumlaut" type="docEmptyType" /> + <xsd:element name="Aring" type="docEmptyType" /> + <xsd:element name="AElig" type="docEmptyType" /> + <xsd:element name="Ccedil" type="docEmptyType" /> + <xsd:element name="Egrave" type="docEmptyType" /> + <xsd:element name="Eacute" type="docEmptyType" /> + <xsd:element name="Ecirc" type="docEmptyType" /> + <xsd:element name="Eumlaut" type="docEmptyType" /> + <xsd:element name="Igrave" type="docEmptyType" /> + <xsd:element name="Iacute" type="docEmptyType" /> + <xsd:element name="Icirc" type="docEmptyType" /> + <xsd:element name="Iumlaut" type="docEmptyType" /> + <xsd:element name="ETH" type="docEmptyType" /> + <xsd:element name="Ntilde" type="docEmptyType" /> + <xsd:element name="Ograve" type="docEmptyType" /> + <xsd:element name="Oacute" type="docEmptyType" /> + <xsd:element name="Ocirc" type="docEmptyType" /> + <xsd:element name="Otilde" type="docEmptyType" /> + <xsd:element name="Oumlaut" type="docEmptyType" /> + <xsd:element name="times" type="docEmptyType" /> + <xsd:element name="Oslash" type="docEmptyType" /> + <xsd:element name="Ugrave" type="docEmptyType" /> + <xsd:element name="Uacute" type="docEmptyType" /> + <xsd:element name="Ucirc" type="docEmptyType" /> + <xsd:element name="Uumlaut" type="docEmptyType" /> + <xsd:element name="Yacute" type="docEmptyType" /> + <xsd:element name="THORN" type="docEmptyType" /> + <xsd:element name="szlig" type="docEmptyType" /> + <xsd:element name="agrave" type="docEmptyType" /> + <xsd:element name="aacute" type="docEmptyType" /> + <xsd:element name="acirc" type="docEmptyType" /> + <xsd:element name="atilde" type="docEmptyType" /> + <xsd:element name="aumlaut" type="docEmptyType" /> + <xsd:element name="aring" type="docEmptyType" /> + <xsd:element name="aelig" type="docEmptyType" /> + <xsd:element name="ccedil" type="docEmptyType" /> + <xsd:element name="egrave" type="docEmptyType" /> + <xsd:element name="eacute" type="docEmptyType" /> + <xsd:element name="ecirc" type="docEmptyType" /> + <xsd:element name="eumlaut" type="docEmptyType" /> + <xsd:element name="igrave" type="docEmptyType" /> + <xsd:element name="iacute" type="docEmptyType" /> + <xsd:element name="icirc" type="docEmptyType" /> + <xsd:element name="iumlaut" type="docEmptyType" /> + <xsd:element name="eth" type="docEmptyType" /> + <xsd:element name="ntilde" type="docEmptyType" /> + <xsd:element name="ograve" type="docEmptyType" /> + <xsd:element name="oacute" type="docEmptyType" /> + <xsd:element name="ocirc" type="docEmptyType" /> + <xsd:element name="otilde" type="docEmptyType" /> + <xsd:element name="oumlaut" type="docEmptyType" /> + <xsd:element name="divide" type="docEmptyType" /> + <xsd:element name="oslash" type="docEmptyType" /> + <xsd:element name="ugrave" type="docEmptyType" /> + <xsd:element name="uacute" type="docEmptyType" /> + <xsd:element name="ucirc" type="docEmptyType" /> + <xsd:element name="uumlaut" type="docEmptyType" /> + <xsd:element name="yacute" type="docEmptyType" /> + <xsd:element name="thorn" type="docEmptyType" /> + <xsd:element name="yumlaut" type="docEmptyType" /> + <xsd:element name="fnof" type="docEmptyType" /> + <xsd:element name="Alpha" type="docEmptyType" /> + <xsd:element name="Beta" type="docEmptyType" /> + <xsd:element name="Gamma" type="docEmptyType" /> + <xsd:element name="Delta" type="docEmptyType" /> + <xsd:element name="Epsilon" type="docEmptyType" /> + <xsd:element name="Zeta" type="docEmptyType" /> + <xsd:element name="Eta" type="docEmptyType" /> + <xsd:element name="Theta" type="docEmptyType" /> + <xsd:element name="Iota" type="docEmptyType" /> + <xsd:element name="Kappa" type="docEmptyType" /> + <xsd:element name="Lambda" type="docEmptyType" /> + <xsd:element name="Mu" type="docEmptyType" /> + <xsd:element name="Nu" type="docEmptyType" /> + <xsd:element name="Xi" type="docEmptyType" /> + <xsd:element name="Omicron" type="docEmptyType" /> + <xsd:element name="Pi" type="docEmptyType" /> + <xsd:element name="Rho" type="docEmptyType" /> + <xsd:element name="Sigma" type="docEmptyType" /> + <xsd:element name="Tau" type="docEmptyType" /> + <xsd:element name="Upsilon" type="docEmptyType" /> + <xsd:element name="Phi" type="docEmptyType" /> + <xsd:element name="Chi" type="docEmptyType" /> + <xsd:element name="Psi" type="docEmptyType" /> + <xsd:element name="Omega" type="docEmptyType" /> + <xsd:element name="alpha" type="docEmptyType" /> + <xsd:element name="beta" type="docEmptyType" /> + <xsd:element name="gamma" type="docEmptyType" /> + <xsd:element name="delta" type="docEmptyType" /> + <xsd:element name="epsilon" type="docEmptyType" /> + <xsd:element name="zeta" type="docEmptyType" /> + <xsd:element name="eta" type="docEmptyType" /> + <xsd:element name="theta" type="docEmptyType" /> + <xsd:element name="iota" type="docEmptyType" /> + <xsd:element name="kappa" type="docEmptyType" /> + <xsd:element name="lambda" type="docEmptyType" /> + <xsd:element name="mu" type="docEmptyType" /> + <xsd:element name="nu" type="docEmptyType" /> + <xsd:element name="xi" type="docEmptyType" /> + <xsd:element name="omicron" type="docEmptyType" /> + <xsd:element name="pi" type="docEmptyType" /> + <xsd:element name="rho" type="docEmptyType" /> + <xsd:element name="sigmaf" type="docEmptyType" /> + <xsd:element name="sigma" type="docEmptyType" /> + <xsd:element name="tau" type="docEmptyType" /> + <xsd:element name="upsilon" type="docEmptyType" /> + <xsd:element name="phi" type="docEmptyType" /> + <xsd:element name="chi" type="docEmptyType" /> + <xsd:element name="psi" type="docEmptyType" /> + <xsd:element name="omega" type="docEmptyType" /> + <xsd:element name="thetasym" type="docEmptyType" /> + <xsd:element name="upsih" type="docEmptyType" /> + <xsd:element name="piv" type="docEmptyType" /> + <xsd:element name="bull" type="docEmptyType" /> + <xsd:element name="hellip" type="docEmptyType" /> + <xsd:element name="prime" type="docEmptyType" /> + <xsd:element name="Prime" type="docEmptyType" /> + <xsd:element name="oline" type="docEmptyType" /> + <xsd:element name="frasl" type="docEmptyType" /> + <xsd:element name="weierp" type="docEmptyType" /> + <xsd:element name="imaginary" type="docEmptyType" /> + <xsd:element name="real" type="docEmptyType" /> + <xsd:element name="trademark" type="docEmptyType" /> + <xsd:element name="alefsym" type="docEmptyType" /> + <xsd:element name="larr" type="docEmptyType" /> + <xsd:element name="uarr" type="docEmptyType" /> + <xsd:element name="rarr" type="docEmptyType" /> + <xsd:element name="darr" type="docEmptyType" /> + <xsd:element name="harr" type="docEmptyType" /> + <xsd:element name="crarr" type="docEmptyType" /> + <xsd:element name="lArr" type="docEmptyType" /> + <xsd:element name="uArr" type="docEmptyType" /> + <xsd:element name="rArr" type="docEmptyType" /> + <xsd:element name="dArr" type="docEmptyType" /> + <xsd:element name="hArr" type="docEmptyType" /> + <xsd:element name="forall" type="docEmptyType" /> + <xsd:element name="part" type="docEmptyType" /> + <xsd:element name="exist" type="docEmptyType" /> + <xsd:element name="empty" type="docEmptyType" /> + <xsd:element name="nabla" type="docEmptyType" /> + <xsd:element name="isin" type="docEmptyType" /> + <xsd:element name="notin" type="docEmptyType" /> + <xsd:element name="ni" type="docEmptyType" /> + <xsd:element name="prod" type="docEmptyType" /> + <xsd:element name="sum" type="docEmptyType" /> + <xsd:element name="minus" type="docEmptyType" /> + <xsd:element name="lowast" type="docEmptyType" /> + <xsd:element name="radic" type="docEmptyType" /> + <xsd:element name="prop" type="docEmptyType" /> + <xsd:element name="infin" type="docEmptyType" /> + <xsd:element name="ang" type="docEmptyType" /> + <xsd:element name="and" type="docEmptyType" /> + <xsd:element name="or" type="docEmptyType" /> + <xsd:element name="cap" type="docEmptyType" /> + <xsd:element name="cup" type="docEmptyType" /> + <xsd:element name="int" type="docEmptyType" /> + <xsd:element name="there4" type="docEmptyType" /> + <xsd:element name="sim" type="docEmptyType" /> + <xsd:element name="cong" type="docEmptyType" /> + <xsd:element name="asymp" type="docEmptyType" /> + <xsd:element name="ne" type="docEmptyType" /> + <xsd:element name="equiv" type="docEmptyType" /> + <xsd:element name="le" type="docEmptyType" /> + <xsd:element name="ge" type="docEmptyType" /> + <xsd:element name="sub" type="docEmptyType" /> + <xsd:element name="sup" type="docEmptyType" /> + <xsd:element name="nsub" type="docEmptyType" /> + <xsd:element name="sube" type="docEmptyType" /> + <xsd:element name="supe" type="docEmptyType" /> + <xsd:element name="oplus" type="docEmptyType" /> + <xsd:element name="otimes" type="docEmptyType" /> + <xsd:element name="perp" type="docEmptyType" /> + <xsd:element name="sdot" type="docEmptyType" /> + <xsd:element name="lceil" type="docEmptyType" /> + <xsd:element name="rceil" type="docEmptyType" /> + <xsd:element name="lfloor" type="docEmptyType" /> + <xsd:element name="rfloor" type="docEmptyType" /> + <xsd:element name="lang" type="docEmptyType" /> + <xsd:element name="rang" type="docEmptyType" /> + <xsd:element name="loz" type="docEmptyType" /> + <xsd:element name="spades" type="docEmptyType" /> + <xsd:element name="clubs" type="docEmptyType" /> + <xsd:element name="hearts" type="docEmptyType" /> + <xsd:element name="diams" type="docEmptyType" /> + <xsd:element name="OElig" type="docEmptyType" /> + <xsd:element name="oelig" type="docEmptyType" /> + <xsd:element name="Scaron" type="docEmptyType" /> + <xsd:element name="scaron" type="docEmptyType" /> + <xsd:element name="Yumlaut" type="docEmptyType" /> + <xsd:element name="circ" type="docEmptyType" /> + <xsd:element name="tilde" type="docEmptyType" /> + <xsd:element name="ensp" type="docEmptyType" /> + <xsd:element name="emsp" type="docEmptyType" /> + <xsd:element name="thinsp" type="docEmptyType" /> + <xsd:element name="zwnj" type="docEmptyType" /> + <xsd:element name="zwj" type="docEmptyType" /> + <xsd:element name="lrm" type="docEmptyType" /> + <xsd:element name="rlm" type="docEmptyType" /> + <xsd:element name="ndash" type="docEmptyType" /> + <xsd:element name="mdash" type="docEmptyType" /> + <xsd:element name="lsquo" type="docEmptyType" /> + <xsd:element name="rsquo" type="docEmptyType" /> + <xsd:element name="sbquo" type="docEmptyType" /> + <xsd:element name="ldquo" type="docEmptyType" /> + <xsd:element name="rdquo" type="docEmptyType" /> + <xsd:element name="bdquo" type="docEmptyType" /> + <xsd:element name="dagger" type="docEmptyType" /> + <xsd:element name="Dagger" type="docEmptyType" /> + <xsd:element name="permil" type="docEmptyType" /> + <xsd:element name="lsaquo" type="docEmptyType" /> + <xsd:element name="rsaquo" type="docEmptyType" /> + <xsd:element name="euro" type="docEmptyType" /> + <xsd:element name="tm" type="docEmptyType" /> + </xsd:choice> + </xsd:group> + + <xsd:complexType name="docTitleType" mixed="true"> + <xsd:group ref="docTitleCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + </xsd:complexType> + + <xsd:group name="docCmdGroup"> + <xsd:choice> + <xsd:group ref="docTitleCmdGroup"/> + <xsd:element name="linebreak" type="docEmptyType" /> + <xsd:element name="hruler" type="docEmptyType" /> + <xsd:element name="preformatted" type="docMarkupType" /> + <xsd:element name="programlisting" type="listingType" /> + <xsd:element name="verbatim" type="xsd:string" /> + <xsd:element name="indexentry" type="docIndexEntryType" /> + <xsd:element name="orderedlist" type="docListType" /> + <xsd:element name="itemizedlist" type="docListType" /> + <xsd:element name="simplesect" type="docSimpleSectType" /> + <xsd:element name="title" type="docTitleType" /> + <xsd:element name="variablelist" type="docVariableListType" /> + <xsd:element name="table" type="docTableType" /> + <xsd:element name="heading" type="docHeadingType" /> + <xsd:element name="image" type="docImageType" /> + <xsd:element name="dotfile" type="docFileType" /> + <xsd:element name="mscfile" type="docFileType" /> + <xsd:element name="diafile" type="docFileType" /> + <xsd:element name="toclist" type="docTocListType" /> + <xsd:element name="language" type="docLanguageType" /> + <xsd:element name="parameterlist" type="docParamListType" /> + <xsd:element name="xrefsect" type="docXRefSectType" /> + <xsd:element name="copydoc" type="docCopyType" /> + <xsd:element name="blockquote" type="docBlockQuoteType" /> + <xsd:element name="parblock" type="docParBlockType" /> + </xsd:choice> + </xsd:group> + + <xsd:complexType name="docParaType" mixed="true"> + <xsd:group ref="docCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + </xsd:complexType> + + <xsd:complexType name="docMarkupType" mixed="true"> + <xsd:group ref="docCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + </xsd:complexType> + + <xsd:complexType name="docURLLink" mixed="true"> + <xsd:group ref="docTitleCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + <xsd:attribute name="url" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docAnchorType" mixed="true"> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docFormulaType" mixed="true"> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docIndexEntryType"> + <xsd:sequence> + <xsd:element name="primaryie" type="xsd:string" /> + <xsd:element name="secondaryie" type="xsd:string" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docListType"> + <xsd:sequence> + <xsd:element name="listitem" type="docListItemType" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docListItemType"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docSimpleSectType"> + <xsd:sequence> + <xsd:element name="title" type="docTitleType" minOccurs="0" /> + <xsd:sequence minOccurs="0" maxOccurs="unbounded"> + <xsd:element name="para" type="docParaType" minOccurs="1" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:sequence> + <xsd:attribute name="kind" type="DoxSimpleSectKind" /> + </xsd:complexType> + + <xsd:complexType name="docVarListEntryType"> + <xsd:sequence> + <xsd:element name="term" type="docTitleType" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:group name="docVariableListGroup"> + <xsd:sequence> + <xsd:element name="varlistentry" type="docVarListEntryType" /> + <xsd:element name="listitem" type="docListItemType" /> + </xsd:sequence> + </xsd:group> + + <xsd:complexType name="docVariableListType"> + <xsd:sequence> + <xsd:group ref="docVariableListGroup" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docRefTextType" mixed="true"> + <xsd:group ref="docTitleCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + <xsd:attribute name="refid" type="xsd:string" /> + <xsd:attribute name="kindref" type="DoxRefKind" /> + <xsd:attribute name="external" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docTableType"> + <xsd:sequence> + <xsd:element name="row" type="docRowType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="caption" type="docCaptionType" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="rows" type="xsd:integer" /> + <xsd:attribute name="cols" type="xsd:integer" /> + </xsd:complexType> + + <xsd:complexType name="docRowType"> + <xsd:sequence> + <xsd:element name="entry" type="docEntryType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docEntryType"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + <xsd:attribute name="thead" type="DoxBool" /> + </xsd:complexType> + + <xsd:complexType name="docCaptionType" mixed="true"> + <xsd:group ref="docTitleCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + </xsd:complexType> + + <xsd:complexType name="docHeadingType" mixed="true"> + <xsd:group ref="docTitleCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + <xsd:attribute name="level" type="xsd:integer" /> <!-- todo: range 1-6 --> + </xsd:complexType> + + <xsd:complexType name="docImageType" mixed="true"> + <xsd:group ref="docTitleCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + <xsd:attribute name="type" type="DoxImageKind" /> + <xsd:attribute name="name" type="xsd:string" /> + <xsd:attribute name="width" type="xsd:string" /> + <xsd:attribute name="height" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docFileType" mixed="true"> + <xsd:group ref="docTitleCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + <xsd:attribute name="name" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docTocItemType" mixed="true"> + <xsd:group ref="docTitleCmdGroup" minOccurs="0" maxOccurs="unbounded" /> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docTocListType"> + <xsd:sequence> + <xsd:element name="tocitem" type="docTocItemType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docLanguageType"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + <xsd:attribute name="langid" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docParamListType"> + <xsd:sequence> + <xsd:element name="parameteritem" type="docParamListItem" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + <xsd:attribute name="kind" type="DoxParamListKind" /> + </xsd:complexType> + + <xsd:complexType name="docParamListItem"> + <xsd:sequence> + <xsd:element name="parameternamelist" type="docParamNameList" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="parameterdescription" type="descriptionType" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docParamNameList"> + <xsd:sequence> + <xsd:element name="parametertype" type="docParamType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="parametername" type="docParamName" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docParamType" mixed="true"> + <xsd:sequence> + <xsd:element name="ref" type="refTextType" minOccurs="0" maxOccurs="1" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docParamName" mixed="true"> + <xsd:sequence> + <xsd:element name="ref" type="refTextType" minOccurs="0" maxOccurs="1" /> + </xsd:sequence> + <xsd:attribute name="direction" type="DoxParamDir" use="optional" /> + </xsd:complexType> + + <xsd:complexType name="docXRefSectType"> + <xsd:sequence> + <xsd:element name="xreftitle" type="xsd:string" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="xrefdescription" type="descriptionType" /> + </xsd:sequence> + <xsd:attribute name="id" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docCopyType"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="sect1" type="docSect1Type" minOccurs="0" maxOccurs="unbounded" /> + <xsd:element name="internal" type="docInternalType" minOccurs="0" /> + </xsd:sequence> + <xsd:attribute name="link" type="xsd:string" /> + </xsd:complexType> + + <xsd:complexType name="docBlockQuoteType"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docParBlockType"> + <xsd:sequence> + <xsd:element name="para" type="docParaType" minOccurs="0" maxOccurs="unbounded" /> + </xsd:sequence> + </xsd:complexType> + + <xsd:complexType name="docEmptyType"/> + + <!-- Simple types --> + + <xsd:simpleType name="DoxBool"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="yes" /> + <xsd:enumeration value="no" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxGraphRelation"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="include" /> + <xsd:enumeration value="usage" /> + <xsd:enumeration value="template-instance" /> + <xsd:enumeration value="public-inheritance" /> + <xsd:enumeration value="protected-inheritance" /> + <xsd:enumeration value="private-inheritance" /> + <xsd:enumeration value="type-constraint" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxRefKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="compound" /> + <xsd:enumeration value="member" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxMemberKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="define" /> + <xsd:enumeration value="property" /> + <xsd:enumeration value="event" /> + <xsd:enumeration value="variable" /> + <xsd:enumeration value="typedef" /> + <xsd:enumeration value="enum" /> + <xsd:enumeration value="function" /> + <xsd:enumeration value="signal" /> + <xsd:enumeration value="prototype" /> + <xsd:enumeration value="friend" /> + <xsd:enumeration value="dcop" /> + <xsd:enumeration value="slot" /> + <xsd:enumeration value="interface" /> + <xsd:enumeration value="service" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxProtectionKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="public" /> + <xsd:enumeration value="protected" /> + <xsd:enumeration value="private" /> + <xsd:enumeration value="package" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxRefQualifierKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="lvalue" /> + <xsd:enumeration value="rvalue" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxLanguage"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="Unknown" /> + <xsd:enumeration value="IDL" /> + <xsd:enumeration value="Java" /> + <xsd:enumeration value="C#" /> + <xsd:enumeration value="D" /> + <xsd:enumeration value="PHP" /> + <xsd:enumeration value="Objective-C" /> + <xsd:enumeration value="C++" /> + <xsd:enumeration value="Javascript" /> + <xsd:enumeration value="Python" /> + <xsd:enumeration value="Fortran" /> + <xsd:enumeration value="VHDL" /> + <xsd:enumeration value="XML" /> + <xsd:enumeration value="SQL" /> + <xsd:enumeration value="Tcl" /> + <xsd:enumeration value="Markdown" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxVirtualKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="non-virtual" /> + <xsd:enumeration value="virtual" /> + <xsd:enumeration value="pure-virtual" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxCompoundKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="class" /> + <xsd:enumeration value="struct" /> + <xsd:enumeration value="union" /> + <xsd:enumeration value="interface" /> + <xsd:enumeration value="protocol" /> + <xsd:enumeration value="category" /> + <xsd:enumeration value="exception" /> + <xsd:enumeration value="service" /> + <xsd:enumeration value="singleton" /> + <xsd:enumeration value="module" /> + <xsd:enumeration value="type" /> + <xsd:enumeration value="file" /> + <xsd:enumeration value="namespace" /> + <xsd:enumeration value="group" /> + <xsd:enumeration value="page" /> + <xsd:enumeration value="example" /> + <xsd:enumeration value="dir" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxSectionKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="user-defined" /> + <xsd:enumeration value="public-type" /> + <xsd:enumeration value="public-func" /> + <xsd:enumeration value="public-attrib" /> + <xsd:enumeration value="public-slot" /> + <xsd:enumeration value="signal" /> + <xsd:enumeration value="dcop-func" /> + <xsd:enumeration value="property" /> + <xsd:enumeration value="event" /> + <xsd:enumeration value="public-static-func" /> + <xsd:enumeration value="public-static-attrib" /> + <xsd:enumeration value="protected-type" /> + <xsd:enumeration value="protected-func" /> + <xsd:enumeration value="protected-attrib" /> + <xsd:enumeration value="protected-slot" /> + <xsd:enumeration value="protected-static-func" /> + <xsd:enumeration value="protected-static-attrib" /> + <xsd:enumeration value="package-type" /> + <xsd:enumeration value="package-func" /> + <xsd:enumeration value="package-attrib" /> + <xsd:enumeration value="package-static-func" /> + <xsd:enumeration value="package-static-attrib" /> + <xsd:enumeration value="private-type" /> + <xsd:enumeration value="private-func" /> + <xsd:enumeration value="private-attrib" /> + <xsd:enumeration value="private-slot" /> + <xsd:enumeration value="private-static-func" /> + <xsd:enumeration value="private-static-attrib" /> + <xsd:enumeration value="friend" /> + <xsd:enumeration value="related" /> + <xsd:enumeration value="define" /> + <xsd:enumeration value="prototype" /> + <xsd:enumeration value="typedef" /> + <xsd:enumeration value="enum" /> + <xsd:enumeration value="func" /> + <xsd:enumeration value="var" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxHighlightClass"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="comment" /> + <xsd:enumeration value="normal" /> + <xsd:enumeration value="preprocessor" /> + <xsd:enumeration value="keyword" /> + <xsd:enumeration value="keywordtype" /> + <xsd:enumeration value="keywordflow" /> + <xsd:enumeration value="stringliteral" /> + <xsd:enumeration value="charliteral" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxSimpleSectKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="see" /> + <xsd:enumeration value="return" /> + <xsd:enumeration value="author" /> + <xsd:enumeration value="authors" /> + <xsd:enumeration value="version" /> + <xsd:enumeration value="since" /> + <xsd:enumeration value="date" /> + <xsd:enumeration value="note" /> + <xsd:enumeration value="warning" /> + <xsd:enumeration value="pre" /> + <xsd:enumeration value="post" /> + <xsd:enumeration value="copyright" /> + <xsd:enumeration value="invariant" /> + <xsd:enumeration value="remark" /> + <xsd:enumeration value="attention" /> + <xsd:enumeration value="par" /> + <xsd:enumeration value="rcs" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxVersionNumber"> + <xsd:restriction base="xsd:string"> + <xsd:pattern value="\d+\.\d+.*" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxImageKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="html" /> + <xsd:enumeration value="latex" /> + <xsd:enumeration value="rtf" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxParamListKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="param" /> + <xsd:enumeration value="retval" /> + <xsd:enumeration value="exception" /> + <xsd:enumeration value="templateparam" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxCharRange"> + <xsd:restriction base="xsd:string"> + <xsd:pattern value="[aeiouncAEIOUNC]" /> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxParamDir"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="in"/> + <xsd:enumeration value="out"/> + <xsd:enumeration value="inout"/> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="DoxAccessor"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="retain"/> + <xsd:enumeration value="copy"/> + <xsd:enumeration value="assign"/> + <xsd:enumeration value="weak"/> + <xsd:enumeration value="strong"/> + <xsd:enumeration value="unretained"/> + </xsd:restriction> + </xsd:simpleType> + +</xsd:schema> + diff --git a/docs/Doxygen/xml/ding_8h.xml b/docs/Doxygen/xml/ding_8h.xml new file mode 100644 index 0000000000000000000000000000000000000000..b8313645f1ad64186976f61a2d0715bdef4ab97d --- /dev/null +++ b/docs/Doxygen/xml/ding_8h.xml @@ -0,0 +1,251 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="ding_8h" kind="file" language="C++"> + <compoundname>ding.h</compoundname> + <includes local="no">systemheader1.h</includes> + <includes local="no">systemheader2.h</includes> + <includes local="no">box/header1.h</includes> + <includes local="no">box/header2.h</includes> + <includes local="yes">local_header1.h</includes> + <includes local="yes">local_header2.h</includes> + <incdepgraph> + <node id="34"> + <label>local_header1.h</label> + </node> + <node id="31"> + <label>systemheader2.h</label> + </node> + <node id="33"> + <label>box/header2.h</label> + </node> + <node id="30"> + <label>systemheader1.h</label> + </node> + <node id="29"> + <label>testing_doxygen/ding.h</label> + <link refid="ding_8h"/> + <childnode refid="30" relation="include"> + </childnode> + <childnode refid="31" relation="include"> + </childnode> + <childnode refid="32" relation="include"> + </childnode> + <childnode refid="33" relation="include"> + </childnode> + <childnode refid="34" relation="include"> + </childnode> + <childnode refid="35" relation="include"> + </childnode> + </node> + <node id="35"> + <label>local_header2.h</label> + </node> + <node id="32"> + <label>box/header1.h</label> + </node> + </incdepgraph> + <innerclass refid="structBoxStruct__struct" prot="public">BoxStruct_struct</innerclass> + <sectiondef kind="enum"> + <memberdef kind="enum" id="ding_8h_1abdf4994e8e07b3eda6c6a5a9bf5357e4" prot="public" static="no"> + <name>BoxEnum_enum</name> + <enumvalue id="ding_8h_1abdf4994e8e07b3eda6c6a5a9bf5357e4a2bf0bdd7b9b287724c66f6c0f74ceb01" prot="public"> + <name>BOXENUM_FIRST</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>Some documentation for first. </para> </detaileddescription> + </enumvalue> + <enumvalue id="ding_8h_1abdf4994e8e07b3eda6c6a5a9bf5357e4a3ede3b6dfb2dbdac72634f0334e11c63" prot="public"> + <name>BOXENUM_SECOND</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>Some documentation for second. </para> </detaileddescription> + </enumvalue> + <enumvalue id="ding_8h_1abdf4994e8e07b3eda6c6a5a9bf5357e4a227130e825c6c4506cc4a226539d85fb" prot="public"> + <name>BOXENUM_ETC</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>Etc. </para> </detaileddescription> + </enumvalue> + <briefdescription> +<para>Use brief, otherwise the index won't have a brief explanation. </para> </briefdescription> + <detaileddescription> +<para>Detailed explanation. </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="50" column="1" bodyfile="testing_doxygen/ding.h" bodystart="50" bodyend="54"/> + </memberdef> + </sectiondef> + <sectiondef kind="typedef"> + <memberdef kind="typedef" id="ding_8h_1a354be0627e025b594a719a4c3f92a69f" prot="public" static="no"> + <type>enum BoxEnum_enum</type> + <definition>typedef enum BoxEnum_enum BoxEnum</definition> + <argsstring></argsstring> + <name>BoxEnum</name> + <briefdescription> +<para>Use brief, otherwise the index won't have a brief explanation. </para> </briefdescription> + <detaileddescription> +<para>Detailed explanation. </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="54" column="1"/> + </memberdef> + <memberdef kind="typedef" id="ding_8h_1a718548848862b3d5da8f7c7cea677de1" prot="public" static="no"> + <type>struct <ref refid="structBoxStruct__struct" kindref="compound">BoxStruct_struct</ref></type> + <definition>typedef struct BoxStruct_struct BoxStruct</definition> + <argsstring></argsstring> + <name>BoxStruct</name> + <briefdescription> +<para>Use brief, otherwise the index won't have a brief explanation. </para> </briefdescription> + <detaileddescription> +<para>Detailed explanation. </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="65" column="1"/> + </memberdef> + </sectiondef> + <sectiondef kind="func"> + <memberdef kind="function" id="ding_8h_1aaddf8ced9406a68229baee8c1e922b6a" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>BOXEXPORT <ref refid="structBoxStruct__struct" kindref="compound">BoxStruct</ref> *</type> + <definition>BOXEXPORT BoxStruct* Box_The_Function_Name</definition> + <argsstring>(BoxParamType1 param1, BoxParamType2 param2)</argsstring> + <name>Box_The_Function_Name</name> + <param> + <type>BoxParamType1</type> + <declname>param1</declname> + </param> + <param> + <type>BoxParamType2</type> + <declname>param2</declname> + </param> + <briefdescription> +<para>Example showing how to document a function with Doxygen. </para> </briefdescription> + <detaileddescription> +<para>Description of what the function does. This part may refer to the parameters of the function, like <computeroutput>param1</computeroutput> or <computeroutput>param2</computeroutput>. A word of code can also be inserted like <computeroutput>this</computeroutput> which is equivalent to <computeroutput>this</computeroutput> and can be useful to say that the function returns a <computeroutput>void</computeroutput> or an <computeroutput>int</computeroutput>. If you want to have more than one word in typewriter font, then just use <tt>. We can also include text verbatim, <verbatim>like this</verbatim> Sometimes it is also convenient to include an example of usage: <programlisting><codeline><highlight class="normal">BoxStruct<sp/>*out<sp/>=<sp/>Box_The_Function_Name(param1,<sp/>param2);</highlight></codeline> +<codeline><highlight class="normal">printf("something...\n");</highlight></codeline> +</programlisting> Or, <programlisting><codeline><highlight class="normal">pyval<sp/>=<sp/>python_func(arg1,<sp/>arg2)</highlight></codeline> +<codeline><highlight class="normal"></highlight><highlight class="keywordflow">print</highlight><highlight class="normal"><sp/>pyval</highlight></codeline> +</programlisting> when the language is not the one used in the current source file (but <bold>be careful</bold> as this may be supported only by recent versions of Doxygen). By the way, <bold>this is how you write bold text</bold> or, if it is just one word, then you can just do <bold>this</bold>. <parameterlist kind="param"><parameteritem> +<parameternamelist> +<parametername>param1</parametername> +</parameternamelist> +<parameterdescription> +<para>Description of the first parameter of the function. </para></parameterdescription> +</parameteritem> +<parameteritem> +<parameternamelist> +<parametername>param2</parametername> +</parameternamelist> +<parameterdescription> +<para>The second one, which follows <computeroutput>param1</computeroutput>. </para></parameterdescription> +</parameteritem> +</parameterlist> +<simplesect kind="return"><para>Describe what the function returns. </para></simplesect> +<simplesect kind="see"><para>Box_The_Second_Function </para></simplesect> +<simplesect kind="see"><para>Box_The_Last_One </para></simplesect> +<simplesect kind="see"><para><ulink url="http://website/">http://website/</ulink> </para></simplesect> +<simplesect kind="note"><para>Something to note. </para></simplesect> +<simplesect kind="warning"><para>Warning. </para></simplesect> +</para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="101" column="1"/> + </memberdef> + <memberdef kind="function" id="ding_8h_1a7ec4699a4197d74b5487929228b0597c" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>BOXEXPORT void *</type> + <definition>BOXEXPORT void* Box_The_Second_Function</definition> + <argsstring>(void)</argsstring> + <name>Box_The_Second_Function</name> + <param> + <type>void</type> + </param> + <briefdescription> +<para>A simple stub function to show how links do work. </para> </briefdescription> + <detaileddescription> +<para>Links are generated automatically for webpages (like <ulink url="http://www.google.co.uk">http://www.google.co.uk</ulink>) and for structures, like <ref refid="structBoxStruct__struct" kindref="compound">BoxStruct_struct</ref>. For typedef-ed types use #BoxStruct. For functions, automatic links are generated when the parenthesis () follow the name of the function, like Box_The_Function_Name(). Alternatively, you can use #Box_The_Function_Name. <simplesect kind="return"><para><computeroutput>NULL</computeroutput> is always returned. </para></simplesect> +</para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="115" column="1"/> + </memberdef> + <memberdef kind="function" id="ding_8h_1a01d1bdf75bc1d4b6445faeafa8fd853d" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>BOXEXPORT void</type> + <definition>BOXEXPORT void Box_The_Last_One</definition> + <argsstring>(void)</argsstring> + <name>Box_The_Last_One</name> + <param> + <type>void</type> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>Brief can be omitted. If you configure Doxygen with <computeroutput>JAVADOC_AUTOBRIEF=YES</computeroutput>, then the first Line of the comment is used instead. In this function this would be as if <verbatim>@brief Brief can be omitted. </verbatim> was used instead. </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="125" column="1"/> + </memberdef> + </sectiondef> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> +<codeline lineno="1"><highlight class="comment">/****************************************************************************</highlight></codeline> +<codeline lineno="2"><highlight class="comment"><sp/>*<sp/>Copyright<sp/>(C)<sp/>2012<sp/>by<sp/>Matteo<sp/>Franchin<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="3"><highlight class="comment"><sp/>*<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="4"><highlight class="comment"><sp/>*<sp/>This<sp/>file<sp/>is<sp/>part<sp/>of<sp/>Box.<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="5"><highlight class="comment"><sp/>*<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="6"><highlight class="comment"><sp/>*<sp/><sp/><sp/>Box<sp/>is<sp/>free<sp/>software:<sp/>you<sp/>can<sp/>redistribute<sp/>it<sp/>and/or<sp/>modify<sp/>it<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="7"><highlight class="comment"><sp/>*<sp/><sp/><sp/>under<sp/>the<sp/>terms<sp/>of<sp/>the<sp/>GNU<sp/>Lesser<sp/>General<sp/>Public<sp/>License<sp/>as<sp/>published<sp/><sp/>*</highlight></codeline> +<codeline lineno="8"><highlight class="comment"><sp/>*<sp/><sp/><sp/>by<sp/>the<sp/>Free<sp/>Software<sp/>Foundation,<sp/>either<sp/>version<sp/>3<sp/>of<sp/>the<sp/>License,<sp/>or<sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="9"><highlight class="comment"><sp/>*<sp/><sp/><sp/>(at<sp/>your<sp/>option)<sp/>any<sp/>later<sp/>version.<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="10"><highlight class="comment"><sp/>*<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="11"><highlight class="comment"><sp/>*<sp/><sp/><sp/>Box<sp/>is<sp/>distributed<sp/>in<sp/>the<sp/>hope<sp/>that<sp/>it<sp/>will<sp/>be<sp/>useful,<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="12"><highlight class="comment"><sp/>*<sp/><sp/><sp/>but<sp/>WITHOUT<sp/>ANY<sp/>WARRANTY;<sp/>without<sp/>even<sp/>the<sp/>implied<sp/>warranty<sp/>of<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="13"><highlight class="comment"><sp/>*<sp/><sp/><sp/>MERCHANTABILITY<sp/>or<sp/>FITNESS<sp/>FOR<sp/>A<sp/>PARTICULAR<sp/>PURPOSE.<sp/><sp/>See<sp/>the<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="14"><highlight class="comment"><sp/>*<sp/><sp/><sp/>GNU<sp/>Lesser<sp/>General<sp/>Public<sp/>License<sp/>for<sp/>more<sp/>details.<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="15"><highlight class="comment"><sp/>*<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="16"><highlight class="comment"><sp/>*<sp/><sp/><sp/>You<sp/>should<sp/>have<sp/>received<sp/>a<sp/>copy<sp/>of<sp/>the<sp/>GNU<sp/>Lesser<sp/>General<sp/>Public<sp/><sp/><sp/><sp/><sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="17"><highlight class="comment"><sp/>*<sp/><sp/><sp/>License<sp/>along<sp/>with<sp/>Box.<sp/><sp/>If<sp/>not,<sp/>see<sp/><http://www.gnu.org/licenses/>.<sp/><sp/><sp/>*</highlight></codeline> +<codeline lineno="18"><highlight class="comment"><sp/>****************************************************************************/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="19"><highlight class="normal"></highlight></codeline> +<codeline lineno="33"><highlight class="preprocessor">#ifndef<sp/>_BOX_PROTOTYPES_DOXYGEN_H</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="34"><highlight class="normal"></highlight><highlight class="preprocessor">#<sp/><sp/>define<sp/>_BOX_PROTOTYPES_DOXYGEN_H</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="35"><highlight class="normal"></highlight></codeline> +<codeline lineno="36"><highlight class="normal"></highlight><highlight class="preprocessor">#<sp/><sp/>include<sp/><systemheader1.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="37"><highlight class="normal"></highlight><highlight class="preprocessor">#<sp/><sp/>include<sp/><systemheader2.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="38"><highlight class="normal"></highlight></codeline> +<codeline lineno="39"><highlight class="normal"></highlight><highlight class="preprocessor">#<sp/><sp/>include<sp/><box/header1.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="40"><highlight class="normal"></highlight><highlight class="preprocessor">#<sp/><sp/>include<sp/><box/header2.h></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="41"><highlight class="normal"></highlight></codeline> +<codeline lineno="42"><highlight class="normal"></highlight><highlight class="preprocessor">#<sp/><sp/>include<sp/>"local_header1.h"</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="43"><highlight class="normal"></highlight><highlight class="preprocessor">#<sp/><sp/>include<sp/>"local_header2.h"</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="44"><highlight class="normal"></highlight></codeline> +<codeline lineno="50"><highlight class="keyword">typedef</highlight><highlight class="normal"><sp/></highlight><highlight class="keyword">enum</highlight><highlight class="normal"><sp/>BoxEnum_enum<sp/>{</highlight></codeline> +<codeline lineno="51"><highlight class="normal"><sp/><sp/>BOXENUM_FIRST,<sp/><sp/></highlight></codeline> +<codeline lineno="52"><highlight class="normal"><sp/><sp/>BOXENUM_SECOND,<sp/></highlight></codeline> +<codeline lineno="53"><highlight class="normal"><sp/><sp/>BOXENUM_ETC<sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="54"><highlight class="normal">}<sp/>BoxEnum;</highlight></codeline> +<codeline lineno="55"><highlight class="normal"></highlight></codeline> +<codeline lineno="61" refid="structBoxStruct__struct" refkind="compound"><highlight class="keyword">typedef</highlight><highlight class="normal"><sp/></highlight><highlight class="keyword">struct<sp/></highlight><highlight class="normal"><ref refid="structBoxStruct__struct" kindref="compound">BoxStruct_struct</ref><sp/>{</highlight></codeline> +<codeline lineno="62" refid="structBoxStruct__struct_1a4593938c5e90f024e7971bdb1392d9d6" refkind="member"><highlight class="normal"><sp/><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/><ref refid="structBoxStruct__struct_1a4593938c5e90f024e7971bdb1392d9d6" kindref="member">a</ref>;<sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="63" refid="structBoxStruct__struct_1aee44748dc579c5d794853ee8b133d197" refkind="member"><highlight class="normal"><sp/><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/><ref refid="structBoxStruct__struct_1aee44748dc579c5d794853ee8b133d197" kindref="member">b</ref>;<sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="64" refid="structBoxStruct__struct_1a4543370ed67b2cf5ae3f55201bea11e6" refkind="member"><highlight class="normal"><sp/><sp/></highlight><highlight class="keywordtype">double</highlight><highlight class="normal"><sp/><ref refid="structBoxStruct__struct_1a4543370ed67b2cf5ae3f55201bea11e6" kindref="member">c</ref>;<sp/></highlight></codeline> +<codeline lineno="65"><highlight class="normal">}<sp/><ref refid="structBoxStruct__struct" kindref="compound">BoxStruct</ref>;</highlight></codeline> +<codeline lineno="66"><highlight class="normal"></highlight></codeline> +<codeline lineno="100"><highlight class="normal">BOXEXPORT<sp/><ref refid="structBoxStruct__struct" kindref="compound">BoxStruct</ref><sp/>*</highlight></codeline> +<codeline lineno="101"><highlight class="normal">Box_The_Function_Name(BoxParamType1<sp/>param1,<sp/>BoxParamType2<sp/>param2<sp/></highlight><highlight class="comment">/*,<sp/>...*/</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="102"><highlight class="normal"></highlight></codeline> +<codeline lineno="114"><highlight class="normal">BOXEXPORT<sp/></highlight><highlight class="keywordtype">void</highlight><highlight class="normal"><sp/>*</highlight></codeline> +<codeline lineno="115"><highlight class="normal">Box_The_Second_Function(</highlight><highlight class="keywordtype">void</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="116"><highlight class="normal"></highlight></codeline> +<codeline lineno="124"><highlight class="normal">BOXEXPORT<sp/></highlight><highlight class="keywordtype">void</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="125"><highlight class="normal">Box_The_Last_One(</highlight><highlight class="keywordtype">void</highlight><highlight class="normal">);</highlight></codeline> +<codeline lineno="126"><highlight class="normal"></highlight></codeline> +<codeline lineno="127"><highlight class="normal"></highlight><highlight class="preprocessor">#endif<sp/></highlight><highlight class="comment">/*<sp/>_BOX_PROTOTYPES_DOXYGEN_H<sp/>*/</highlight><highlight class="preprocessor"></highlight></codeline> + </programlisting> + <location file="testing_doxygen/ding.h"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/dir_eedb883b3a90ccdfffd3f135939cac7c.xml b/docs/Doxygen/xml/dir_eedb883b3a90ccdfffd3f135939cac7c.xml new file mode 100644 index 0000000000000000000000000000000000000000..14829293bd9ae77e028948443df303d53430a8ff --- /dev/null +++ b/docs/Doxygen/xml/dir_eedb883b3a90ccdfffd3f135939cac7c.xml @@ -0,0 +1,13 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="dir_eedb883b3a90ccdfffd3f135939cac7c" kind="dir"> + <compoundname>testing_doxygen</compoundname> + <innerfile refid="ding_8h">ding.h</innerfile> + <innerfile refid="test_8h">test.h</innerfile> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <location file="testing_doxygen/"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/index.xml b/docs/Doxygen/xml/index.xml new file mode 100644 index 0000000000000000000000000000000000000000..b5bdcdcc2efd2171493eee2e7faaf46e68950ada --- /dev/null +++ b/docs/Doxygen/xml/index.xml @@ -0,0 +1,106 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygenindex xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="index.xsd" version="1.8.13"> + <compound refid="structBoxStruct__struct" kind="struct"><name>BoxStruct_struct</name> + <member refid="structBoxStruct__struct_1a4593938c5e90f024e7971bdb1392d9d6" kind="variable"><name>a</name></member> + <member refid="structBoxStruct__struct_1aee44748dc579c5d794853ee8b133d197" kind="variable"><name>b</name></member> + <member refid="structBoxStruct__struct_1a4543370ed67b2cf5ae3f55201bea11e6" kind="variable"><name>c</name></member> + </compound> + <compound refid="structpoint3d" kind="struct"><name>point3d</name> + <member refid="structpoint3d_1ac16dfc549efe0bd9b819ea4a9a8462a9" kind="variable"><name>x</name></member> + <member refid="structpoint3d_1af76302f192767fd9546392affbe5631c" kind="variable"><name>y</name></member> + <member refid="structpoint3d_1a96e63d7cd720242d2f79287b04a503e1" kind="variable"><name>z</name></member> + <member refid="structpoint3d_1afb9519af724fab8e88b239b60c864a6d" kind="variable"><name>name</name></member> + <member refid="structpoint3d_1a809caeed7433b4f182554ef12f8705a9" kind="variable"><name>namelength</name></member> + </compound> + <compound refid="namespacebinary__c-python" kind="namespace"><name>binary_c-python</name> + </compound> + <compound refid="namespacebinary__c-python_1_1python__API__test" kind="namespace"><name>binary_c-python::python_API_test</name> + <member refid="python__API__test_8py_1ad3fc3808472df835d5865975a4273e72" kind="function"><name>run_test_binary</name></member> + </compound> + <compound refid="namespacebinary__c-python_1_1setup" kind="namespace"><name>binary_c-python::setup</name> + <member refid="setup_8py_1a899b6507d0ec24a3cf34480b64cb8ee7" kind="variable"><name>binary_c_config</name></member> + <member refid="setup_8py_1aec518d25e86105cbdc6c32b2a133167c" kind="variable"><name>binary_c_incdirs</name></member> + <member refid="setup_8py_1a22524a8647a3988457bd395a27199bfa" kind="variable"><name>binary_c_libdirs</name></member> + <member refid="setup_8py_1af3f7476f2073d7fdf7b453e6269fba59" kind="variable"><name>binary_c_cflags</name></member> + <member refid="setup_8py_1ac4cd9ed5436642e038801d8d1566e4ce" kind="variable"><name>binary_c_libs</name></member> + <member refid="setup_8py_1ad824cf9bc98e549d3cc71ca88fba14a9" kind="variable"><name>binary_c_define_macros</name></member> + <member refid="setup_8py_1a4757dde6dce6c656076be42cf8537001" kind="variable"><name>defines</name></member> + <member refid="setup_8py_1a0b8b23bdb02a56ae2f1ae0c7855d2702" kind="variable"><name>lone</name></member> + <member refid="setup_8py_1a16a72b3383891cea7fce76706074f884" kind="variable"><name>partner</name></member> + <member refid="setup_8py_1a58794927d930a234d9e702ba4423823d" kind="variable"><name>y</name></member> + <member refid="setup_8py_1a730173d3d595423bfd062e09a5d16d9b" kind="variable"><name>API_h</name></member> + <member refid="setup_8py_1a40bb4279f1a17744d76c2fed54164cc3" kind="variable"><name>name</name></member> + <member refid="setup_8py_1aafdb9e72044b7542f648ecb2dedf8734" kind="variable"><name>version</name></member> + <member refid="setup_8py_1aa24836992d0239704b3495f0ead7f94f" kind="variable"><name>description</name></member> + <member refid="setup_8py_1a2a6933b7ec26c631b604aa14cf67bda2" kind="variable"><name>author</name></member> + <member refid="setup_8py_1a5e25c369cfd7169df760f39c8b197bfc" kind="variable"><name>author_email</name></member> + <member refid="setup_8py_1aedca0e7d89fefed2719bf9cb3c8c5e4b" kind="variable"><name>license</name></member> + <member refid="setup_8py_1a9f58f848900f33125be8aa083bbd2faa" kind="variable"><name>ext_modules</name></member> + </compound> + <compound refid="____init_____8py" kind="file"><name>__init__.py</name> + </compound> + <compound refid="binary__c__python_8c" kind="file"><name>binary_c_python.c</name> + <member refid="binary__c__python_8c_1a96eecd753426f64250c860477b14b76d" kind="variable"><name>MAYBE_UNUSED</name></member> + <member refid="binary__c__python_8c_1abef09ae9b0e98b48ee64a5b8898c0934" kind="variable"><name>run_binary_docstring</name></member> + <member refid="binary__c__python_8c_1a71fbab2704c5a989132bbc3374de3ac6" kind="variable"><name>run_binary_with_logdocstring</name></member> + <member refid="binary__c__python_8c_1acd24c10503704c9aa1c7139eabd8be8d" kind="variable"><name>run_binary_custom_loggingdocstring</name></member> + <member refid="binary__c__python_8c_1a48934ebaaa619338286d601df71c410f" kind="variable"><name>new_binary_system_docstring</name></member> + <member refid="binary__c__python_8c_1a3aa0ba793de1db3cbc48c344310cd91e" kind="variable"><name>function_prototype_docstring</name></member> + <member refid="binary__c__python_8c_1a9fae61892a92ac21d69be86e41322580" kind="variable"><name>return_arglines_docstring</name></member> + <member refid="binary__c__python_8c_1a940779b99fd9dae3bce10134c5d9edb2" kind="variable"><name>store</name></member> + <member refid="binary__c__python_8c_1afcd2b5e08091d3973eb552badcfec160" kind="variable"><name>module_methods</name></member> + <member refid="binary__c__python_8c_1a6d4d643c46a2daece60a9bd028631ba3" kind="function"><name>binary_c_run_binary</name></member> + <member refid="binary__c__python_8c_1a0aa1357151a7e1cbf44b3c47f52d4796" kind="function"><name>binary_c_run_binary_with_logfile</name></member> + <member refid="binary__c__python_8c_1ae65c00f695567279ad4cd5f9aa6efd31" kind="function"><name>binary_c_run_binary_custom_logging</name></member> + <member refid="binary__c__python_8c_1a0a58cc76e5fd871157e87eb0c8621f37" kind="function"><name>binary_c_function_prototype</name></member> + <member refid="binary__c__python_8c_1a1ecf6504fb58dc9305382349df1e9574" kind="function"><name>binary_c_new_binary_system</name></member> + <member refid="binary__c__python_8c_1a533a791a652638d95e6a50a14470b436" kind="function"><name>binary_c_return_arglines</name></member> + <member refid="binary__c__python_8c_1abc8e10822e5c0270ef1ea36a557fbe1b" kind="function"><name>initbinary_c</name></member> + </compound> + <compound refid="binary__c__python_8h" kind="file"><name>binary_c_python.h</name> + <member refid="binary__c__python_8h_1a38ee349162bf908751d46fe7b21204e1" kind="define"><name>BINARY_C_PYTHON_H</name></member> + <member refid="binary__c__python_8h_1ab3a75b19ea9b28f47fcfc0012c06715c" kind="define"><name>BINARY_C_APITEST_VERSION</name></member> + <member refid="binary__c__python_8h_1a01f02a9dd2aeb8df6a0e319ff60589f8" kind="define"><name>APIprint</name></member> + <member refid="binary__c__python_8h_1a0b64516451f088cc73b3a76d07e50cee" kind="define"><name>NO_OUTPUT</name></member> + <member refid="binary__c__python_8h_1ace9c83eff223e1ceae820171f3398b3f" kind="function"><name>run_binary</name></member> + <member refid="binary__c__python_8h_1a9f0348a1a042139f4d9322febd572e64" kind="function"><name>run_binary_with_logfile</name></member> + <member refid="binary__c__python_8h_1a61495de6862edf96e3687fe962f21da4" kind="function"><name>run_binary_custom_logging</name></member> + <member refid="binary__c__python_8h_1afcf0243ae54eae72022879581a9e4d2b" kind="function"><name>return_arglines</name></member> + </compound> + <compound refid="binary__c__python__api_8c" kind="file"><name>binary_c_python_api.c</name> + <member refid="binary__c__python__api_8c_1a7585f58c2cc99092d759440e455c402b" kind="variable"><name>out_pipe</name></member> + <member refid="binary__c__python__api_8c_1a0ecee3f382d2832184b83f828a847ebc" kind="variable"><name>stdoutwas</name></member> + <member refid="binary__c__python__api_8c_1a9cf1110dc5965ce4553af25faeed0016" kind="function"><name>run_binary</name></member> + <member refid="binary__c__python__api_8c_1a61495de6862edf96e3687fe962f21da4" kind="function"><name>run_binary_custom_logging</name></member> + <member refid="binary__c__python__api_8c_1a3a84ae972c9a076b44b11536521f95d5" kind="function"><name>return_arglines</name></member> + <member refid="binary__c__python__api_8c_1ab3c7f69d58d2ad92d556accd53a38ca7" kind="function"><name>run_binary_with_logfile</name></member> + </compound> + <compound refid="python__API__test_8py" kind="file"><name>python_API_test.py</name> + </compound> + <compound refid="README_8md" kind="file"><name>README.md</name> + </compound> + <compound refid="setup_8py" kind="file"><name>setup.py</name> + </compound> + <compound refid="ding_8h" kind="file"><name>ding.h</name> + <member refid="ding_8h_1abdf4994e8e07b3eda6c6a5a9bf5357e4" kind="enum"><name>BoxEnum_enum</name></member> + <member refid="ding_8h_1abdf4994e8e07b3eda6c6a5a9bf5357e4a2bf0bdd7b9b287724c66f6c0f74ceb01" kind="enumvalue"><name>BOXENUM_FIRST</name></member> + <member refid="ding_8h_1abdf4994e8e07b3eda6c6a5a9bf5357e4a3ede3b6dfb2dbdac72634f0334e11c63" kind="enumvalue"><name>BOXENUM_SECOND</name></member> + <member refid="ding_8h_1abdf4994e8e07b3eda6c6a5a9bf5357e4a227130e825c6c4506cc4a226539d85fb" kind="enumvalue"><name>BOXENUM_ETC</name></member> + <member refid="ding_8h_1a354be0627e025b594a719a4c3f92a69f" kind="typedef"><name>BoxEnum</name></member> + <member refid="ding_8h_1a718548848862b3d5da8f7c7cea677de1" kind="typedef"><name>BoxStruct</name></member> + <member refid="ding_8h_1aaddf8ced9406a68229baee8c1e922b6a" kind="function"><name>Box_The_Function_Name</name></member> + <member refid="ding_8h_1a7ec4699a4197d74b5487929228b0597c" kind="function"><name>Box_The_Second_Function</name></member> + <member refid="ding_8h_1a01d1bdf75bc1d4b6445faeafa8fd853d" kind="function"><name>Box_The_Last_One</name></member> + </compound> + <compound refid="test_8h" kind="file"><name>test.h</name> + <member refid="test_8h_1a38ee349162bf908751d46fe7b21204e1" kind="define"><name>BINARY_C_PYTHON_H</name></member> + <member refid="test_8h_1ab3a75b19ea9b28f47fcfc0012c06715c" kind="define"><name>BINARY_C_APITEST_VERSION</name></member> + <member refid="test_8h_1a01f02a9dd2aeb8df6a0e319ff60589f8" kind="define"><name>APIprint</name></member> + <member refid="test_8h_1a0b64516451f088cc73b3a76d07e50cee" kind="define"><name>NO_OUTPUT</name></member> + <member refid="test_8h_1af758c6cbee7cc9546fbdb8a8b502abdb" kind="function"><name>run_binary</name></member> + </compound> + <compound refid="md_README" kind="page"><name>md_README</name> + </compound> + <compound refid="dir_eedb883b3a90ccdfffd3f135939cac7c" kind="dir"><name>testing_doxygen</name> + </compound> +</doxygenindex> diff --git a/docs/Doxygen/xml/index.xsd b/docs/Doxygen/xml/index.xsd new file mode 100644 index 0000000000000000000000000000000000000000..d7ab2a906b19983c8b1d375e4167b2841ec07c78 --- /dev/null +++ b/docs/Doxygen/xml/index.xsd @@ -0,0 +1,66 @@ +<?xml version='1.0' encoding='utf-8' ?> +<xsd:schema xmlns:xsd="http://www.w3.org/2001/XMLSchema"> + <xsd:element name="doxygenindex" type="DoxygenType"/> + + <xsd:complexType name="DoxygenType"> + <xsd:sequence> + <xsd:element name="compound" type="CompoundType" minOccurs="0" maxOccurs="unbounded"/> + </xsd:sequence> + <xsd:attribute name="version" type="xsd:string" use="required"/> + </xsd:complexType> + + <xsd:complexType name="CompoundType"> + <xsd:sequence> + <xsd:element name="name" type="xsd:string"/> + <xsd:element name="member" type="MemberType" minOccurs="0" maxOccurs="unbounded"/> + </xsd:sequence> + <xsd:attribute name="refid" type="xsd:string" use="required"/> + <xsd:attribute name="kind" type="CompoundKind" use="required"/> + </xsd:complexType> + + <xsd:complexType name="MemberType"> + <xsd:sequence> + <xsd:element name="name" type="xsd:string"/> + </xsd:sequence> + <xsd:attribute name="refid" type="xsd:string" use="required"/> + <xsd:attribute name="kind" type="MemberKind" use="required"/> + </xsd:complexType> + + <xsd:simpleType name="CompoundKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="class"/> + <xsd:enumeration value="struct"/> + <xsd:enumeration value="union"/> + <xsd:enumeration value="interface"/> + <xsd:enumeration value="protocol"/> + <xsd:enumeration value="category"/> + <xsd:enumeration value="exception"/> + <xsd:enumeration value="file"/> + <xsd:enumeration value="namespace"/> + <xsd:enumeration value="group"/> + <xsd:enumeration value="page"/> + <xsd:enumeration value="example"/> + <xsd:enumeration value="dir"/> + </xsd:restriction> + </xsd:simpleType> + + <xsd:simpleType name="MemberKind"> + <xsd:restriction base="xsd:string"> + <xsd:enumeration value="define"/> + <xsd:enumeration value="property"/> + <xsd:enumeration value="event"/> + <xsd:enumeration value="variable"/> + <xsd:enumeration value="typedef"/> + <xsd:enumeration value="enum"/> + <xsd:enumeration value="enumvalue"/> + <xsd:enumeration value="function"/> + <xsd:enumeration value="signal"/> + <xsd:enumeration value="prototype"/> + <xsd:enumeration value="friend"/> + <xsd:enumeration value="dcop"/> + <xsd:enumeration value="slot"/> + </xsd:restriction> + </xsd:simpleType> + +</xsd:schema> + diff --git a/docs/Doxygen/xml/md_README.xml b/docs/Doxygen/xml/md_README.xml new file mode 100644 index 0000000000000000000000000000000000000000..f5351b1d2365b4381e451ff42c2c3070073920cc --- /dev/null +++ b/docs/Doxygen/xml/md_README.xml @@ -0,0 +1,22 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="md_README" kind="page"> + <compoundname>md_README</compoundname> + <title>Python module for binary_c</title> + <detaileddescription> +<para>Based on a original work by Jeff Andrews (can be found in old_solution/ directory) updated and extended for Python3 by Robert Izzard, David hendriks</para><para>Warning : THIS CODE IS EXPERIMENTAL!</para><para><ulink url="mailto:r.izzard@surrey.ac.uk">r.izzard@surrey.ac.uk</ulink> <ulink url="http://personal.ph.surrey.ac.uk/~ri0005/binary_c.html">http://personal.ph.surrey.ac.uk/~ri0005/binary_c.html</ulink> 09/06/2019</para><para><heading level="2">Requirements </heading> +</para><para><itemizedlist> +<listitem><para>Python3</para></listitem><listitem><para>binary_c version 2.1+</para></listitem><listitem><para>requirements.txt (no?)</para></listitem></itemizedlist> +</para><para><heading level="2">Environment variables </heading> +</para><para>Before compilation you should set the following environment variables:</para><para><itemizedlist> +<listitem><para>required: <computeroutput>BINARY_C</computeroutput> should point to the root directory of your binary_c installation</para></listitem><listitem><para>recommended: <computeroutput>LD_LIBRARY_PATH</computeroutput> should include $BINARY_C/src and whatever directories are required to run binary_c (e.g. locations of libgsl, libmemoize, librinterpolate, etc.)</para></listitem><listitem><para>recommended: <computeroutput>LIBRARY_PATH</computeroutput> should include whatever directories are required to build binary_c (e.g. locations of libgsl, libmemoize, librinterpolate, etc.)</para></listitem></itemizedlist> +</para><para><heading level="2">Build instructions </heading> +</para><para>To build the module, make sure you have built binary_c (with <computeroutput>make</computeroutput> in the binary_c root directory), its shared library (with <computeroutput>make libbinary_c.so</computeroutput> in the binary_c root directory), and set environment variables as described above, then run the following code in t: <programlisting><codeline><highlight class="normal">make<sp/>clean</highlight></codeline> +<codeline><highlight class="normal">make</highlight></codeline> +</programlisting> Then to test the Python module:</para><para><programlisting><codeline><highlight class="normal">python3<sp/>./python_API_test.py</highlight></codeline> +</programlisting> You will require whatever libraries with which binary_c was compiled, as well as the compiler with which Python was built (usually gcc, which is easily installed on most systems).</para><para>If you want to be able to import the binary_c module correctly for child directories (or anywhere for that matter), execute or put the following code in your .bashrc/.zshrc: <programlisting><codeline><highlight class="normal">export<sp/>LD_LIBRARY_PATH=<full<sp/>path<sp/>to<sp/>directory<sp/>containing<sp/>libbinary_c_api.so>:$LD_LIBRARY_PATH</highlight></codeline> +<codeline><highlight class="normal">export<sp/>PYTHONPATH=<full<sp/>path<sp/>to<sp/>directory<sp/>containing<sp/>libbinary_c_api.so>:$PYTHONPATH</highlight></codeline> +</programlisting></para><para><heading level="2">Usage notes </heading> +</para><para>When running a jupyter notebook and importing binary_c, it might happen that the module binary_c cannot be found. I experienced this when I executed Jupyter Notebook from a virtual environment which didnt use the same python (version/binary/shim) as the one I built this library with. Make sure jupyter does use the same underlying python version/binary/shim. That resolved the issue for me.</para><para>Also: I figured that having binaryc output the log like "<LOG HEADER> t=10e4 ..." (i.e. printing the parameter names as well as their values) would be useful because in that way one can easily have python read that out automatically instead of having to manually copy the list of parameter names.</para><para>See examples/ dir for some working examples </para> </detaileddescription> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/namespacebinary__c-python.xml b/docs/Doxygen/xml/namespacebinary__c-python.xml new file mode 100644 index 0000000000000000000000000000000000000000..6d0b182de9b75ae4d6ba5a59ca36d31ee2e4c76d --- /dev/null +++ b/docs/Doxygen/xml/namespacebinary__c-python.xml @@ -0,0 +1,13 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="namespacebinary__c-python" kind="namespace" language="Python"> + <compoundname>binary_c-python</compoundname> + <innernamespace refid="namespacebinary__c-python_1_1python__API__test">binary_c-python::python_API_test</innernamespace> + <innernamespace refid="namespacebinary__c-python_1_1setup">binary_c-python::setup</innernamespace> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <location file="__init__.py" line="1" column="1"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/namespacebinary__c-python_1_1python__API__test.xml b/docs/Doxygen/xml/namespacebinary__c-python_1_1python__API__test.xml new file mode 100644 index 0000000000000000000000000000000000000000..f680a2ce1835d8636f5f798aa81e73901ee25d1a --- /dev/null +++ b/docs/Doxygen/xml/namespacebinary__c-python_1_1python__API__test.xml @@ -0,0 +1,26 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="namespacebinary__c-python_1_1python__API__test" kind="namespace" language="Python"> + <compoundname>binary_c-python::python_API_test</compoundname> + <sectiondef kind="func"> + <memberdef kind="function" id="python__API__test_8py_1ad3fc3808472df835d5865975a4273e72" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>def</type> + <definition>def binary_c-python.python_API_test.run_test_binary</definition> + <argsstring>()</argsstring> + <name>run_test_binary</name> + <briefdescription> +<para>Test script to run a binary using the binary_c Python module. </para> </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="python_API_test.py" line="10" column="1" bodyfile="python_API_test.py" bodystart="10" bodyend="33"/> + </memberdef> + </sectiondef> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <location file="python_API_test.py" line="1" column="1"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/namespacebinary__c-python_1_1setup.xml b/docs/Doxygen/xml/namespacebinary__c-python_1_1setup.xml new file mode 100644 index 0000000000000000000000000000000000000000..66916deb4d44cbe739933f410fc764dce0833d16 --- /dev/null +++ b/docs/Doxygen/xml/namespacebinary__c-python_1_1setup.xml @@ -0,0 +1,258 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="namespacebinary__c-python_1_1setup" kind="namespace" language="Python"> + <compoundname>binary_c-python::setup</compoundname> + <sectiondef kind="var"> + <memberdef kind="variable" id="setup_8py_1a899b6507d0ec24a3cf34480b64cb8ee7" prot="public" static="no" mutable="no"> + <type>string</type> + <definition>string binary_c-python::setup.binary_c_config</definition> + <argsstring></argsstring> + <name>binary_c_config</name> + <initializer>= os.environ['BINARY_C']+'/binary_c-config'</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="9" column="1" bodyfile="setup.py" bodystart="9" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1aec518d25e86105cbdc6c32b2a133167c" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.binary_c_incdirs</definition> + <argsstring></argsstring> + <name>binary_c_incdirs</name> + <initializer>= subprocess.run([binary_c_config,'incdirs_list'],stdout=subprocess.PIPE).stdout.decode('utf-8').split()</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="11" column="1" bodyfile="setup.py" bodystart="11" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a22524a8647a3988457bd395a27199bfa" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.binary_c_libdirs</definition> + <argsstring></argsstring> + <name>binary_c_libdirs</name> + <initializer>= subprocess.run([binary_c_config,'libdirs_list'],stdout=subprocess.PIPE).stdout.decode('utf-8').split()</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="12" column="1" bodyfile="setup.py" bodystart="12" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1af3f7476f2073d7fdf7b453e6269fba59" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.binary_c_cflags</definition> + <argsstring></argsstring> + <name>binary_c_cflags</name> + <initializer>= subprocess.run([binary_c_config,'cflags'],stdout=subprocess.PIPE).stdout.decode('utf-8').split()</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="13" column="1" bodyfile="setup.py" bodystart="13" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1ac4cd9ed5436642e038801d8d1566e4ce" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.binary_c_libs</definition> + <argsstring></argsstring> + <name>binary_c_libs</name> + <initializer>= subprocess.run([binary_c_config,'libs_list'],stdout=subprocess.PIPE).stdout.decode('utf-8').split()</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="15" column="1" bodyfile="setup.py" bodystart="15" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1ad824cf9bc98e549d3cc71ca88fba14a9" prot="public" static="no" mutable="no"> + <type>list</type> + <definition>list binary_c-python::setup.binary_c_define_macros</definition> + <argsstring></argsstring> + <name>binary_c_define_macros</name> + <initializer>= []</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="18" column="1" bodyfile="setup.py" bodystart="18" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a4757dde6dce6c656076be42cf8537001" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.defines</definition> + <argsstring></argsstring> + <name>defines</name> + <initializer>= subprocess.run([binary_c_config,'define_macros'],stdout=subprocess.PIPE).stdout.decode('utf-8').split()</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="19" column="1" bodyfile="setup.py" bodystart="19" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a0b8b23bdb02a56ae2f1ae0c7855d2702" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.lone</definition> + <argsstring></argsstring> + <name>lone</name> + <initializer>= re.compile('^-D(.+)$')</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="20" column="1" bodyfile="setup.py" bodystart="20" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a16a72b3383891cea7fce76706074f884" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.partner</definition> + <argsstring></argsstring> + <name>partner</name> + <initializer>= re.compile('^-D(.+)=(.+)$')</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="21" column="1" bodyfile="setup.py" bodystart="21" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a58794927d930a234d9e702ba4423823d" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.y</definition> + <argsstring></argsstring> + <name>y</name> + <initializer>= partner.match(x)</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="24" column="1" bodyfile="setup.py" bodystart="24" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a730173d3d595423bfd062e09a5d16d9b" prot="public" static="no" mutable="no"> + <type>string</type> + <definition>string binary_c-python::setup.API_h</definition> + <argsstring></argsstring> + <name>API_h</name> + <initializer>= os.environ['BINARY_C'] + '/src/API/binary_c_API.h'</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="32" column="1" bodyfile="setup.py" bodystart="32" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a40bb4279f1a17744d76c2fed54164cc3" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.name</definition> + <argsstring></argsstring> + <name>name</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="36" column="1" bodyfile="setup.py" bodystart="36" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1aafdb9e72044b7542f648ecb2dedf8734" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.version</definition> + <argsstring></argsstring> + <name>version</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="37" column="1" bodyfile="setup.py" bodystart="37" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1aa24836992d0239704b3495f0ead7f94f" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.description</definition> + <argsstring></argsstring> + <name>description</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="38" column="1" bodyfile="setup.py" bodystart="38" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a2a6933b7ec26c631b604aa14cf67bda2" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.author</definition> + <argsstring></argsstring> + <name>author</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="39" column="1" bodyfile="setup.py" bodystart="39" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a5e25c369cfd7169df760f39c8b197bfc" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.author_email</definition> + <argsstring></argsstring> + <name>author_email</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="40" column="1" bodyfile="setup.py" bodystart="40" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1aedca0e7d89fefed2719bf9cb3c8c5e4b" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.license</definition> + <argsstring></argsstring> + <name>license</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="41" column="1" bodyfile="setup.py" bodystart="41" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="setup_8py_1a9f58f848900f33125be8aa083bbd2faa" prot="public" static="no" mutable="no"> + <type></type> + <definition>binary_c-python::setup.ext_modules</definition> + <argsstring></argsstring> + <name>ext_modules</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="setup.py" line="42" column="1" bodyfile="setup.py" bodystart="42" bodyend="-1"/> + </memberdef> + </sectiondef> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <location file="setup.py" line="1" column="1"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/python__API__test_8py.xml b/docs/Doxygen/xml/python__API__test_8py.xml new file mode 100644 index 0000000000000000000000000000000000000000..42a9bc687eca42b1f840a4a3208e580c2e25e20c --- /dev/null +++ b/docs/Doxygen/xml/python__API__test_8py.xml @@ -0,0 +1,43 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="python__API__test_8py" kind="file" language="Python"> + <compoundname>python_API_test.py</compoundname> + <innernamespace refid="namespacebinary__c-python_1_1python__API__test">binary_c-python::python_API_test</innernamespace> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> +<codeline lineno="1"><highlight class="comment">#!/usr/bin/python3</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="2"><highlight class="normal"></highlight></codeline> +<codeline lineno="3"><highlight class="normal"></highlight><highlight class="keyword">import</highlight><highlight class="normal"><sp/>binary_c</highlight></codeline> +<codeline lineno="4"><highlight class="normal"></highlight></codeline> +<codeline lineno="5"><highlight class="normal"></highlight></codeline> +<codeline lineno="9"><highlight class="normal"></highlight></codeline> +<codeline lineno="10"><highlight class="normal"></highlight><highlight class="keyword">def<sp/></highlight><highlight class="normal">run_test_binary():</highlight></codeline> +<codeline lineno="11"><highlight class="normal"><sp/><sp/><sp/><sp/>m1<sp/>=<sp/>15.0<sp/></highlight><highlight class="comment">#<sp/>Msun</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="12"><highlight class="normal"><sp/><sp/><sp/><sp/>m2<sp/>=<sp/>14.0<sp/></highlight><highlight class="comment">#<sp/>Msun</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="13"><highlight class="normal"><sp/><sp/><sp/><sp/>separation<sp/>=<sp/>0<sp/></highlight><highlight class="comment">#<sp/>0<sp/>=<sp/>ignored,<sp/>use<sp/>period</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="14"><highlight class="normal"><sp/><sp/><sp/><sp/>orbital_period<sp/>=<sp/>4530.0<sp/></highlight><highlight class="comment">#<sp/>days</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="15"><highlight class="normal"><sp/><sp/><sp/><sp/>eccentricity<sp/>=<sp/>0.0</highlight></codeline> +<codeline lineno="16"><highlight class="normal"><sp/><sp/><sp/><sp/>metallicity<sp/>=<sp/>0.02</highlight></codeline> +<codeline lineno="17"><highlight class="normal"><sp/><sp/><sp/><sp/>max_evolution_time<sp/>=<sp/>15000</highlight></codeline> +<codeline lineno="18"><highlight class="normal"><sp/><sp/><sp/><sp/>buffer<sp/>=<sp/></highlight><highlight class="stringliteral">""</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="19"><highlight class="normal"><sp/><sp/><sp/><sp/>argstring<sp/>=<sp/></highlight><highlight class="stringliteral">"binary_c<sp/>M_1<sp/>{0:g}<sp/>M_2<sp/>{1:g}<sp/>separation<sp/>{2:g}<sp/>orbital_period<sp/>{3:g}<sp/>eccentricity<sp/>{4:g}<sp/>metallicity<sp/>{5:g}<sp/>max_evolution_time<sp/>{6:g}<sp/><sp/>"</highlight><highlight class="normal">.format(m1,m2,separation,orbital_period,eccentricity,metallicity,max_evolution_time)</highlight></codeline> +<codeline lineno="20"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="21"><highlight class="normal"><sp/><sp/><sp/><sp/>output<sp/>=<sp/>binary_c.run_binary(argstring)</highlight></codeline> +<codeline lineno="22"><highlight class="normal"></highlight></codeline> +<codeline lineno="23"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">print</highlight><highlight class="normal"><sp/>(</highlight><highlight class="stringliteral">"\n\nBinary_c<sp/>output:\n\n"</highlight><highlight class="normal">)</highlight></codeline> +<codeline lineno="24"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">print</highlight><highlight class="normal"><sp/>(output)</highlight></codeline> +<codeline lineno="25"><highlight class="normal"></highlight></codeline> +<codeline lineno="26"><highlight class="normal"></highlight></codeline> +<codeline lineno="27"><highlight class="normal"></highlight></codeline> +<codeline lineno="28"><highlight class="normal">binary_star=binary_c.new_system()</highlight></codeline> +<codeline lineno="29"><highlight class="normal"></highlight></codeline> +<codeline lineno="30"><highlight class="normal">print(binary_star)</highlight></codeline> +<codeline lineno="31"><highlight class="normal">run_test_binary()</highlight></codeline> +<codeline lineno="32"><highlight class="normal"></highlight></codeline> + </programlisting> + <location file="python_API_test.py"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/setup_8py.xml b/docs/Doxygen/xml/setup_8py.xml new file mode 100644 index 0000000000000000000000000000000000000000..985bd68dd0bdd477c5bdfc8b2d6aca0db84e2dfd --- /dev/null +++ b/docs/Doxygen/xml/setup_8py.xml @@ -0,0 +1,67 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="setup_8py" kind="file" language="Python"> + <compoundname>setup.py</compoundname> + <innernamespace refid="namespacebinary__c-python_1_1setup">binary_c-python::setup</innernamespace> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> +<codeline lineno="1"><highlight class="keyword">from</highlight><highlight class="normal"><sp/>distutils.core<sp/></highlight><highlight class="keyword">import</highlight><highlight class="normal"><sp/>setup,<sp/>Extension</highlight></codeline> +<codeline lineno="2"><highlight class="normal"></highlight><highlight class="keyword">import</highlight><highlight class="normal"><sp/>os</highlight></codeline> +<codeline lineno="3"><highlight class="normal"></highlight><highlight class="keyword">import</highlight><highlight class="normal"><sp/>subprocess</highlight></codeline> +<codeline lineno="4"><highlight class="normal"></highlight><highlight class="keyword">import</highlight><highlight class="normal"><sp/>re</highlight></codeline> +<codeline lineno="5"><highlight class="normal"></highlight><highlight class="keyword">import</highlight><highlight class="normal"><sp/>sys</highlight></codeline> +<codeline lineno="6"><highlight class="normal"></highlight></codeline> +<codeline lineno="7"><highlight class="normal"></highlight><highlight class="comment">#<sp/>binary_c<sp/>must<sp/>be<sp/>installed.</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="8"><highlight class="normal"></highlight></codeline> +<codeline lineno="9"><highlight class="normal">binary_c_config<sp/>=<sp/>os.environ[</highlight><highlight class="stringliteral">'BINARY_C'</highlight><highlight class="normal">]+</highlight><highlight class="stringliteral">'/binary_c-config'</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="10"><highlight class="normal"></highlight></codeline> +<codeline lineno="11"><highlight class="normal">binary_c_incdirs<sp/>=<sp/>subprocess.run([binary_c_config,</highlight><highlight class="stringliteral">'incdirs_list'</highlight><highlight class="normal">],stdout=subprocess.PIPE).stdout.decode(</highlight><highlight class="stringliteral">'utf-8'</highlight><highlight class="normal">).split()</highlight></codeline> +<codeline lineno="12"><highlight class="normal">binary_c_libdirs<sp/>=<sp/>subprocess.run([binary_c_config,</highlight><highlight class="stringliteral">'libdirs_list'</highlight><highlight class="normal">],stdout=subprocess.PIPE).stdout.decode(</highlight><highlight class="stringliteral">'utf-8'</highlight><highlight class="normal">).split()</highlight></codeline> +<codeline lineno="13"><highlight class="normal">binary_c_cflags<sp/>=<sp/><sp/>subprocess.run([binary_c_config,</highlight><highlight class="stringliteral">'cflags'</highlight><highlight class="normal">],stdout=subprocess.PIPE).stdout.decode(</highlight><highlight class="stringliteral">'utf-8'</highlight><highlight class="normal">).split()</highlight></codeline> +<codeline lineno="14"><highlight class="normal"></highlight><highlight class="comment">#<sp/>binary_c_cflags.remove('-fvisibility=hidden')</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="15"><highlight class="normal">binary_c_libs<sp/>=<sp/>subprocess.run([binary_c_config,</highlight><highlight class="stringliteral">'libs_list'</highlight><highlight class="normal">],stdout=subprocess.PIPE).stdout.decode(</highlight><highlight class="stringliteral">'utf-8'</highlight><highlight class="normal">).split()</highlight></codeline> +<codeline lineno="16"><highlight class="normal"></highlight></codeline> +<codeline lineno="17"><highlight class="normal"></highlight><highlight class="comment">#<sp/>create<sp/>list<sp/>of<sp/>tuples<sp/>of<sp/>defined<sp/>macros</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="18"><highlight class="normal">binary_c_define_macros<sp/>=<sp/>[]</highlight></codeline> +<codeline lineno="19"><highlight class="normal">defines<sp/>=<sp/>subprocess.run([binary_c_config,</highlight><highlight class="stringliteral">'define_macros'</highlight><highlight class="normal">],stdout=subprocess.PIPE).stdout.decode(</highlight><highlight class="stringliteral">'utf-8'</highlight><highlight class="normal">).split()</highlight></codeline> +<codeline lineno="20"><highlight class="normal">lone<sp/>=<sp/>re.compile(</highlight><highlight class="stringliteral">'^-D(.+)$'</highlight><highlight class="normal">)</highlight></codeline> +<codeline lineno="21"><highlight class="normal">partner<sp/>=<sp/>re.compile(</highlight><highlight class="stringliteral">'^-D(.+)=(.+)$'</highlight><highlight class="normal">)</highlight></codeline> +<codeline lineno="22"><highlight class="normal"></highlight></codeline> +<codeline lineno="23"><highlight class="normal"></highlight><highlight class="keywordflow">for</highlight><highlight class="normal"><sp/>x<sp/></highlight><highlight class="keywordflow">in</highlight><highlight class="normal"><sp/>defines:</highlight></codeline> +<codeline lineno="24"><highlight class="normal"><sp/><sp/><sp/><sp/>y<sp/>=<sp/>partner.match(x)</highlight></codeline> +<codeline lineno="25"><highlight class="normal"><sp/><sp/><sp/><sp/>if(y):</highlight></codeline> +<codeline lineno="26"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>binary_c_define_macros.extend([(y.group(1),y.group(2))])</highlight></codeline> +<codeline lineno="27"><highlight class="normal"><sp/><sp/><sp/><sp/></highlight><highlight class="keywordflow">else</highlight><highlight class="normal">:</highlight></codeline> +<codeline lineno="28"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>y<sp/>=<sp/>lone.match(x)</highlight></codeline> +<codeline lineno="29"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>if(y):</highlight></codeline> +<codeline lineno="30"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>binary_c_define_macros.extend([(y.group(1),</highlight><highlight class="keywordtype">None</highlight><highlight class="normal">)])</highlight></codeline> +<codeline lineno="31"><highlight class="normal"></highlight><highlight class="comment">#<sp/>add<sp/>API<sp/>header<sp/>file</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="32"><highlight class="normal">API_h<sp/>=<sp/>os.environ[</highlight><highlight class="stringliteral">'BINARY_C'</highlight><highlight class="normal">]<sp/>+<sp/></highlight><highlight class="stringliteral">'/src/API/binary_c_API.h'</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="33"><highlight class="normal">binary_c_define_macros.extend([(</highlight><highlight class="stringliteral">'BINARY_C_API_H'</highlight><highlight class="normal">,API_h)])</highlight></codeline> +<codeline lineno="34"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight></codeline> +<codeline lineno="35"><highlight class="normal">setup(</highlight></codeline> +<codeline lineno="36"><highlight class="normal"><sp/><sp/><sp/><sp/>name=</highlight><highlight class="stringliteral">'binary_c'</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="37"><highlight class="normal"><sp/><sp/><sp/><sp/>version=</highlight><highlight class="stringliteral">'1.0'</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="38"><highlight class="normal"><sp/><sp/><sp/><sp/>description=</highlight><highlight class="stringliteral">'This<sp/>is<sp/>a<sp/>python<sp/>API<sp/>for<sp/>binary_c<sp/>by<sp/>Rob<sp/>Izzard<sp/>and<sp/>collaborators'</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="39"><highlight class="normal"><sp/><sp/><sp/><sp/>author=</highlight><highlight class="stringliteral">'Jeff<sp/>Andrews<sp/>and<sp/>Robert<sp/>Izzard<sp/>and<sp/>David<sp/>Hendriks'</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="40"><highlight class="normal"><sp/><sp/><sp/><sp/>author_email=</highlight><highlight class="stringliteral">'andrews@physics.uoc.gr<sp/>and<sp/>r.izzard@surrey.ac.uk<sp/>and<sp/>rob.izzard@gmail.com<sp/>and<sp/>dhendriks93@gmail.com'</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="41"><highlight class="normal">license=</highlight><highlight class="stringliteral">''</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="42"><highlight class="normal"><sp/><sp/><sp/><sp/>ext_modules=[Extension(</highlight><highlight class="stringliteral">"binary_c"</highlight><highlight class="normal">,</highlight></codeline> +<codeline lineno="43"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>[</highlight><highlight class="stringliteral">"binary_c_python.c"</highlight><highlight class="normal">],</highlight></codeline> +<codeline lineno="44"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>libraries<sp/>=<sp/>[</highlight><highlight class="stringliteral">'binary_c'</highlight><highlight class="normal">]<sp/>+<sp/>binary_c_libs<sp/>+<sp/>[</highlight><highlight class="stringliteral">'binary_c_api'</highlight><highlight class="normal">],</highlight></codeline> +<codeline lineno="45"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>include_dirs<sp/>=<sp/>[os.environ[</highlight><highlight class="stringliteral">'BINARY_C'</highlight><highlight class="normal">]<sp/>+<sp/></highlight><highlight class="stringliteral">'/src'</highlight><highlight class="normal">,<sp/>os.environ[</highlight><highlight class="stringliteral">'BINARY_C'</highlight><highlight class="normal">]<sp/>+<sp/></highlight><highlight class="stringliteral">'/src/API'</highlight><highlight class="normal">]<sp/>+<sp/>binary_c_incdirs,</highlight></codeline> +<codeline lineno="46"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>library_dirs<sp/>=<sp/>[os.environ[</highlight><highlight class="stringliteral">'BINARY_C'</highlight><highlight class="normal">]<sp/>+<sp/></highlight><highlight class="stringliteral">'/src'</highlight><highlight class="normal">,<sp/></highlight><highlight class="stringliteral">'./'</highlight><highlight class="normal">]<sp/>+<sp/>binary_c_libdirs,</highlight></codeline> +<codeline lineno="47"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>runtime_library_dirs<sp/>=<sp/>[os.environ[</highlight><highlight class="stringliteral">'BINARY_C'</highlight><highlight class="normal">]+</highlight><highlight class="stringliteral">'/src'</highlight><highlight class="normal">,<sp/></highlight><highlight class="stringliteral">'./'</highlight><highlight class="normal">]<sp/>+<sp/>binary_c_libdirs,</highlight></codeline> +<codeline lineno="48"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>define_macros<sp/>=<sp/>[]<sp/>+<sp/>binary_c_define_macros,</highlight></codeline> +<codeline lineno="49"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>extra_objects<sp/>=<sp/>[],</highlight></codeline> +<codeline lineno="50"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>extra_compile_args<sp/>=<sp/>[],</highlight></codeline> +<codeline lineno="51"><highlight class="normal"></highlight></codeline> +<codeline lineno="52"><highlight class="normal"><sp/><sp/><sp/><sp/>)]<sp/><sp/></highlight><highlight class="comment">#<sp/>binary_c<sp/>must<sp/>be<sp/>loaded</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="53"><highlight class="normal">)</highlight></codeline> + </programlisting> + <location file="setup.py"/> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/structBoxStruct__struct.xml b/docs/Doxygen/xml/structBoxStruct__struct.xml new file mode 100644 index 0000000000000000000000000000000000000000..975a2816418e12123c1c62a06efcdfd896365a15 --- /dev/null +++ b/docs/Doxygen/xml/structBoxStruct__struct.xml @@ -0,0 +1,58 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="structBoxStruct__struct" kind="struct" language="C++" prot="public"> + <compoundname>BoxStruct_struct</compoundname> + <includes refid="ding_8h" local="no">ding.h</includes> + <sectiondef kind="public-attrib"> + <memberdef kind="variable" id="structBoxStruct__struct_1a4593938c5e90f024e7971bdb1392d9d6" prot="public" static="no" mutable="no"> + <type>int</type> + <definition>int BoxStruct_struct::a</definition> + <argsstring></argsstring> + <name>a</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>Some documentation for the member <ref refid="structBoxStruct__struct_1a4593938c5e90f024e7971bdb1392d9d6" kindref="member">BoxStruct::a</ref>. </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="62" column="1" bodyfile="testing_doxygen/ding.h" bodystart="62" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="structBoxStruct__struct_1aee44748dc579c5d794853ee8b133d197" prot="public" static="no" mutable="no"> + <type>int</type> + <definition>int BoxStruct_struct::b</definition> + <argsstring></argsstring> + <name>b</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>Some documentation for the member <ref refid="structBoxStruct__struct_1aee44748dc579c5d794853ee8b133d197" kindref="member">BoxStruct::b</ref>. </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="63" column="1" bodyfile="testing_doxygen/ding.h" bodystart="63" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="structBoxStruct__struct_1a4543370ed67b2cf5ae3f55201bea11e6" prot="public" static="no" mutable="no"> + <type>double</type> + <definition>double BoxStruct_struct::c</definition> + <argsstring></argsstring> + <name>c</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>Etc. </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/ding.h" line="64" column="1" bodyfile="testing_doxygen/ding.h" bodystart="64" bodyend="-1"/> + </memberdef> + </sectiondef> + <briefdescription> +<para>Use brief, otherwise the index won't have a brief explanation. </para> </briefdescription> + <detaileddescription> +<para>Detailed explanation. </para> </detaileddescription> + <location file="testing_doxygen/ding.h" line="61" column="1" bodyfile="testing_doxygen/ding.h" bodystart="61" bodyend="65"/> + <listofallmembers> + <member refid="structBoxStruct__struct_1a4593938c5e90f024e7971bdb1392d9d6" prot="public" virt="non-virtual"><scope>BoxStruct_struct</scope><name>a</name></member> + <member refid="structBoxStruct__struct_1aee44748dc579c5d794853ee8b133d197" prot="public" virt="non-virtual"><scope>BoxStruct_struct</scope><name>b</name></member> + <member refid="structBoxStruct__struct_1a4543370ed67b2cf5ae3f55201bea11e6" prot="public" virt="non-virtual"><scope>BoxStruct_struct</scope><name>c</name></member> + </listofallmembers> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/structpoint3d.xml b/docs/Doxygen/xml/structpoint3d.xml new file mode 100644 index 0000000000000000000000000000000000000000..e2ab0ff084f985ea4292e86d60cf9e5920ff5da5 --- /dev/null +++ b/docs/Doxygen/xml/structpoint3d.xml @@ -0,0 +1,89 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="structpoint3d" kind="struct" language="C++" prot="public"> + <compoundname>point3d</compoundname> + <includes refid="test_8h" local="no">test.h</includes> + <sectiondef kind="user-defined"> + <memberdef kind="variable" id="structpoint3d_1ac16dfc549efe0bd9b819ea4a9a8462a9" prot="public" static="no" mutable="no"> + <type>double</type> + <definition>double point3d::x</definition> + <argsstring></argsstring> + <name>x</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>the x coordinate </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="11" column="1" bodyfile="testing_doxygen/test.h" bodystart="11" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="structpoint3d_1af76302f192767fd9546392affbe5631c" prot="public" static="no" mutable="no"> + <type>double</type> + <definition>double point3d::y</definition> + <argsstring></argsstring> + <name>y</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>the y coordinate </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="12" column="1" bodyfile="testing_doxygen/test.h" bodystart="12" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="structpoint3d_1a96e63d7cd720242d2f79287b04a503e1" prot="public" static="no" mutable="no"> + <type>double</type> + <definition>double point3d::z</definition> + <argsstring></argsstring> + <name>z</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>the z coordinate </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="13" column="1" bodyfile="testing_doxygen/test.h" bodystart="13" bodyend="-1"/> + </memberdef> + </sectiondef> + <sectiondef kind="user-defined"> + <header>group 2</header> + <memberdef kind="variable" id="structpoint3d_1afb9519af724fab8e88b239b60c864a6d" prot="public" static="no" mutable="no"> + <type>char *</type> + <definition>char* point3d::name</definition> + <argsstring></argsstring> + <name>name</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>the name of the point </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="19" column="1" bodyfile="testing_doxygen/test.h" bodystart="19" bodyend="-1"/> + </memberdef> + <memberdef kind="variable" id="structpoint3d_1a809caeed7433b4f182554ef12f8705a9" prot="public" static="no" mutable="no"> + <type>int</type> + <definition>int point3d::namelength</definition> + <argsstring></argsstring> + <name>namelength</name> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>the size of the point name </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="20" column="1" bodyfile="testing_doxygen/test.h" bodystart="20" bodyend="-1"/> + </memberdef> + </sectiondef> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>A structure to represent 3d vectors </para> </detaileddescription> + <location file="testing_doxygen/test.h" line="9" column="1" bodyfile="testing_doxygen/test.h" bodystart="8" bodyend="22"/> + <listofallmembers> + <member refid="structpoint3d_1afb9519af724fab8e88b239b60c864a6d" prot="public" virt="non-virtual"><scope>point3d</scope><name>name</name></member> + <member refid="structpoint3d_1a809caeed7433b4f182554ef12f8705a9" prot="public" virt="non-virtual"><scope>point3d</scope><name>namelength</name></member> + <member refid="structpoint3d_1ac16dfc549efe0bd9b819ea4a9a8462a9" prot="public" virt="non-virtual"><scope>point3d</scope><name>x</name></member> + <member refid="structpoint3d_1af76302f192767fd9546392affbe5631c" prot="public" virt="non-virtual"><scope>point3d</scope><name>y</name></member> + <member refid="structpoint3d_1a96e63d7cd720242d2f79287b04a503e1" prot="public" virt="non-virtual"><scope>point3d</scope><name>z</name></member> + </listofallmembers> + </compounddef> +</doxygen> diff --git a/docs/Doxygen/xml/test_8h.xml b/docs/Doxygen/xml/test_8h.xml new file mode 100644 index 0000000000000000000000000000000000000000..62d975f765ddffd118af3f5697467b6bae365411 --- /dev/null +++ b/docs/Doxygen/xml/test_8h.xml @@ -0,0 +1,134 @@ +<?xml version='1.0' encoding='UTF-8' standalone='no'?> +<doxygen xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="compound.xsd" version="1.8.13"> + <compounddef id="test_8h" kind="file" language="C++"> + <compoundname>test.h</compoundname> + <innerclass refid="structpoint3d" prot="public">point3d</innerclass> + <sectiondef kind="define"> + <memberdef kind="define" id="test_8h_1a38ee349162bf908751d46fe7b21204e1" prot="public" static="no"> + <name>BINARY_C_PYTHON_H</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="3" column="9" bodyfile="testing_doxygen/test.h" bodystart="3" bodyend="-1"/> + </memberdef> + <memberdef kind="define" id="test_8h_1ab3a75b19ea9b28f47fcfc0012c06715c" prot="public" static="no"> + <name>BINARY_C_APITEST_VERSION</name> + <initializer>0.1</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="57" column="9" bodyfile="testing_doxygen/test.h" bodystart="57" bodyend="-1"/> + </memberdef> + <memberdef kind="define" id="test_8h_1a01f02a9dd2aeb8df6a0e319ff60589f8" prot="public" static="no"> + <name>APIprint</name> + <param><defname>...</defname></param> + <initializer>APIprintf(__VA_ARGS__);</initializer> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="58" column="9" bodyfile="testing_doxygen/test.h" bodystart="58" bodyend="-1"/> + </memberdef> + <memberdef kind="define" id="test_8h_1a0b64516451f088cc73b3a76d07e50cee" prot="public" static="no"> + <name>NO_OUTPUT</name> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="59" column="9" bodyfile="testing_doxygen/test.h" bodystart="59" bodyend="-1"/> + </memberdef> + </sectiondef> + <sectiondef kind="func"> + <memberdef kind="function" id="test_8h_1af758c6cbee7cc9546fbdb8a8b502abdb" prot="public" static="no" const="no" explicit="no" inline="no" virt="non-virtual"> + <type>int</type> + <definition>int run_binary</definition> + <argsstring>(char *argstring, char **const outstring, char **const errorstring)</argsstring> + <name>run_binary</name> + <param> + <type>char *</type> + <declname>argstring</declname> + </param> + <param> + <type>char **const</type> + <declname>outstring</declname> + </param> + <param> + <type>char **const</type> + <declname>errorstring</declname> + </param> + <briefdescription> + </briefdescription> + <detaileddescription> +<para>Function to run a binary </para> </detaileddescription> + <inbodydescription> + </inbodydescription> + <location file="testing_doxygen/test.h" line="35" column="1"/> + </memberdef> + </sectiondef> + <briefdescription> + </briefdescription> + <detaileddescription> + </detaileddescription> + <programlisting> +<codeline lineno="1"><highlight class="preprocessor">#pragma<sp/>once</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="2"><highlight class="normal"></highlight><highlight class="preprocessor">#ifndef<sp/>BINARY_C_PYTHON_H</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="3"><highlight class="normal"></highlight><highlight class="preprocessor">#define<sp/>BINARY_C_PYTHON_H</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="4"><highlight class="normal"></highlight></codeline> +<codeline lineno="8" refid="structpoint3d" refkind="compound"><highlight class="keyword">typedef</highlight><highlight class="normal"><sp/></highlight><highlight class="keyword">struct</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="9"><highlight class="normal">{</highlight></codeline> +<codeline lineno="11" refid="structpoint3d_1ac16dfc549efe0bd9b819ea4a9a8462a9" refkind="member"><highlight class="normal"><sp/><sp/></highlight><highlight class="keywordtype">double</highlight><highlight class="normal"><sp/><ref refid="structpoint3d_1ac16dfc549efe0bd9b819ea4a9a8462a9" kindref="member">x</ref><sp/>;<sp/></highlight></codeline> +<codeline lineno="12" refid="structpoint3d_1af76302f192767fd9546392affbe5631c" refkind="member"><highlight class="normal"><sp/><sp/></highlight><highlight class="keywordtype">double</highlight><highlight class="normal"><sp/><ref refid="structpoint3d_1af76302f192767fd9546392affbe5631c" kindref="member">y</ref><sp/>;<sp/></highlight></codeline> +<codeline lineno="13" refid="structpoint3d_1a96e63d7cd720242d2f79287b04a503e1" refkind="member"><highlight class="normal"><sp/><sp/></highlight><highlight class="keywordtype">double</highlight><highlight class="normal"><sp/><ref refid="structpoint3d_1a96e63d7cd720242d2f79287b04a503e1" kindref="member">z</ref><sp/>;<sp/></highlight></codeline> +<codeline lineno="19" refid="structpoint3d_1afb9519af724fab8e88b239b60c864a6d" refkind="member"><highlight class="normal"><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/><ref refid="structpoint3d_1afb9519af724fab8e88b239b60c864a6d" kindref="member">name</ref><sp/><sp/><sp/><sp/><sp/><sp/><sp/>;<sp/></highlight></codeline> +<codeline lineno="20" refid="structpoint3d_1a809caeed7433b4f182554ef12f8705a9" refkind="member"><highlight class="normal"><sp/><sp/></highlight><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/><sp/><sp/><sp/><ref refid="structpoint3d_1a809caeed7433b4f182554ef12f8705a9" kindref="member">namelength</ref><sp/>;<sp/></highlight></codeline> +<codeline lineno="22"><highlight class="normal">}<sp/><ref refid="structpoint3d" kindref="compound">point3d</ref><sp/>;</highlight></codeline> +<codeline lineno="23"><highlight class="normal"></highlight></codeline> +<codeline lineno="24"><highlight class="normal"></highlight></codeline> +<codeline lineno="25"><highlight class="normal"></highlight><highlight class="comment">/*</highlight></codeline> +<codeline lineno="26"><highlight class="comment"><sp/>*<sp/>Include<sp/>binary_C's<sp/>API</highlight></codeline> +<codeline lineno="27"><highlight class="comment"><sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="28"><highlight class="normal"></highlight><highlight class="comment">//#include<sp/>"binary_c_API.h"</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="29"><highlight class="normal"></highlight><highlight class="comment">//#include<sp/>"binary_c_API_prototypes.h"</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="30"><highlight class="normal"></highlight></codeline> +<codeline lineno="31"><highlight class="normal"></highlight><highlight class="comment">/*<sp/>Binary_c's<sp/>python<sp/>API<sp/>prototypes<sp/>*/</highlight></codeline> +<codeline lineno="35"><highlight class="keywordtype">int</highlight><highlight class="normal"><sp/>run_binary<sp/>(</highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>*<sp/>argstring,</highlight></codeline> +<codeline lineno="36"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>outstring,</highlight></codeline> +<codeline lineno="37"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="keywordtype">char</highlight><highlight class="normal"><sp/>**<sp/></highlight><highlight class="keyword">const</highlight><highlight class="normal"><sp/>errorstring);</highlight></codeline> +<codeline lineno="38"><highlight class="normal"></highlight></codeline> +<codeline lineno="39"><highlight class="normal"><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/></highlight><highlight class="comment">//<sp/>size_t<sp/>*<sp/>const<sp/>nbytes);</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="40"><highlight class="normal"></highlight></codeline> +<codeline lineno="41"><highlight class="normal"></highlight><highlight class="comment">//<sp/>int<sp/>run_binary_with_logfile<sp/>(char<sp/>*<sp/>argstring,</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="42"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>char<sp/>**<sp/>const<sp/>outstring,</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="43"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>char<sp/>**<sp/>const<sp/>errorstring,</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="44"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>size_t<sp/>*<sp/>const<sp/>nbytes);</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="45"><highlight class="normal"></highlight></codeline> +<codeline lineno="46"><highlight class="normal"></highlight><highlight class="comment">//<sp/>int<sp/>run_binary_custom_logging(char<sp/>*<sp/>argstring,</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="47"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>long<sp/>int<sp/>func_memaddr,</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="48"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>char<sp/>**<sp/>const<sp/>buffer,</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="49"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>char<sp/>**<sp/>const<sp/>error_buffer,</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="50"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>size_t<sp/>*<sp/>const<sp/>nbytes);</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="51"><highlight class="normal"></highlight></codeline> +<codeline lineno="52"><highlight class="normal"></highlight><highlight class="comment">//<sp/>int<sp/>return_arglines(char<sp/>**<sp/>const<sp/>outstring,</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="53"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>char<sp/>**<sp/>const<sp/>errorstring,<sp/><sp/></highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="54"><highlight class="normal"></highlight><highlight class="comment">//<sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/><sp/>size_t<sp/>*<sp/>const<sp/>nbytes);</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="55"><highlight class="normal"></highlight></codeline> +<codeline lineno="56"><highlight class="normal"></highlight><highlight class="comment">/*<sp/>C<sp/>macros<sp/>*/</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="57"><highlight class="normal"></highlight><highlight class="preprocessor">#define<sp/>BINARY_C_APITEST_VERSION<sp/>0.1</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="58"><highlight class="normal"></highlight><highlight class="preprocessor">#define<sp/>APIprint(...)<sp/>APIprintf(__VA_ARGS__);</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="59"><highlight class="normal"></highlight><highlight class="preprocessor">#define<sp/>NO_OUTPUT</highlight><highlight class="normal"></highlight></codeline> +<codeline lineno="60"><highlight class="normal"></highlight></codeline> +<codeline lineno="61"><highlight class="normal"></highlight><highlight class="preprocessor">#endif<sp/>//<sp/>BINARY_C_C_PYTHON_H</highlight></codeline> + </programlisting> + <location file="testing_doxygen/test.h"/> + </compounddef> +</doxygen> diff --git a/docs/Makefile b/docs/Makefile new file mode 100644 index 0000000000000000000000000000000000000000..d0c3cbf1020d5c292abdedf27627c6abe25e2293 --- /dev/null +++ b/docs/Makefile @@ -0,0 +1,20 @@ +# Minimal makefile for Sphinx documentation +# + +# You can set these variables from the command line, and also +# from the environment for the first two. +SPHINXOPTS ?= +SPHINXBUILD ?= sphinx-build +SOURCEDIR = source +BUILDDIR = build + +# Put it first so that "make" without argument is like "make help". +help: + @$(SPHINXBUILD) -M help "$(SOURCEDIR)" "$(BUILDDIR)" $(SPHINXOPTS) $(O) + +.PHONY: help Makefile + +# Catch-all target: route all unknown targets to Sphinx using the new +# "make mode" option. $(O) is meant as a shortcut for $(SPHINXOPTS). +%: Makefile + @$(SPHINXBUILD) -M $@ "$(SOURCEDIR)" "$(BUILDDIR)" $(SPHINXOPTS) $(O) diff --git a/docs/build/doctrees/custom_logging_functions.doctree b/docs/build/doctrees/custom_logging_functions.doctree new file mode 100644 index 0000000000000000000000000000000000000000..57d867a709d23598a3e7c32b274773e390ec212c Binary files /dev/null and b/docs/build/doctrees/custom_logging_functions.doctree differ diff --git a/docs/build/doctrees/environment.pickle b/docs/build/doctrees/environment.pickle new file mode 100644 index 0000000000000000000000000000000000000000..40e30452acbbc1fde3cbb7440ff96e665dc6bbe1 Binary files /dev/null and b/docs/build/doctrees/environment.pickle differ diff --git a/docs/build/doctrees/examples.doctree b/docs/build/doctrees/examples.doctree new file mode 100644 index 0000000000000000000000000000000000000000..0d72b96b86b24199b553333048e925ba14e25432 Binary files /dev/null and b/docs/build/doctrees/examples.doctree differ diff --git a/docs/build/doctrees/functions.doctree b/docs/build/doctrees/functions.doctree new file mode 100644 index 0000000000000000000000000000000000000000..d13d32747a4b330aa519fe15d03a16f5bd0f4642 Binary files /dev/null and b/docs/build/doctrees/functions.doctree differ diff --git a/docs/build/doctrees/index.doctree b/docs/build/doctrees/index.doctree new file mode 100644 index 0000000000000000000000000000000000000000..c7b1ab2268d1229e141199d9e82dbc5aeee8c451 Binary files /dev/null and b/docs/build/doctrees/index.doctree differ diff --git a/docs/build/doctrees/modules.doctree b/docs/build/doctrees/modules.doctree new file mode 100644 index 0000000000000000000000000000000000000000..b33b192d57623a291830309bcb0ceceb8d1d03e0 Binary files /dev/null and b/docs/build/doctrees/modules.doctree differ diff --git a/docs/build/doctrees/readme_link.doctree b/docs/build/doctrees/readme_link.doctree new file mode 100644 index 0000000000000000000000000000000000000000..b6fc2602ddd43ca15f71a830fadc20040307b4c3 Binary files /dev/null and b/docs/build/doctrees/readme_link.doctree differ diff --git a/docs/build/doctrees/stellar_types.doctree b/docs/build/doctrees/stellar_types.doctree new file mode 100644 index 0000000000000000000000000000000000000000..e0e8a376695f522032643b643be5617cfec5cd77 Binary files /dev/null and b/docs/build/doctrees/stellar_types.doctree differ diff --git a/docs/build/html/.buildinfo b/docs/build/html/.buildinfo new file mode 100644 index 0000000000000000000000000000000000000000..b07a2a24ba837696223eeced0eecaf6050daf565 --- /dev/null +++ b/docs/build/html/.buildinfo @@ -0,0 +1,4 @@ +# Sphinx build info version 1 +# This file hashes the configuration used when building these files. When it is not found, a full rebuild will be done. +config: a2f3f39afa8c44b6089b6708fe401876 +tags: 645f666f9bcd5a90fca523b33c5a78b7 diff --git a/docs/build/html/_sources/custom_logging_functions.rst.txt b/docs/build/html/_sources/custom_logging_functions.rst.txt new file mode 100644 index 0000000000000000000000000000000000000000..84f5bcf9954aab034c5ee509f3be6038e5bf7c51 --- /dev/null +++ b/docs/build/html/_sources/custom_logging_functions.rst.txt @@ -0,0 +1,7 @@ +custom\_logging\_functions module +================================= + +.. automodule:: custom_logging_functions + :members: + :undoc-members: + :show-inheritance: diff --git a/docs/build/html/_sources/examples.rst.txt b/docs/build/html/_sources/examples.rst.txt new file mode 100644 index 0000000000000000000000000000000000000000..619224b9c847e5cb18bc55eb22c43f60382e5398 --- /dev/null +++ b/docs/build/html/_sources/examples.rst.txt @@ -0,0 +1,9 @@ +examples +======== +This chapter serves to document several of the example usages + + +.. automodule:: examples.examples + :members: + :undoc-members: + :show-inheritance: \ No newline at end of file diff --git a/docs/build/html/_sources/functions.rst.txt b/docs/build/html/_sources/functions.rst.txt new file mode 100644 index 0000000000000000000000000000000000000000..087d090c05d40e4c58022adbc9fb1d41b0b84507 --- /dev/null +++ b/docs/build/html/_sources/functions.rst.txt @@ -0,0 +1,7 @@ +functions module +================ + +.. automodule:: functions + :members: + :undoc-members: + :show-inheritance: diff --git a/docs/build/html/_sources/index.rst.txt b/docs/build/html/_sources/index.rst.txt new file mode 100644 index 0000000000000000000000000000000000000000..cae3549628f939c62fbde8504f9c57b0b3be7992 --- /dev/null +++ b/docs/build/html/_sources/index.rst.txt @@ -0,0 +1,23 @@ +.. binary_c-python documentation master file, created by + sphinx-quickstart on Wed Nov 13 11:43:40 2019. + You can adapt this file completely to your liking, but it should at least + contain the root `toctree` directive. + +Welcome to binary_c-python's documentation! +=========================================== + +.. toctree:: + :maxdepth: 4 + :caption: Contents: + + readme_link + examples + modules + + +Indices and tables +================== + +* :ref:`genindex` +* :ref:`modindex` +* :ref:`search` diff --git a/docs/build/html/_sources/modules.rst.txt b/docs/build/html/_sources/modules.rst.txt new file mode 100644 index 0000000000000000000000000000000000000000..cc9bb7deb7eda24ee72102d53594ddf309f48265 --- /dev/null +++ b/docs/build/html/_sources/modules.rst.txt @@ -0,0 +1,9 @@ +binaryc_python_utils +==================== + +.. toctree:: + :maxdepth: 4 + + custom_logging_functions + functions +.. stellar_types diff --git a/docs/build/html/_sources/readme_link.rst.txt b/docs/build/html/_sources/readme_link.rst.txt new file mode 100644 index 0000000000000000000000000000000000000000..3bd447c431e4695451c11a92ad57b5829d9059af --- /dev/null +++ b/docs/build/html/_sources/readme_link.rst.txt @@ -0,0 +1 @@ +.. mdinclude:: ../../README.md diff --git a/docs/build/html/_sources/stellar_types.rst.txt b/docs/build/html/_sources/stellar_types.rst.txt new file mode 100644 index 0000000000000000000000000000000000000000..4fbcab371f65b4e07137de53ecf0d7c10923cd0e --- /dev/null +++ b/docs/build/html/_sources/stellar_types.rst.txt @@ -0,0 +1,7 @@ +stellar\_types module +===================== + +.. automodule:: stellar_types + :members: + :undoc-members: + :show-inheritance: diff --git a/docs/build/html/_static/alabaster.css b/docs/build/html/_static/alabaster.css new file mode 100644 index 0000000000000000000000000000000000000000..0eddaeb07d19bffb50884d7bd7996418b6461a09 --- /dev/null +++ b/docs/build/html/_static/alabaster.css @@ -0,0 +1,701 @@ +@import url("basic.css"); + +/* -- page layout ----------------------------------------------------------- */ + +body { + font-family: Georgia, serif; + font-size: 17px; + background-color: #fff; + color: #000; + margin: 0; + padding: 0; +} + + +div.document { + width: 940px; + margin: 30px auto 0 auto; +} + +div.documentwrapper { + float: left; + width: 100%; +} + +div.bodywrapper { + margin: 0 0 0 220px; +} + +div.sphinxsidebar { + width: 220px; + font-size: 14px; + line-height: 1.5; +} + +hr { + border: 1px solid #B1B4B6; +} + +div.body { + background-color: #fff; + color: #3E4349; + padding: 0 30px 0 30px; +} + +div.body > .section { + text-align: left; +} + +div.footer { + width: 940px; + margin: 20px auto 30px auto; + font-size: 14px; + color: #888; + text-align: right; +} + +div.footer a { + color: #888; +} + +p.caption { + font-family: inherit; + font-size: inherit; +} + + +div.relations { + display: none; +} + + +div.sphinxsidebar a { + color: #444; + text-decoration: none; + border-bottom: 1px dotted #999; +} + +div.sphinxsidebar a:hover { + border-bottom: 1px solid #999; +} + +div.sphinxsidebarwrapper { + padding: 18px 10px; +} + +div.sphinxsidebarwrapper p.logo { + padding: 0; + margin: -10px 0 0 0px; + text-align: center; +} + +div.sphinxsidebarwrapper h1.logo { + margin-top: -10px; + text-align: center; + margin-bottom: 5px; + text-align: left; +} + +div.sphinxsidebarwrapper h1.logo-name { + margin-top: 0px; +} + +div.sphinxsidebarwrapper p.blurb { + margin-top: 0; + font-style: normal; +} + +div.sphinxsidebar h3, +div.sphinxsidebar h4 { + font-family: Georgia, serif; + color: #444; + font-size: 24px; + font-weight: normal; + margin: 0 0 5px 0; + padding: 0; +} + +div.sphinxsidebar h4 { + font-size: 20px; +} + +div.sphinxsidebar h3 a { + color: #444; +} + +div.sphinxsidebar p.logo a, +div.sphinxsidebar h3 a, +div.sphinxsidebar p.logo a:hover, +div.sphinxsidebar h3 a:hover { + border: none; +} + +div.sphinxsidebar p { + color: #555; + margin: 10px 0; +} + +div.sphinxsidebar ul { + margin: 10px 0; + padding: 0; + color: #000; +} + +div.sphinxsidebar ul li.toctree-l1 > a { + font-size: 120%; +} + +div.sphinxsidebar ul li.toctree-l2 > a { + font-size: 110%; +} + +div.sphinxsidebar input { + border: 1px solid #CCC; + font-family: Georgia, serif; + font-size: 1em; +} + +div.sphinxsidebar hr { + border: none; + height: 1px; + color: #AAA; + background: #AAA; + + text-align: left; + margin-left: 0; + width: 50%; +} + +div.sphinxsidebar .badge { + border-bottom: none; +} + +div.sphinxsidebar .badge:hover { + border-bottom: none; +} + +/* To address an issue with donation coming after search */ +div.sphinxsidebar h3.donation { + margin-top: 10px; +} + +/* -- body styles ----------------------------------------------------------- */ + +a { + color: #004B6B; + text-decoration: underline; +} + +a:hover { + color: #6D4100; + text-decoration: underline; +} + +div.body h1, +div.body h2, +div.body h3, +div.body h4, +div.body h5, +div.body h6 { + font-family: Georgia, serif; + font-weight: normal; + margin: 30px 0px 10px 0px; + padding: 0; +} + +div.body h1 { margin-top: 0; padding-top: 0; font-size: 240%; } +div.body h2 { font-size: 180%; } +div.body h3 { font-size: 150%; } +div.body h4 { font-size: 130%; } +div.body h5 { font-size: 100%; } +div.body h6 { font-size: 100%; } + +a.headerlink { + color: #DDD; + padding: 0 4px; + text-decoration: none; +} + +a.headerlink:hover { + color: #444; + background: #EAEAEA; +} + +div.body p, div.body dd, div.body li { + line-height: 1.4em; +} + +div.admonition { + margin: 20px 0px; + padding: 10px 30px; + background-color: #EEE; + border: 1px solid #CCC; +} + +div.admonition tt.xref, div.admonition code.xref, div.admonition a tt { + background-color: #FBFBFB; + border-bottom: 1px solid #fafafa; +} + +div.admonition p.admonition-title { + font-family: Georgia, serif; + font-weight: normal; + font-size: 24px; + margin: 0 0 10px 0; + padding: 0; + line-height: 1; +} + +div.admonition p.last { + margin-bottom: 0; +} + +div.highlight { + background-color: #fff; +} + +dt:target, .highlight { + background: #FAF3E8; +} + +div.warning { + background-color: #FCC; + border: 1px solid #FAA; +} + +div.danger { + background-color: #FCC; + border: 1px solid #FAA; + -moz-box-shadow: 2px 2px 4px #D52C2C; + -webkit-box-shadow: 2px 2px 4px #D52C2C; + box-shadow: 2px 2px 4px #D52C2C; +} + +div.error { + background-color: #FCC; + border: 1px solid #FAA; + -moz-box-shadow: 2px 2px 4px #D52C2C; + -webkit-box-shadow: 2px 2px 4px #D52C2C; + box-shadow: 2px 2px 4px #D52C2C; +} + +div.caution { + background-color: #FCC; + border: 1px solid #FAA; +} + +div.attention { + background-color: #FCC; + border: 1px solid #FAA; +} + +div.important { + background-color: #EEE; + border: 1px solid #CCC; +} + +div.note { + background-color: #EEE; + border: 1px solid #CCC; +} + +div.tip { + background-color: #EEE; + border: 1px solid #CCC; +} + +div.hint { + background-color: #EEE; + border: 1px solid #CCC; +} + +div.seealso { + background-color: #EEE; + border: 1px solid #CCC; +} + +div.topic { + background-color: #EEE; +} + +p.admonition-title { + display: inline; +} + +p.admonition-title:after { + content: ":"; +} + +pre, tt, code { + font-family: 'Consolas', 'Menlo', 'DejaVu Sans Mono', 'Bitstream Vera Sans Mono', monospace; + font-size: 0.9em; +} + +.hll { + background-color: #FFC; + margin: 0 -12px; + padding: 0 12px; + display: block; +} + +img.screenshot { +} + +tt.descname, tt.descclassname, code.descname, code.descclassname { + font-size: 0.95em; +} + +tt.descname, code.descname { + padding-right: 0.08em; +} + +img.screenshot { + -moz-box-shadow: 2px 2px 4px #EEE; + -webkit-box-shadow: 2px 2px 4px #EEE; + box-shadow: 2px 2px 4px #EEE; +} + +table.docutils { + border: 1px solid #888; + -moz-box-shadow: 2px 2px 4px #EEE; + -webkit-box-shadow: 2px 2px 4px #EEE; + box-shadow: 2px 2px 4px #EEE; +} + +table.docutils td, table.docutils th { + border: 1px solid #888; + padding: 0.25em 0.7em; +} + +table.field-list, table.footnote { + border: none; + -moz-box-shadow: none; + -webkit-box-shadow: none; + box-shadow: none; +} + +table.footnote { + margin: 15px 0; + width: 100%; + border: 1px solid #EEE; + background: #FDFDFD; + font-size: 0.9em; +} + +table.footnote + table.footnote { + margin-top: -15px; + border-top: none; +} + +table.field-list th { + padding: 0 0.8em 0 0; +} + +table.field-list td { + padding: 0; +} + +table.field-list p { + margin-bottom: 0.8em; +} + +/* Cloned from + * https://github.com/sphinx-doc/sphinx/commit/ef60dbfce09286b20b7385333d63a60321784e68 + */ +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +table.footnote td.label { + width: .1px; + padding: 0.3em 0 0.3em 0.5em; +} + +table.footnote td { + padding: 0.3em 0.5em; +} + +dl { + margin: 0; + padding: 0; +} + +dl dd { + margin-left: 30px; +} + +blockquote { + margin: 0 0 0 30px; + padding: 0; +} + +ul, ol { + /* Matches the 30px from the narrow-screen "li > ul" selector below */ + margin: 10px 0 10px 30px; + padding: 0; +} + +pre { + background: #EEE; + padding: 7px 30px; + margin: 15px 0px; + line-height: 1.3em; +} + +div.viewcode-block:target { + background: #ffd; +} + +dl pre, blockquote pre, li pre { + margin-left: 0; + padding-left: 30px; +} + +tt, code { + background-color: #ecf0f3; + color: #222; + /* padding: 1px 2px; */ +} + +tt.xref, code.xref, a tt { + background-color: #FBFBFB; + border-bottom: 1px solid #fff; +} + +a.reference { + text-decoration: none; + border-bottom: 1px dotted #004B6B; +} + +/* Don't put an underline on images */ +a.image-reference, a.image-reference:hover { + border-bottom: none; +} + +a.reference:hover { + border-bottom: 1px solid #6D4100; +} + +a.footnote-reference { + text-decoration: none; + font-size: 0.7em; + vertical-align: top; + border-bottom: 1px dotted #004B6B; +} + +a.footnote-reference:hover { + border-bottom: 1px solid #6D4100; +} + +a:hover tt, a:hover code { + background: #EEE; +} + + +@media screen and (max-width: 870px) { + + div.sphinxsidebar { + display: none; + } + + div.document { + width: 100%; + + } + + div.documentwrapper { + margin-left: 0; + margin-top: 0; + margin-right: 0; + margin-bottom: 0; + } + + div.bodywrapper { + margin-top: 0; + margin-right: 0; + margin-bottom: 0; + margin-left: 0; + } + + ul { + margin-left: 0; + } + + li > ul { + /* Matches the 30px from the "ul, ol" selector above */ + margin-left: 30px; + } + + .document { + width: auto; + } + + .footer { + width: auto; + } + + .bodywrapper { + margin: 0; + } + + .footer { + width: auto; + } + + .github { + display: none; + } + + + +} + + + +@media screen and (max-width: 875px) { + + body { + margin: 0; + padding: 20px 30px; + } + + div.documentwrapper { + float: none; + background: #fff; + } + + div.sphinxsidebar { + display: block; + float: none; + width: 102.5%; + margin: 50px -30px -20px -30px; + padding: 10px 20px; + background: #333; + color: #FFF; + } + + div.sphinxsidebar h3, div.sphinxsidebar h4, div.sphinxsidebar p, + div.sphinxsidebar h3 a { + color: #fff; + } + + div.sphinxsidebar a { + color: #AAA; + } + + div.sphinxsidebar p.logo { + display: none; + } + + div.document { + width: 100%; + margin: 0; + } + + div.footer { + display: none; + } + + div.bodywrapper { + margin: 0; + } + + div.body { + min-height: 0; + padding: 0; + } + + .rtd_doc_footer { + display: none; + } + + .document { + width: auto; + } + + .footer { + width: auto; + } + + .footer { + width: auto; + } + + .github { + display: none; + } +} + + +/* misc. */ + +.revsys-inline { + display: none!important; +} + +/* Make nested-list/multi-paragraph items look better in Releases changelog + * pages. Without this, docutils' magical list fuckery causes inconsistent + * formatting between different release sub-lists. + */ +div#changelog > div.section > ul > li > p:only-child { + margin-bottom: 0; +} + +/* Hide fugly table cell borders in ..bibliography:: directive output */ +table.docutils.citation, table.docutils.citation td, table.docutils.citation th { + border: none; + /* Below needed in some edge cases; if not applied, bottom shadows appear */ + -moz-box-shadow: none; + -webkit-box-shadow: none; + box-shadow: none; +} + + +/* relbar */ + +.related { + line-height: 30px; + width: 100%; + font-size: 0.9rem; +} + +.related.top { + border-bottom: 1px solid #EEE; + margin-bottom: 20px; +} + +.related.bottom { + border-top: 1px solid #EEE; +} + +.related ul { + padding: 0; + margin: 0; + list-style: none; +} + +.related li { + display: inline; +} + +nav#rellinks { + float: right; +} + +nav#rellinks li+li:before { + content: "|"; +} + +nav#breadcrumbs li+li:before { + content: "\00BB"; +} + +/* Hide certain items when printing */ +@media print { + div.related { + display: none; + } +} \ No newline at end of file diff --git a/docs/build/html/_static/basic.css b/docs/build/html/_static/basic.css new file mode 100644 index 0000000000000000000000000000000000000000..ea6972d55273ba89dd060c362ed5662aa53049dd --- /dev/null +++ b/docs/build/html/_static/basic.css @@ -0,0 +1,764 @@ +/* + * basic.css + * ~~~~~~~~~ + * + * Sphinx stylesheet -- basic theme. + * + * :copyright: Copyright 2007-2019 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/* -- main layout ----------------------------------------------------------- */ + +div.clearer { + clear: both; +} + +/* -- relbar ---------------------------------------------------------------- */ + +div.related { + width: 100%; + font-size: 90%; +} + +div.related h3 { + display: none; +} + +div.related ul { + margin: 0; + padding: 0 0 0 10px; + list-style: none; +} + +div.related li { + display: inline; +} + +div.related li.right { + float: right; + margin-right: 5px; +} + +/* -- sidebar --------------------------------------------------------------- */ + +div.sphinxsidebarwrapper { + padding: 10px 5px 0 10px; +} + +div.sphinxsidebar { + float: left; + width: 230px; + margin-left: -100%; + font-size: 90%; + word-wrap: break-word; + overflow-wrap : break-word; +} + +div.sphinxsidebar ul { + list-style: none; +} + +div.sphinxsidebar ul ul, +div.sphinxsidebar ul.want-points { + margin-left: 20px; + list-style: square; +} + +div.sphinxsidebar ul ul { + margin-top: 0; + margin-bottom: 0; +} + +div.sphinxsidebar form { + margin-top: 10px; +} + +div.sphinxsidebar input { + border: 1px solid #98dbcc; + font-family: sans-serif; + font-size: 1em; +} + +div.sphinxsidebar #searchbox form.search { + overflow: hidden; +} + +div.sphinxsidebar #searchbox input[type="text"] { + float: left; + width: 80%; + padding: 0.25em; + box-sizing: border-box; +} + +div.sphinxsidebar #searchbox input[type="submit"] { + float: left; + width: 20%; + border-left: none; + padding: 0.25em; + box-sizing: border-box; +} + + +img { + border: 0; + max-width: 100%; +} + +/* -- search page ----------------------------------------------------------- */ + +ul.search { + margin: 10px 0 0 20px; + padding: 0; +} + +ul.search li { + padding: 5px 0 5px 20px; + background-image: url(file.png); + background-repeat: no-repeat; + background-position: 0 7px; +} + +ul.search li a { + font-weight: bold; +} + +ul.search li div.context { + color: #888; + margin: 2px 0 0 30px; + text-align: left; +} + +ul.keywordmatches li.goodmatch a { + font-weight: bold; +} + +/* -- index page ------------------------------------------------------------ */ + +table.contentstable { + width: 90%; + margin-left: auto; + margin-right: auto; +} + +table.contentstable p.biglink { + line-height: 150%; +} + +a.biglink { + font-size: 1.3em; +} + +span.linkdescr { + font-style: italic; + padding-top: 5px; + font-size: 90%; +} + +/* -- general index --------------------------------------------------------- */ + +table.indextable { + width: 100%; +} + +table.indextable td { + text-align: left; + vertical-align: top; +} + +table.indextable ul { + margin-top: 0; + margin-bottom: 0; + list-style-type: none; +} + +table.indextable > tbody > tr > td > ul { + padding-left: 0em; +} + +table.indextable tr.pcap { + height: 10px; +} + +table.indextable tr.cap { + margin-top: 10px; + background-color: #f2f2f2; +} + +img.toggler { + margin-right: 3px; + margin-top: 3px; + cursor: pointer; +} + +div.modindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +div.genindex-jumpbox { + border-top: 1px solid #ddd; + border-bottom: 1px solid #ddd; + margin: 1em 0 1em 0; + padding: 0.4em; +} + +/* -- domain module index --------------------------------------------------- */ + +table.modindextable td { + padding: 2px; + border-collapse: collapse; +} + +/* -- general body styles --------------------------------------------------- */ + +div.body { + min-width: 450px; + max-width: 800px; +} + +div.body p, div.body dd, div.body li, div.body blockquote { + -moz-hyphens: auto; + -ms-hyphens: auto; + -webkit-hyphens: auto; + hyphens: auto; +} + +a.headerlink { + visibility: hidden; +} + +a.brackets:before, +span.brackets > a:before{ + content: "["; +} + +a.brackets:after, +span.brackets > a:after { + content: "]"; +} + +h1:hover > a.headerlink, +h2:hover > a.headerlink, +h3:hover > a.headerlink, +h4:hover > a.headerlink, +h5:hover > a.headerlink, +h6:hover > a.headerlink, +dt:hover > a.headerlink, +caption:hover > a.headerlink, +p.caption:hover > a.headerlink, +div.code-block-caption:hover > a.headerlink { + visibility: visible; +} + +div.body p.caption { + text-align: inherit; +} + +div.body td { + text-align: left; +} + +.first { + margin-top: 0 !important; +} + +p.rubric { + margin-top: 30px; + font-weight: bold; +} + +img.align-left, .figure.align-left, object.align-left { + clear: left; + float: left; + margin-right: 1em; +} + +img.align-right, .figure.align-right, object.align-right { + clear: right; + float: right; + margin-left: 1em; +} + +img.align-center, .figure.align-center, object.align-center { + display: block; + margin-left: auto; + margin-right: auto; +} + +img.align-default, .figure.align-default { + display: block; + margin-left: auto; + margin-right: auto; +} + +.align-left { + text-align: left; +} + +.align-center { + text-align: center; +} + +.align-default { + text-align: center; +} + +.align-right { + text-align: right; +} + +/* -- sidebars -------------------------------------------------------------- */ + +div.sidebar { + margin: 0 0 0.5em 1em; + border: 1px solid #ddb; + padding: 7px 7px 0 7px; + background-color: #ffe; + width: 40%; + float: right; +} + +p.sidebar-title { + font-weight: bold; +} + +/* -- topics ---------------------------------------------------------------- */ + +div.topic { + border: 1px solid #ccc; + padding: 7px 7px 0 7px; + margin: 10px 0 10px 0; +} + +p.topic-title { + font-size: 1.1em; + font-weight: bold; + margin-top: 10px; +} + +/* -- admonitions ----------------------------------------------------------- */ + +div.admonition { + margin-top: 10px; + margin-bottom: 10px; + padding: 7px; +} + +div.admonition dt { + font-weight: bold; +} + +div.admonition dl { + margin-bottom: 0; +} + +p.admonition-title { + margin: 0px 10px 5px 0px; + font-weight: bold; +} + +div.body p.centered { + text-align: center; + margin-top: 25px; +} + +/* -- tables ---------------------------------------------------------------- */ + +table.docutils { + border: 0; + border-collapse: collapse; +} + +table.align-center { + margin-left: auto; + margin-right: auto; +} + +table.align-default { + margin-left: auto; + margin-right: auto; +} + +table caption span.caption-number { + font-style: italic; +} + +table caption span.caption-text { +} + +table.docutils td, table.docutils th { + padding: 1px 8px 1px 5px; + border-top: 0; + border-left: 0; + border-right: 0; + border-bottom: 1px solid #aaa; +} + +table.footnote td, table.footnote th { + border: 0 !important; +} + +th { + text-align: left; + padding-right: 5px; +} + +table.citation { + border-left: solid 1px gray; + margin-left: 1px; +} + +table.citation td { + border-bottom: none; +} + +th > p:first-child, +td > p:first-child { + margin-top: 0px; +} + +th > p:last-child, +td > p:last-child { + margin-bottom: 0px; +} + +/* -- figures --------------------------------------------------------------- */ + +div.figure { + margin: 0.5em; + padding: 0.5em; +} + +div.figure p.caption { + padding: 0.3em; +} + +div.figure p.caption span.caption-number { + font-style: italic; +} + +div.figure p.caption span.caption-text { +} + +/* -- field list styles ----------------------------------------------------- */ + +table.field-list td, table.field-list th { + border: 0 !important; +} + +.field-list ul { + margin: 0; + padding-left: 1em; +} + +.field-list p { + margin: 0; +} + +.field-name { + -moz-hyphens: manual; + -ms-hyphens: manual; + -webkit-hyphens: manual; + hyphens: manual; +} + +/* -- hlist styles ---------------------------------------------------------- */ + +table.hlist td { + vertical-align: top; +} + + +/* -- other body styles ----------------------------------------------------- */ + +ol.arabic { + list-style: decimal; +} + +ol.loweralpha { + list-style: lower-alpha; +} + +ol.upperalpha { + list-style: upper-alpha; +} + +ol.lowerroman { + list-style: lower-roman; +} + +ol.upperroman { + list-style: upper-roman; +} + +li > p:first-child { + margin-top: 0px; +} + +li > p:last-child { + margin-bottom: 0px; +} + +dl.footnote > dt, +dl.citation > dt { + float: left; +} + +dl.footnote > dd, +dl.citation > dd { + margin-bottom: 0em; +} + +dl.footnote > dd:after, +dl.citation > dd:after { + content: ""; + clear: both; +} + +dl.field-list { + display: grid; + grid-template-columns: fit-content(30%) auto; +} + +dl.field-list > dt { + font-weight: bold; + word-break: break-word; + padding-left: 0.5em; + padding-right: 5px; +} + +dl.field-list > dt:after { + content: ":"; +} + +dl.field-list > dd { + padding-left: 0.5em; + margin-top: 0em; + margin-left: 0em; + margin-bottom: 0em; +} + +dl { + margin-bottom: 15px; +} + +dd > p:first-child { + margin-top: 0px; +} + +dd ul, dd table { + margin-bottom: 10px; +} + +dd { + margin-top: 3px; + margin-bottom: 10px; + margin-left: 30px; +} + +dt:target, span.highlighted { + background-color: #fbe54e; +} + +rect.highlighted { + fill: #fbe54e; +} + +dl.glossary dt { + font-weight: bold; + font-size: 1.1em; +} + +.optional { + font-size: 1.3em; +} + +.sig-paren { + font-size: larger; +} + +.versionmodified { + font-style: italic; +} + +.system-message { + background-color: #fda; + padding: 5px; + border: 3px solid red; +} + +.footnote:target { + background-color: #ffa; +} + +.line-block { + display: block; + margin-top: 1em; + margin-bottom: 1em; +} + +.line-block .line-block { + margin-top: 0; + margin-bottom: 0; + margin-left: 1.5em; +} + +.guilabel, .menuselection { + font-family: sans-serif; +} + +.accelerator { + text-decoration: underline; +} + +.classifier { + font-style: oblique; +} + +.classifier:before { + font-style: normal; + margin: 0.5em; + content: ":"; +} + +abbr, acronym { + border-bottom: dotted 1px; + cursor: help; +} + +/* -- code displays --------------------------------------------------------- */ + +pre { + overflow: auto; + overflow-y: hidden; /* fixes display issues on Chrome browsers */ +} + +span.pre { + -moz-hyphens: none; + -ms-hyphens: none; + -webkit-hyphens: none; + hyphens: none; +} + +td.linenos pre { + padding: 5px 0px; + border: 0; + background-color: transparent; + color: #aaa; +} + +table.highlighttable { + margin-left: 0.5em; +} + +table.highlighttable td { + padding: 0 0.5em 0 0.5em; +} + +div.code-block-caption { + padding: 2px 5px; + font-size: small; +} + +div.code-block-caption code { + background-color: transparent; +} + +div.code-block-caption + div > div.highlight > pre { + margin-top: 0; +} + +div.code-block-caption span.caption-number { + padding: 0.1em 0.3em; + font-style: italic; +} + +div.code-block-caption span.caption-text { +} + +div.literal-block-wrapper { + padding: 1em 1em 0; +} + +div.literal-block-wrapper div.highlight { + margin: 0; +} + +code.descname { + background-color: transparent; + font-weight: bold; + font-size: 1.2em; +} + +code.descclassname { + background-color: transparent; +} + +code.xref, a code { + background-color: transparent; + font-weight: bold; +} + +h1 code, h2 code, h3 code, h4 code, h5 code, h6 code { + background-color: transparent; +} + +.viewcode-link { + float: right; +} + +.viewcode-back { + float: right; + font-family: sans-serif; +} + +div.viewcode-block:target { + margin: -1px -10px; + padding: 0 10px; +} + +/* -- math display ---------------------------------------------------------- */ + +img.math { + vertical-align: middle; +} + +div.body div.math p { + text-align: center; +} + +span.eqno { + float: right; +} + +span.eqno a.headerlink { + position: relative; + left: 0px; + z-index: 1; +} + +div.math:hover a.headerlink { + visibility: visible; +} + +/* -- printout stylesheet --------------------------------------------------- */ + +@media print { + div.document, + div.documentwrapper, + div.bodywrapper { + margin: 0 !important; + width: 100%; + } + + div.sphinxsidebar, + div.related, + div.footer, + #top-link { + display: none; + } +} \ No newline at end of file diff --git a/docs/build/html/_static/custom.css b/docs/build/html/_static/custom.css new file mode 100644 index 0000000000000000000000000000000000000000..2a924f1d6a8bc930c5296bdb2d5c2d3e39b04a1c --- /dev/null +++ b/docs/build/html/_static/custom.css @@ -0,0 +1 @@ +/* This file intentionally left blank. */ diff --git a/docs/build/html/_static/doctools.js b/docs/build/html/_static/doctools.js new file mode 100644 index 0000000000000000000000000000000000000000..b33f87fcb249ea9b0e0a07fa9c5f2595ea925709 --- /dev/null +++ b/docs/build/html/_static/doctools.js @@ -0,0 +1,314 @@ +/* + * doctools.js + * ~~~~~~~~~~~ + * + * Sphinx JavaScript utilities for all documentation. + * + * :copyright: Copyright 2007-2019 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +/** + * select a different prefix for underscore + */ +$u = _.noConflict(); + +/** + * make the code below compatible with browsers without + * an installed firebug like debugger +if (!window.console || !console.firebug) { + var names = ["log", "debug", "info", "warn", "error", "assert", "dir", + "dirxml", "group", "groupEnd", "time", "timeEnd", "count", "trace", + "profile", "profileEnd"]; + window.console = {}; + for (var i = 0; i < names.length; ++i) + window.console[names[i]] = function() {}; +} + */ + +/** + * small helper function to urldecode strings + */ +jQuery.urldecode = function(x) { + return decodeURIComponent(x).replace(/\+/g, ' '); +}; + +/** + * small helper function to urlencode strings + */ +jQuery.urlencode = encodeURIComponent; + +/** + * This function returns the parsed url parameters of the + * current request. Multiple values per key are supported, + * it will always return arrays of strings for the value parts. + */ +jQuery.getQueryParameters = function(s) { + if (typeof s === 'undefined') + s = document.location.search; + var parts = s.substr(s.indexOf('?') + 1).split('&'); + var result = {}; + for (var i = 0; i < parts.length; i++) { + var tmp = parts[i].split('=', 2); + var key = jQuery.urldecode(tmp[0]); + var value = jQuery.urldecode(tmp[1]); + if (key in result) + result[key].push(value); + else + result[key] = [value]; + } + return result; +}; + +/** + * highlight a given string on a jquery object by wrapping it in + * span elements with the given class name. + */ +jQuery.fn.highlightText = function(text, className) { + function highlight(node, addItems) { + if (node.nodeType === 3) { + var val = node.nodeValue; + var pos = val.toLowerCase().indexOf(text); + if (pos >= 0 && + !jQuery(node.parentNode).hasClass(className) && + !jQuery(node.parentNode).hasClass("nohighlight")) { + var span; + var isInSVG = jQuery(node).closest("body, svg, foreignObject").is("svg"); + if (isInSVG) { + span = document.createElementNS("http://www.w3.org/2000/svg", "tspan"); + } else { + span = document.createElement("span"); + span.className = className; + } + span.appendChild(document.createTextNode(val.substr(pos, text.length))); + node.parentNode.insertBefore(span, node.parentNode.insertBefore( + document.createTextNode(val.substr(pos + text.length)), + node.nextSibling)); + node.nodeValue = val.substr(0, pos); + if (isInSVG) { + var rect = document.createElementNS("http://www.w3.org/2000/svg", "rect"); + var bbox = node.parentElement.getBBox(); + rect.x.baseVal.value = bbox.x; + rect.y.baseVal.value = bbox.y; + rect.width.baseVal.value = bbox.width; + rect.height.baseVal.value = bbox.height; + rect.setAttribute('class', className); + addItems.push({ + "parent": node.parentNode, + "target": rect}); + } + } + } + else if (!jQuery(node).is("button, select, textarea")) { + jQuery.each(node.childNodes, function() { + highlight(this, addItems); + }); + } + } + var addItems = []; + var result = this.each(function() { + highlight(this, addItems); + }); + for (var i = 0; i < addItems.length; ++i) { + jQuery(addItems[i].parent).before(addItems[i].target); + } + return result; +}; + +/* + * backward compatibility for jQuery.browser + * This will be supported until firefox bug is fixed. + */ +if (!jQuery.browser) { + jQuery.uaMatch = function(ua) { + ua = ua.toLowerCase(); + + var match = /(chrome)[ \/]([\w.]+)/.exec(ua) || + /(webkit)[ \/]([\w.]+)/.exec(ua) || + /(opera)(?:.*version|)[ \/]([\w.]+)/.exec(ua) || + /(msie) ([\w.]+)/.exec(ua) || + ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec(ua) || + []; + + return { + browser: match[ 1 ] || "", + version: match[ 2 ] || "0" + }; + }; + jQuery.browser = {}; + jQuery.browser[jQuery.uaMatch(navigator.userAgent).browser] = true; +} + +/** + * Small JavaScript module for the documentation. + */ +var Documentation = { + + init : function() { + this.fixFirefoxAnchorBug(); + this.highlightSearchWords(); + this.initIndexTable(); + if (DOCUMENTATION_OPTIONS.NAVIGATION_WITH_KEYS) { + this.initOnKeyListeners(); + } + }, + + /** + * i18n support + */ + TRANSLATIONS : {}, + PLURAL_EXPR : function(n) { return n === 1 ? 0 : 1; }, + LOCALE : 'unknown', + + // gettext and ngettext don't access this so that the functions + // can safely bound to a different name (_ = Documentation.gettext) + gettext : function(string) { + var translated = Documentation.TRANSLATIONS[string]; + if (typeof translated === 'undefined') + return string; + return (typeof translated === 'string') ? translated : translated[0]; + }, + + ngettext : function(singular, plural, n) { + var translated = Documentation.TRANSLATIONS[singular]; + if (typeof translated === 'undefined') + return (n == 1) ? singular : plural; + return translated[Documentation.PLURALEXPR(n)]; + }, + + addTranslations : function(catalog) { + for (var key in catalog.messages) + this.TRANSLATIONS[key] = catalog.messages[key]; + this.PLURAL_EXPR = new Function('n', 'return +(' + catalog.plural_expr + ')'); + this.LOCALE = catalog.locale; + }, + + /** + * add context elements like header anchor links + */ + addContextElements : function() { + $('div[id] > :header:first').each(function() { + $('<a class="headerlink">\u00B6</a>'). + attr('href', '#' + this.id). + attr('title', _('Permalink to this headline')). + appendTo(this); + }); + $('dt[id]').each(function() { + $('<a class="headerlink">\u00B6</a>'). + attr('href', '#' + this.id). + attr('title', _('Permalink to this definition')). + appendTo(this); + }); + }, + + /** + * workaround a firefox stupidity + * see: https://bugzilla.mozilla.org/show_bug.cgi?id=645075 + */ + fixFirefoxAnchorBug : function() { + if (document.location.hash && $.browser.mozilla) + window.setTimeout(function() { + document.location.href += ''; + }, 10); + }, + + /** + * highlight the search words provided in the url in the text + */ + highlightSearchWords : function() { + var params = $.getQueryParameters(); + var terms = (params.highlight) ? params.highlight[0].split(/\s+/) : []; + if (terms.length) { + var body = $('div.body'); + if (!body.length) { + body = $('body'); + } + window.setTimeout(function() { + $.each(terms, function() { + body.highlightText(this.toLowerCase(), 'highlighted'); + }); + }, 10); + $('<p class="highlight-link"><a href="javascript:Documentation.' + + 'hideSearchWords()">' + _('Hide Search Matches') + '</a></p>') + .appendTo($('#searchbox')); + } + }, + + /** + * init the domain index toggle buttons + */ + initIndexTable : function() { + var togglers = $('img.toggler').click(function() { + var src = $(this).attr('src'); + var idnum = $(this).attr('id').substr(7); + $('tr.cg-' + idnum).toggle(); + if (src.substr(-9) === 'minus.png') + $(this).attr('src', src.substr(0, src.length-9) + 'plus.png'); + else + $(this).attr('src', src.substr(0, src.length-8) + 'minus.png'); + }).css('display', ''); + if (DOCUMENTATION_OPTIONS.COLLAPSE_INDEX) { + togglers.click(); + } + }, + + /** + * helper function to hide the search marks again + */ + hideSearchWords : function() { + $('#searchbox .highlight-link').fadeOut(300); + $('span.highlighted').removeClass('highlighted'); + }, + + /** + * make the url absolute + */ + makeURL : function(relativeURL) { + return DOCUMENTATION_OPTIONS.URL_ROOT + '/' + relativeURL; + }, + + /** + * get the current relative url + */ + getCurrentURL : function() { + var path = document.location.pathname; + var parts = path.split(/\//); + $.each(DOCUMENTATION_OPTIONS.URL_ROOT.split(/\//), function() { + if (this === '..') + parts.pop(); + }); + var url = parts.join('/'); + return path.substring(url.lastIndexOf('/') + 1, path.length - 1); + }, + + initOnKeyListeners: function() { + $(document).keyup(function(event) { + var activeElementType = document.activeElement.tagName; + // don't navigate when in search box or textarea + if (activeElementType !== 'TEXTAREA' && activeElementType !== 'INPUT' && activeElementType !== 'SELECT') { + switch (event.keyCode) { + case 37: // left + var prevHref = $('link[rel="prev"]').prop('href'); + if (prevHref) { + window.location.href = prevHref; + return false; + } + case 39: // right + var nextHref = $('link[rel="next"]').prop('href'); + if (nextHref) { + window.location.href = nextHref; + return false; + } + } + } + }); + } +}; + +// quick alias for translations +_ = Documentation.gettext; + +$(document).ready(function() { + Documentation.init(); +}); diff --git a/docs/build/html/_static/documentation_options.js b/docs/build/html/_static/documentation_options.js new file mode 100644 index 0000000000000000000000000000000000000000..6d8651025fb4786e22a766603bc6bbb6191d945a --- /dev/null +++ b/docs/build/html/_static/documentation_options.js @@ -0,0 +1,10 @@ +var DOCUMENTATION_OPTIONS = { + URL_ROOT: document.getElementById("documentation_options").getAttribute('data-url_root'), + VERSION: '', + LANGUAGE: 'None', + COLLAPSE_INDEX: false, + FILE_SUFFIX: '.html', + HAS_SOURCE: true, + SOURCELINK_SUFFIX: '.txt', + NAVIGATION_WITH_KEYS: false +}; \ No newline at end of file diff --git a/docs/build/html/_static/file.png b/docs/build/html/_static/file.png new file mode 100644 index 0000000000000000000000000000000000000000..a858a410e4faa62ce324d814e4b816fff83a6fb3 Binary files /dev/null and b/docs/build/html/_static/file.png differ diff --git a/docs/build/html/_static/jquery-3.4.1.js b/docs/build/html/_static/jquery-3.4.1.js new file mode 100644 index 0000000000000000000000000000000000000000..773ad95c56f8321eb4901736930024ec517a948a --- /dev/null +++ b/docs/build/html/_static/jquery-3.4.1.js @@ -0,0 +1,10598 @@ +/*! + * jQuery JavaScript Library v3.4.1 + * https://jquery.com/ + * + * Includes Sizzle.js + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://jquery.org/license + * + * Date: 2019-05-01T21:04Z + */ +( function( global, factory ) { + + "use strict"; + + if ( typeof module === "object" && typeof module.exports === "object" ) { + + // For CommonJS and CommonJS-like environments where a proper `window` + // is present, execute the factory and get jQuery. + // For environments that do not have a `window` with a `document` + // (such as Node.js), expose a factory as module.exports. + // This accentuates the need for the creation of a real `window`. + // e.g. var jQuery = require("jquery")(window); + // See ticket #14549 for more info. + module.exports = global.document ? + factory( global, true ) : + function( w ) { + if ( !w.document ) { + throw new Error( "jQuery requires a window with a document" ); + } + return factory( w ); + }; + } else { + factory( global ); + } + +// Pass this if window is not defined yet +} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) { + +// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1 +// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode +// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common +// enough that all such attempts are guarded in a try block. +"use strict"; + +var arr = []; + +var document = window.document; + +var getProto = Object.getPrototypeOf; + +var slice = arr.slice; + +var concat = arr.concat; + +var push = arr.push; + +var indexOf = arr.indexOf; + +var class2type = {}; + +var toString = class2type.toString; + +var hasOwn = class2type.hasOwnProperty; + +var fnToString = hasOwn.toString; + +var ObjectFunctionString = fnToString.call( Object ); + +var support = {}; + +var isFunction = function isFunction( obj ) { + + // Support: Chrome <=57, Firefox <=52 + // In some browsers, typeof returns "function" for HTML <object> elements + // (i.e., `typeof document.createElement( "object" ) === "function"`). + // We don't want to classify *any* DOM node as a function. + return typeof obj === "function" && typeof obj.nodeType !== "number"; + }; + + +var isWindow = function isWindow( obj ) { + return obj != null && obj === obj.window; + }; + + + + + var preservedScriptAttributes = { + type: true, + src: true, + nonce: true, + noModule: true + }; + + function DOMEval( code, node, doc ) { + doc = doc || document; + + var i, val, + script = doc.createElement( "script" ); + + script.text = code; + if ( node ) { + for ( i in preservedScriptAttributes ) { + + // Support: Firefox 64+, Edge 18+ + // Some browsers don't support the "nonce" property on scripts. + // On the other hand, just using `getAttribute` is not enough as + // the `nonce` attribute is reset to an empty string whenever it + // becomes browsing-context connected. + // See https://github.com/whatwg/html/issues/2369 + // See https://html.spec.whatwg.org/#nonce-attributes + // The `node.getAttribute` check was added for the sake of + // `jQuery.globalEval` so that it can fake a nonce-containing node + // via an object. + val = node[ i ] || node.getAttribute && node.getAttribute( i ); + if ( val ) { + script.setAttribute( i, val ); + } + } + } + doc.head.appendChild( script ).parentNode.removeChild( script ); + } + + +function toType( obj ) { + if ( obj == null ) { + return obj + ""; + } + + // Support: Android <=2.3 only (functionish RegExp) + return typeof obj === "object" || typeof obj === "function" ? + class2type[ toString.call( obj ) ] || "object" : + typeof obj; +} +/* global Symbol */ +// Defining this global in .eslintrc.json would create a danger of using the global +// unguarded in another place, it seems safer to define global only for this module + + + +var + version = "3.4.1", + + // Define a local copy of jQuery + jQuery = function( selector, context ) { + + // The jQuery object is actually just the init constructor 'enhanced' + // Need init if jQuery is called (just allow error to be thrown if not included) + return new jQuery.fn.init( selector, context ); + }, + + // Support: Android <=4.0 only + // Make sure we trim BOM and NBSP + rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g; + +jQuery.fn = jQuery.prototype = { + + // The current version of jQuery being used + jquery: version, + + constructor: jQuery, + + // The default length of a jQuery object is 0 + length: 0, + + toArray: function() { + return slice.call( this ); + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + + // Return all the elements in a clean array + if ( num == null ) { + return slice.call( this ); + } + + // Return just the one element from the set + return num < 0 ? this[ num + this.length ] : this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems ) { + + // Build a new jQuery matched element set + var ret = jQuery.merge( this.constructor(), elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + // Return the newly-formed element set + return ret; + }, + + // Execute a callback for every element in the matched set. + each: function( callback ) { + return jQuery.each( this, callback ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map( this, function( elem, i ) { + return callback.call( elem, i, elem ); + } ) ); + }, + + slice: function() { + return this.pushStack( slice.apply( this, arguments ) ); + }, + + first: function() { + return this.eq( 0 ); + }, + + last: function() { + return this.eq( -1 ); + }, + + eq: function( i ) { + var len = this.length, + j = +i + ( i < 0 ? len : 0 ); + return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] ); + }, + + end: function() { + return this.prevObject || this.constructor(); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: push, + sort: arr.sort, + splice: arr.splice +}; + +jQuery.extend = jQuery.fn.extend = function() { + var options, name, src, copy, copyIsArray, clone, + target = arguments[ 0 ] || {}, + i = 1, + length = arguments.length, + deep = false; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + + // Skip the boolean and the target + target = arguments[ i ] || {}; + i++; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !isFunction( target ) ) { + target = {}; + } + + // Extend jQuery itself if only one argument is passed + if ( i === length ) { + target = this; + i--; + } + + for ( ; i < length; i++ ) { + + // Only deal with non-null/undefined values + if ( ( options = arguments[ i ] ) != null ) { + + // Extend the base object + for ( name in options ) { + copy = options[ name ]; + + // Prevent Object.prototype pollution + // Prevent never-ending loop + if ( name === "__proto__" || target === copy ) { + continue; + } + + // Recurse if we're merging plain objects or arrays + if ( deep && copy && ( jQuery.isPlainObject( copy ) || + ( copyIsArray = Array.isArray( copy ) ) ) ) { + src = target[ name ]; + + // Ensure proper type for the source value + if ( copyIsArray && !Array.isArray( src ) ) { + clone = []; + } else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) { + clone = {}; + } else { + clone = src; + } + copyIsArray = false; + + // Never move original objects, clone them + target[ name ] = jQuery.extend( deep, clone, copy ); + + // Don't bring in undefined values + } else if ( copy !== undefined ) { + target[ name ] = copy; + } + } + } + } + + // Return the modified object + return target; +}; + +jQuery.extend( { + + // Unique for each copy of jQuery on the page + expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ), + + // Assume jQuery is ready without the ready module + isReady: true, + + error: function( msg ) { + throw new Error( msg ); + }, + + noop: function() {}, + + isPlainObject: function( obj ) { + var proto, Ctor; + + // Detect obvious negatives + // Use toString instead of jQuery.type to catch host objects + if ( !obj || toString.call( obj ) !== "[object Object]" ) { + return false; + } + + proto = getProto( obj ); + + // Objects with no prototype (e.g., `Object.create( null )`) are plain + if ( !proto ) { + return true; + } + + // Objects with prototype are plain iff they were constructed by a global Object function + Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor; + return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString; + }, + + isEmptyObject: function( obj ) { + var name; + + for ( name in obj ) { + return false; + } + return true; + }, + + // Evaluates a script in a global context + globalEval: function( code, options ) { + DOMEval( code, { nonce: options && options.nonce } ); + }, + + each: function( obj, callback ) { + var length, i = 0; + + if ( isArrayLike( obj ) ) { + length = obj.length; + for ( ; i < length; i++ ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } else { + for ( i in obj ) { + if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) { + break; + } + } + } + + return obj; + }, + + // Support: Android <=4.0 only + trim: function( text ) { + return text == null ? + "" : + ( text + "" ).replace( rtrim, "" ); + }, + + // results is for internal usage only + makeArray: function( arr, results ) { + var ret = results || []; + + if ( arr != null ) { + if ( isArrayLike( Object( arr ) ) ) { + jQuery.merge( ret, + typeof arr === "string" ? + [ arr ] : arr + ); + } else { + push.call( ret, arr ); + } + } + + return ret; + }, + + inArray: function( elem, arr, i ) { + return arr == null ? -1 : indexOf.call( arr, elem, i ); + }, + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + merge: function( first, second ) { + var len = +second.length, + j = 0, + i = first.length; + + for ( ; j < len; j++ ) { + first[ i++ ] = second[ j ]; + } + + first.length = i; + + return first; + }, + + grep: function( elems, callback, invert ) { + var callbackInverse, + matches = [], + i = 0, + length = elems.length, + callbackExpect = !invert; + + // Go through the array, only saving the items + // that pass the validator function + for ( ; i < length; i++ ) { + callbackInverse = !callback( elems[ i ], i ); + if ( callbackInverse !== callbackExpect ) { + matches.push( elems[ i ] ); + } + } + + return matches; + }, + + // arg is for internal usage only + map: function( elems, callback, arg ) { + var length, value, + i = 0, + ret = []; + + // Go through the array, translating each of the items to their new values + if ( isArrayLike( elems ) ) { + length = elems.length; + for ( ; i < length; i++ ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + + // Go through every key on the object, + } else { + for ( i in elems ) { + value = callback( elems[ i ], i, arg ); + + if ( value != null ) { + ret.push( value ); + } + } + } + + // Flatten any nested arrays + return concat.apply( [], ret ); + }, + + // A global GUID counter for objects + guid: 1, + + // jQuery.support is not used in Core but other projects attach their + // properties to it so it needs to exist. + support: support +} ); + +if ( typeof Symbol === "function" ) { + jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ]; +} + +// Populate the class2type map +jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ), +function( i, name ) { + class2type[ "[object " + name + "]" ] = name.toLowerCase(); +} ); + +function isArrayLike( obj ) { + + // Support: real iOS 8.2 only (not reproducible in simulator) + // `in` check used to prevent JIT error (gh-2145) + // hasOwn isn't used here due to false negatives + // regarding Nodelist length in IE + var length = !!obj && "length" in obj && obj.length, + type = toType( obj ); + + if ( isFunction( obj ) || isWindow( obj ) ) { + return false; + } + + return type === "array" || length === 0 || + typeof length === "number" && length > 0 && ( length - 1 ) in obj; +} +var Sizzle = +/*! + * Sizzle CSS Selector Engine v2.3.4 + * https://sizzlejs.com/ + * + * Copyright JS Foundation and other contributors + * Released under the MIT license + * https://js.foundation/ + * + * Date: 2019-04-08 + */ +(function( window ) { + +var i, + support, + Expr, + getText, + isXML, + tokenize, + compile, + select, + outermostContext, + sortInput, + hasDuplicate, + + // Local document vars + setDocument, + document, + docElem, + documentIsHTML, + rbuggyQSA, + rbuggyMatches, + matches, + contains, + + // Instance-specific data + expando = "sizzle" + 1 * new Date(), + preferredDoc = window.document, + dirruns = 0, + done = 0, + classCache = createCache(), + tokenCache = createCache(), + compilerCache = createCache(), + nonnativeSelectorCache = createCache(), + sortOrder = function( a, b ) { + if ( a === b ) { + hasDuplicate = true; + } + return 0; + }, + + // Instance methods + hasOwn = ({}).hasOwnProperty, + arr = [], + pop = arr.pop, + push_native = arr.push, + push = arr.push, + slice = arr.slice, + // Use a stripped-down indexOf as it's faster than native + // https://jsperf.com/thor-indexof-vs-for/5 + indexOf = function( list, elem ) { + var i = 0, + len = list.length; + for ( ; i < len; i++ ) { + if ( list[i] === elem ) { + return i; + } + } + return -1; + }, + + booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped", + + // Regular expressions + + // http://www.w3.org/TR/css3-selectors/#whitespace + whitespace = "[\\x20\\t\\r\\n\\f]", + + // http://www.w3.org/TR/CSS21/syndata.html#value-def-identifier + identifier = "(?:\\\\.|[\\w-]|[^\0-\\xa0])+", + + // Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors + attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace + + // Operator (capture 2) + "*([*^$|!~]?=)" + whitespace + + // "Attribute values must be CSS identifiers [capture 5] or strings [capture 3 or capture 4]" + "*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" + whitespace + + "*\\]", + + pseudos = ":(" + identifier + ")(?:\\((" + + // To reduce the number of selectors needing tokenize in the preFilter, prefer arguments: + // 1. quoted (capture 3; capture 4 or capture 5) + "('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" + + // 2. simple (capture 6) + "((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" + + // 3. anything else (capture 2) + ".*" + + ")\\)|)", + + // Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter + rwhitespace = new RegExp( whitespace + "+", "g" ), + rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" + whitespace + "+$", "g" ), + + rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ), + rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace + "*" ), + rdescend = new RegExp( whitespace + "|>" ), + + rpseudo = new RegExp( pseudos ), + ridentifier = new RegExp( "^" + identifier + "$" ), + + matchExpr = { + "ID": new RegExp( "^#(" + identifier + ")" ), + "CLASS": new RegExp( "^\\.(" + identifier + ")" ), + "TAG": new RegExp( "^(" + identifier + "|[*])" ), + "ATTR": new RegExp( "^" + attributes ), + "PSEUDO": new RegExp( "^" + pseudos ), + "CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" + whitespace + + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" + whitespace + + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ), + "bool": new RegExp( "^(?:" + booleans + ")$", "i" ), + // For use in libraries implementing .is() + // We use this for POS matching in `select` + "needsContext": new RegExp( "^" + whitespace + "*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + + whitespace + "*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" ) + }, + + rhtml = /HTML$/i, + rinputs = /^(?:input|select|textarea|button)$/i, + rheader = /^h\d$/i, + + rnative = /^[^{]+\{\s*\[native \w/, + + // Easily-parseable/retrievable ID or TAG or CLASS selectors + rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/, + + rsibling = /[+~]/, + + // CSS escapes + // http://www.w3.org/TR/CSS21/syndata.html#escaped-characters + runescape = new RegExp( "\\\\([\\da-f]{1,6}" + whitespace + "?|(" + whitespace + ")|.)", "ig" ), + funescape = function( _, escaped, escapedWhitespace ) { + var high = "0x" + escaped - 0x10000; + // NaN means non-codepoint + // Support: Firefox<24 + // Workaround erroneous numeric interpretation of +"0x" + return high !== high || escapedWhitespace ? + escaped : + high < 0 ? + // BMP codepoint + String.fromCharCode( high + 0x10000 ) : + // Supplemental Plane codepoint (surrogate pair) + String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 ); + }, + + // CSS string/identifier serialization + // https://drafts.csswg.org/cssom/#common-serializing-idioms + rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g, + fcssescape = function( ch, asCodePoint ) { + if ( asCodePoint ) { + + // U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER + if ( ch === "\0" ) { + return "\uFFFD"; + } + + // Control characters and (dependent upon position) numbers get escaped as code points + return ch.slice( 0, -1 ) + "\\" + ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " "; + } + + // Other potentially-special ASCII characters get backslash-escaped + return "\\" + ch; + }, + + // Used for iframes + // See setDocument() + // Removing the function wrapper causes a "Permission Denied" + // error in IE + unloadHandler = function() { + setDocument(); + }, + + inDisabledFieldset = addCombinator( + function( elem ) { + return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset"; + }, + { dir: "parentNode", next: "legend" } + ); + +// Optimize for push.apply( _, NodeList ) +try { + push.apply( + (arr = slice.call( preferredDoc.childNodes )), + preferredDoc.childNodes + ); + // Support: Android<4.0 + // Detect silently failing push.apply + arr[ preferredDoc.childNodes.length ].nodeType; +} catch ( e ) { + push = { apply: arr.length ? + + // Leverage slice if possible + function( target, els ) { + push_native.apply( target, slice.call(els) ); + } : + + // Support: IE<9 + // Otherwise append directly + function( target, els ) { + var j = target.length, + i = 0; + // Can't trust NodeList.length + while ( (target[j++] = els[i++]) ) {} + target.length = j - 1; + } + }; +} + +function Sizzle( selector, context, results, seed ) { + var m, i, elem, nid, match, groups, newSelector, + newContext = context && context.ownerDocument, + + // nodeType defaults to 9, since context defaults to document + nodeType = context ? context.nodeType : 9; + + results = results || []; + + // Return early from calls with invalid selector or context + if ( typeof selector !== "string" || !selector || + nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) { + + return results; + } + + // Try to shortcut find operations (as opposed to filters) in HTML documents + if ( !seed ) { + + if ( ( context ? context.ownerDocument || context : preferredDoc ) !== document ) { + setDocument( context ); + } + context = context || document; + + if ( documentIsHTML ) { + + // If the selector is sufficiently simple, try using a "get*By*" DOM method + // (excepting DocumentFragment context, where the methods don't exist) + if ( nodeType !== 11 && (match = rquickExpr.exec( selector )) ) { + + // ID selector + if ( (m = match[1]) ) { + + // Document context + if ( nodeType === 9 ) { + if ( (elem = context.getElementById( m )) ) { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( elem.id === m ) { + results.push( elem ); + return results; + } + } else { + return results; + } + + // Element context + } else { + + // Support: IE, Opera, Webkit + // TODO: identify versions + // getElementById can match elements by name instead of ID + if ( newContext && (elem = newContext.getElementById( m )) && + contains( context, elem ) && + elem.id === m ) { + + results.push( elem ); + return results; + } + } + + // Type selector + } else if ( match[2] ) { + push.apply( results, context.getElementsByTagName( selector ) ); + return results; + + // Class selector + } else if ( (m = match[3]) && support.getElementsByClassName && + context.getElementsByClassName ) { + + push.apply( results, context.getElementsByClassName( m ) ); + return results; + } + } + + // Take advantage of querySelectorAll + if ( support.qsa && + !nonnativeSelectorCache[ selector + " " ] && + (!rbuggyQSA || !rbuggyQSA.test( selector )) && + + // Support: IE 8 only + // Exclude object elements + (nodeType !== 1 || context.nodeName.toLowerCase() !== "object") ) { + + newSelector = selector; + newContext = context; + + // qSA considers elements outside a scoping root when evaluating child or + // descendant combinators, which is not what we want. + // In such cases, we work around the behavior by prefixing every selector in the + // list with an ID selector referencing the scope context. + // Thanks to Andrew Dupont for this technique. + if ( nodeType === 1 && rdescend.test( selector ) ) { + + // Capture the context ID, setting it first if necessary + if ( (nid = context.getAttribute( "id" )) ) { + nid = nid.replace( rcssescape, fcssescape ); + } else { + context.setAttribute( "id", (nid = expando) ); + } + + // Prefix every selector in the list + groups = tokenize( selector ); + i = groups.length; + while ( i-- ) { + groups[i] = "#" + nid + " " + toSelector( groups[i] ); + } + newSelector = groups.join( "," ); + + // Expand context for sibling selectors + newContext = rsibling.test( selector ) && testContext( context.parentNode ) || + context; + } + + try { + push.apply( results, + newContext.querySelectorAll( newSelector ) + ); + return results; + } catch ( qsaError ) { + nonnativeSelectorCache( selector, true ); + } finally { + if ( nid === expando ) { + context.removeAttribute( "id" ); + } + } + } + } + } + + // All others + return select( selector.replace( rtrim, "$1" ), context, results, seed ); +} + +/** + * Create key-value caches of limited size + * @returns {function(string, object)} Returns the Object data after storing it on itself with + * property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength) + * deleting the oldest entry + */ +function createCache() { + var keys = []; + + function cache( key, value ) { + // Use (key + " ") to avoid collision with native prototype properties (see Issue #157) + if ( keys.push( key + " " ) > Expr.cacheLength ) { + // Only keep the most recent entries + delete cache[ keys.shift() ]; + } + return (cache[ key + " " ] = value); + } + return cache; +} + +/** + * Mark a function for special use by Sizzle + * @param {Function} fn The function to mark + */ +function markFunction( fn ) { + fn[ expando ] = true; + return fn; +} + +/** + * Support testing using an element + * @param {Function} fn Passed the created element and returns a boolean result + */ +function assert( fn ) { + var el = document.createElement("fieldset"); + + try { + return !!fn( el ); + } catch (e) { + return false; + } finally { + // Remove from its parent by default + if ( el.parentNode ) { + el.parentNode.removeChild( el ); + } + // release memory in IE + el = null; + } +} + +/** + * Adds the same handler for all of the specified attrs + * @param {String} attrs Pipe-separated list of attributes + * @param {Function} handler The method that will be applied + */ +function addHandle( attrs, handler ) { + var arr = attrs.split("|"), + i = arr.length; + + while ( i-- ) { + Expr.attrHandle[ arr[i] ] = handler; + } +} + +/** + * Checks document order of two siblings + * @param {Element} a + * @param {Element} b + * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b + */ +function siblingCheck( a, b ) { + var cur = b && a, + diff = cur && a.nodeType === 1 && b.nodeType === 1 && + a.sourceIndex - b.sourceIndex; + + // Use IE sourceIndex if available on both nodes + if ( diff ) { + return diff; + } + + // Check if b follows a + if ( cur ) { + while ( (cur = cur.nextSibling) ) { + if ( cur === b ) { + return -1; + } + } + } + + return a ? 1 : -1; +} + +/** + * Returns a function to use in pseudos for input types + * @param {String} type + */ +function createInputPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for buttons + * @param {String} type + */ +function createButtonPseudo( type ) { + return function( elem ) { + var name = elem.nodeName.toLowerCase(); + return (name === "input" || name === "button") && elem.type === type; + }; +} + +/** + * Returns a function to use in pseudos for :enabled/:disabled + * @param {Boolean} disabled true for :disabled; false for :enabled + */ +function createDisabledPseudo( disabled ) { + + // Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable + return function( elem ) { + + // Only certain elements can match :enabled or :disabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled + // https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled + if ( "form" in elem ) { + + // Check for inherited disabledness on relevant non-disabled elements: + // * listed form-associated elements in a disabled fieldset + // https://html.spec.whatwg.org/multipage/forms.html#category-listed + // https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled + // * option elements in a disabled optgroup + // https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled + // All such elements have a "form" property. + if ( elem.parentNode && elem.disabled === false ) { + + // Option elements defer to a parent optgroup if present + if ( "label" in elem ) { + if ( "label" in elem.parentNode ) { + return elem.parentNode.disabled === disabled; + } else { + return elem.disabled === disabled; + } + } + + // Support: IE 6 - 11 + // Use the isDisabled shortcut property to check for disabled fieldset ancestors + return elem.isDisabled === disabled || + + // Where there is no isDisabled, check manually + /* jshint -W018 */ + elem.isDisabled !== !disabled && + inDisabledFieldset( elem ) === disabled; + } + + return elem.disabled === disabled; + + // Try to winnow out elements that can't be disabled before trusting the disabled property. + // Some victims get caught in our net (label, legend, menu, track), but it shouldn't + // even exist on them, let alone have a boolean value. + } else if ( "label" in elem ) { + return elem.disabled === disabled; + } + + // Remaining elements are neither :enabled nor :disabled + return false; + }; +} + +/** + * Returns a function to use in pseudos for positionals + * @param {Function} fn + */ +function createPositionalPseudo( fn ) { + return markFunction(function( argument ) { + argument = +argument; + return markFunction(function( seed, matches ) { + var j, + matchIndexes = fn( [], seed.length, argument ), + i = matchIndexes.length; + + // Match elements found at the specified indexes + while ( i-- ) { + if ( seed[ (j = matchIndexes[i]) ] ) { + seed[j] = !(matches[j] = seed[j]); + } + } + }); + }); +} + +/** + * Checks a node for validity as a Sizzle context + * @param {Element|Object=} context + * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value + */ +function testContext( context ) { + return context && typeof context.getElementsByTagName !== "undefined" && context; +} + +// Expose support vars for convenience +support = Sizzle.support = {}; + +/** + * Detects XML nodes + * @param {Element|Object} elem An element or a document + * @returns {Boolean} True iff elem is a non-HTML XML node + */ +isXML = Sizzle.isXML = function( elem ) { + var namespace = elem.namespaceURI, + docElem = (elem.ownerDocument || elem).documentElement; + + // Support: IE <=8 + // Assume HTML when documentElement doesn't yet exist, such as inside loading iframes + // https://bugs.jquery.com/ticket/4833 + return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" ); +}; + +/** + * Sets document-related variables once based on the current document + * @param {Element|Object} [doc] An element or document object to use to set the document + * @returns {Object} Returns the current document + */ +setDocument = Sizzle.setDocument = function( node ) { + var hasCompare, subWindow, + doc = node ? node.ownerDocument || node : preferredDoc; + + // Return early if doc is invalid or already selected + if ( doc === document || doc.nodeType !== 9 || !doc.documentElement ) { + return document; + } + + // Update global variables + document = doc; + docElem = document.documentElement; + documentIsHTML = !isXML( document ); + + // Support: IE 9-11, Edge + // Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936) + if ( preferredDoc !== document && + (subWindow = document.defaultView) && subWindow.top !== subWindow ) { + + // Support: IE 11, Edge + if ( subWindow.addEventListener ) { + subWindow.addEventListener( "unload", unloadHandler, false ); + + // Support: IE 9 - 10 only + } else if ( subWindow.attachEvent ) { + subWindow.attachEvent( "onunload", unloadHandler ); + } + } + + /* Attributes + ---------------------------------------------------------------------- */ + + // Support: IE<8 + // Verify that getAttribute really returns attributes and not properties + // (excepting IE8 booleans) + support.attributes = assert(function( el ) { + el.className = "i"; + return !el.getAttribute("className"); + }); + + /* getElement(s)By* + ---------------------------------------------------------------------- */ + + // Check if getElementsByTagName("*") returns only elements + support.getElementsByTagName = assert(function( el ) { + el.appendChild( document.createComment("") ); + return !el.getElementsByTagName("*").length; + }); + + // Support: IE<9 + support.getElementsByClassName = rnative.test( document.getElementsByClassName ); + + // Support: IE<10 + // Check if getElementById returns elements by name + // The broken getElementById methods don't pick up programmatically-set names, + // so use a roundabout getElementsByName test + support.getById = assert(function( el ) { + docElem.appendChild( el ).id = expando; + return !document.getElementsByName || !document.getElementsByName( expando ).length; + }); + + // ID filter and find + if ( support.getById ) { + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + return elem.getAttribute("id") === attrId; + }; + }; + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var elem = context.getElementById( id ); + return elem ? [ elem ] : []; + } + }; + } else { + Expr.filter["ID"] = function( id ) { + var attrId = id.replace( runescape, funescape ); + return function( elem ) { + var node = typeof elem.getAttributeNode !== "undefined" && + elem.getAttributeNode("id"); + return node && node.value === attrId; + }; + }; + + // Support: IE 6 - 7 only + // getElementById is not reliable as a find shortcut + Expr.find["ID"] = function( id, context ) { + if ( typeof context.getElementById !== "undefined" && documentIsHTML ) { + var node, i, elems, + elem = context.getElementById( id ); + + if ( elem ) { + + // Verify the id attribute + node = elem.getAttributeNode("id"); + if ( node && node.value === id ) { + return [ elem ]; + } + + // Fall back on getElementsByName + elems = context.getElementsByName( id ); + i = 0; + while ( (elem = elems[i++]) ) { + node = elem.getAttributeNode("id"); + if ( node && node.value === id ) { + return [ elem ]; + } + } + } + + return []; + } + }; + } + + // Tag + Expr.find["TAG"] = support.getElementsByTagName ? + function( tag, context ) { + if ( typeof context.getElementsByTagName !== "undefined" ) { + return context.getElementsByTagName( tag ); + + // DocumentFragment nodes don't have gEBTN + } else if ( support.qsa ) { + return context.querySelectorAll( tag ); + } + } : + + function( tag, context ) { + var elem, + tmp = [], + i = 0, + // By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too + results = context.getElementsByTagName( tag ); + + // Filter out possible comments + if ( tag === "*" ) { + while ( (elem = results[i++]) ) { + if ( elem.nodeType === 1 ) { + tmp.push( elem ); + } + } + + return tmp; + } + return results; + }; + + // Class + Expr.find["CLASS"] = support.getElementsByClassName && function( className, context ) { + if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) { + return context.getElementsByClassName( className ); + } + }; + + /* QSA/matchesSelector + ---------------------------------------------------------------------- */ + + // QSA and matchesSelector support + + // matchesSelector(:active) reports false when true (IE9/Opera 11.5) + rbuggyMatches = []; + + // qSa(:focus) reports false when true (Chrome 21) + // We allow this because of a bug in IE8/9 that throws an error + // whenever `document.activeElement` is accessed on an iframe + // So, we allow :focus to pass through QSA all the time to avoid the IE error + // See https://bugs.jquery.com/ticket/13378 + rbuggyQSA = []; + + if ( (support.qsa = rnative.test( document.querySelectorAll )) ) { + // Build QSA regex + // Regex strategy adopted from Diego Perini + assert(function( el ) { + // Select is set to empty string on purpose + // This is to test IE's treatment of not explicitly + // setting a boolean content attribute, + // since its presence should be enough + // https://bugs.jquery.com/ticket/12359 + docElem.appendChild( el ).innerHTML = "<a id='" + expando + "'></a>" + + "<select id='" + expando + "-\r\\' msallowcapture=''>" + + "<option selected=''></option></select>"; + + // Support: IE8, Opera 11-12.16 + // Nothing should be selected when empty strings follow ^= or $= or *= + // The test attribute must be unknown in Opera but "safe" for WinRT + // https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section + if ( el.querySelectorAll("[msallowcapture^='']").length ) { + rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" ); + } + + // Support: IE8 + // Boolean attributes and "value" are not treated correctly + if ( !el.querySelectorAll("[selected]").length ) { + rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" ); + } + + // Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+ + if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) { + rbuggyQSA.push("~="); + } + + // Webkit/Opera - :checked should return selected option elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + // IE8 throws error here and will not see later tests + if ( !el.querySelectorAll(":checked").length ) { + rbuggyQSA.push(":checked"); + } + + // Support: Safari 8+, iOS 8+ + // https://bugs.webkit.org/show_bug.cgi?id=136851 + // In-page `selector#id sibling-combinator selector` fails + if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) { + rbuggyQSA.push(".#.+[+~]"); + } + }); + + assert(function( el ) { + el.innerHTML = "<a href='' disabled='disabled'></a>" + + "<select disabled='disabled'><option/></select>"; + + // Support: Windows 8 Native Apps + // The type and name attributes are restricted during .innerHTML assignment + var input = document.createElement("input"); + input.setAttribute( "type", "hidden" ); + el.appendChild( input ).setAttribute( "name", "D" ); + + // Support: IE8 + // Enforce case-sensitivity of name attribute + if ( el.querySelectorAll("[name=d]").length ) { + rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" ); + } + + // FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled) + // IE8 throws error here and will not see later tests + if ( el.querySelectorAll(":enabled").length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Support: IE9-11+ + // IE's :disabled selector does not pick up the children of disabled fieldsets + docElem.appendChild( el ).disabled = true; + if ( el.querySelectorAll(":disabled").length !== 2 ) { + rbuggyQSA.push( ":enabled", ":disabled" ); + } + + // Opera 10-11 does not throw on post-comma invalid pseudos + el.querySelectorAll("*,:x"); + rbuggyQSA.push(",.*:"); + }); + } + + if ( (support.matchesSelector = rnative.test( (matches = docElem.matches || + docElem.webkitMatchesSelector || + docElem.mozMatchesSelector || + docElem.oMatchesSelector || + docElem.msMatchesSelector) )) ) { + + assert(function( el ) { + // Check to see if it's possible to do matchesSelector + // on a disconnected node (IE 9) + support.disconnectedMatch = matches.call( el, "*" ); + + // This should fail with an exception + // Gecko does not error, returns false instead + matches.call( el, "[s!='']:x" ); + rbuggyMatches.push( "!=", pseudos ); + }); + } + + rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join("|") ); + rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join("|") ); + + /* Contains + ---------------------------------------------------------------------- */ + hasCompare = rnative.test( docElem.compareDocumentPosition ); + + // Element contains another + // Purposefully self-exclusive + // As in, an element does not contain itself + contains = hasCompare || rnative.test( docElem.contains ) ? + function( a, b ) { + var adown = a.nodeType === 9 ? a.documentElement : a, + bup = b && b.parentNode; + return a === bup || !!( bup && bup.nodeType === 1 && ( + adown.contains ? + adown.contains( bup ) : + a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16 + )); + } : + function( a, b ) { + if ( b ) { + while ( (b = b.parentNode) ) { + if ( b === a ) { + return true; + } + } + } + return false; + }; + + /* Sorting + ---------------------------------------------------------------------- */ + + // Document order sorting + sortOrder = hasCompare ? + function( a, b ) { + + // Flag for duplicate removal + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + // Sort on method existence if only one input has compareDocumentPosition + var compare = !a.compareDocumentPosition - !b.compareDocumentPosition; + if ( compare ) { + return compare; + } + + // Calculate position if both inputs belong to the same document + compare = ( a.ownerDocument || a ) === ( b.ownerDocument || b ) ? + a.compareDocumentPosition( b ) : + + // Otherwise we know they are disconnected + 1; + + // Disconnected nodes + if ( compare & 1 || + (!support.sortDetached && b.compareDocumentPosition( a ) === compare) ) { + + // Choose the first element that is related to our preferred document + if ( a === document || a.ownerDocument === preferredDoc && contains(preferredDoc, a) ) { + return -1; + } + if ( b === document || b.ownerDocument === preferredDoc && contains(preferredDoc, b) ) { + return 1; + } + + // Maintain original order + return sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + } + + return compare & 4 ? -1 : 1; + } : + function( a, b ) { + // Exit early if the nodes are identical + if ( a === b ) { + hasDuplicate = true; + return 0; + } + + var cur, + i = 0, + aup = a.parentNode, + bup = b.parentNode, + ap = [ a ], + bp = [ b ]; + + // Parentless nodes are either documents or disconnected + if ( !aup || !bup ) { + return a === document ? -1 : + b === document ? 1 : + aup ? -1 : + bup ? 1 : + sortInput ? + ( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) : + 0; + + // If the nodes are siblings, we can do a quick check + } else if ( aup === bup ) { + return siblingCheck( a, b ); + } + + // Otherwise we need full lists of their ancestors for comparison + cur = a; + while ( (cur = cur.parentNode) ) { + ap.unshift( cur ); + } + cur = b; + while ( (cur = cur.parentNode) ) { + bp.unshift( cur ); + } + + // Walk down the tree looking for a discrepancy + while ( ap[i] === bp[i] ) { + i++; + } + + return i ? + // Do a sibling check if the nodes have a common ancestor + siblingCheck( ap[i], bp[i] ) : + + // Otherwise nodes in our document sort first + ap[i] === preferredDoc ? -1 : + bp[i] === preferredDoc ? 1 : + 0; + }; + + return document; +}; + +Sizzle.matches = function( expr, elements ) { + return Sizzle( expr, null, null, elements ); +}; + +Sizzle.matchesSelector = function( elem, expr ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + if ( support.matchesSelector && documentIsHTML && + !nonnativeSelectorCache[ expr + " " ] && + ( !rbuggyMatches || !rbuggyMatches.test( expr ) ) && + ( !rbuggyQSA || !rbuggyQSA.test( expr ) ) ) { + + try { + var ret = matches.call( elem, expr ); + + // IE 9's matchesSelector returns false on disconnected nodes + if ( ret || support.disconnectedMatch || + // As well, disconnected nodes are said to be in a document + // fragment in IE 9 + elem.document && elem.document.nodeType !== 11 ) { + return ret; + } + } catch (e) { + nonnativeSelectorCache( expr, true ); + } + } + + return Sizzle( expr, document, null, [ elem ] ).length > 0; +}; + +Sizzle.contains = function( context, elem ) { + // Set document vars if needed + if ( ( context.ownerDocument || context ) !== document ) { + setDocument( context ); + } + return contains( context, elem ); +}; + +Sizzle.attr = function( elem, name ) { + // Set document vars if needed + if ( ( elem.ownerDocument || elem ) !== document ) { + setDocument( elem ); + } + + var fn = Expr.attrHandle[ name.toLowerCase() ], + // Don't get fooled by Object.prototype properties (jQuery #13807) + val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ? + fn( elem, name, !documentIsHTML ) : + undefined; + + return val !== undefined ? + val : + support.attributes || !documentIsHTML ? + elem.getAttribute( name ) : + (val = elem.getAttributeNode(name)) && val.specified ? + val.value : + null; +}; + +Sizzle.escape = function( sel ) { + return (sel + "").replace( rcssescape, fcssescape ); +}; + +Sizzle.error = function( msg ) { + throw new Error( "Syntax error, unrecognized expression: " + msg ); +}; + +/** + * Document sorting and removing duplicates + * @param {ArrayLike} results + */ +Sizzle.uniqueSort = function( results ) { + var elem, + duplicates = [], + j = 0, + i = 0; + + // Unless we *know* we can detect duplicates, assume their presence + hasDuplicate = !support.detectDuplicates; + sortInput = !support.sortStable && results.slice( 0 ); + results.sort( sortOrder ); + + if ( hasDuplicate ) { + while ( (elem = results[i++]) ) { + if ( elem === results[ i ] ) { + j = duplicates.push( i ); + } + } + while ( j-- ) { + results.splice( duplicates[ j ], 1 ); + } + } + + // Clear input after sorting to release objects + // See https://github.com/jquery/sizzle/pull/225 + sortInput = null; + + return results; +}; + +/** + * Utility function for retrieving the text value of an array of DOM nodes + * @param {Array|Element} elem + */ +getText = Sizzle.getText = function( elem ) { + var node, + ret = "", + i = 0, + nodeType = elem.nodeType; + + if ( !nodeType ) { + // If no nodeType, this is expected to be an array + while ( (node = elem[i++]) ) { + // Do not traverse comment nodes + ret += getText( node ); + } + } else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) { + // Use textContent for elements + // innerText usage removed for consistency of new lines (jQuery #11153) + if ( typeof elem.textContent === "string" ) { + return elem.textContent; + } else { + // Traverse its children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + ret += getText( elem ); + } + } + } else if ( nodeType === 3 || nodeType === 4 ) { + return elem.nodeValue; + } + // Do not include comment or processing instruction nodes + + return ret; +}; + +Expr = Sizzle.selectors = { + + // Can be adjusted by the user + cacheLength: 50, + + createPseudo: markFunction, + + match: matchExpr, + + attrHandle: {}, + + find: {}, + + relative: { + ">": { dir: "parentNode", first: true }, + " ": { dir: "parentNode" }, + "+": { dir: "previousSibling", first: true }, + "~": { dir: "previousSibling" } + }, + + preFilter: { + "ATTR": function( match ) { + match[1] = match[1].replace( runescape, funescape ); + + // Move the given value to match[3] whether quoted or unquoted + match[3] = ( match[3] || match[4] || match[5] || "" ).replace( runescape, funescape ); + + if ( match[2] === "~=" ) { + match[3] = " " + match[3] + " "; + } + + return match.slice( 0, 4 ); + }, + + "CHILD": function( match ) { + /* matches from matchExpr["CHILD"] + 1 type (only|nth|...) + 2 what (child|of-type) + 3 argument (even|odd|\d*|\d*n([+-]\d+)?|...) + 4 xn-component of xn+y argument ([+-]?\d*n|) + 5 sign of xn-component + 6 x of xn-component + 7 sign of y-component + 8 y of y-component + */ + match[1] = match[1].toLowerCase(); + + if ( match[1].slice( 0, 3 ) === "nth" ) { + // nth-* requires argument + if ( !match[3] ) { + Sizzle.error( match[0] ); + } + + // numeric x and y parameters for Expr.filter.CHILD + // remember that false/true cast respectively to 0/1 + match[4] = +( match[4] ? match[5] + (match[6] || 1) : 2 * ( match[3] === "even" || match[3] === "odd" ) ); + match[5] = +( ( match[7] + match[8] ) || match[3] === "odd" ); + + // other types prohibit arguments + } else if ( match[3] ) { + Sizzle.error( match[0] ); + } + + return match; + }, + + "PSEUDO": function( match ) { + var excess, + unquoted = !match[6] && match[2]; + + if ( matchExpr["CHILD"].test( match[0] ) ) { + return null; + } + + // Accept quoted arguments as-is + if ( match[3] ) { + match[2] = match[4] || match[5] || ""; + + // Strip excess characters from unquoted arguments + } else if ( unquoted && rpseudo.test( unquoted ) && + // Get excess from tokenize (recursively) + (excess = tokenize( unquoted, true )) && + // advance to the next closing parenthesis + (excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length) ) { + + // excess is a negative index + match[0] = match[0].slice( 0, excess ); + match[2] = unquoted.slice( 0, excess ); + } + + // Return only captures needed by the pseudo filter method (type and argument) + return match.slice( 0, 3 ); + } + }, + + filter: { + + "TAG": function( nodeNameSelector ) { + var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase(); + return nodeNameSelector === "*" ? + function() { return true; } : + function( elem ) { + return elem.nodeName && elem.nodeName.toLowerCase() === nodeName; + }; + }, + + "CLASS": function( className ) { + var pattern = classCache[ className + " " ]; + + return pattern || + (pattern = new RegExp( "(^|" + whitespace + ")" + className + "(" + whitespace + "|$)" )) && + classCache( className, function( elem ) { + return pattern.test( typeof elem.className === "string" && elem.className || typeof elem.getAttribute !== "undefined" && elem.getAttribute("class") || "" ); + }); + }, + + "ATTR": function( name, operator, check ) { + return function( elem ) { + var result = Sizzle.attr( elem, name ); + + if ( result == null ) { + return operator === "!="; + } + if ( !operator ) { + return true; + } + + result += ""; + + return operator === "=" ? result === check : + operator === "!=" ? result !== check : + operator === "^=" ? check && result.indexOf( check ) === 0 : + operator === "*=" ? check && result.indexOf( check ) > -1 : + operator === "$=" ? check && result.slice( -check.length ) === check : + operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 : + operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" : + false; + }; + }, + + "CHILD": function( type, what, argument, first, last ) { + var simple = type.slice( 0, 3 ) !== "nth", + forward = type.slice( -4 ) !== "last", + ofType = what === "of-type"; + + return first === 1 && last === 0 ? + + // Shortcut for :nth-*(n) + function( elem ) { + return !!elem.parentNode; + } : + + function( elem, context, xml ) { + var cache, uniqueCache, outerCache, node, nodeIndex, start, + dir = simple !== forward ? "nextSibling" : "previousSibling", + parent = elem.parentNode, + name = ofType && elem.nodeName.toLowerCase(), + useCache = !xml && !ofType, + diff = false; + + if ( parent ) { + + // :(first|last|only)-(child|of-type) + if ( simple ) { + while ( dir ) { + node = elem; + while ( (node = node[ dir ]) ) { + if ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) { + + return false; + } + } + // Reverse direction for :only-* (if we haven't yet done so) + start = dir = type === "only" && !start && "nextSibling"; + } + return true; + } + + start = [ forward ? parent.firstChild : parent.lastChild ]; + + // non-xml :nth-child(...) stores cache data on `parent` + if ( forward && useCache ) { + + // Seek `elem` from a previously-cached index + + // ...in a gzip-friendly way + node = parent; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex && cache[ 2 ]; + node = nodeIndex && parent.childNodes[ nodeIndex ]; + + while ( (node = ++nodeIndex && node && node[ dir ] || + + // Fallback to seeking `elem` from the start + (diff = nodeIndex = 0) || start.pop()) ) { + + // When found, cache indexes on `parent` and break + if ( node.nodeType === 1 && ++diff && node === elem ) { + uniqueCache[ type ] = [ dirruns, nodeIndex, diff ]; + break; + } + } + + } else { + // Use previously-cached element index if available + if ( useCache ) { + // ...in a gzip-friendly way + node = elem; + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + cache = uniqueCache[ type ] || []; + nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ]; + diff = nodeIndex; + } + + // xml :nth-child(...) + // or :nth-last-child(...) or :nth(-last)?-of-type(...) + if ( diff === false ) { + // Use the same loop as above to seek `elem` from the start + while ( (node = ++nodeIndex && node && node[ dir ] || + (diff = nodeIndex = 0) || start.pop()) ) { + + if ( ( ofType ? + node.nodeName.toLowerCase() === name : + node.nodeType === 1 ) && + ++diff ) { + + // Cache the index of each encountered element + if ( useCache ) { + outerCache = node[ expando ] || (node[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ node.uniqueID ] || + (outerCache[ node.uniqueID ] = {}); + + uniqueCache[ type ] = [ dirruns, diff ]; + } + + if ( node === elem ) { + break; + } + } + } + } + } + + // Incorporate the offset, then check against cycle size + diff -= last; + return diff === first || ( diff % first === 0 && diff / first >= 0 ); + } + }; + }, + + "PSEUDO": function( pseudo, argument ) { + // pseudo-class names are case-insensitive + // http://www.w3.org/TR/selectors/#pseudo-classes + // Prioritize by case sensitivity in case custom pseudos are added with uppercase letters + // Remember that setFilters inherits from pseudos + var args, + fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] || + Sizzle.error( "unsupported pseudo: " + pseudo ); + + // The user may use createPseudo to indicate that + // arguments are needed to create the filter function + // just as Sizzle does + if ( fn[ expando ] ) { + return fn( argument ); + } + + // But maintain support for old signatures + if ( fn.length > 1 ) { + args = [ pseudo, pseudo, "", argument ]; + return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ? + markFunction(function( seed, matches ) { + var idx, + matched = fn( seed, argument ), + i = matched.length; + while ( i-- ) { + idx = indexOf( seed, matched[i] ); + seed[ idx ] = !( matches[ idx ] = matched[i] ); + } + }) : + function( elem ) { + return fn( elem, 0, args ); + }; + } + + return fn; + } + }, + + pseudos: { + // Potentially complex pseudos + "not": markFunction(function( selector ) { + // Trim the selector passed to compile + // to avoid treating leading and trailing + // spaces as combinators + var input = [], + results = [], + matcher = compile( selector.replace( rtrim, "$1" ) ); + + return matcher[ expando ] ? + markFunction(function( seed, matches, context, xml ) { + var elem, + unmatched = matcher( seed, null, xml, [] ), + i = seed.length; + + // Match elements unmatched by `matcher` + while ( i-- ) { + if ( (elem = unmatched[i]) ) { + seed[i] = !(matches[i] = elem); + } + } + }) : + function( elem, context, xml ) { + input[0] = elem; + matcher( input, null, xml, results ); + // Don't keep the element (issue #299) + input[0] = null; + return !results.pop(); + }; + }), + + "has": markFunction(function( selector ) { + return function( elem ) { + return Sizzle( selector, elem ).length > 0; + }; + }), + + "contains": markFunction(function( text ) { + text = text.replace( runescape, funescape ); + return function( elem ) { + return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1; + }; + }), + + // "Whether an element is represented by a :lang() selector + // is based solely on the element's language value + // being equal to the identifier C, + // or beginning with the identifier C immediately followed by "-". + // The matching of C against the element's language value is performed case-insensitively. + // The identifier C does not have to be a valid language name." + // http://www.w3.org/TR/selectors/#lang-pseudo + "lang": markFunction( function( lang ) { + // lang value must be a valid identifier + if ( !ridentifier.test(lang || "") ) { + Sizzle.error( "unsupported lang: " + lang ); + } + lang = lang.replace( runescape, funescape ).toLowerCase(); + return function( elem ) { + var elemLang; + do { + if ( (elemLang = documentIsHTML ? + elem.lang : + elem.getAttribute("xml:lang") || elem.getAttribute("lang")) ) { + + elemLang = elemLang.toLowerCase(); + return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0; + } + } while ( (elem = elem.parentNode) && elem.nodeType === 1 ); + return false; + }; + }), + + // Miscellaneous + "target": function( elem ) { + var hash = window.location && window.location.hash; + return hash && hash.slice( 1 ) === elem.id; + }, + + "root": function( elem ) { + return elem === docElem; + }, + + "focus": function( elem ) { + return elem === document.activeElement && (!document.hasFocus || document.hasFocus()) && !!(elem.type || elem.href || ~elem.tabIndex); + }, + + // Boolean properties + "enabled": createDisabledPseudo( false ), + "disabled": createDisabledPseudo( true ), + + "checked": function( elem ) { + // In CSS3, :checked should return both checked and selected elements + // http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked + var nodeName = elem.nodeName.toLowerCase(); + return (nodeName === "input" && !!elem.checked) || (nodeName === "option" && !!elem.selected); + }, + + "selected": function( elem ) { + // Accessing this property makes selected-by-default + // options in Safari work properly + if ( elem.parentNode ) { + elem.parentNode.selectedIndex; + } + + return elem.selected === true; + }, + + // Contents + "empty": function( elem ) { + // http://www.w3.org/TR/selectors/#empty-pseudo + // :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5), + // but not by others (comment: 8; processing instruction: 7; etc.) + // nodeType < 6 works because attributes (2) do not appear as children + for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) { + if ( elem.nodeType < 6 ) { + return false; + } + } + return true; + }, + + "parent": function( elem ) { + return !Expr.pseudos["empty"]( elem ); + }, + + // Element/input types + "header": function( elem ) { + return rheader.test( elem.nodeName ); + }, + + "input": function( elem ) { + return rinputs.test( elem.nodeName ); + }, + + "button": function( elem ) { + var name = elem.nodeName.toLowerCase(); + return name === "input" && elem.type === "button" || name === "button"; + }, + + "text": function( elem ) { + var attr; + return elem.nodeName.toLowerCase() === "input" && + elem.type === "text" && + + // Support: IE<8 + // New HTML5 attribute values (e.g., "search") appear with elem.type === "text" + ( (attr = elem.getAttribute("type")) == null || attr.toLowerCase() === "text" ); + }, + + // Position-in-collection + "first": createPositionalPseudo(function() { + return [ 0 ]; + }), + + "last": createPositionalPseudo(function( matchIndexes, length ) { + return [ length - 1 ]; + }), + + "eq": createPositionalPseudo(function( matchIndexes, length, argument ) { + return [ argument < 0 ? argument + length : argument ]; + }), + + "even": createPositionalPseudo(function( matchIndexes, length ) { + var i = 0; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "odd": createPositionalPseudo(function( matchIndexes, length ) { + var i = 1; + for ( ; i < length; i += 2 ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "lt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? + argument + length : + argument > length ? + length : + argument; + for ( ; --i >= 0; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }), + + "gt": createPositionalPseudo(function( matchIndexes, length, argument ) { + var i = argument < 0 ? argument + length : argument; + for ( ; ++i < length; ) { + matchIndexes.push( i ); + } + return matchIndexes; + }) + } +}; + +Expr.pseudos["nth"] = Expr.pseudos["eq"]; + +// Add button/input type pseudos +for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) { + Expr.pseudos[ i ] = createInputPseudo( i ); +} +for ( i in { submit: true, reset: true } ) { + Expr.pseudos[ i ] = createButtonPseudo( i ); +} + +// Easy API for creating new setFilters +function setFilters() {} +setFilters.prototype = Expr.filters = Expr.pseudos; +Expr.setFilters = new setFilters(); + +tokenize = Sizzle.tokenize = function( selector, parseOnly ) { + var matched, match, tokens, type, + soFar, groups, preFilters, + cached = tokenCache[ selector + " " ]; + + if ( cached ) { + return parseOnly ? 0 : cached.slice( 0 ); + } + + soFar = selector; + groups = []; + preFilters = Expr.preFilter; + + while ( soFar ) { + + // Comma and first run + if ( !matched || (match = rcomma.exec( soFar )) ) { + if ( match ) { + // Don't consume trailing commas as valid + soFar = soFar.slice( match[0].length ) || soFar; + } + groups.push( (tokens = []) ); + } + + matched = false; + + // Combinators + if ( (match = rcombinators.exec( soFar )) ) { + matched = match.shift(); + tokens.push({ + value: matched, + // Cast descendant combinators to space + type: match[0].replace( rtrim, " " ) + }); + soFar = soFar.slice( matched.length ); + } + + // Filters + for ( type in Expr.filter ) { + if ( (match = matchExpr[ type ].exec( soFar )) && (!preFilters[ type ] || + (match = preFilters[ type ]( match ))) ) { + matched = match.shift(); + tokens.push({ + value: matched, + type: type, + matches: match + }); + soFar = soFar.slice( matched.length ); + } + } + + if ( !matched ) { + break; + } + } + + // Return the length of the invalid excess + // if we're just parsing + // Otherwise, throw an error or return tokens + return parseOnly ? + soFar.length : + soFar ? + Sizzle.error( selector ) : + // Cache the tokens + tokenCache( selector, groups ).slice( 0 ); +}; + +function toSelector( tokens ) { + var i = 0, + len = tokens.length, + selector = ""; + for ( ; i < len; i++ ) { + selector += tokens[i].value; + } + return selector; +} + +function addCombinator( matcher, combinator, base ) { + var dir = combinator.dir, + skip = combinator.next, + key = skip || dir, + checkNonElements = base && key === "parentNode", + doneName = done++; + + return combinator.first ? + // Check against closest ancestor/preceding element + function( elem, context, xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + return matcher( elem, context, xml ); + } + } + return false; + } : + + // Check against all ancestor/preceding elements + function( elem, context, xml ) { + var oldCache, uniqueCache, outerCache, + newCache = [ dirruns, doneName ]; + + // We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching + if ( xml ) { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + if ( matcher( elem, context, xml ) ) { + return true; + } + } + } + } else { + while ( (elem = elem[ dir ]) ) { + if ( elem.nodeType === 1 || checkNonElements ) { + outerCache = elem[ expando ] || (elem[ expando ] = {}); + + // Support: IE <9 only + // Defend against cloned attroperties (jQuery gh-1709) + uniqueCache = outerCache[ elem.uniqueID ] || (outerCache[ elem.uniqueID ] = {}); + + if ( skip && skip === elem.nodeName.toLowerCase() ) { + elem = elem[ dir ] || elem; + } else if ( (oldCache = uniqueCache[ key ]) && + oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) { + + // Assign to newCache so results back-propagate to previous elements + return (newCache[ 2 ] = oldCache[ 2 ]); + } else { + // Reuse newcache so results back-propagate to previous elements + uniqueCache[ key ] = newCache; + + // A match means we're done; a fail means we have to keep checking + if ( (newCache[ 2 ] = matcher( elem, context, xml )) ) { + return true; + } + } + } + } + } + return false; + }; +} + +function elementMatcher( matchers ) { + return matchers.length > 1 ? + function( elem, context, xml ) { + var i = matchers.length; + while ( i-- ) { + if ( !matchers[i]( elem, context, xml ) ) { + return false; + } + } + return true; + } : + matchers[0]; +} + +function multipleContexts( selector, contexts, results ) { + var i = 0, + len = contexts.length; + for ( ; i < len; i++ ) { + Sizzle( selector, contexts[i], results ); + } + return results; +} + +function condense( unmatched, map, filter, context, xml ) { + var elem, + newUnmatched = [], + i = 0, + len = unmatched.length, + mapped = map != null; + + for ( ; i < len; i++ ) { + if ( (elem = unmatched[i]) ) { + if ( !filter || filter( elem, context, xml ) ) { + newUnmatched.push( elem ); + if ( mapped ) { + map.push( i ); + } + } + } + } + + return newUnmatched; +} + +function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) { + if ( postFilter && !postFilter[ expando ] ) { + postFilter = setMatcher( postFilter ); + } + if ( postFinder && !postFinder[ expando ] ) { + postFinder = setMatcher( postFinder, postSelector ); + } + return markFunction(function( seed, results, context, xml ) { + var temp, i, elem, + preMap = [], + postMap = [], + preexisting = results.length, + + // Get initial elements from seed or context + elems = seed || multipleContexts( selector || "*", context.nodeType ? [ context ] : context, [] ), + + // Prefilter to get matcher input, preserving a map for seed-results synchronization + matcherIn = preFilter && ( seed || !selector ) ? + condense( elems, preMap, preFilter, context, xml ) : + elems, + + matcherOut = matcher ? + // If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results, + postFinder || ( seed ? preFilter : preexisting || postFilter ) ? + + // ...intermediate processing is necessary + [] : + + // ...otherwise use results directly + results : + matcherIn; + + // Find primary matches + if ( matcher ) { + matcher( matcherIn, matcherOut, context, xml ); + } + + // Apply postFilter + if ( postFilter ) { + temp = condense( matcherOut, postMap ); + postFilter( temp, [], context, xml ); + + // Un-match failing elements by moving them back to matcherIn + i = temp.length; + while ( i-- ) { + if ( (elem = temp[i]) ) { + matcherOut[ postMap[i] ] = !(matcherIn[ postMap[i] ] = elem); + } + } + } + + if ( seed ) { + if ( postFinder || preFilter ) { + if ( postFinder ) { + // Get the final matcherOut by condensing this intermediate into postFinder contexts + temp = []; + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) ) { + // Restore matcherIn since elem is not yet a final match + temp.push( (matcherIn[i] = elem) ); + } + } + postFinder( null, (matcherOut = []), temp, xml ); + } + + // Move matched elements from seed to results to keep them synchronized + i = matcherOut.length; + while ( i-- ) { + if ( (elem = matcherOut[i]) && + (temp = postFinder ? indexOf( seed, elem ) : preMap[i]) > -1 ) { + + seed[temp] = !(results[temp] = elem); + } + } + } + + // Add elements to results, through postFinder if defined + } else { + matcherOut = condense( + matcherOut === results ? + matcherOut.splice( preexisting, matcherOut.length ) : + matcherOut + ); + if ( postFinder ) { + postFinder( null, results, matcherOut, xml ); + } else { + push.apply( results, matcherOut ); + } + } + }); +} + +function matcherFromTokens( tokens ) { + var checkContext, matcher, j, + len = tokens.length, + leadingRelative = Expr.relative[ tokens[0].type ], + implicitRelative = leadingRelative || Expr.relative[" "], + i = leadingRelative ? 1 : 0, + + // The foundational matcher ensures that elements are reachable from top-level context(s) + matchContext = addCombinator( function( elem ) { + return elem === checkContext; + }, implicitRelative, true ), + matchAnyContext = addCombinator( function( elem ) { + return indexOf( checkContext, elem ) > -1; + }, implicitRelative, true ), + matchers = [ function( elem, context, xml ) { + var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || ( + (checkContext = context).nodeType ? + matchContext( elem, context, xml ) : + matchAnyContext( elem, context, xml ) ); + // Avoid hanging onto element (issue #299) + checkContext = null; + return ret; + } ]; + + for ( ; i < len; i++ ) { + if ( (matcher = Expr.relative[ tokens[i].type ]) ) { + matchers = [ addCombinator(elementMatcher( matchers ), matcher) ]; + } else { + matcher = Expr.filter[ tokens[i].type ].apply( null, tokens[i].matches ); + + // Return special upon seeing a positional matcher + if ( matcher[ expando ] ) { + // Find the next relative operator (if any) for proper handling + j = ++i; + for ( ; j < len; j++ ) { + if ( Expr.relative[ tokens[j].type ] ) { + break; + } + } + return setMatcher( + i > 1 && elementMatcher( matchers ), + i > 1 && toSelector( + // If the preceding token was a descendant combinator, insert an implicit any-element `*` + tokens.slice( 0, i - 1 ).concat({ value: tokens[ i - 2 ].type === " " ? "*" : "" }) + ).replace( rtrim, "$1" ), + matcher, + i < j && matcherFromTokens( tokens.slice( i, j ) ), + j < len && matcherFromTokens( (tokens = tokens.slice( j )) ), + j < len && toSelector( tokens ) + ); + } + matchers.push( matcher ); + } + } + + return elementMatcher( matchers ); +} + +function matcherFromGroupMatchers( elementMatchers, setMatchers ) { + var bySet = setMatchers.length > 0, + byElement = elementMatchers.length > 0, + superMatcher = function( seed, context, xml, results, outermost ) { + var elem, j, matcher, + matchedCount = 0, + i = "0", + unmatched = seed && [], + setMatched = [], + contextBackup = outermostContext, + // We must always have either seed elements or outermost context + elems = seed || byElement && Expr.find["TAG"]( "*", outermost ), + // Use integer dirruns iff this is the outermost matcher + dirrunsUnique = (dirruns += contextBackup == null ? 1 : Math.random() || 0.1), + len = elems.length; + + if ( outermost ) { + outermostContext = context === document || context || outermost; + } + + // Add elements passing elementMatchers directly to results + // Support: IE<9, Safari + // Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id + for ( ; i !== len && (elem = elems[i]) != null; i++ ) { + if ( byElement && elem ) { + j = 0; + if ( !context && elem.ownerDocument !== document ) { + setDocument( elem ); + xml = !documentIsHTML; + } + while ( (matcher = elementMatchers[j++]) ) { + if ( matcher( elem, context || document, xml) ) { + results.push( elem ); + break; + } + } + if ( outermost ) { + dirruns = dirrunsUnique; + } + } + + // Track unmatched elements for set filters + if ( bySet ) { + // They will have gone through all possible matchers + if ( (elem = !matcher && elem) ) { + matchedCount--; + } + + // Lengthen the array for every element, matched or not + if ( seed ) { + unmatched.push( elem ); + } + } + } + + // `i` is now the count of elements visited above, and adding it to `matchedCount` + // makes the latter nonnegative. + matchedCount += i; + + // Apply set filters to unmatched elements + // NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount` + // equals `i`), unless we didn't visit _any_ elements in the above loop because we have + // no element matchers and no seed. + // Incrementing an initially-string "0" `i` allows `i` to remain a string only in that + // case, which will result in a "00" `matchedCount` that differs from `i` but is also + // numerically zero. + if ( bySet && i !== matchedCount ) { + j = 0; + while ( (matcher = setMatchers[j++]) ) { + matcher( unmatched, setMatched, context, xml ); + } + + if ( seed ) { + // Reintegrate element matches to eliminate the need for sorting + if ( matchedCount > 0 ) { + while ( i-- ) { + if ( !(unmatched[i] || setMatched[i]) ) { + setMatched[i] = pop.call( results ); + } + } + } + + // Discard index placeholder values to get only actual matches + setMatched = condense( setMatched ); + } + + // Add matches to results + push.apply( results, setMatched ); + + // Seedless set matches succeeding multiple successful matchers stipulate sorting + if ( outermost && !seed && setMatched.length > 0 && + ( matchedCount + setMatchers.length ) > 1 ) { + + Sizzle.uniqueSort( results ); + } + } + + // Override manipulation of globals by nested matchers + if ( outermost ) { + dirruns = dirrunsUnique; + outermostContext = contextBackup; + } + + return unmatched; + }; + + return bySet ? + markFunction( superMatcher ) : + superMatcher; +} + +compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) { + var i, + setMatchers = [], + elementMatchers = [], + cached = compilerCache[ selector + " " ]; + + if ( !cached ) { + // Generate a function of recursive functions that can be used to check each element + if ( !match ) { + match = tokenize( selector ); + } + i = match.length; + while ( i-- ) { + cached = matcherFromTokens( match[i] ); + if ( cached[ expando ] ) { + setMatchers.push( cached ); + } else { + elementMatchers.push( cached ); + } + } + + // Cache the compiled function + cached = compilerCache( selector, matcherFromGroupMatchers( elementMatchers, setMatchers ) ); + + // Save selector and tokenization + cached.selector = selector; + } + return cached; +}; + +/** + * A low-level selection function that works with Sizzle's compiled + * selector functions + * @param {String|Function} selector A selector or a pre-compiled + * selector function built with Sizzle.compile + * @param {Element} context + * @param {Array} [results] + * @param {Array} [seed] A set of elements to match against + */ +select = Sizzle.select = function( selector, context, results, seed ) { + var i, tokens, token, type, find, + compiled = typeof selector === "function" && selector, + match = !seed && tokenize( (selector = compiled.selector || selector) ); + + results = results || []; + + // Try to minimize operations if there is only one selector in the list and no seed + // (the latter of which guarantees us context) + if ( match.length === 1 ) { + + // Reduce context if the leading compound selector is an ID + tokens = match[0] = match[0].slice( 0 ); + if ( tokens.length > 2 && (token = tokens[0]).type === "ID" && + context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[1].type ] ) { + + context = ( Expr.find["ID"]( token.matches[0].replace(runescape, funescape), context ) || [] )[0]; + if ( !context ) { + return results; + + // Precompiled matchers will still verify ancestry, so step up a level + } else if ( compiled ) { + context = context.parentNode; + } + + selector = selector.slice( tokens.shift().value.length ); + } + + // Fetch a seed set for right-to-left matching + i = matchExpr["needsContext"].test( selector ) ? 0 : tokens.length; + while ( i-- ) { + token = tokens[i]; + + // Abort if we hit a combinator + if ( Expr.relative[ (type = token.type) ] ) { + break; + } + if ( (find = Expr.find[ type ]) ) { + // Search, expanding context for leading sibling combinators + if ( (seed = find( + token.matches[0].replace( runescape, funescape ), + rsibling.test( tokens[0].type ) && testContext( context.parentNode ) || context + )) ) { + + // If seed is empty or no tokens remain, we can return early + tokens.splice( i, 1 ); + selector = seed.length && toSelector( tokens ); + if ( !selector ) { + push.apply( results, seed ); + return results; + } + + break; + } + } + } + } + + // Compile and execute a filtering function if one is not provided + // Provide `match` to avoid retokenization if we modified the selector above + ( compiled || compile( selector, match ) )( + seed, + context, + !documentIsHTML, + results, + !context || rsibling.test( selector ) && testContext( context.parentNode ) || context + ); + return results; +}; + +// One-time assignments + +// Sort stability +support.sortStable = expando.split("").sort( sortOrder ).join("") === expando; + +// Support: Chrome 14-35+ +// Always assume duplicates if they aren't passed to the comparison function +support.detectDuplicates = !!hasDuplicate; + +// Initialize against the default document +setDocument(); + +// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27) +// Detached nodes confoundingly follow *each other* +support.sortDetached = assert(function( el ) { + // Should return 1, but returns 4 (following) + return el.compareDocumentPosition( document.createElement("fieldset") ) & 1; +}); + +// Support: IE<8 +// Prevent attribute/property "interpolation" +// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx +if ( !assert(function( el ) { + el.innerHTML = "<a href='#'></a>"; + return el.firstChild.getAttribute("href") === "#" ; +}) ) { + addHandle( "type|href|height|width", function( elem, name, isXML ) { + if ( !isXML ) { + return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 ); + } + }); +} + +// Support: IE<9 +// Use defaultValue in place of getAttribute("value") +if ( !support.attributes || !assert(function( el ) { + el.innerHTML = "<input/>"; + el.firstChild.setAttribute( "value", "" ); + return el.firstChild.getAttribute( "value" ) === ""; +}) ) { + addHandle( "value", function( elem, name, isXML ) { + if ( !isXML && elem.nodeName.toLowerCase() === "input" ) { + return elem.defaultValue; + } + }); +} + +// Support: IE<9 +// Use getAttributeNode to fetch booleans when getAttribute lies +if ( !assert(function( el ) { + return el.getAttribute("disabled") == null; +}) ) { + addHandle( booleans, function( elem, name, isXML ) { + var val; + if ( !isXML ) { + return elem[ name ] === true ? name.toLowerCase() : + (val = elem.getAttributeNode( name )) && val.specified ? + val.value : + null; + } + }); +} + +return Sizzle; + +})( window ); + + + +jQuery.find = Sizzle; +jQuery.expr = Sizzle.selectors; + +// Deprecated +jQuery.expr[ ":" ] = jQuery.expr.pseudos; +jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort; +jQuery.text = Sizzle.getText; +jQuery.isXMLDoc = Sizzle.isXML; +jQuery.contains = Sizzle.contains; +jQuery.escapeSelector = Sizzle.escape; + + + + +var dir = function( elem, dir, until ) { + var matched = [], + truncate = until !== undefined; + + while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) { + if ( elem.nodeType === 1 ) { + if ( truncate && jQuery( elem ).is( until ) ) { + break; + } + matched.push( elem ); + } + } + return matched; +}; + + +var siblings = function( n, elem ) { + var matched = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType === 1 && n !== elem ) { + matched.push( n ); + } + } + + return matched; +}; + + +var rneedsContext = jQuery.expr.match.needsContext; + + + +function nodeName( elem, name ) { + + return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase(); + +}; +var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i ); + + + +// Implement the identical functionality for filter and not +function winnow( elements, qualifier, not ) { + if ( isFunction( qualifier ) ) { + return jQuery.grep( elements, function( elem, i ) { + return !!qualifier.call( elem, i, elem ) !== not; + } ); + } + + // Single element + if ( qualifier.nodeType ) { + return jQuery.grep( elements, function( elem ) { + return ( elem === qualifier ) !== not; + } ); + } + + // Arraylike of elements (jQuery, arguments, Array) + if ( typeof qualifier !== "string" ) { + return jQuery.grep( elements, function( elem ) { + return ( indexOf.call( qualifier, elem ) > -1 ) !== not; + } ); + } + + // Filtered directly for both simple and complex selectors + return jQuery.filter( qualifier, elements, not ); +} + +jQuery.filter = function( expr, elems, not ) { + var elem = elems[ 0 ]; + + if ( not ) { + expr = ":not(" + expr + ")"; + } + + if ( elems.length === 1 && elem.nodeType === 1 ) { + return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : []; + } + + return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) { + return elem.nodeType === 1; + } ) ); +}; + +jQuery.fn.extend( { + find: function( selector ) { + var i, ret, + len = this.length, + self = this; + + if ( typeof selector !== "string" ) { + return this.pushStack( jQuery( selector ).filter( function() { + for ( i = 0; i < len; i++ ) { + if ( jQuery.contains( self[ i ], this ) ) { + return true; + } + } + } ) ); + } + + ret = this.pushStack( [] ); + + for ( i = 0; i < len; i++ ) { + jQuery.find( selector, self[ i ], ret ); + } + + return len > 1 ? jQuery.uniqueSort( ret ) : ret; + }, + filter: function( selector ) { + return this.pushStack( winnow( this, selector || [], false ) ); + }, + not: function( selector ) { + return this.pushStack( winnow( this, selector || [], true ) ); + }, + is: function( selector ) { + return !!winnow( + this, + + // If this is a positional/relative selector, check membership in the returned set + // so $("p:first").is("p:last") won't return true for a doc with two "p". + typeof selector === "string" && rneedsContext.test( selector ) ? + jQuery( selector ) : + selector || [], + false + ).length; + } +} ); + + +// Initialize a jQuery object + + +// A central reference to the root jQuery(document) +var rootjQuery, + + // A simple way to check for HTML strings + // Prioritize #id over <tag> to avoid XSS via location.hash (#9521) + // Strict HTML recognition (#11290: must start with <) + // Shortcut simple #id case for speed + rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/, + + init = jQuery.fn.init = function( selector, context, root ) { + var match, elem; + + // HANDLE: $(""), $(null), $(undefined), $(false) + if ( !selector ) { + return this; + } + + // Method init() accepts an alternate rootjQuery + // so migrate can support jQuery.sub (gh-2101) + root = root || rootjQuery; + + // Handle HTML strings + if ( typeof selector === "string" ) { + if ( selector[ 0 ] === "<" && + selector[ selector.length - 1 ] === ">" && + selector.length >= 3 ) { + + // Assume that strings that start and end with <> are HTML and skip the regex check + match = [ null, selector, null ]; + + } else { + match = rquickExpr.exec( selector ); + } + + // Match html or make sure no context is specified for #id + if ( match && ( match[ 1 ] || !context ) ) { + + // HANDLE: $(html) -> $(array) + if ( match[ 1 ] ) { + context = context instanceof jQuery ? context[ 0 ] : context; + + // Option to run scripts is true for back-compat + // Intentionally let the error be thrown if parseHTML is not present + jQuery.merge( this, jQuery.parseHTML( + match[ 1 ], + context && context.nodeType ? context.ownerDocument || context : document, + true + ) ); + + // HANDLE: $(html, props) + if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) { + for ( match in context ) { + + // Properties of context are called as methods if possible + if ( isFunction( this[ match ] ) ) { + this[ match ]( context[ match ] ); + + // ...and otherwise set as attributes + } else { + this.attr( match, context[ match ] ); + } + } + } + + return this; + + // HANDLE: $(#id) + } else { + elem = document.getElementById( match[ 2 ] ); + + if ( elem ) { + + // Inject the element directly into the jQuery object + this[ 0 ] = elem; + this.length = 1; + } + return this; + } + + // HANDLE: $(expr, $(...)) + } else if ( !context || context.jquery ) { + return ( context || root ).find( selector ); + + // HANDLE: $(expr, context) + // (which is just equivalent to: $(context).find(expr) + } else { + return this.constructor( context ).find( selector ); + } + + // HANDLE: $(DOMElement) + } else if ( selector.nodeType ) { + this[ 0 ] = selector; + this.length = 1; + return this; + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( isFunction( selector ) ) { + return root.ready !== undefined ? + root.ready( selector ) : + + // Execute immediately if ready is not present + selector( jQuery ); + } + + return jQuery.makeArray( selector, this ); + }; + +// Give the init function the jQuery prototype for later instantiation +init.prototype = jQuery.fn; + +// Initialize central reference +rootjQuery = jQuery( document ); + + +var rparentsprev = /^(?:parents|prev(?:Until|All))/, + + // Methods guaranteed to produce a unique set when starting from a unique set + guaranteedUnique = { + children: true, + contents: true, + next: true, + prev: true + }; + +jQuery.fn.extend( { + has: function( target ) { + var targets = jQuery( target, this ), + l = targets.length; + + return this.filter( function() { + var i = 0; + for ( ; i < l; i++ ) { + if ( jQuery.contains( this, targets[ i ] ) ) { + return true; + } + } + } ); + }, + + closest: function( selectors, context ) { + var cur, + i = 0, + l = this.length, + matched = [], + targets = typeof selectors !== "string" && jQuery( selectors ); + + // Positional selectors never match, since there's no _selection_ context + if ( !rneedsContext.test( selectors ) ) { + for ( ; i < l; i++ ) { + for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) { + + // Always skip document fragments + if ( cur.nodeType < 11 && ( targets ? + targets.index( cur ) > -1 : + + // Don't pass non-elements to Sizzle + cur.nodeType === 1 && + jQuery.find.matchesSelector( cur, selectors ) ) ) { + + matched.push( cur ); + break; + } + } + } + } + + return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched ); + }, + + // Determine the position of an element within the set + index: function( elem ) { + + // No argument, return index in parent + if ( !elem ) { + return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1; + } + + // Index in selector + if ( typeof elem === "string" ) { + return indexOf.call( jQuery( elem ), this[ 0 ] ); + } + + // Locate the position of the desired element + return indexOf.call( this, + + // If it receives a jQuery object, the first element is used + elem.jquery ? elem[ 0 ] : elem + ); + }, + + add: function( selector, context ) { + return this.pushStack( + jQuery.uniqueSort( + jQuery.merge( this.get(), jQuery( selector, context ) ) + ) + ); + }, + + addBack: function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + } +} ); + +function sibling( cur, dir ) { + while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {} + return cur; +} + +jQuery.each( { + parent: function( elem ) { + var parent = elem.parentNode; + return parent && parent.nodeType !== 11 ? parent : null; + }, + parents: function( elem ) { + return dir( elem, "parentNode" ); + }, + parentsUntil: function( elem, i, until ) { + return dir( elem, "parentNode", until ); + }, + next: function( elem ) { + return sibling( elem, "nextSibling" ); + }, + prev: function( elem ) { + return sibling( elem, "previousSibling" ); + }, + nextAll: function( elem ) { + return dir( elem, "nextSibling" ); + }, + prevAll: function( elem ) { + return dir( elem, "previousSibling" ); + }, + nextUntil: function( elem, i, until ) { + return dir( elem, "nextSibling", until ); + }, + prevUntil: function( elem, i, until ) { + return dir( elem, "previousSibling", until ); + }, + siblings: function( elem ) { + return siblings( ( elem.parentNode || {} ).firstChild, elem ); + }, + children: function( elem ) { + return siblings( elem.firstChild ); + }, + contents: function( elem ) { + if ( typeof elem.contentDocument !== "undefined" ) { + return elem.contentDocument; + } + + // Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only + // Treat the template element as a regular one in browsers that + // don't support it. + if ( nodeName( elem, "template" ) ) { + elem = elem.content || elem; + } + + return jQuery.merge( [], elem.childNodes ); + } +}, function( name, fn ) { + jQuery.fn[ name ] = function( until, selector ) { + var matched = jQuery.map( this, fn, until ); + + if ( name.slice( -5 ) !== "Until" ) { + selector = until; + } + + if ( selector && typeof selector === "string" ) { + matched = jQuery.filter( selector, matched ); + } + + if ( this.length > 1 ) { + + // Remove duplicates + if ( !guaranteedUnique[ name ] ) { + jQuery.uniqueSort( matched ); + } + + // Reverse order for parents* and prev-derivatives + if ( rparentsprev.test( name ) ) { + matched.reverse(); + } + } + + return this.pushStack( matched ); + }; +} ); +var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g ); + + + +// Convert String-formatted options into Object-formatted ones +function createOptions( options ) { + var object = {}; + jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) { + object[ flag ] = true; + } ); + return object; +} + +/* + * Create a callback list using the following parameters: + * + * options: an optional list of space-separated options that will change how + * the callback list behaves or a more traditional option object + * + * By default a callback list will act like an event callback list and can be + * "fired" multiple times. + * + * Possible options: + * + * once: will ensure the callback list can only be fired once (like a Deferred) + * + * memory: will keep track of previous values and will call any callback added + * after the list has been fired right away with the latest "memorized" + * values (like a Deferred) + * + * unique: will ensure a callback can only be added once (no duplicate in the list) + * + * stopOnFalse: interrupt callings when a callback returns false + * + */ +jQuery.Callbacks = function( options ) { + + // Convert options from String-formatted to Object-formatted if needed + // (we check in cache first) + options = typeof options === "string" ? + createOptions( options ) : + jQuery.extend( {}, options ); + + var // Flag to know if list is currently firing + firing, + + // Last fire value for non-forgettable lists + memory, + + // Flag to know if list was already fired + fired, + + // Flag to prevent firing + locked, + + // Actual callback list + list = [], + + // Queue of execution data for repeatable lists + queue = [], + + // Index of currently firing callback (modified by add/remove as needed) + firingIndex = -1, + + // Fire callbacks + fire = function() { + + // Enforce single-firing + locked = locked || options.once; + + // Execute callbacks for all pending executions, + // respecting firingIndex overrides and runtime changes + fired = firing = true; + for ( ; queue.length; firingIndex = -1 ) { + memory = queue.shift(); + while ( ++firingIndex < list.length ) { + + // Run callback and check for early termination + if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false && + options.stopOnFalse ) { + + // Jump to end and forget the data so .add doesn't re-fire + firingIndex = list.length; + memory = false; + } + } + } + + // Forget the data if we're done with it + if ( !options.memory ) { + memory = false; + } + + firing = false; + + // Clean up if we're done firing for good + if ( locked ) { + + // Keep an empty list if we have data for future add calls + if ( memory ) { + list = []; + + // Otherwise, this object is spent + } else { + list = ""; + } + } + }, + + // Actual Callbacks object + self = { + + // Add a callback or a collection of callbacks to the list + add: function() { + if ( list ) { + + // If we have memory from a past run, we should fire after adding + if ( memory && !firing ) { + firingIndex = list.length - 1; + queue.push( memory ); + } + + ( function add( args ) { + jQuery.each( args, function( _, arg ) { + if ( isFunction( arg ) ) { + if ( !options.unique || !self.has( arg ) ) { + list.push( arg ); + } + } else if ( arg && arg.length && toType( arg ) !== "string" ) { + + // Inspect recursively + add( arg ); + } + } ); + } )( arguments ); + + if ( memory && !firing ) { + fire(); + } + } + return this; + }, + + // Remove a callback from the list + remove: function() { + jQuery.each( arguments, function( _, arg ) { + var index; + while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) { + list.splice( index, 1 ); + + // Handle firing indexes + if ( index <= firingIndex ) { + firingIndex--; + } + } + } ); + return this; + }, + + // Check if a given callback is in the list. + // If no argument is given, return whether or not list has callbacks attached. + has: function( fn ) { + return fn ? + jQuery.inArray( fn, list ) > -1 : + list.length > 0; + }, + + // Remove all callbacks from the list + empty: function() { + if ( list ) { + list = []; + } + return this; + }, + + // Disable .fire and .add + // Abort any current/pending executions + // Clear all callbacks and values + disable: function() { + locked = queue = []; + list = memory = ""; + return this; + }, + disabled: function() { + return !list; + }, + + // Disable .fire + // Also disable .add unless we have memory (since it would have no effect) + // Abort any pending executions + lock: function() { + locked = queue = []; + if ( !memory && !firing ) { + list = memory = ""; + } + return this; + }, + locked: function() { + return !!locked; + }, + + // Call all callbacks with the given context and arguments + fireWith: function( context, args ) { + if ( !locked ) { + args = args || []; + args = [ context, args.slice ? args.slice() : args ]; + queue.push( args ); + if ( !firing ) { + fire(); + } + } + return this; + }, + + // Call all the callbacks with the given arguments + fire: function() { + self.fireWith( this, arguments ); + return this; + }, + + // To know if the callbacks have already been called at least once + fired: function() { + return !!fired; + } + }; + + return self; +}; + + +function Identity( v ) { + return v; +} +function Thrower( ex ) { + throw ex; +} + +function adoptValue( value, resolve, reject, noValue ) { + var method; + + try { + + // Check for promise aspect first to privilege synchronous behavior + if ( value && isFunction( ( method = value.promise ) ) ) { + method.call( value ).done( resolve ).fail( reject ); + + // Other thenables + } else if ( value && isFunction( ( method = value.then ) ) ) { + method.call( value, resolve, reject ); + + // Other non-thenables + } else { + + // Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer: + // * false: [ value ].slice( 0 ) => resolve( value ) + // * true: [ value ].slice( 1 ) => resolve() + resolve.apply( undefined, [ value ].slice( noValue ) ); + } + + // For Promises/A+, convert exceptions into rejections + // Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in + // Deferred#then to conditionally suppress rejection. + } catch ( value ) { + + // Support: Android 4.0 only + // Strict mode functions invoked without .call/.apply get global-object context + reject.apply( undefined, [ value ] ); + } +} + +jQuery.extend( { + + Deferred: function( func ) { + var tuples = [ + + // action, add listener, callbacks, + // ... .then handlers, argument index, [final state] + [ "notify", "progress", jQuery.Callbacks( "memory" ), + jQuery.Callbacks( "memory" ), 2 ], + [ "resolve", "done", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 0, "resolved" ], + [ "reject", "fail", jQuery.Callbacks( "once memory" ), + jQuery.Callbacks( "once memory" ), 1, "rejected" ] + ], + state = "pending", + promise = { + state: function() { + return state; + }, + always: function() { + deferred.done( arguments ).fail( arguments ); + return this; + }, + "catch": function( fn ) { + return promise.then( null, fn ); + }, + + // Keep pipe for back-compat + pipe: function( /* fnDone, fnFail, fnProgress */ ) { + var fns = arguments; + + return jQuery.Deferred( function( newDefer ) { + jQuery.each( tuples, function( i, tuple ) { + + // Map tuples (progress, done, fail) to arguments (done, fail, progress) + var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ]; + + // deferred.progress(function() { bind to newDefer or newDefer.notify }) + // deferred.done(function() { bind to newDefer or newDefer.resolve }) + // deferred.fail(function() { bind to newDefer or newDefer.reject }) + deferred[ tuple[ 1 ] ]( function() { + var returned = fn && fn.apply( this, arguments ); + if ( returned && isFunction( returned.promise ) ) { + returned.promise() + .progress( newDefer.notify ) + .done( newDefer.resolve ) + .fail( newDefer.reject ); + } else { + newDefer[ tuple[ 0 ] + "With" ]( + this, + fn ? [ returned ] : arguments + ); + } + } ); + } ); + fns = null; + } ).promise(); + }, + then: function( onFulfilled, onRejected, onProgress ) { + var maxDepth = 0; + function resolve( depth, deferred, handler, special ) { + return function() { + var that = this, + args = arguments, + mightThrow = function() { + var returned, then; + + // Support: Promises/A+ section 2.3.3.3.3 + // https://promisesaplus.com/#point-59 + // Ignore double-resolution attempts + if ( depth < maxDepth ) { + return; + } + + returned = handler.apply( that, args ); + + // Support: Promises/A+ section 2.3.1 + // https://promisesaplus.com/#point-48 + if ( returned === deferred.promise() ) { + throw new TypeError( "Thenable self-resolution" ); + } + + // Support: Promises/A+ sections 2.3.3.1, 3.5 + // https://promisesaplus.com/#point-54 + // https://promisesaplus.com/#point-75 + // Retrieve `then` only once + then = returned && + + // Support: Promises/A+ section 2.3.4 + // https://promisesaplus.com/#point-64 + // Only check objects and functions for thenability + ( typeof returned === "object" || + typeof returned === "function" ) && + returned.then; + + // Handle a returned thenable + if ( isFunction( then ) ) { + + // Special processors (notify) just wait for resolution + if ( special ) { + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ) + ); + + // Normal processors (resolve) also hook into progress + } else { + + // ...and disregard older resolution values + maxDepth++; + + then.call( + returned, + resolve( maxDepth, deferred, Identity, special ), + resolve( maxDepth, deferred, Thrower, special ), + resolve( maxDepth, deferred, Identity, + deferred.notifyWith ) + ); + } + + // Handle all other returned values + } else { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Identity ) { + that = undefined; + args = [ returned ]; + } + + // Process the value(s) + // Default process is resolve + ( special || deferred.resolveWith )( that, args ); + } + }, + + // Only normal processors (resolve) catch and reject exceptions + process = special ? + mightThrow : + function() { + try { + mightThrow(); + } catch ( e ) { + + if ( jQuery.Deferred.exceptionHook ) { + jQuery.Deferred.exceptionHook( e, + process.stackTrace ); + } + + // Support: Promises/A+ section 2.3.3.3.4.1 + // https://promisesaplus.com/#point-61 + // Ignore post-resolution exceptions + if ( depth + 1 >= maxDepth ) { + + // Only substitute handlers pass on context + // and multiple values (non-spec behavior) + if ( handler !== Thrower ) { + that = undefined; + args = [ e ]; + } + + deferred.rejectWith( that, args ); + } + } + }; + + // Support: Promises/A+ section 2.3.3.3.1 + // https://promisesaplus.com/#point-57 + // Re-resolve promises immediately to dodge false rejection from + // subsequent errors + if ( depth ) { + process(); + } else { + + // Call an optional hook to record the stack, in case of exception + // since it's otherwise lost when execution goes async + if ( jQuery.Deferred.getStackHook ) { + process.stackTrace = jQuery.Deferred.getStackHook(); + } + window.setTimeout( process ); + } + }; + } + + return jQuery.Deferred( function( newDefer ) { + + // progress_handlers.add( ... ) + tuples[ 0 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onProgress ) ? + onProgress : + Identity, + newDefer.notifyWith + ) + ); + + // fulfilled_handlers.add( ... ) + tuples[ 1 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onFulfilled ) ? + onFulfilled : + Identity + ) + ); + + // rejected_handlers.add( ... ) + tuples[ 2 ][ 3 ].add( + resolve( + 0, + newDefer, + isFunction( onRejected ) ? + onRejected : + Thrower + ) + ); + } ).promise(); + }, + + // Get a promise for this deferred + // If obj is provided, the promise aspect is added to the object + promise: function( obj ) { + return obj != null ? jQuery.extend( obj, promise ) : promise; + } + }, + deferred = {}; + + // Add list-specific methods + jQuery.each( tuples, function( i, tuple ) { + var list = tuple[ 2 ], + stateString = tuple[ 5 ]; + + // promise.progress = list.add + // promise.done = list.add + // promise.fail = list.add + promise[ tuple[ 1 ] ] = list.add; + + // Handle state + if ( stateString ) { + list.add( + function() { + + // state = "resolved" (i.e., fulfilled) + // state = "rejected" + state = stateString; + }, + + // rejected_callbacks.disable + // fulfilled_callbacks.disable + tuples[ 3 - i ][ 2 ].disable, + + // rejected_handlers.disable + // fulfilled_handlers.disable + tuples[ 3 - i ][ 3 ].disable, + + // progress_callbacks.lock + tuples[ 0 ][ 2 ].lock, + + // progress_handlers.lock + tuples[ 0 ][ 3 ].lock + ); + } + + // progress_handlers.fire + // fulfilled_handlers.fire + // rejected_handlers.fire + list.add( tuple[ 3 ].fire ); + + // deferred.notify = function() { deferred.notifyWith(...) } + // deferred.resolve = function() { deferred.resolveWith(...) } + // deferred.reject = function() { deferred.rejectWith(...) } + deferred[ tuple[ 0 ] ] = function() { + deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments ); + return this; + }; + + // deferred.notifyWith = list.fireWith + // deferred.resolveWith = list.fireWith + // deferred.rejectWith = list.fireWith + deferred[ tuple[ 0 ] + "With" ] = list.fireWith; + } ); + + // Make the deferred a promise + promise.promise( deferred ); + + // Call given func if any + if ( func ) { + func.call( deferred, deferred ); + } + + // All done! + return deferred; + }, + + // Deferred helper + when: function( singleValue ) { + var + + // count of uncompleted subordinates + remaining = arguments.length, + + // count of unprocessed arguments + i = remaining, + + // subordinate fulfillment data + resolveContexts = Array( i ), + resolveValues = slice.call( arguments ), + + // the master Deferred + master = jQuery.Deferred(), + + // subordinate callback factory + updateFunc = function( i ) { + return function( value ) { + resolveContexts[ i ] = this; + resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value; + if ( !( --remaining ) ) { + master.resolveWith( resolveContexts, resolveValues ); + } + }; + }; + + // Single- and empty arguments are adopted like Promise.resolve + if ( remaining <= 1 ) { + adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject, + !remaining ); + + // Use .then() to unwrap secondary thenables (cf. gh-3000) + if ( master.state() === "pending" || + isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) { + + return master.then(); + } + } + + // Multiple arguments are aggregated like Promise.all array elements + while ( i-- ) { + adoptValue( resolveValues[ i ], updateFunc( i ), master.reject ); + } + + return master.promise(); + } +} ); + + +// These usually indicate a programmer mistake during development, +// warn about them ASAP rather than swallowing them by default. +var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/; + +jQuery.Deferred.exceptionHook = function( error, stack ) { + + // Support: IE 8 - 9 only + // Console exists when dev tools are open, which can happen at any time + if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) { + window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack ); + } +}; + + + + +jQuery.readyException = function( error ) { + window.setTimeout( function() { + throw error; + } ); +}; + + + + +// The deferred used on DOM ready +var readyList = jQuery.Deferred(); + +jQuery.fn.ready = function( fn ) { + + readyList + .then( fn ) + + // Wrap jQuery.readyException in a function so that the lookup + // happens at the time of error handling instead of callback + // registration. + .catch( function( error ) { + jQuery.readyException( error ); + } ); + + return this; +}; + +jQuery.extend( { + + // Is the DOM ready to be used? Set to true once it occurs. + isReady: false, + + // A counter to track how many items to wait for before + // the ready event fires. See #6781 + readyWait: 1, + + // Handle when the DOM is ready + ready: function( wait ) { + + // Abort if there are pending holds or we're already ready + if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) { + return; + } + + // Remember that the DOM is ready + jQuery.isReady = true; + + // If a normal DOM Ready event fired, decrement, and wait if need be + if ( wait !== true && --jQuery.readyWait > 0 ) { + return; + } + + // If there are functions bound, to execute + readyList.resolveWith( document, [ jQuery ] ); + } +} ); + +jQuery.ready.then = readyList.then; + +// The ready event handler and self cleanup method +function completed() { + document.removeEventListener( "DOMContentLoaded", completed ); + window.removeEventListener( "load", completed ); + jQuery.ready(); +} + +// Catch cases where $(document).ready() is called +// after the browser event has already occurred. +// Support: IE <=9 - 10 only +// Older IE sometimes signals "interactive" too soon +if ( document.readyState === "complete" || + ( document.readyState !== "loading" && !document.documentElement.doScroll ) ) { + + // Handle it asynchronously to allow scripts the opportunity to delay ready + window.setTimeout( jQuery.ready ); + +} else { + + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", completed ); + + // A fallback to window.onload, that will always work + window.addEventListener( "load", completed ); +} + + + + +// Multifunctional method to get and set values of a collection +// The value/s can optionally be executed if it's a function +var access = function( elems, fn, key, value, chainable, emptyGet, raw ) { + var i = 0, + len = elems.length, + bulk = key == null; + + // Sets many values + if ( toType( key ) === "object" ) { + chainable = true; + for ( i in key ) { + access( elems, fn, i, key[ i ], true, emptyGet, raw ); + } + + // Sets one value + } else if ( value !== undefined ) { + chainable = true; + + if ( !isFunction( value ) ) { + raw = true; + } + + if ( bulk ) { + + // Bulk operations run against the entire set + if ( raw ) { + fn.call( elems, value ); + fn = null; + + // ...except when executing function values + } else { + bulk = fn; + fn = function( elem, key, value ) { + return bulk.call( jQuery( elem ), value ); + }; + } + } + + if ( fn ) { + for ( ; i < len; i++ ) { + fn( + elems[ i ], key, raw ? + value : + value.call( elems[ i ], i, fn( elems[ i ], key ) ) + ); + } + } + } + + if ( chainable ) { + return elems; + } + + // Gets + if ( bulk ) { + return fn.call( elems ); + } + + return len ? fn( elems[ 0 ], key ) : emptyGet; +}; + + +// Matches dashed string for camelizing +var rmsPrefix = /^-ms-/, + rdashAlpha = /-([a-z])/g; + +// Used by camelCase as callback to replace() +function fcamelCase( all, letter ) { + return letter.toUpperCase(); +} + +// Convert dashed to camelCase; used by the css and data modules +// Support: IE <=9 - 11, Edge 12 - 15 +// Microsoft forgot to hump their vendor prefix (#9572) +function camelCase( string ) { + return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase ); +} +var acceptData = function( owner ) { + + // Accepts only: + // - Node + // - Node.ELEMENT_NODE + // - Node.DOCUMENT_NODE + // - Object + // - Any + return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType ); +}; + + + + +function Data() { + this.expando = jQuery.expando + Data.uid++; +} + +Data.uid = 1; + +Data.prototype = { + + cache: function( owner ) { + + // Check if the owner object already has a cache + var value = owner[ this.expando ]; + + // If not, create one + if ( !value ) { + value = {}; + + // We can accept data for non-element nodes in modern browsers, + // but we should not, see #8335. + // Always return an empty object. + if ( acceptData( owner ) ) { + + // If it is a node unlikely to be stringify-ed or looped over + // use plain assignment + if ( owner.nodeType ) { + owner[ this.expando ] = value; + + // Otherwise secure it in a non-enumerable property + // configurable must be true to allow the property to be + // deleted when data is removed + } else { + Object.defineProperty( owner, this.expando, { + value: value, + configurable: true + } ); + } + } + } + + return value; + }, + set: function( owner, data, value ) { + var prop, + cache = this.cache( owner ); + + // Handle: [ owner, key, value ] args + // Always use camelCase key (gh-2257) + if ( typeof data === "string" ) { + cache[ camelCase( data ) ] = value; + + // Handle: [ owner, { properties } ] args + } else { + + // Copy the properties one-by-one to the cache object + for ( prop in data ) { + cache[ camelCase( prop ) ] = data[ prop ]; + } + } + return cache; + }, + get: function( owner, key ) { + return key === undefined ? + this.cache( owner ) : + + // Always use camelCase key (gh-2257) + owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ]; + }, + access: function( owner, key, value ) { + + // In cases where either: + // + // 1. No key was specified + // 2. A string key was specified, but no value provided + // + // Take the "read" path and allow the get method to determine + // which value to return, respectively either: + // + // 1. The entire cache object + // 2. The data stored at the key + // + if ( key === undefined || + ( ( key && typeof key === "string" ) && value === undefined ) ) { + + return this.get( owner, key ); + } + + // When the key is not a string, or both a key and value + // are specified, set or extend (existing objects) with either: + // + // 1. An object of properties + // 2. A key and value + // + this.set( owner, key, value ); + + // Since the "set" path can have two possible entry points + // return the expected data based on which path was taken[*] + return value !== undefined ? value : key; + }, + remove: function( owner, key ) { + var i, + cache = owner[ this.expando ]; + + if ( cache === undefined ) { + return; + } + + if ( key !== undefined ) { + + // Support array or space separated string of keys + if ( Array.isArray( key ) ) { + + // If key is an array of keys... + // We always set camelCase keys, so remove that. + key = key.map( camelCase ); + } else { + key = camelCase( key ); + + // If a key with the spaces exists, use it. + // Otherwise, create an array by matching non-whitespace + key = key in cache ? + [ key ] : + ( key.match( rnothtmlwhite ) || [] ); + } + + i = key.length; + + while ( i-- ) { + delete cache[ key[ i ] ]; + } + } + + // Remove the expando if there's no more data + if ( key === undefined || jQuery.isEmptyObject( cache ) ) { + + // Support: Chrome <=35 - 45 + // Webkit & Blink performance suffers when deleting properties + // from DOM nodes, so set to undefined instead + // https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted) + if ( owner.nodeType ) { + owner[ this.expando ] = undefined; + } else { + delete owner[ this.expando ]; + } + } + }, + hasData: function( owner ) { + var cache = owner[ this.expando ]; + return cache !== undefined && !jQuery.isEmptyObject( cache ); + } +}; +var dataPriv = new Data(); + +var dataUser = new Data(); + + + +// Implementation Summary +// +// 1. Enforce API surface and semantic compatibility with 1.9.x branch +// 2. Improve the module's maintainability by reducing the storage +// paths to a single mechanism. +// 3. Use the same single mechanism to support "private" and "user" data. +// 4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData) +// 5. Avoid exposing implementation details on user objects (eg. expando properties) +// 6. Provide a clear path for implementation upgrade to WeakMap in 2014 + +var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/, + rmultiDash = /[A-Z]/g; + +function getData( data ) { + if ( data === "true" ) { + return true; + } + + if ( data === "false" ) { + return false; + } + + if ( data === "null" ) { + return null; + } + + // Only convert to a number if it doesn't change the string + if ( data === +data + "" ) { + return +data; + } + + if ( rbrace.test( data ) ) { + return JSON.parse( data ); + } + + return data; +} + +function dataAttr( elem, key, data ) { + var name; + + // If nothing was found internally, try to fetch any + // data from the HTML5 data-* attribute + if ( data === undefined && elem.nodeType === 1 ) { + name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase(); + data = elem.getAttribute( name ); + + if ( typeof data === "string" ) { + try { + data = getData( data ); + } catch ( e ) {} + + // Make sure we set the data so it isn't changed later + dataUser.set( elem, key, data ); + } else { + data = undefined; + } + } + return data; +} + +jQuery.extend( { + hasData: function( elem ) { + return dataUser.hasData( elem ) || dataPriv.hasData( elem ); + }, + + data: function( elem, name, data ) { + return dataUser.access( elem, name, data ); + }, + + removeData: function( elem, name ) { + dataUser.remove( elem, name ); + }, + + // TODO: Now that all calls to _data and _removeData have been replaced + // with direct calls to dataPriv methods, these can be deprecated. + _data: function( elem, name, data ) { + return dataPriv.access( elem, name, data ); + }, + + _removeData: function( elem, name ) { + dataPriv.remove( elem, name ); + } +} ); + +jQuery.fn.extend( { + data: function( key, value ) { + var i, name, data, + elem = this[ 0 ], + attrs = elem && elem.attributes; + + // Gets all values + if ( key === undefined ) { + if ( this.length ) { + data = dataUser.get( elem ); + + if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) { + i = attrs.length; + while ( i-- ) { + + // Support: IE 11 only + // The attrs elements can be null (#14894) + if ( attrs[ i ] ) { + name = attrs[ i ].name; + if ( name.indexOf( "data-" ) === 0 ) { + name = camelCase( name.slice( 5 ) ); + dataAttr( elem, name, data[ name ] ); + } + } + } + dataPriv.set( elem, "hasDataAttrs", true ); + } + } + + return data; + } + + // Sets multiple values + if ( typeof key === "object" ) { + return this.each( function() { + dataUser.set( this, key ); + } ); + } + + return access( this, function( value ) { + var data; + + // The calling jQuery object (element matches) is not empty + // (and therefore has an element appears at this[ 0 ]) and the + // `value` parameter was not undefined. An empty jQuery object + // will result in `undefined` for elem = this[ 0 ] which will + // throw an exception if an attempt to read a data cache is made. + if ( elem && value === undefined ) { + + // Attempt to get data from the cache + // The key will always be camelCased in Data + data = dataUser.get( elem, key ); + if ( data !== undefined ) { + return data; + } + + // Attempt to "discover" the data in + // HTML5 custom data-* attrs + data = dataAttr( elem, key ); + if ( data !== undefined ) { + return data; + } + + // We tried really hard, but the data doesn't exist. + return; + } + + // Set the data... + this.each( function() { + + // We always store the camelCased key + dataUser.set( this, key, value ); + } ); + }, null, value, arguments.length > 1, null, true ); + }, + + removeData: function( key ) { + return this.each( function() { + dataUser.remove( this, key ); + } ); + } +} ); + + +jQuery.extend( { + queue: function( elem, type, data ) { + var queue; + + if ( elem ) { + type = ( type || "fx" ) + "queue"; + queue = dataPriv.get( elem, type ); + + // Speed up dequeue by getting out quickly if this is just a lookup + if ( data ) { + if ( !queue || Array.isArray( data ) ) { + queue = dataPriv.access( elem, type, jQuery.makeArray( data ) ); + } else { + queue.push( data ); + } + } + return queue || []; + } + }, + + dequeue: function( elem, type ) { + type = type || "fx"; + + var queue = jQuery.queue( elem, type ), + startLength = queue.length, + fn = queue.shift(), + hooks = jQuery._queueHooks( elem, type ), + next = function() { + jQuery.dequeue( elem, type ); + }; + + // If the fx queue is dequeued, always remove the progress sentinel + if ( fn === "inprogress" ) { + fn = queue.shift(); + startLength--; + } + + if ( fn ) { + + // Add a progress sentinel to prevent the fx queue from being + // automatically dequeued + if ( type === "fx" ) { + queue.unshift( "inprogress" ); + } + + // Clear up the last queue stop function + delete hooks.stop; + fn.call( elem, next, hooks ); + } + + if ( !startLength && hooks ) { + hooks.empty.fire(); + } + }, + + // Not public - generate a queueHooks object, or return the current one + _queueHooks: function( elem, type ) { + var key = type + "queueHooks"; + return dataPriv.get( elem, key ) || dataPriv.access( elem, key, { + empty: jQuery.Callbacks( "once memory" ).add( function() { + dataPriv.remove( elem, [ type + "queue", key ] ); + } ) + } ); + } +} ); + +jQuery.fn.extend( { + queue: function( type, data ) { + var setter = 2; + + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + setter--; + } + + if ( arguments.length < setter ) { + return jQuery.queue( this[ 0 ], type ); + } + + return data === undefined ? + this : + this.each( function() { + var queue = jQuery.queue( this, type, data ); + + // Ensure a hooks for this queue + jQuery._queueHooks( this, type ); + + if ( type === "fx" && queue[ 0 ] !== "inprogress" ) { + jQuery.dequeue( this, type ); + } + } ); + }, + dequeue: function( type ) { + return this.each( function() { + jQuery.dequeue( this, type ); + } ); + }, + clearQueue: function( type ) { + return this.queue( type || "fx", [] ); + }, + + // Get a promise resolved when queues of a certain type + // are emptied (fx is the type by default) + promise: function( type, obj ) { + var tmp, + count = 1, + defer = jQuery.Deferred(), + elements = this, + i = this.length, + resolve = function() { + if ( !( --count ) ) { + defer.resolveWith( elements, [ elements ] ); + } + }; + + if ( typeof type !== "string" ) { + obj = type; + type = undefined; + } + type = type || "fx"; + + while ( i-- ) { + tmp = dataPriv.get( elements[ i ], type + "queueHooks" ); + if ( tmp && tmp.empty ) { + count++; + tmp.empty.add( resolve ); + } + } + resolve(); + return defer.promise( obj ); + } +} ); +var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source; + +var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" ); + + +var cssExpand = [ "Top", "Right", "Bottom", "Left" ]; + +var documentElement = document.documentElement; + + + + var isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ); + }, + composed = { composed: true }; + + // Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only + // Check attachment across shadow DOM boundaries when possible (gh-3504) + // Support: iOS 10.0-10.2 only + // Early iOS 10 versions support `attachShadow` but not `getRootNode`, + // leading to errors. We need to check for `getRootNode`. + if ( documentElement.getRootNode ) { + isAttached = function( elem ) { + return jQuery.contains( elem.ownerDocument, elem ) || + elem.getRootNode( composed ) === elem.ownerDocument; + }; + } +var isHiddenWithinTree = function( elem, el ) { + + // isHiddenWithinTree might be called from jQuery#filter function; + // in that case, element will be second argument + elem = el || elem; + + // Inline style trumps all + return elem.style.display === "none" || + elem.style.display === "" && + + // Otherwise, check computed style + // Support: Firefox <=43 - 45 + // Disconnected elements can have computed display: none, so first confirm that elem is + // in the document. + isAttached( elem ) && + + jQuery.css( elem, "display" ) === "none"; + }; + +var swap = function( elem, options, callback, args ) { + var ret, name, + old = {}; + + // Remember the old values, and insert the new ones + for ( name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + ret = callback.apply( elem, args || [] ); + + // Revert the old values + for ( name in options ) { + elem.style[ name ] = old[ name ]; + } + + return ret; +}; + + + + +function adjustCSS( elem, prop, valueParts, tween ) { + var adjusted, scale, + maxIterations = 20, + currentValue = tween ? + function() { + return tween.cur(); + } : + function() { + return jQuery.css( elem, prop, "" ); + }, + initial = currentValue(), + unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ), + + // Starting value computation is required for potential unit mismatches + initialInUnit = elem.nodeType && + ( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) && + rcssNum.exec( jQuery.css( elem, prop ) ); + + if ( initialInUnit && initialInUnit[ 3 ] !== unit ) { + + // Support: Firefox <=54 + // Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144) + initial = initial / 2; + + // Trust units reported by jQuery.css + unit = unit || initialInUnit[ 3 ]; + + // Iteratively approximate from a nonzero starting point + initialInUnit = +initial || 1; + + while ( maxIterations-- ) { + + // Evaluate and update our best guess (doubling guesses that zero out). + // Finish if the scale equals or crosses 1 (making the old*new product non-positive). + jQuery.style( elem, prop, initialInUnit + unit ); + if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) { + maxIterations = 0; + } + initialInUnit = initialInUnit / scale; + + } + + initialInUnit = initialInUnit * 2; + jQuery.style( elem, prop, initialInUnit + unit ); + + // Make sure we update the tween properties later on + valueParts = valueParts || []; + } + + if ( valueParts ) { + initialInUnit = +initialInUnit || +initial || 0; + + // Apply relative offset (+=/-=) if specified + adjusted = valueParts[ 1 ] ? + initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] : + +valueParts[ 2 ]; + if ( tween ) { + tween.unit = unit; + tween.start = initialInUnit; + tween.end = adjusted; + } + } + return adjusted; +} + + +var defaultDisplayMap = {}; + +function getDefaultDisplay( elem ) { + var temp, + doc = elem.ownerDocument, + nodeName = elem.nodeName, + display = defaultDisplayMap[ nodeName ]; + + if ( display ) { + return display; + } + + temp = doc.body.appendChild( doc.createElement( nodeName ) ); + display = jQuery.css( temp, "display" ); + + temp.parentNode.removeChild( temp ); + + if ( display === "none" ) { + display = "block"; + } + defaultDisplayMap[ nodeName ] = display; + + return display; +} + +function showHide( elements, show ) { + var display, elem, + values = [], + index = 0, + length = elements.length; + + // Determine new display value for elements that need to change + for ( ; index < length; index++ ) { + elem = elements[ index ]; + if ( !elem.style ) { + continue; + } + + display = elem.style.display; + if ( show ) { + + // Since we force visibility upon cascade-hidden elements, an immediate (and slow) + // check is required in this first loop unless we have a nonempty display value (either + // inline or about-to-be-restored) + if ( display === "none" ) { + values[ index ] = dataPriv.get( elem, "display" ) || null; + if ( !values[ index ] ) { + elem.style.display = ""; + } + } + if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) { + values[ index ] = getDefaultDisplay( elem ); + } + } else { + if ( display !== "none" ) { + values[ index ] = "none"; + + // Remember what we're overwriting + dataPriv.set( elem, "display", display ); + } + } + } + + // Set the display of the elements in a second loop to avoid constant reflow + for ( index = 0; index < length; index++ ) { + if ( values[ index ] != null ) { + elements[ index ].style.display = values[ index ]; + } + } + + return elements; +} + +jQuery.fn.extend( { + show: function() { + return showHide( this, true ); + }, + hide: function() { + return showHide( this ); + }, + toggle: function( state ) { + if ( typeof state === "boolean" ) { + return state ? this.show() : this.hide(); + } + + return this.each( function() { + if ( isHiddenWithinTree( this ) ) { + jQuery( this ).show(); + } else { + jQuery( this ).hide(); + } + } ); + } +} ); +var rcheckableType = ( /^(?:checkbox|radio)$/i ); + +var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i ); + +var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i ); + + + +// We have to close these tags to support XHTML (#13200) +var wrapMap = { + + // Support: IE <=9 only + option: [ 1, "<select multiple='multiple'>", "</select>" ], + + // XHTML parsers do not magically insert elements in the + // same way that tag soup parsers do. So we cannot shorten + // this by omitting <tbody> or other required elements. + thead: [ 1, "<table>", "</table>" ], + col: [ 2, "<table><colgroup>", "</colgroup></table>" ], + tr: [ 2, "<table><tbody>", "</tbody></table>" ], + td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ], + + _default: [ 0, "", "" ] +}; + +// Support: IE <=9 only +wrapMap.optgroup = wrapMap.option; + +wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead; +wrapMap.th = wrapMap.td; + + +function getAll( context, tag ) { + + // Support: IE <=9 - 11 only + // Use typeof to avoid zero-argument method invocation on host objects (#15151) + var ret; + + if ( typeof context.getElementsByTagName !== "undefined" ) { + ret = context.getElementsByTagName( tag || "*" ); + + } else if ( typeof context.querySelectorAll !== "undefined" ) { + ret = context.querySelectorAll( tag || "*" ); + + } else { + ret = []; + } + + if ( tag === undefined || tag && nodeName( context, tag ) ) { + return jQuery.merge( [ context ], ret ); + } + + return ret; +} + + +// Mark scripts as having already been evaluated +function setGlobalEval( elems, refElements ) { + var i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + dataPriv.set( + elems[ i ], + "globalEval", + !refElements || dataPriv.get( refElements[ i ], "globalEval" ) + ); + } +} + + +var rhtml = /<|&#?\w+;/; + +function buildFragment( elems, context, scripts, selection, ignored ) { + var elem, tmp, tag, wrap, attached, j, + fragment = context.createDocumentFragment(), + nodes = [], + i = 0, + l = elems.length; + + for ( ; i < l; i++ ) { + elem = elems[ i ]; + + if ( elem || elem === 0 ) { + + // Add nodes directly + if ( toType( elem ) === "object" ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem ); + + // Convert non-html into a text node + } else if ( !rhtml.test( elem ) ) { + nodes.push( context.createTextNode( elem ) ); + + // Convert html into DOM nodes + } else { + tmp = tmp || fragment.appendChild( context.createElement( "div" ) ); + + // Deserialize a standard representation + tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase(); + wrap = wrapMap[ tag ] || wrapMap._default; + tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ]; + + // Descend through wrappers to the right content + j = wrap[ 0 ]; + while ( j-- ) { + tmp = tmp.lastChild; + } + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( nodes, tmp.childNodes ); + + // Remember the top-level container + tmp = fragment.firstChild; + + // Ensure the created nodes are orphaned (#12392) + tmp.textContent = ""; + } + } + } + + // Remove wrapper from fragment + fragment.textContent = ""; + + i = 0; + while ( ( elem = nodes[ i++ ] ) ) { + + // Skip elements already in the context collection (trac-4087) + if ( selection && jQuery.inArray( elem, selection ) > -1 ) { + if ( ignored ) { + ignored.push( elem ); + } + continue; + } + + attached = isAttached( elem ); + + // Append to fragment + tmp = getAll( fragment.appendChild( elem ), "script" ); + + // Preserve script evaluation history + if ( attached ) { + setGlobalEval( tmp ); + } + + // Capture executables + if ( scripts ) { + j = 0; + while ( ( elem = tmp[ j++ ] ) ) { + if ( rscriptType.test( elem.type || "" ) ) { + scripts.push( elem ); + } + } + } + } + + return fragment; +} + + +( function() { + var fragment = document.createDocumentFragment(), + div = fragment.appendChild( document.createElement( "div" ) ), + input = document.createElement( "input" ); + + // Support: Android 4.0 - 4.3 only + // Check state lost if the name is set (#11217) + // Support: Windows Web Apps (WWA) + // `name` and `type` must use .setAttribute for WWA (#14901) + input.setAttribute( "type", "radio" ); + input.setAttribute( "checked", "checked" ); + input.setAttribute( "name", "t" ); + + div.appendChild( input ); + + // Support: Android <=4.1 only + // Older WebKit doesn't clone checked state correctly in fragments + support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked; + + // Support: IE <=11 only + // Make sure textarea (and checkbox) defaultValue is properly cloned + div.innerHTML = "<textarea>x</textarea>"; + support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue; +} )(); + + +var + rkeyEvent = /^key/, + rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/, + rtypenamespace = /^([^.]*)(?:\.(.+)|)/; + +function returnTrue() { + return true; +} + +function returnFalse() { + return false; +} + +// Support: IE <=9 - 11+ +// focus() and blur() are asynchronous, except when they are no-op. +// So expect focus to be synchronous when the element is already active, +// and blur to be synchronous when the element is not already active. +// (focus and blur are always synchronous in other supported browsers, +// this just defines when we can count on it). +function expectSync( elem, type ) { + return ( elem === safeActiveElement() ) === ( type === "focus" ); +} + +// Support: IE <=9 only +// Accessing document.activeElement can throw unexpectedly +// https://bugs.jquery.com/ticket/13393 +function safeActiveElement() { + try { + return document.activeElement; + } catch ( err ) { } +} + +function on( elem, types, selector, data, fn, one ) { + var origFn, type; + + // Types can be a map of types/handlers + if ( typeof types === "object" ) { + + // ( types-Object, selector, data ) + if ( typeof selector !== "string" ) { + + // ( types-Object, data ) + data = data || selector; + selector = undefined; + } + for ( type in types ) { + on( elem, type, selector, data, types[ type ], one ); + } + return elem; + } + + if ( data == null && fn == null ) { + + // ( types, fn ) + fn = selector; + data = selector = undefined; + } else if ( fn == null ) { + if ( typeof selector === "string" ) { + + // ( types, selector, fn ) + fn = data; + data = undefined; + } else { + + // ( types, data, fn ) + fn = data; + data = selector; + selector = undefined; + } + } + if ( fn === false ) { + fn = returnFalse; + } else if ( !fn ) { + return elem; + } + + if ( one === 1 ) { + origFn = fn; + fn = function( event ) { + + // Can use an empty set, since event contains the info + jQuery().off( event ); + return origFn.apply( this, arguments ); + }; + + // Use same guid so caller can remove using origFn + fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ ); + } + return elem.each( function() { + jQuery.event.add( this, types, fn, data, selector ); + } ); +} + +/* + * Helper functions for managing events -- not part of the public interface. + * Props to Dean Edwards' addEvent library for many of the ideas. + */ +jQuery.event = { + + global: {}, + + add: function( elem, types, handler, data, selector ) { + + var handleObjIn, eventHandle, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.get( elem ); + + // Don't attach events to noData or text/comment nodes (but allow plain objects) + if ( !elemData ) { + return; + } + + // Caller can pass in an object of custom data in lieu of the handler + if ( handler.handler ) { + handleObjIn = handler; + handler = handleObjIn.handler; + selector = handleObjIn.selector; + } + + // Ensure that invalid selectors throw exceptions at attach time + // Evaluate against documentElement in case elem is a non-element node (e.g., document) + if ( selector ) { + jQuery.find.matchesSelector( documentElement, selector ); + } + + // Make sure that the handler has a unique ID, used to find/remove it later + if ( !handler.guid ) { + handler.guid = jQuery.guid++; + } + + // Init the element's event structure and main handler, if this is the first + if ( !( events = elemData.events ) ) { + events = elemData.events = {}; + } + if ( !( eventHandle = elemData.handle ) ) { + eventHandle = elemData.handle = function( e ) { + + // Discard the second event of a jQuery.event.trigger() and + // when an event is called after a page has unloaded + return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ? + jQuery.event.dispatch.apply( elem, arguments ) : undefined; + }; + } + + // Handle multiple events separated by a space + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // There *must* be a type, no attaching namespace-only handlers + if ( !type ) { + continue; + } + + // If event changes its type, use the special event handlers for the changed type + special = jQuery.event.special[ type ] || {}; + + // If selector defined, determine special event api type, otherwise given type + type = ( selector ? special.delegateType : special.bindType ) || type; + + // Update special based on newly reset type + special = jQuery.event.special[ type ] || {}; + + // handleObj is passed to all event handlers + handleObj = jQuery.extend( { + type: type, + origType: origType, + data: data, + handler: handler, + guid: handler.guid, + selector: selector, + needsContext: selector && jQuery.expr.match.needsContext.test( selector ), + namespace: namespaces.join( "." ) + }, handleObjIn ); + + // Init the event handler queue if we're the first + if ( !( handlers = events[ type ] ) ) { + handlers = events[ type ] = []; + handlers.delegateCount = 0; + + // Only use addEventListener if the special events handler returns false + if ( !special.setup || + special.setup.call( elem, data, namespaces, eventHandle ) === false ) { + + if ( elem.addEventListener ) { + elem.addEventListener( type, eventHandle ); + } + } + } + + if ( special.add ) { + special.add.call( elem, handleObj ); + + if ( !handleObj.handler.guid ) { + handleObj.handler.guid = handler.guid; + } + } + + // Add to the element's handler list, delegates in front + if ( selector ) { + handlers.splice( handlers.delegateCount++, 0, handleObj ); + } else { + handlers.push( handleObj ); + } + + // Keep track of which events have ever been used, for event optimization + jQuery.event.global[ type ] = true; + } + + }, + + // Detach an event or set of events from an element + remove: function( elem, types, handler, selector, mappedTypes ) { + + var j, origCount, tmp, + events, t, handleObj, + special, handlers, type, namespaces, origType, + elemData = dataPriv.hasData( elem ) && dataPriv.get( elem ); + + if ( !elemData || !( events = elemData.events ) ) { + return; + } + + // Once for each type.namespace in types; type may be omitted + types = ( types || "" ).match( rnothtmlwhite ) || [ "" ]; + t = types.length; + while ( t-- ) { + tmp = rtypenamespace.exec( types[ t ] ) || []; + type = origType = tmp[ 1 ]; + namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort(); + + // Unbind all events (on this namespace, if provided) for the element + if ( !type ) { + for ( type in events ) { + jQuery.event.remove( elem, type + types[ t ], handler, selector, true ); + } + continue; + } + + special = jQuery.event.special[ type ] || {}; + type = ( selector ? special.delegateType : special.bindType ) || type; + handlers = events[ type ] || []; + tmp = tmp[ 2 ] && + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ); + + // Remove matching events + origCount = j = handlers.length; + while ( j-- ) { + handleObj = handlers[ j ]; + + if ( ( mappedTypes || origType === handleObj.origType ) && + ( !handler || handler.guid === handleObj.guid ) && + ( !tmp || tmp.test( handleObj.namespace ) ) && + ( !selector || selector === handleObj.selector || + selector === "**" && handleObj.selector ) ) { + handlers.splice( j, 1 ); + + if ( handleObj.selector ) { + handlers.delegateCount--; + } + if ( special.remove ) { + special.remove.call( elem, handleObj ); + } + } + } + + // Remove generic event handler if we removed something and no more handlers exist + // (avoids potential for endless recursion during removal of special event handlers) + if ( origCount && !handlers.length ) { + if ( !special.teardown || + special.teardown.call( elem, namespaces, elemData.handle ) === false ) { + + jQuery.removeEvent( elem, type, elemData.handle ); + } + + delete events[ type ]; + } + } + + // Remove data and the expando if it's no longer used + if ( jQuery.isEmptyObject( events ) ) { + dataPriv.remove( elem, "handle events" ); + } + }, + + dispatch: function( nativeEvent ) { + + // Make a writable jQuery.Event from the native event object + var event = jQuery.event.fix( nativeEvent ); + + var i, j, ret, matched, handleObj, handlerQueue, + args = new Array( arguments.length ), + handlers = ( dataPriv.get( this, "events" ) || {} )[ event.type ] || [], + special = jQuery.event.special[ event.type ] || {}; + + // Use the fix-ed jQuery.Event rather than the (read-only) native event + args[ 0 ] = event; + + for ( i = 1; i < arguments.length; i++ ) { + args[ i ] = arguments[ i ]; + } + + event.delegateTarget = this; + + // Call the preDispatch hook for the mapped type, and let it bail if desired + if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) { + return; + } + + // Determine handlers + handlerQueue = jQuery.event.handlers.call( this, event, handlers ); + + // Run delegates first; they may want to stop propagation beneath us + i = 0; + while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) { + event.currentTarget = matched.elem; + + j = 0; + while ( ( handleObj = matched.handlers[ j++ ] ) && + !event.isImmediatePropagationStopped() ) { + + // If the event is namespaced, then each handler is only invoked if it is + // specially universal or its namespaces are a superset of the event's. + if ( !event.rnamespace || handleObj.namespace === false || + event.rnamespace.test( handleObj.namespace ) ) { + + event.handleObj = handleObj; + event.data = handleObj.data; + + ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle || + handleObj.handler ).apply( matched.elem, args ); + + if ( ret !== undefined ) { + if ( ( event.result = ret ) === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + } + } + } + + // Call the postDispatch hook for the mapped type + if ( special.postDispatch ) { + special.postDispatch.call( this, event ); + } + + return event.result; + }, + + handlers: function( event, handlers ) { + var i, handleObj, sel, matchedHandlers, matchedSelectors, + handlerQueue = [], + delegateCount = handlers.delegateCount, + cur = event.target; + + // Find delegate handlers + if ( delegateCount && + + // Support: IE <=9 + // Black-hole SVG <use> instance trees (trac-13180) + cur.nodeType && + + // Support: Firefox <=42 + // Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861) + // https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click + // Support: IE 11 only + // ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343) + !( event.type === "click" && event.button >= 1 ) ) { + + for ( ; cur !== this; cur = cur.parentNode || this ) { + + // Don't check non-elements (#13208) + // Don't process clicks on disabled elements (#6911, #8165, #11382, #11764) + if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) { + matchedHandlers = []; + matchedSelectors = {}; + for ( i = 0; i < delegateCount; i++ ) { + handleObj = handlers[ i ]; + + // Don't conflict with Object.prototype properties (#13203) + sel = handleObj.selector + " "; + + if ( matchedSelectors[ sel ] === undefined ) { + matchedSelectors[ sel ] = handleObj.needsContext ? + jQuery( sel, this ).index( cur ) > -1 : + jQuery.find( sel, this, null, [ cur ] ).length; + } + if ( matchedSelectors[ sel ] ) { + matchedHandlers.push( handleObj ); + } + } + if ( matchedHandlers.length ) { + handlerQueue.push( { elem: cur, handlers: matchedHandlers } ); + } + } + } + } + + // Add the remaining (directly-bound) handlers + cur = this; + if ( delegateCount < handlers.length ) { + handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } ); + } + + return handlerQueue; + }, + + addProp: function( name, hook ) { + Object.defineProperty( jQuery.Event.prototype, name, { + enumerable: true, + configurable: true, + + get: isFunction( hook ) ? + function() { + if ( this.originalEvent ) { + return hook( this.originalEvent ); + } + } : + function() { + if ( this.originalEvent ) { + return this.originalEvent[ name ]; + } + }, + + set: function( value ) { + Object.defineProperty( this, name, { + enumerable: true, + configurable: true, + writable: true, + value: value + } ); + } + } ); + }, + + fix: function( originalEvent ) { + return originalEvent[ jQuery.expando ] ? + originalEvent : + new jQuery.Event( originalEvent ); + }, + + special: { + load: { + + // Prevent triggered image.load events from bubbling to window.load + noBubble: true + }, + click: { + + // Utilize native event to ensure correct state for checkable inputs + setup: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Claim the first handler + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + // dataPriv.set( el, "click", ... ) + leverageNative( el, "click", returnTrue ); + } + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function( data ) { + + // For mutual compressibility with _default, replace `this` access with a local var. + // `|| data` is dead code meant only to preserve the variable through minification. + var el = this || data; + + // Force setup before triggering a click + if ( rcheckableType.test( el.type ) && + el.click && nodeName( el, "input" ) ) { + + leverageNative( el, "click" ); + } + + // Return non-false to allow normal event-path propagation + return true; + }, + + // For cross-browser consistency, suppress native .click() on links + // Also prevent it if we're currently inside a leveraged native-event stack + _default: function( event ) { + var target = event.target; + return rcheckableType.test( target.type ) && + target.click && nodeName( target, "input" ) && + dataPriv.get( target, "click" ) || + nodeName( target, "a" ); + } + }, + + beforeunload: { + postDispatch: function( event ) { + + // Support: Firefox 20+ + // Firefox doesn't alert if the returnValue field is not set. + if ( event.result !== undefined && event.originalEvent ) { + event.originalEvent.returnValue = event.result; + } + } + } + } +}; + +// Ensure the presence of an event listener that handles manually-triggered +// synthetic events by interrupting progress until reinvoked in response to +// *native* events that it fires directly, ensuring that state changes have +// already occurred before other listeners are invoked. +function leverageNative( el, type, expectSync ) { + + // Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add + if ( !expectSync ) { + if ( dataPriv.get( el, type ) === undefined ) { + jQuery.event.add( el, type, returnTrue ); + } + return; + } + + // Register the controller as a special universal handler for all event namespaces + dataPriv.set( el, type, false ); + jQuery.event.add( el, type, { + namespace: false, + handler: function( event ) { + var notAsync, result, + saved = dataPriv.get( this, type ); + + if ( ( event.isTrigger & 1 ) && this[ type ] ) { + + // Interrupt processing of the outer synthetic .trigger()ed event + // Saved data should be false in such cases, but might be a leftover capture object + // from an async native handler (gh-4350) + if ( !saved.length ) { + + // Store arguments for use when handling the inner native event + // There will always be at least one argument (an event object), so this array + // will not be confused with a leftover capture object. + saved = slice.call( arguments ); + dataPriv.set( this, type, saved ); + + // Trigger the native event and capture its result + // Support: IE <=9 - 11+ + // focus() and blur() are asynchronous + notAsync = expectSync( this, type ); + this[ type ](); + result = dataPriv.get( this, type ); + if ( saved !== result || notAsync ) { + dataPriv.set( this, type, false ); + } else { + result = {}; + } + if ( saved !== result ) { + + // Cancel the outer synthetic event + event.stopImmediatePropagation(); + event.preventDefault(); + return result.value; + } + + // If this is an inner synthetic event for an event with a bubbling surrogate + // (focus or blur), assume that the surrogate already propagated from triggering the + // native event and prevent that from happening again here. + // This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the + // bubbling surrogate propagates *after* the non-bubbling base), but that seems + // less bad than duplication. + } else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) { + event.stopPropagation(); + } + + // If this is a native event triggered above, everything is now in order + // Fire an inner synthetic event with the original arguments + } else if ( saved.length ) { + + // ...and capture the result + dataPriv.set( this, type, { + value: jQuery.event.trigger( + + // Support: IE <=9 - 11+ + // Extend with the prototype to reset the above stopImmediatePropagation() + jQuery.extend( saved[ 0 ], jQuery.Event.prototype ), + saved.slice( 1 ), + this + ) + } ); + + // Abort handling of the native event + event.stopImmediatePropagation(); + } + } + } ); +} + +jQuery.removeEvent = function( elem, type, handle ) { + + // This "if" is needed for plain objects + if ( elem.removeEventListener ) { + elem.removeEventListener( type, handle ); + } +}; + +jQuery.Event = function( src, props ) { + + // Allow instantiation without the 'new' keyword + if ( !( this instanceof jQuery.Event ) ) { + return new jQuery.Event( src, props ); + } + + // Event object + if ( src && src.type ) { + this.originalEvent = src; + this.type = src.type; + + // Events bubbling up the document may have been marked as prevented + // by a handler lower down the tree; reflect the correct value. + this.isDefaultPrevented = src.defaultPrevented || + src.defaultPrevented === undefined && + + // Support: Android <=2.3 only + src.returnValue === false ? + returnTrue : + returnFalse; + + // Create target properties + // Support: Safari <=6 - 7 only + // Target should not be a text node (#504, #13143) + this.target = ( src.target && src.target.nodeType === 3 ) ? + src.target.parentNode : + src.target; + + this.currentTarget = src.currentTarget; + this.relatedTarget = src.relatedTarget; + + // Event type + } else { + this.type = src; + } + + // Put explicitly provided properties onto the event object + if ( props ) { + jQuery.extend( this, props ); + } + + // Create a timestamp if incoming event doesn't have one + this.timeStamp = src && src.timeStamp || Date.now(); + + // Mark it as fixed + this[ jQuery.expando ] = true; +}; + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + constructor: jQuery.Event, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse, + isSimulated: false, + + preventDefault: function() { + var e = this.originalEvent; + + this.isDefaultPrevented = returnTrue; + + if ( e && !this.isSimulated ) { + e.preventDefault(); + } + }, + stopPropagation: function() { + var e = this.originalEvent; + + this.isPropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopPropagation(); + } + }, + stopImmediatePropagation: function() { + var e = this.originalEvent; + + this.isImmediatePropagationStopped = returnTrue; + + if ( e && !this.isSimulated ) { + e.stopImmediatePropagation(); + } + + this.stopPropagation(); + } +}; + +// Includes all common event props including KeyEvent and MouseEvent specific props +jQuery.each( { + altKey: true, + bubbles: true, + cancelable: true, + changedTouches: true, + ctrlKey: true, + detail: true, + eventPhase: true, + metaKey: true, + pageX: true, + pageY: true, + shiftKey: true, + view: true, + "char": true, + code: true, + charCode: true, + key: true, + keyCode: true, + button: true, + buttons: true, + clientX: true, + clientY: true, + offsetX: true, + offsetY: true, + pointerId: true, + pointerType: true, + screenX: true, + screenY: true, + targetTouches: true, + toElement: true, + touches: true, + + which: function( event ) { + var button = event.button; + + // Add which for key events + if ( event.which == null && rkeyEvent.test( event.type ) ) { + return event.charCode != null ? event.charCode : event.keyCode; + } + + // Add which for click: 1 === left; 2 === middle; 3 === right + if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) { + if ( button & 1 ) { + return 1; + } + + if ( button & 2 ) { + return 3; + } + + if ( button & 4 ) { + return 2; + } + + return 0; + } + + return event.which; + } +}, jQuery.event.addProp ); + +jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) { + jQuery.event.special[ type ] = { + + // Utilize native event if possible so blur/focus sequence is correct + setup: function() { + + // Claim the first handler + // dataPriv.set( this, "focus", ... ) + // dataPriv.set( this, "blur", ... ) + leverageNative( this, type, expectSync ); + + // Return false to allow normal processing in the caller + return false; + }, + trigger: function() { + + // Force setup before trigger + leverageNative( this, type ); + + // Return non-false to allow normal event-path propagation + return true; + }, + + delegateType: delegateType + }; +} ); + +// Create mouseenter/leave events using mouseover/out and event-time checks +// so that event delegation works in jQuery. +// Do the same for pointerenter/pointerleave and pointerover/pointerout +// +// Support: Safari 7 only +// Safari sends mouseenter too often; see: +// https://bugs.chromium.org/p/chromium/issues/detail?id=470258 +// for the description of the bug (it existed in older Chrome versions as well). +jQuery.each( { + mouseenter: "mouseover", + mouseleave: "mouseout", + pointerenter: "pointerover", + pointerleave: "pointerout" +}, function( orig, fix ) { + jQuery.event.special[ orig ] = { + delegateType: fix, + bindType: fix, + + handle: function( event ) { + var ret, + target = this, + related = event.relatedTarget, + handleObj = event.handleObj; + + // For mouseenter/leave call the handler if related is outside the target. + // NB: No relatedTarget if the mouse left/entered the browser window + if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) { + event.type = handleObj.origType; + ret = handleObj.handler.apply( this, arguments ); + event.type = fix; + } + return ret; + } + }; +} ); + +jQuery.fn.extend( { + + on: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn ); + }, + one: function( types, selector, data, fn ) { + return on( this, types, selector, data, fn, 1 ); + }, + off: function( types, selector, fn ) { + var handleObj, type; + if ( types && types.preventDefault && types.handleObj ) { + + // ( event ) dispatched jQuery.Event + handleObj = types.handleObj; + jQuery( types.delegateTarget ).off( + handleObj.namespace ? + handleObj.origType + "." + handleObj.namespace : + handleObj.origType, + handleObj.selector, + handleObj.handler + ); + return this; + } + if ( typeof types === "object" ) { + + // ( types-object [, selector] ) + for ( type in types ) { + this.off( type, selector, types[ type ] ); + } + return this; + } + if ( selector === false || typeof selector === "function" ) { + + // ( types [, fn] ) + fn = selector; + selector = undefined; + } + if ( fn === false ) { + fn = returnFalse; + } + return this.each( function() { + jQuery.event.remove( this, types, fn, selector ); + } ); + } +} ); + + +var + + /* eslint-disable max-len */ + + // See https://github.com/eslint/eslint/issues/3229 + rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi, + + /* eslint-enable */ + + // Support: IE <=10 - 11, Edge 12 - 13 only + // In IE/Edge using regex groups here causes severe slowdowns. + // See https://connect.microsoft.com/IE/feedback/details/1736512/ + rnoInnerhtml = /<script|<style|<link/i, + + // checked="checked" or checked + rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i, + rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g; + +// Prefer a tbody over its parent table for containing new rows +function manipulationTarget( elem, content ) { + if ( nodeName( elem, "table" ) && + nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) { + + return jQuery( elem ).children( "tbody" )[ 0 ] || elem; + } + + return elem; +} + +// Replace/restore the type attribute of script elements for safe DOM manipulation +function disableScript( elem ) { + elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type; + return elem; +} +function restoreScript( elem ) { + if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) { + elem.type = elem.type.slice( 5 ); + } else { + elem.removeAttribute( "type" ); + } + + return elem; +} + +function cloneCopyEvent( src, dest ) { + var i, l, type, pdataOld, pdataCur, udataOld, udataCur, events; + + if ( dest.nodeType !== 1 ) { + return; + } + + // 1. Copy private data: events, handlers, etc. + if ( dataPriv.hasData( src ) ) { + pdataOld = dataPriv.access( src ); + pdataCur = dataPriv.set( dest, pdataOld ); + events = pdataOld.events; + + if ( events ) { + delete pdataCur.handle; + pdataCur.events = {}; + + for ( type in events ) { + for ( i = 0, l = events[ type ].length; i < l; i++ ) { + jQuery.event.add( dest, type, events[ type ][ i ] ); + } + } + } + } + + // 2. Copy user data + if ( dataUser.hasData( src ) ) { + udataOld = dataUser.access( src ); + udataCur = jQuery.extend( {}, udataOld ); + + dataUser.set( dest, udataCur ); + } +} + +// Fix IE bugs, see support tests +function fixInput( src, dest ) { + var nodeName = dest.nodeName.toLowerCase(); + + // Fails to persist the checked state of a cloned checkbox or radio button. + if ( nodeName === "input" && rcheckableType.test( src.type ) ) { + dest.checked = src.checked; + + // Fails to return the selected option to the default selected state when cloning options + } else if ( nodeName === "input" || nodeName === "textarea" ) { + dest.defaultValue = src.defaultValue; + } +} + +function domManip( collection, args, callback, ignored ) { + + // Flatten any nested arrays + args = concat.apply( [], args ); + + var fragment, first, scripts, hasScripts, node, doc, + i = 0, + l = collection.length, + iNoClone = l - 1, + value = args[ 0 ], + valueIsFunction = isFunction( value ); + + // We can't cloneNode fragments that contain checked, in WebKit + if ( valueIsFunction || + ( l > 1 && typeof value === "string" && + !support.checkClone && rchecked.test( value ) ) ) { + return collection.each( function( index ) { + var self = collection.eq( index ); + if ( valueIsFunction ) { + args[ 0 ] = value.call( this, index, self.html() ); + } + domManip( self, args, callback, ignored ); + } ); + } + + if ( l ) { + fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored ); + first = fragment.firstChild; + + if ( fragment.childNodes.length === 1 ) { + fragment = first; + } + + // Require either new content or an interest in ignored elements to invoke the callback + if ( first || ignored ) { + scripts = jQuery.map( getAll( fragment, "script" ), disableScript ); + hasScripts = scripts.length; + + // Use the original fragment for the last item + // instead of the first because it can end up + // being emptied incorrectly in certain situations (#8070). + for ( ; i < l; i++ ) { + node = fragment; + + if ( i !== iNoClone ) { + node = jQuery.clone( node, true, true ); + + // Keep references to cloned scripts for later restoration + if ( hasScripts ) { + + // Support: Android <=4.0 only, PhantomJS 1 only + // push.apply(_, arraylike) throws on ancient WebKit + jQuery.merge( scripts, getAll( node, "script" ) ); + } + } + + callback.call( collection[ i ], node, i ); + } + + if ( hasScripts ) { + doc = scripts[ scripts.length - 1 ].ownerDocument; + + // Reenable scripts + jQuery.map( scripts, restoreScript ); + + // Evaluate executable scripts on first document insertion + for ( i = 0; i < hasScripts; i++ ) { + node = scripts[ i ]; + if ( rscriptType.test( node.type || "" ) && + !dataPriv.access( node, "globalEval" ) && + jQuery.contains( doc, node ) ) { + + if ( node.src && ( node.type || "" ).toLowerCase() !== "module" ) { + + // Optional AJAX dependency, but won't run scripts if not present + if ( jQuery._evalUrl && !node.noModule ) { + jQuery._evalUrl( node.src, { + nonce: node.nonce || node.getAttribute( "nonce" ) + } ); + } + } else { + DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc ); + } + } + } + } + } + } + + return collection; +} + +function remove( elem, selector, keepData ) { + var node, + nodes = selector ? jQuery.filter( selector, elem ) : elem, + i = 0; + + for ( ; ( node = nodes[ i ] ) != null; i++ ) { + if ( !keepData && node.nodeType === 1 ) { + jQuery.cleanData( getAll( node ) ); + } + + if ( node.parentNode ) { + if ( keepData && isAttached( node ) ) { + setGlobalEval( getAll( node, "script" ) ); + } + node.parentNode.removeChild( node ); + } + } + + return elem; +} + +jQuery.extend( { + htmlPrefilter: function( html ) { + return html.replace( rxhtmlTag, "<$1></$2>" ); + }, + + clone: function( elem, dataAndEvents, deepDataAndEvents ) { + var i, l, srcElements, destElements, + clone = elem.cloneNode( true ), + inPage = isAttached( elem ); + + // Fix IE cloning issues + if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) && + !jQuery.isXMLDoc( elem ) ) { + + // We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2 + destElements = getAll( clone ); + srcElements = getAll( elem ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + fixInput( srcElements[ i ], destElements[ i ] ); + } + } + + // Copy the events from the original to the clone + if ( dataAndEvents ) { + if ( deepDataAndEvents ) { + srcElements = srcElements || getAll( elem ); + destElements = destElements || getAll( clone ); + + for ( i = 0, l = srcElements.length; i < l; i++ ) { + cloneCopyEvent( srcElements[ i ], destElements[ i ] ); + } + } else { + cloneCopyEvent( elem, clone ); + } + } + + // Preserve script evaluation history + destElements = getAll( clone, "script" ); + if ( destElements.length > 0 ) { + setGlobalEval( destElements, !inPage && getAll( elem, "script" ) ); + } + + // Return the cloned set + return clone; + }, + + cleanData: function( elems ) { + var data, elem, type, + special = jQuery.event.special, + i = 0; + + for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) { + if ( acceptData( elem ) ) { + if ( ( data = elem[ dataPriv.expando ] ) ) { + if ( data.events ) { + for ( type in data.events ) { + if ( special[ type ] ) { + jQuery.event.remove( elem, type ); + + // This is a shortcut to avoid jQuery.event.remove's overhead + } else { + jQuery.removeEvent( elem, type, data.handle ); + } + } + } + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataPriv.expando ] = undefined; + } + if ( elem[ dataUser.expando ] ) { + + // Support: Chrome <=35 - 45+ + // Assign undefined instead of using delete, see Data#remove + elem[ dataUser.expando ] = undefined; + } + } + } + } +} ); + +jQuery.fn.extend( { + detach: function( selector ) { + return remove( this, selector, true ); + }, + + remove: function( selector ) { + return remove( this, selector ); + }, + + text: function( value ) { + return access( this, function( value ) { + return value === undefined ? + jQuery.text( this ) : + this.empty().each( function() { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + this.textContent = value; + } + } ); + }, null, value, arguments.length ); + }, + + append: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.appendChild( elem ); + } + } ); + }, + + prepend: function() { + return domManip( this, arguments, function( elem ) { + if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) { + var target = manipulationTarget( this, elem ); + target.insertBefore( elem, target.firstChild ); + } + } ); + }, + + before: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this ); + } + } ); + }, + + after: function() { + return domManip( this, arguments, function( elem ) { + if ( this.parentNode ) { + this.parentNode.insertBefore( elem, this.nextSibling ); + } + } ); + }, + + empty: function() { + var elem, + i = 0; + + for ( ; ( elem = this[ i ] ) != null; i++ ) { + if ( elem.nodeType === 1 ) { + + // Prevent memory leaks + jQuery.cleanData( getAll( elem, false ) ); + + // Remove any remaining nodes + elem.textContent = ""; + } + } + + return this; + }, + + clone: function( dataAndEvents, deepDataAndEvents ) { + dataAndEvents = dataAndEvents == null ? false : dataAndEvents; + deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents; + + return this.map( function() { + return jQuery.clone( this, dataAndEvents, deepDataAndEvents ); + } ); + }, + + html: function( value ) { + return access( this, function( value ) { + var elem = this[ 0 ] || {}, + i = 0, + l = this.length; + + if ( value === undefined && elem.nodeType === 1 ) { + return elem.innerHTML; + } + + // See if we can take a shortcut and just use innerHTML + if ( typeof value === "string" && !rnoInnerhtml.test( value ) && + !wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) { + + value = jQuery.htmlPrefilter( value ); + + try { + for ( ; i < l; i++ ) { + elem = this[ i ] || {}; + + // Remove element nodes and prevent memory leaks + if ( elem.nodeType === 1 ) { + jQuery.cleanData( getAll( elem, false ) ); + elem.innerHTML = value; + } + } + + elem = 0; + + // If using innerHTML throws an exception, use the fallback method + } catch ( e ) {} + } + + if ( elem ) { + this.empty().append( value ); + } + }, null, value, arguments.length ); + }, + + replaceWith: function() { + var ignored = []; + + // Make the changes, replacing each non-ignored context element with the new content + return domManip( this, arguments, function( elem ) { + var parent = this.parentNode; + + if ( jQuery.inArray( this, ignored ) < 0 ) { + jQuery.cleanData( getAll( this ) ); + if ( parent ) { + parent.replaceChild( elem, this ); + } + } + + // Force callback invocation + }, ignored ); + } +} ); + +jQuery.each( { + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function( name, original ) { + jQuery.fn[ name ] = function( selector ) { + var elems, + ret = [], + insert = jQuery( selector ), + last = insert.length - 1, + i = 0; + + for ( ; i <= last; i++ ) { + elems = i === last ? this : this.clone( true ); + jQuery( insert[ i ] )[ original ]( elems ); + + // Support: Android <=4.0 only, PhantomJS 1 only + // .get() because push.apply(_, arraylike) throws on ancient WebKit + push.apply( ret, elems.get() ); + } + + return this.pushStack( ret ); + }; +} ); +var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" ); + +var getStyles = function( elem ) { + + // Support: IE <=11 only, Firefox <=30 (#15098, #14150) + // IE throws on elements created in popups + // FF meanwhile throws on frame elements through "defaultView.getComputedStyle" + var view = elem.ownerDocument.defaultView; + + if ( !view || !view.opener ) { + view = window; + } + + return view.getComputedStyle( elem ); + }; + +var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" ); + + + +( function() { + + // Executing both pixelPosition & boxSizingReliable tests require only one layout + // so they're executed at the same time to save the second computation. + function computeStyleTests() { + + // This is a singleton, we need to execute it only once + if ( !div ) { + return; + } + + container.style.cssText = "position:absolute;left:-11111px;width:60px;" + + "margin-top:1px;padding:0;border:0"; + div.style.cssText = + "position:relative;display:block;box-sizing:border-box;overflow:scroll;" + + "margin:auto;border:1px;padding:1px;" + + "width:60%;top:1%"; + documentElement.appendChild( container ).appendChild( div ); + + var divStyle = window.getComputedStyle( div ); + pixelPositionVal = divStyle.top !== "1%"; + + // Support: Android 4.0 - 4.3 only, Firefox <=3 - 44 + reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12; + + // Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3 + // Some styles come back with percentage values, even though they shouldn't + div.style.right = "60%"; + pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36; + + // Support: IE 9 - 11 only + // Detect misreporting of content dimensions for box-sizing:border-box elements + boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36; + + // Support: IE 9 only + // Detect overflow:scroll screwiness (gh-3699) + // Support: Chrome <=64 + // Don't get tricked when zoom affects offsetWidth (gh-4029) + div.style.position = "absolute"; + scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12; + + documentElement.removeChild( container ); + + // Nullify the div so it wouldn't be stored in the memory and + // it will also be a sign that checks already performed + div = null; + } + + function roundPixelMeasures( measure ) { + return Math.round( parseFloat( measure ) ); + } + + var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal, + reliableMarginLeftVal, + container = document.createElement( "div" ), + div = document.createElement( "div" ); + + // Finish early in limited (non-browser) environments + if ( !div.style ) { + return; + } + + // Support: IE <=9 - 11 only + // Style of cloned element affects source element cloned (#8908) + div.style.backgroundClip = "content-box"; + div.cloneNode( true ).style.backgroundClip = ""; + support.clearCloneStyle = div.style.backgroundClip === "content-box"; + + jQuery.extend( support, { + boxSizingReliable: function() { + computeStyleTests(); + return boxSizingReliableVal; + }, + pixelBoxStyles: function() { + computeStyleTests(); + return pixelBoxStylesVal; + }, + pixelPosition: function() { + computeStyleTests(); + return pixelPositionVal; + }, + reliableMarginLeft: function() { + computeStyleTests(); + return reliableMarginLeftVal; + }, + scrollboxSize: function() { + computeStyleTests(); + return scrollboxSizeVal; + } + } ); +} )(); + + +function curCSS( elem, name, computed ) { + var width, minWidth, maxWidth, ret, + + // Support: Firefox 51+ + // Retrieving style before computed somehow + // fixes an issue with getting wrong values + // on detached elements + style = elem.style; + + computed = computed || getStyles( elem ); + + // getPropertyValue is needed for: + // .css('filter') (IE 9 only, #12537) + // .css('--customProperty) (#3144) + if ( computed ) { + ret = computed.getPropertyValue( name ) || computed[ name ]; + + if ( ret === "" && !isAttached( elem ) ) { + ret = jQuery.style( elem, name ); + } + + // A tribute to the "awesome hack by Dean Edwards" + // Android Browser returns percentage for some values, + // but width seems to be reliably pixels. + // This is against the CSSOM draft spec: + // https://drafts.csswg.org/cssom/#resolved-values + if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) { + + // Remember the original values + width = style.width; + minWidth = style.minWidth; + maxWidth = style.maxWidth; + + // Put in the new values to get a computed value out + style.minWidth = style.maxWidth = style.width = ret; + ret = computed.width; + + // Revert the changed values + style.width = width; + style.minWidth = minWidth; + style.maxWidth = maxWidth; + } + } + + return ret !== undefined ? + + // Support: IE <=9 - 11 only + // IE returns zIndex value as an integer. + ret + "" : + ret; +} + + +function addGetHookIf( conditionFn, hookFn ) { + + // Define the hook, we'll check on the first run if it's really needed. + return { + get: function() { + if ( conditionFn() ) { + + // Hook not needed (or it's not possible to use it due + // to missing dependency), remove it. + delete this.get; + return; + } + + // Hook needed; redefine it so that the support test is not executed again. + return ( this.get = hookFn ).apply( this, arguments ); + } + }; +} + + +var cssPrefixes = [ "Webkit", "Moz", "ms" ], + emptyStyle = document.createElement( "div" ).style, + vendorProps = {}; + +// Return a vendor-prefixed property or undefined +function vendorPropName( name ) { + + // Check for vendor prefixed names + var capName = name[ 0 ].toUpperCase() + name.slice( 1 ), + i = cssPrefixes.length; + + while ( i-- ) { + name = cssPrefixes[ i ] + capName; + if ( name in emptyStyle ) { + return name; + } + } +} + +// Return a potentially-mapped jQuery.cssProps or vendor prefixed property +function finalPropName( name ) { + var final = jQuery.cssProps[ name ] || vendorProps[ name ]; + + if ( final ) { + return final; + } + if ( name in emptyStyle ) { + return name; + } + return vendorProps[ name ] = vendorPropName( name ) || name; +} + + +var + + // Swappable if display is none or starts with table + // except "table", "table-cell", or "table-caption" + // See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display + rdisplayswap = /^(none|table(?!-c[ea]).+)/, + rcustomProp = /^--/, + cssShow = { position: "absolute", visibility: "hidden", display: "block" }, + cssNormalTransform = { + letterSpacing: "0", + fontWeight: "400" + }; + +function setPositiveNumber( elem, value, subtract ) { + + // Any relative (+/-) values have already been + // normalized at this point + var matches = rcssNum.exec( value ); + return matches ? + + // Guard against undefined "subtract", e.g., when used as in cssHooks + Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) : + value; +} + +function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) { + var i = dimension === "width" ? 1 : 0, + extra = 0, + delta = 0; + + // Adjustment may not be necessary + if ( box === ( isBorderBox ? "border" : "content" ) ) { + return 0; + } + + for ( ; i < 4; i += 2 ) { + + // Both box models exclude margin + if ( box === "margin" ) { + delta += jQuery.css( elem, box + cssExpand[ i ], true, styles ); + } + + // If we get here with a content-box, we're seeking "padding" or "border" or "margin" + if ( !isBorderBox ) { + + // Add padding + delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + + // For "border" or "margin", add border + if ( box !== "padding" ) { + delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + + // But still keep track of it otherwise + } else { + extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + + // If we get here with a border-box (content + padding + border), we're seeking "content" or + // "padding" or "margin" + } else { + + // For "content", subtract padding + if ( box === "content" ) { + delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles ); + } + + // For "content" or "padding", subtract border + if ( box !== "margin" ) { + delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles ); + } + } + } + + // Account for positive content-box scroll gutter when requested by providing computedVal + if ( !isBorderBox && computedVal >= 0 ) { + + // offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border + // Assuming integer scroll gutter, subtract the rest and round down + delta += Math.max( 0, Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + computedVal - + delta - + extra - + 0.5 + + // If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter + // Use an explicit zero to avoid NaN (gh-3964) + ) ) || 0; + } + + return delta; +} + +function getWidthOrHeight( elem, dimension, extra ) { + + // Start with computed style + var styles = getStyles( elem ), + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322). + // Fake content-box until we know it's needed to know the true value. + boxSizingNeeded = !support.boxSizingReliable() || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + valueIsBorderBox = isBorderBox, + + val = curCSS( elem, dimension, styles ), + offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ); + + // Support: Firefox <=54 + // Return a confounding non-pixel value or feign ignorance, as appropriate. + if ( rnumnonpx.test( val ) ) { + if ( !extra ) { + return val; + } + val = "auto"; + } + + + // Fall back to offsetWidth/offsetHeight when value is "auto" + // This happens for inline elements with no explicit setting (gh-3571) + // Support: Android <=4.1 - 4.3 only + // Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602) + // Support: IE 9-11 only + // Also use offsetWidth/offsetHeight for when box sizing is unreliable + // We use getClientRects() to check for hidden/disconnected. + // In those cases, the computed value can be trusted to be border-box + if ( ( !support.boxSizingReliable() && isBorderBox || + val === "auto" || + !parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) && + elem.getClientRects().length ) { + + isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box"; + + // Where available, offsetWidth/offsetHeight approximate border box dimensions. + // Where not available (e.g., SVG), assume unreliable box-sizing and interpret the + // retrieved value as a content box dimension. + valueIsBorderBox = offsetProp in elem; + if ( valueIsBorderBox ) { + val = elem[ offsetProp ]; + } + } + + // Normalize "" and auto + val = parseFloat( val ) || 0; + + // Adjust for the element's box model + return ( val + + boxModelAdjustment( + elem, + dimension, + extra || ( isBorderBox ? "border" : "content" ), + valueIsBorderBox, + styles, + + // Provide the current computed size to request scroll gutter calculation (gh-3589) + val + ) + ) + "px"; +} + +jQuery.extend( { + + // Add in style property hooks for overriding the default + // behavior of getting and setting a style property + cssHooks: { + opacity: { + get: function( elem, computed ) { + if ( computed ) { + + // We should always get a number back from opacity + var ret = curCSS( elem, "opacity" ); + return ret === "" ? "1" : ret; + } + } + } + }, + + // Don't automatically add "px" to these possibly-unitless properties + cssNumber: { + "animationIterationCount": true, + "columnCount": true, + "fillOpacity": true, + "flexGrow": true, + "flexShrink": true, + "fontWeight": true, + "gridArea": true, + "gridColumn": true, + "gridColumnEnd": true, + "gridColumnStart": true, + "gridRow": true, + "gridRowEnd": true, + "gridRowStart": true, + "lineHeight": true, + "opacity": true, + "order": true, + "orphans": true, + "widows": true, + "zIndex": true, + "zoom": true + }, + + // Add in properties whose names you wish to fix before + // setting or getting the value + cssProps: {}, + + // Get and set the style property on a DOM Node + style: function( elem, name, value, extra ) { + + // Don't set styles on text and comment nodes + if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) { + return; + } + + // Make sure that we're working with the right name + var ret, type, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ), + style = elem.style; + + // Make sure that we're working with the right name. We don't + // want to query the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Gets hook for the prefixed version, then unprefixed version + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // Check if we're setting a value + if ( value !== undefined ) { + type = typeof value; + + // Convert "+=" or "-=" to relative numbers (#7345) + if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) { + value = adjustCSS( elem, name, ret ); + + // Fixes bug #9237 + type = "number"; + } + + // Make sure that null and NaN values aren't set (#7116) + if ( value == null || value !== value ) { + return; + } + + // If a number was passed in, add the unit (except for certain CSS properties) + // The isCustomProp check can be removed in jQuery 4.0 when we only auto-append + // "px" to a few hardcoded values. + if ( type === "number" && !isCustomProp ) { + value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" ); + } + + // background-* props affect original clone's values + if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) { + style[ name ] = "inherit"; + } + + // If a hook was provided, use that value, otherwise just set the specified value + if ( !hooks || !( "set" in hooks ) || + ( value = hooks.set( elem, value, extra ) ) !== undefined ) { + + if ( isCustomProp ) { + style.setProperty( name, value ); + } else { + style[ name ] = value; + } + } + + } else { + + // If a hook was provided get the non-computed value from there + if ( hooks && "get" in hooks && + ( ret = hooks.get( elem, false, extra ) ) !== undefined ) { + + return ret; + } + + // Otherwise just get the value from the style object + return style[ name ]; + } + }, + + css: function( elem, name, extra, styles ) { + var val, num, hooks, + origName = camelCase( name ), + isCustomProp = rcustomProp.test( name ); + + // Make sure that we're working with the right name. We don't + // want to modify the value if it is a CSS custom property + // since they are user-defined. + if ( !isCustomProp ) { + name = finalPropName( origName ); + } + + // Try prefixed name followed by the unprefixed name + hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ]; + + // If a hook was provided get the computed value from there + if ( hooks && "get" in hooks ) { + val = hooks.get( elem, true, extra ); + } + + // Otherwise, if a way to get the computed value exists, use that + if ( val === undefined ) { + val = curCSS( elem, name, styles ); + } + + // Convert "normal" to computed value + if ( val === "normal" && name in cssNormalTransform ) { + val = cssNormalTransform[ name ]; + } + + // Make numeric if forced or a qualifier was provided and val looks numeric + if ( extra === "" || extra ) { + num = parseFloat( val ); + return extra === true || isFinite( num ) ? num || 0 : val; + } + + return val; + } +} ); + +jQuery.each( [ "height", "width" ], function( i, dimension ) { + jQuery.cssHooks[ dimension ] = { + get: function( elem, computed, extra ) { + if ( computed ) { + + // Certain elements can have dimension info if we invisibly show them + // but it must have a current display style that would benefit + return rdisplayswap.test( jQuery.css( elem, "display" ) ) && + + // Support: Safari 8+ + // Table columns in Safari have non-zero offsetWidth & zero + // getBoundingClientRect().width unless display is changed. + // Support: IE <=11 only + // Running getBoundingClientRect on a disconnected node + // in IE throws an error. + ( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ? + swap( elem, cssShow, function() { + return getWidthOrHeight( elem, dimension, extra ); + } ) : + getWidthOrHeight( elem, dimension, extra ); + } + }, + + set: function( elem, value, extra ) { + var matches, + styles = getStyles( elem ), + + // Only read styles.position if the test has a chance to fail + // to avoid forcing a reflow. + scrollboxSizeBuggy = !support.scrollboxSize() && + styles.position === "absolute", + + // To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991) + boxSizingNeeded = scrollboxSizeBuggy || extra, + isBorderBox = boxSizingNeeded && + jQuery.css( elem, "boxSizing", false, styles ) === "border-box", + subtract = extra ? + boxModelAdjustment( + elem, + dimension, + extra, + isBorderBox, + styles + ) : + 0; + + // Account for unreliable border-box dimensions by comparing offset* to computed and + // faking a content-box to get border and padding (gh-3699) + if ( isBorderBox && scrollboxSizeBuggy ) { + subtract -= Math.ceil( + elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] - + parseFloat( styles[ dimension ] ) - + boxModelAdjustment( elem, dimension, "border", false, styles ) - + 0.5 + ); + } + + // Convert to pixels if value adjustment is needed + if ( subtract && ( matches = rcssNum.exec( value ) ) && + ( matches[ 3 ] || "px" ) !== "px" ) { + + elem.style[ dimension ] = value; + value = jQuery.css( elem, dimension ); + } + + return setPositiveNumber( elem, value, subtract ); + } + }; +} ); + +jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft, + function( elem, computed ) { + if ( computed ) { + return ( parseFloat( curCSS( elem, "marginLeft" ) ) || + elem.getBoundingClientRect().left - + swap( elem, { marginLeft: 0 }, function() { + return elem.getBoundingClientRect().left; + } ) + ) + "px"; + } + } +); + +// These hooks are used by animate to expand properties +jQuery.each( { + margin: "", + padding: "", + border: "Width" +}, function( prefix, suffix ) { + jQuery.cssHooks[ prefix + suffix ] = { + expand: function( value ) { + var i = 0, + expanded = {}, + + // Assumes a single number if not a string + parts = typeof value === "string" ? value.split( " " ) : [ value ]; + + for ( ; i < 4; i++ ) { + expanded[ prefix + cssExpand[ i ] + suffix ] = + parts[ i ] || parts[ i - 2 ] || parts[ 0 ]; + } + + return expanded; + } + }; + + if ( prefix !== "margin" ) { + jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber; + } +} ); + +jQuery.fn.extend( { + css: function( name, value ) { + return access( this, function( elem, name, value ) { + var styles, len, + map = {}, + i = 0; + + if ( Array.isArray( name ) ) { + styles = getStyles( elem ); + len = name.length; + + for ( ; i < len; i++ ) { + map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles ); + } + + return map; + } + + return value !== undefined ? + jQuery.style( elem, name, value ) : + jQuery.css( elem, name ); + }, name, value, arguments.length > 1 ); + } +} ); + + +function Tween( elem, options, prop, end, easing ) { + return new Tween.prototype.init( elem, options, prop, end, easing ); +} +jQuery.Tween = Tween; + +Tween.prototype = { + constructor: Tween, + init: function( elem, options, prop, end, easing, unit ) { + this.elem = elem; + this.prop = prop; + this.easing = easing || jQuery.easing._default; + this.options = options; + this.start = this.now = this.cur(); + this.end = end; + this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" ); + }, + cur: function() { + var hooks = Tween.propHooks[ this.prop ]; + + return hooks && hooks.get ? + hooks.get( this ) : + Tween.propHooks._default.get( this ); + }, + run: function( percent ) { + var eased, + hooks = Tween.propHooks[ this.prop ]; + + if ( this.options.duration ) { + this.pos = eased = jQuery.easing[ this.easing ]( + percent, this.options.duration * percent, 0, 1, this.options.duration + ); + } else { + this.pos = eased = percent; + } + this.now = ( this.end - this.start ) * eased + this.start; + + if ( this.options.step ) { + this.options.step.call( this.elem, this.now, this ); + } + + if ( hooks && hooks.set ) { + hooks.set( this ); + } else { + Tween.propHooks._default.set( this ); + } + return this; + } +}; + +Tween.prototype.init.prototype = Tween.prototype; + +Tween.propHooks = { + _default: { + get: function( tween ) { + var result; + + // Use a property on the element directly when it is not a DOM element, + // or when there is no matching style property that exists. + if ( tween.elem.nodeType !== 1 || + tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) { + return tween.elem[ tween.prop ]; + } + + // Passing an empty string as a 3rd parameter to .css will automatically + // attempt a parseFloat and fallback to a string if the parse fails. + // Simple values such as "10px" are parsed to Float; + // complex values such as "rotate(1rad)" are returned as-is. + result = jQuery.css( tween.elem, tween.prop, "" ); + + // Empty strings, null, undefined and "auto" are converted to 0. + return !result || result === "auto" ? 0 : result; + }, + set: function( tween ) { + + // Use step hook for back compat. + // Use cssHook if its there. + // Use .style if available and use plain properties where available. + if ( jQuery.fx.step[ tween.prop ] ) { + jQuery.fx.step[ tween.prop ]( tween ); + } else if ( tween.elem.nodeType === 1 && ( + jQuery.cssHooks[ tween.prop ] || + tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) { + jQuery.style( tween.elem, tween.prop, tween.now + tween.unit ); + } else { + tween.elem[ tween.prop ] = tween.now; + } + } + } +}; + +// Support: IE <=9 only +// Panic based approach to setting things on disconnected nodes +Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = { + set: function( tween ) { + if ( tween.elem.nodeType && tween.elem.parentNode ) { + tween.elem[ tween.prop ] = tween.now; + } + } +}; + +jQuery.easing = { + linear: function( p ) { + return p; + }, + swing: function( p ) { + return 0.5 - Math.cos( p * Math.PI ) / 2; + }, + _default: "swing" +}; + +jQuery.fx = Tween.prototype.init; + +// Back compat <1.8 extension point +jQuery.fx.step = {}; + + + + +var + fxNow, inProgress, + rfxtypes = /^(?:toggle|show|hide)$/, + rrun = /queueHooks$/; + +function schedule() { + if ( inProgress ) { + if ( document.hidden === false && window.requestAnimationFrame ) { + window.requestAnimationFrame( schedule ); + } else { + window.setTimeout( schedule, jQuery.fx.interval ); + } + + jQuery.fx.tick(); + } +} + +// Animations created synchronously will run synchronously +function createFxNow() { + window.setTimeout( function() { + fxNow = undefined; + } ); + return ( fxNow = Date.now() ); +} + +// Generate parameters to create a standard animation +function genFx( type, includeWidth ) { + var which, + i = 0, + attrs = { height: type }; + + // If we include width, step value is 1 to do all cssExpand values, + // otherwise step value is 2 to skip over Left and Right + includeWidth = includeWidth ? 1 : 0; + for ( ; i < 4; i += 2 - includeWidth ) { + which = cssExpand[ i ]; + attrs[ "margin" + which ] = attrs[ "padding" + which ] = type; + } + + if ( includeWidth ) { + attrs.opacity = attrs.width = type; + } + + return attrs; +} + +function createTween( value, prop, animation ) { + var tween, + collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ), + index = 0, + length = collection.length; + for ( ; index < length; index++ ) { + if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) { + + // We're done with this property + return tween; + } + } +} + +function defaultPrefilter( elem, props, opts ) { + var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display, + isBox = "width" in props || "height" in props, + anim = this, + orig = {}, + style = elem.style, + hidden = elem.nodeType && isHiddenWithinTree( elem ), + dataShow = dataPriv.get( elem, "fxshow" ); + + // Queue-skipping animations hijack the fx hooks + if ( !opts.queue ) { + hooks = jQuery._queueHooks( elem, "fx" ); + if ( hooks.unqueued == null ) { + hooks.unqueued = 0; + oldfire = hooks.empty.fire; + hooks.empty.fire = function() { + if ( !hooks.unqueued ) { + oldfire(); + } + }; + } + hooks.unqueued++; + + anim.always( function() { + + // Ensure the complete handler is called before this completes + anim.always( function() { + hooks.unqueued--; + if ( !jQuery.queue( elem, "fx" ).length ) { + hooks.empty.fire(); + } + } ); + } ); + } + + // Detect show/hide animations + for ( prop in props ) { + value = props[ prop ]; + if ( rfxtypes.test( value ) ) { + delete props[ prop ]; + toggle = toggle || value === "toggle"; + if ( value === ( hidden ? "hide" : "show" ) ) { + + // Pretend to be hidden if this is a "show" and + // there is still data from a stopped show/hide + if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) { + hidden = true; + + // Ignore all other no-op show/hide data + } else { + continue; + } + } + orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop ); + } + } + + // Bail out if this is a no-op like .hide().hide() + propTween = !jQuery.isEmptyObject( props ); + if ( !propTween && jQuery.isEmptyObject( orig ) ) { + return; + } + + // Restrict "overflow" and "display" styles during box animations + if ( isBox && elem.nodeType === 1 ) { + + // Support: IE <=9 - 11, Edge 12 - 15 + // Record all 3 overflow attributes because IE does not infer the shorthand + // from identically-valued overflowX and overflowY and Edge just mirrors + // the overflowX value there. + opts.overflow = [ style.overflow, style.overflowX, style.overflowY ]; + + // Identify a display type, preferring old show/hide data over the CSS cascade + restoreDisplay = dataShow && dataShow.display; + if ( restoreDisplay == null ) { + restoreDisplay = dataPriv.get( elem, "display" ); + } + display = jQuery.css( elem, "display" ); + if ( display === "none" ) { + if ( restoreDisplay ) { + display = restoreDisplay; + } else { + + // Get nonempty value(s) by temporarily forcing visibility + showHide( [ elem ], true ); + restoreDisplay = elem.style.display || restoreDisplay; + display = jQuery.css( elem, "display" ); + showHide( [ elem ] ); + } + } + + // Animate inline elements as inline-block + if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) { + if ( jQuery.css( elem, "float" ) === "none" ) { + + // Restore the original display value at the end of pure show/hide animations + if ( !propTween ) { + anim.done( function() { + style.display = restoreDisplay; + } ); + if ( restoreDisplay == null ) { + display = style.display; + restoreDisplay = display === "none" ? "" : display; + } + } + style.display = "inline-block"; + } + } + } + + if ( opts.overflow ) { + style.overflow = "hidden"; + anim.always( function() { + style.overflow = opts.overflow[ 0 ]; + style.overflowX = opts.overflow[ 1 ]; + style.overflowY = opts.overflow[ 2 ]; + } ); + } + + // Implement show/hide animations + propTween = false; + for ( prop in orig ) { + + // General show/hide setup for this element animation + if ( !propTween ) { + if ( dataShow ) { + if ( "hidden" in dataShow ) { + hidden = dataShow.hidden; + } + } else { + dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } ); + } + + // Store hidden/visible for toggle so `.stop().toggle()` "reverses" + if ( toggle ) { + dataShow.hidden = !hidden; + } + + // Show elements before animating them + if ( hidden ) { + showHide( [ elem ], true ); + } + + /* eslint-disable no-loop-func */ + + anim.done( function() { + + /* eslint-enable no-loop-func */ + + // The final step of a "hide" animation is actually hiding the element + if ( !hidden ) { + showHide( [ elem ] ); + } + dataPriv.remove( elem, "fxshow" ); + for ( prop in orig ) { + jQuery.style( elem, prop, orig[ prop ] ); + } + } ); + } + + // Per-property setup + propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim ); + if ( !( prop in dataShow ) ) { + dataShow[ prop ] = propTween.start; + if ( hidden ) { + propTween.end = propTween.start; + propTween.start = 0; + } + } + } +} + +function propFilter( props, specialEasing ) { + var index, name, easing, value, hooks; + + // camelCase, specialEasing and expand cssHook pass + for ( index in props ) { + name = camelCase( index ); + easing = specialEasing[ name ]; + value = props[ index ]; + if ( Array.isArray( value ) ) { + easing = value[ 1 ]; + value = props[ index ] = value[ 0 ]; + } + + if ( index !== name ) { + props[ name ] = value; + delete props[ index ]; + } + + hooks = jQuery.cssHooks[ name ]; + if ( hooks && "expand" in hooks ) { + value = hooks.expand( value ); + delete props[ name ]; + + // Not quite $.extend, this won't overwrite existing keys. + // Reusing 'index' because we have the correct "name" + for ( index in value ) { + if ( !( index in props ) ) { + props[ index ] = value[ index ]; + specialEasing[ index ] = easing; + } + } + } else { + specialEasing[ name ] = easing; + } + } +} + +function Animation( elem, properties, options ) { + var result, + stopped, + index = 0, + length = Animation.prefilters.length, + deferred = jQuery.Deferred().always( function() { + + // Don't match elem in the :animated selector + delete tick.elem; + } ), + tick = function() { + if ( stopped ) { + return false; + } + var currentTime = fxNow || createFxNow(), + remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ), + + // Support: Android 2.3 only + // Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497) + temp = remaining / animation.duration || 0, + percent = 1 - temp, + index = 0, + length = animation.tweens.length; + + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( percent ); + } + + deferred.notifyWith( elem, [ animation, percent, remaining ] ); + + // If there's more to do, yield + if ( percent < 1 && length ) { + return remaining; + } + + // If this was an empty animation, synthesize a final progress notification + if ( !length ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + } + + // Resolve the animation and report its conclusion + deferred.resolveWith( elem, [ animation ] ); + return false; + }, + animation = deferred.promise( { + elem: elem, + props: jQuery.extend( {}, properties ), + opts: jQuery.extend( true, { + specialEasing: {}, + easing: jQuery.easing._default + }, options ), + originalProperties: properties, + originalOptions: options, + startTime: fxNow || createFxNow(), + duration: options.duration, + tweens: [], + createTween: function( prop, end ) { + var tween = jQuery.Tween( elem, animation.opts, prop, end, + animation.opts.specialEasing[ prop ] || animation.opts.easing ); + animation.tweens.push( tween ); + return tween; + }, + stop: function( gotoEnd ) { + var index = 0, + + // If we are going to the end, we want to run all the tweens + // otherwise we skip this part + length = gotoEnd ? animation.tweens.length : 0; + if ( stopped ) { + return this; + } + stopped = true; + for ( ; index < length; index++ ) { + animation.tweens[ index ].run( 1 ); + } + + // Resolve when we played the last frame; otherwise, reject + if ( gotoEnd ) { + deferred.notifyWith( elem, [ animation, 1, 0 ] ); + deferred.resolveWith( elem, [ animation, gotoEnd ] ); + } else { + deferred.rejectWith( elem, [ animation, gotoEnd ] ); + } + return this; + } + } ), + props = animation.props; + + propFilter( props, animation.opts.specialEasing ); + + for ( ; index < length; index++ ) { + result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts ); + if ( result ) { + if ( isFunction( result.stop ) ) { + jQuery._queueHooks( animation.elem, animation.opts.queue ).stop = + result.stop.bind( result ); + } + return result; + } + } + + jQuery.map( props, createTween, animation ); + + if ( isFunction( animation.opts.start ) ) { + animation.opts.start.call( elem, animation ); + } + + // Attach callbacks from options + animation + .progress( animation.opts.progress ) + .done( animation.opts.done, animation.opts.complete ) + .fail( animation.opts.fail ) + .always( animation.opts.always ); + + jQuery.fx.timer( + jQuery.extend( tick, { + elem: elem, + anim: animation, + queue: animation.opts.queue + } ) + ); + + return animation; +} + +jQuery.Animation = jQuery.extend( Animation, { + + tweeners: { + "*": [ function( prop, value ) { + var tween = this.createTween( prop, value ); + adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween ); + return tween; + } ] + }, + + tweener: function( props, callback ) { + if ( isFunction( props ) ) { + callback = props; + props = [ "*" ]; + } else { + props = props.match( rnothtmlwhite ); + } + + var prop, + index = 0, + length = props.length; + + for ( ; index < length; index++ ) { + prop = props[ index ]; + Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || []; + Animation.tweeners[ prop ].unshift( callback ); + } + }, + + prefilters: [ defaultPrefilter ], + + prefilter: function( callback, prepend ) { + if ( prepend ) { + Animation.prefilters.unshift( callback ); + } else { + Animation.prefilters.push( callback ); + } + } +} ); + +jQuery.speed = function( speed, easing, fn ) { + var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : { + complete: fn || !fn && easing || + isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !isFunction( easing ) && easing + }; + + // Go to the end state if fx are off + if ( jQuery.fx.off ) { + opt.duration = 0; + + } else { + if ( typeof opt.duration !== "number" ) { + if ( opt.duration in jQuery.fx.speeds ) { + opt.duration = jQuery.fx.speeds[ opt.duration ]; + + } else { + opt.duration = jQuery.fx.speeds._default; + } + } + } + + // Normalize opt.queue - true/undefined/null -> "fx" + if ( opt.queue == null || opt.queue === true ) { + opt.queue = "fx"; + } + + // Queueing + opt.old = opt.complete; + + opt.complete = function() { + if ( isFunction( opt.old ) ) { + opt.old.call( this ); + } + + if ( opt.queue ) { + jQuery.dequeue( this, opt.queue ); + } + }; + + return opt; +}; + +jQuery.fn.extend( { + fadeTo: function( speed, to, easing, callback ) { + + // Show any hidden elements after setting opacity to 0 + return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show() + + // Animate to the value specified + .end().animate( { opacity: to }, speed, easing, callback ); + }, + animate: function( prop, speed, easing, callback ) { + var empty = jQuery.isEmptyObject( prop ), + optall = jQuery.speed( speed, easing, callback ), + doAnimation = function() { + + // Operate on a copy of prop so per-property easing won't be lost + var anim = Animation( this, jQuery.extend( {}, prop ), optall ); + + // Empty animations, or finishing resolves immediately + if ( empty || dataPriv.get( this, "finish" ) ) { + anim.stop( true ); + } + }; + doAnimation.finish = doAnimation; + + return empty || optall.queue === false ? + this.each( doAnimation ) : + this.queue( optall.queue, doAnimation ); + }, + stop: function( type, clearQueue, gotoEnd ) { + var stopQueue = function( hooks ) { + var stop = hooks.stop; + delete hooks.stop; + stop( gotoEnd ); + }; + + if ( typeof type !== "string" ) { + gotoEnd = clearQueue; + clearQueue = type; + type = undefined; + } + if ( clearQueue && type !== false ) { + this.queue( type || "fx", [] ); + } + + return this.each( function() { + var dequeue = true, + index = type != null && type + "queueHooks", + timers = jQuery.timers, + data = dataPriv.get( this ); + + if ( index ) { + if ( data[ index ] && data[ index ].stop ) { + stopQueue( data[ index ] ); + } + } else { + for ( index in data ) { + if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) { + stopQueue( data[ index ] ); + } + } + } + + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && + ( type == null || timers[ index ].queue === type ) ) { + + timers[ index ].anim.stop( gotoEnd ); + dequeue = false; + timers.splice( index, 1 ); + } + } + + // Start the next in the queue if the last step wasn't forced. + // Timers currently will call their complete callbacks, which + // will dequeue but only if they were gotoEnd. + if ( dequeue || !gotoEnd ) { + jQuery.dequeue( this, type ); + } + } ); + }, + finish: function( type ) { + if ( type !== false ) { + type = type || "fx"; + } + return this.each( function() { + var index, + data = dataPriv.get( this ), + queue = data[ type + "queue" ], + hooks = data[ type + "queueHooks" ], + timers = jQuery.timers, + length = queue ? queue.length : 0; + + // Enable finishing flag on private data + data.finish = true; + + // Empty the queue first + jQuery.queue( this, type, [] ); + + if ( hooks && hooks.stop ) { + hooks.stop.call( this, true ); + } + + // Look for any active animations, and finish them + for ( index = timers.length; index--; ) { + if ( timers[ index ].elem === this && timers[ index ].queue === type ) { + timers[ index ].anim.stop( true ); + timers.splice( index, 1 ); + } + } + + // Look for any animations in the old queue and finish them + for ( index = 0; index < length; index++ ) { + if ( queue[ index ] && queue[ index ].finish ) { + queue[ index ].finish.call( this ); + } + } + + // Turn off finishing flag + delete data.finish; + } ); + } +} ); + +jQuery.each( [ "toggle", "show", "hide" ], function( i, name ) { + var cssFn = jQuery.fn[ name ]; + jQuery.fn[ name ] = function( speed, easing, callback ) { + return speed == null || typeof speed === "boolean" ? + cssFn.apply( this, arguments ) : + this.animate( genFx( name, true ), speed, easing, callback ); + }; +} ); + +// Generate shortcuts for custom animations +jQuery.each( { + slideDown: genFx( "show" ), + slideUp: genFx( "hide" ), + slideToggle: genFx( "toggle" ), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" }, + fadeToggle: { opacity: "toggle" } +}, function( name, props ) { + jQuery.fn[ name ] = function( speed, easing, callback ) { + return this.animate( props, speed, easing, callback ); + }; +} ); + +jQuery.timers = []; +jQuery.fx.tick = function() { + var timer, + i = 0, + timers = jQuery.timers; + + fxNow = Date.now(); + + for ( ; i < timers.length; i++ ) { + timer = timers[ i ]; + + // Run the timer and safely remove it when done (allowing for external removal) + if ( !timer() && timers[ i ] === timer ) { + timers.splice( i--, 1 ); + } + } + + if ( !timers.length ) { + jQuery.fx.stop(); + } + fxNow = undefined; +}; + +jQuery.fx.timer = function( timer ) { + jQuery.timers.push( timer ); + jQuery.fx.start(); +}; + +jQuery.fx.interval = 13; +jQuery.fx.start = function() { + if ( inProgress ) { + return; + } + + inProgress = true; + schedule(); +}; + +jQuery.fx.stop = function() { + inProgress = null; +}; + +jQuery.fx.speeds = { + slow: 600, + fast: 200, + + // Default speed + _default: 400 +}; + + +// Based off of the plugin by Clint Helfers, with permission. +// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/ +jQuery.fn.delay = function( time, type ) { + time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time; + type = type || "fx"; + + return this.queue( type, function( next, hooks ) { + var timeout = window.setTimeout( next, time ); + hooks.stop = function() { + window.clearTimeout( timeout ); + }; + } ); +}; + + +( function() { + var input = document.createElement( "input" ), + select = document.createElement( "select" ), + opt = select.appendChild( document.createElement( "option" ) ); + + input.type = "checkbox"; + + // Support: Android <=4.3 only + // Default value for a checkbox should be "on" + support.checkOn = input.value !== ""; + + // Support: IE <=11 only + // Must access selectedIndex to make default options select + support.optSelected = opt.selected; + + // Support: IE <=11 only + // An input loses its value after becoming a radio + input = document.createElement( "input" ); + input.value = "t"; + input.type = "radio"; + support.radioValue = input.value === "t"; +} )(); + + +var boolHook, + attrHandle = jQuery.expr.attrHandle; + +jQuery.fn.extend( { + attr: function( name, value ) { + return access( this, jQuery.attr, name, value, arguments.length > 1 ); + }, + + removeAttr: function( name ) { + return this.each( function() { + jQuery.removeAttr( this, name ); + } ); + } +} ); + +jQuery.extend( { + attr: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set attributes on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + // Fallback to prop when attributes are not supported + if ( typeof elem.getAttribute === "undefined" ) { + return jQuery.prop( elem, name, value ); + } + + // Attribute hooks are determined by the lowercase version + // Grab necessary hook if one is defined + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + hooks = jQuery.attrHooks[ name.toLowerCase() ] || + ( jQuery.expr.match.bool.test( name ) ? boolHook : undefined ); + } + + if ( value !== undefined ) { + if ( value === null ) { + jQuery.removeAttr( elem, name ); + return; + } + + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + elem.setAttribute( name, value + "" ); + return value; + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + ret = jQuery.find.attr( elem, name ); + + // Non-existent attributes return null, we normalize to undefined + return ret == null ? undefined : ret; + }, + + attrHooks: { + type: { + set: function( elem, value ) { + if ( !support.radioValue && value === "radio" && + nodeName( elem, "input" ) ) { + var val = elem.value; + elem.setAttribute( "type", value ); + if ( val ) { + elem.value = val; + } + return value; + } + } + } + }, + + removeAttr: function( elem, value ) { + var name, + i = 0, + + // Attribute names can contain non-HTML whitespace characters + // https://html.spec.whatwg.org/multipage/syntax.html#attributes-2 + attrNames = value && value.match( rnothtmlwhite ); + + if ( attrNames && elem.nodeType === 1 ) { + while ( ( name = attrNames[ i++ ] ) ) { + elem.removeAttribute( name ); + } + } + } +} ); + +// Hooks for boolean attributes +boolHook = { + set: function( elem, value, name ) { + if ( value === false ) { + + // Remove boolean attributes when set to false + jQuery.removeAttr( elem, name ); + } else { + elem.setAttribute( name, name ); + } + return name; + } +}; + +jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( i, name ) { + var getter = attrHandle[ name ] || jQuery.find.attr; + + attrHandle[ name ] = function( elem, name, isXML ) { + var ret, handle, + lowercaseName = name.toLowerCase(); + + if ( !isXML ) { + + // Avoid an infinite loop by temporarily removing this function from the getter + handle = attrHandle[ lowercaseName ]; + attrHandle[ lowercaseName ] = ret; + ret = getter( elem, name, isXML ) != null ? + lowercaseName : + null; + attrHandle[ lowercaseName ] = handle; + } + return ret; + }; +} ); + + + + +var rfocusable = /^(?:input|select|textarea|button)$/i, + rclickable = /^(?:a|area)$/i; + +jQuery.fn.extend( { + prop: function( name, value ) { + return access( this, jQuery.prop, name, value, arguments.length > 1 ); + }, + + removeProp: function( name ) { + return this.each( function() { + delete this[ jQuery.propFix[ name ] || name ]; + } ); + } +} ); + +jQuery.extend( { + prop: function( elem, name, value ) { + var ret, hooks, + nType = elem.nodeType; + + // Don't get/set properties on text, comment and attribute nodes + if ( nType === 3 || nType === 8 || nType === 2 ) { + return; + } + + if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) { + + // Fix name and attach hooks + name = jQuery.propFix[ name ] || name; + hooks = jQuery.propHooks[ name ]; + } + + if ( value !== undefined ) { + if ( hooks && "set" in hooks && + ( ret = hooks.set( elem, value, name ) ) !== undefined ) { + return ret; + } + + return ( elem[ name ] = value ); + } + + if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) { + return ret; + } + + return elem[ name ]; + }, + + propHooks: { + tabIndex: { + get: function( elem ) { + + // Support: IE <=9 - 11 only + // elem.tabIndex doesn't always return the + // correct value when it hasn't been explicitly set + // https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + // Use proper attribute retrieval(#12072) + var tabindex = jQuery.find.attr( elem, "tabindex" ); + + if ( tabindex ) { + return parseInt( tabindex, 10 ); + } + + if ( + rfocusable.test( elem.nodeName ) || + rclickable.test( elem.nodeName ) && + elem.href + ) { + return 0; + } + + return -1; + } + } + }, + + propFix: { + "for": "htmlFor", + "class": "className" + } +} ); + +// Support: IE <=11 only +// Accessing the selectedIndex property +// forces the browser to respect setting selected +// on the option +// The getter ensures a default option is selected +// when in an optgroup +// eslint rule "no-unused-expressions" is disabled for this code +// since it considers such accessions noop +if ( !support.optSelected ) { + jQuery.propHooks.selected = { + get: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent && parent.parentNode ) { + parent.parentNode.selectedIndex; + } + return null; + }, + set: function( elem ) { + + /* eslint no-unused-expressions: "off" */ + + var parent = elem.parentNode; + if ( parent ) { + parent.selectedIndex; + + if ( parent.parentNode ) { + parent.parentNode.selectedIndex; + } + } + } + }; +} + +jQuery.each( [ + "tabIndex", + "readOnly", + "maxLength", + "cellSpacing", + "cellPadding", + "rowSpan", + "colSpan", + "useMap", + "frameBorder", + "contentEditable" +], function() { + jQuery.propFix[ this.toLowerCase() ] = this; +} ); + + + + + // Strip and collapse whitespace according to HTML spec + // https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace + function stripAndCollapse( value ) { + var tokens = value.match( rnothtmlwhite ) || []; + return tokens.join( " " ); + } + + +function getClass( elem ) { + return elem.getAttribute && elem.getAttribute( "class" ) || ""; +} + +function classesToArray( value ) { + if ( Array.isArray( value ) ) { + return value; + } + if ( typeof value === "string" ) { + return value.match( rnothtmlwhite ) || []; + } + return []; +} + +jQuery.fn.extend( { + addClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).addClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + if ( cur.indexOf( " " + clazz + " " ) < 0 ) { + cur += clazz + " "; + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + removeClass: function( value ) { + var classes, elem, cur, curValue, clazz, j, finalValue, + i = 0; + + if ( isFunction( value ) ) { + return this.each( function( j ) { + jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) ); + } ); + } + + if ( !arguments.length ) { + return this.attr( "class", "" ); + } + + classes = classesToArray( value ); + + if ( classes.length ) { + while ( ( elem = this[ i++ ] ) ) { + curValue = getClass( elem ); + + // This expression is here for better compressibility (see addClass) + cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " ); + + if ( cur ) { + j = 0; + while ( ( clazz = classes[ j++ ] ) ) { + + // Remove *all* instances + while ( cur.indexOf( " " + clazz + " " ) > -1 ) { + cur = cur.replace( " " + clazz + " ", " " ); + } + } + + // Only assign if different to avoid unneeded rendering. + finalValue = stripAndCollapse( cur ); + if ( curValue !== finalValue ) { + elem.setAttribute( "class", finalValue ); + } + } + } + } + + return this; + }, + + toggleClass: function( value, stateVal ) { + var type = typeof value, + isValidValue = type === "string" || Array.isArray( value ); + + if ( typeof stateVal === "boolean" && isValidValue ) { + return stateVal ? this.addClass( value ) : this.removeClass( value ); + } + + if ( isFunction( value ) ) { + return this.each( function( i ) { + jQuery( this ).toggleClass( + value.call( this, i, getClass( this ), stateVal ), + stateVal + ); + } ); + } + + return this.each( function() { + var className, i, self, classNames; + + if ( isValidValue ) { + + // Toggle individual class names + i = 0; + self = jQuery( this ); + classNames = classesToArray( value ); + + while ( ( className = classNames[ i++ ] ) ) { + + // Check each className given, space separated list + if ( self.hasClass( className ) ) { + self.removeClass( className ); + } else { + self.addClass( className ); + } + } + + // Toggle whole class name + } else if ( value === undefined || type === "boolean" ) { + className = getClass( this ); + if ( className ) { + + // Store className if set + dataPriv.set( this, "__className__", className ); + } + + // If the element has a class name or if we're passed `false`, + // then remove the whole classname (if there was one, the above saved it). + // Otherwise bring back whatever was previously saved (if anything), + // falling back to the empty string if nothing was stored. + if ( this.setAttribute ) { + this.setAttribute( "class", + className || value === false ? + "" : + dataPriv.get( this, "__className__" ) || "" + ); + } + } + } ); + }, + + hasClass: function( selector ) { + var className, elem, + i = 0; + + className = " " + selector + " "; + while ( ( elem = this[ i++ ] ) ) { + if ( elem.nodeType === 1 && + ( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) { + return true; + } + } + + return false; + } +} ); + + + + +var rreturn = /\r/g; + +jQuery.fn.extend( { + val: function( value ) { + var hooks, ret, valueIsFunction, + elem = this[ 0 ]; + + if ( !arguments.length ) { + if ( elem ) { + hooks = jQuery.valHooks[ elem.type ] || + jQuery.valHooks[ elem.nodeName.toLowerCase() ]; + + if ( hooks && + "get" in hooks && + ( ret = hooks.get( elem, "value" ) ) !== undefined + ) { + return ret; + } + + ret = elem.value; + + // Handle most common string cases + if ( typeof ret === "string" ) { + return ret.replace( rreturn, "" ); + } + + // Handle cases where value is null/undef or number + return ret == null ? "" : ret; + } + + return; + } + + valueIsFunction = isFunction( value ); + + return this.each( function( i ) { + var val; + + if ( this.nodeType !== 1 ) { + return; + } + + if ( valueIsFunction ) { + val = value.call( this, i, jQuery( this ).val() ); + } else { + val = value; + } + + // Treat null/undefined as ""; convert numbers to string + if ( val == null ) { + val = ""; + + } else if ( typeof val === "number" ) { + val += ""; + + } else if ( Array.isArray( val ) ) { + val = jQuery.map( val, function( value ) { + return value == null ? "" : value + ""; + } ); + } + + hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ]; + + // If set returns undefined, fall back to normal setting + if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) { + this.value = val; + } + } ); + } +} ); + +jQuery.extend( { + valHooks: { + option: { + get: function( elem ) { + + var val = jQuery.find.attr( elem, "value" ); + return val != null ? + val : + + // Support: IE <=10 - 11 only + // option.text throws exceptions (#14686, #14858) + // Strip and collapse whitespace + // https://html.spec.whatwg.org/#strip-and-collapse-whitespace + stripAndCollapse( jQuery.text( elem ) ); + } + }, + select: { + get: function( elem ) { + var value, option, i, + options = elem.options, + index = elem.selectedIndex, + one = elem.type === "select-one", + values = one ? null : [], + max = one ? index + 1 : options.length; + + if ( index < 0 ) { + i = max; + + } else { + i = one ? index : 0; + } + + // Loop through all the selected options + for ( ; i < max; i++ ) { + option = options[ i ]; + + // Support: IE <=9 only + // IE8-9 doesn't update selected after form reset (#2551) + if ( ( option.selected || i === index ) && + + // Don't return options that are disabled or in a disabled optgroup + !option.disabled && + ( !option.parentNode.disabled || + !nodeName( option.parentNode, "optgroup" ) ) ) { + + // Get the specific value for the option + value = jQuery( option ).val(); + + // We don't need an array for one selects + if ( one ) { + return value; + } + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + }, + + set: function( elem, value ) { + var optionSet, option, + options = elem.options, + values = jQuery.makeArray( value ), + i = options.length; + + while ( i-- ) { + option = options[ i ]; + + /* eslint-disable no-cond-assign */ + + if ( option.selected = + jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1 + ) { + optionSet = true; + } + + /* eslint-enable no-cond-assign */ + } + + // Force browsers to behave consistently when non-matching value is set + if ( !optionSet ) { + elem.selectedIndex = -1; + } + return values; + } + } + } +} ); + +// Radios and checkboxes getter/setter +jQuery.each( [ "radio", "checkbox" ], function() { + jQuery.valHooks[ this ] = { + set: function( elem, value ) { + if ( Array.isArray( value ) ) { + return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 ); + } + } + }; + if ( !support.checkOn ) { + jQuery.valHooks[ this ].get = function( elem ) { + return elem.getAttribute( "value" ) === null ? "on" : elem.value; + }; + } +} ); + + + + +// Return jQuery for attributes-only inclusion + + +support.focusin = "onfocusin" in window; + + +var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/, + stopPropagationCallback = function( e ) { + e.stopPropagation(); + }; + +jQuery.extend( jQuery.event, { + + trigger: function( event, data, elem, onlyHandlers ) { + + var i, cur, tmp, bubbleType, ontype, handle, special, lastElement, + eventPath = [ elem || document ], + type = hasOwn.call( event, "type" ) ? event.type : event, + namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : []; + + cur = lastElement = tmp = elem = elem || document; + + // Don't do events on text and comment nodes + if ( elem.nodeType === 3 || elem.nodeType === 8 ) { + return; + } + + // focus/blur morphs to focusin/out; ensure we're not firing them right now + if ( rfocusMorph.test( type + jQuery.event.triggered ) ) { + return; + } + + if ( type.indexOf( "." ) > -1 ) { + + // Namespaced trigger; create a regexp to match event type in handle() + namespaces = type.split( "." ); + type = namespaces.shift(); + namespaces.sort(); + } + ontype = type.indexOf( ":" ) < 0 && "on" + type; + + // Caller can pass in a jQuery.Event object, Object, or just an event type string + event = event[ jQuery.expando ] ? + event : + new jQuery.Event( type, typeof event === "object" && event ); + + // Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true) + event.isTrigger = onlyHandlers ? 2 : 3; + event.namespace = namespaces.join( "." ); + event.rnamespace = event.namespace ? + new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) : + null; + + // Clean up the event in case it is being reused + event.result = undefined; + if ( !event.target ) { + event.target = elem; + } + + // Clone any incoming data and prepend the event, creating the handler arg list + data = data == null ? + [ event ] : + jQuery.makeArray( data, [ event ] ); + + // Allow special events to draw outside the lines + special = jQuery.event.special[ type ] || {}; + if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) { + return; + } + + // Determine event propagation path in advance, per W3C events spec (#9951) + // Bubble up to document, then to window; watch for a global ownerDocument var (#9724) + if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) { + + bubbleType = special.delegateType || type; + if ( !rfocusMorph.test( bubbleType + type ) ) { + cur = cur.parentNode; + } + for ( ; cur; cur = cur.parentNode ) { + eventPath.push( cur ); + tmp = cur; + } + + // Only add window if we got to document (e.g., not plain obj or detached DOM) + if ( tmp === ( elem.ownerDocument || document ) ) { + eventPath.push( tmp.defaultView || tmp.parentWindow || window ); + } + } + + // Fire handlers on the event path + i = 0; + while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) { + lastElement = cur; + event.type = i > 1 ? + bubbleType : + special.bindType || type; + + // jQuery handler + handle = ( dataPriv.get( cur, "events" ) || {} )[ event.type ] && + dataPriv.get( cur, "handle" ); + if ( handle ) { + handle.apply( cur, data ); + } + + // Native handler + handle = ontype && cur[ ontype ]; + if ( handle && handle.apply && acceptData( cur ) ) { + event.result = handle.apply( cur, data ); + if ( event.result === false ) { + event.preventDefault(); + } + } + } + event.type = type; + + // If nobody prevented the default action, do it now + if ( !onlyHandlers && !event.isDefaultPrevented() ) { + + if ( ( !special._default || + special._default.apply( eventPath.pop(), data ) === false ) && + acceptData( elem ) ) { + + // Call a native DOM method on the target with the same name as the event. + // Don't do default actions on window, that's where global variables be (#6170) + if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) { + + // Don't re-trigger an onFOO event when we call its FOO() method + tmp = elem[ ontype ]; + + if ( tmp ) { + elem[ ontype ] = null; + } + + // Prevent re-triggering of the same event, since we already bubbled it above + jQuery.event.triggered = type; + + if ( event.isPropagationStopped() ) { + lastElement.addEventListener( type, stopPropagationCallback ); + } + + elem[ type ](); + + if ( event.isPropagationStopped() ) { + lastElement.removeEventListener( type, stopPropagationCallback ); + } + + jQuery.event.triggered = undefined; + + if ( tmp ) { + elem[ ontype ] = tmp; + } + } + } + } + + return event.result; + }, + + // Piggyback on a donor event to simulate a different one + // Used only for `focus(in | out)` events + simulate: function( type, elem, event ) { + var e = jQuery.extend( + new jQuery.Event(), + event, + { + type: type, + isSimulated: true + } + ); + + jQuery.event.trigger( e, null, elem ); + } + +} ); + +jQuery.fn.extend( { + + trigger: function( type, data ) { + return this.each( function() { + jQuery.event.trigger( type, data, this ); + } ); + }, + triggerHandler: function( type, data ) { + var elem = this[ 0 ]; + if ( elem ) { + return jQuery.event.trigger( type, data, elem, true ); + } + } +} ); + + +// Support: Firefox <=44 +// Firefox doesn't have focus(in | out) events +// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787 +// +// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1 +// focus(in | out) events fire after focus & blur events, +// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order +// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857 +if ( !support.focusin ) { + jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) { + + // Attach a single capturing handler on the document while someone wants focusin/focusout + var handler = function( event ) { + jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) ); + }; + + jQuery.event.special[ fix ] = { + setup: function() { + var doc = this.ownerDocument || this, + attaches = dataPriv.access( doc, fix ); + + if ( !attaches ) { + doc.addEventListener( orig, handler, true ); + } + dataPriv.access( doc, fix, ( attaches || 0 ) + 1 ); + }, + teardown: function() { + var doc = this.ownerDocument || this, + attaches = dataPriv.access( doc, fix ) - 1; + + if ( !attaches ) { + doc.removeEventListener( orig, handler, true ); + dataPriv.remove( doc, fix ); + + } else { + dataPriv.access( doc, fix, attaches ); + } + } + }; + } ); +} +var location = window.location; + +var nonce = Date.now(); + +var rquery = ( /\?/ ); + + + +// Cross-browser xml parsing +jQuery.parseXML = function( data ) { + var xml; + if ( !data || typeof data !== "string" ) { + return null; + } + + // Support: IE 9 - 11 only + // IE throws on parseFromString with invalid input. + try { + xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" ); + } catch ( e ) { + xml = undefined; + } + + if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) { + jQuery.error( "Invalid XML: " + data ); + } + return xml; +}; + + +var + rbracket = /\[\]$/, + rCRLF = /\r?\n/g, + rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i, + rsubmittable = /^(?:input|select|textarea|keygen)/i; + +function buildParams( prefix, obj, traditional, add ) { + var name; + + if ( Array.isArray( obj ) ) { + + // Serialize array item. + jQuery.each( obj, function( i, v ) { + if ( traditional || rbracket.test( prefix ) ) { + + // Treat each array item as a scalar. + add( prefix, v ); + + } else { + + // Item is non-scalar (array or object), encode its numeric index. + buildParams( + prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]", + v, + traditional, + add + ); + } + } ); + + } else if ( !traditional && toType( obj ) === "object" ) { + + // Serialize object item. + for ( name in obj ) { + buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add ); + } + + } else { + + // Serialize scalar item. + add( prefix, obj ); + } +} + +// Serialize an array of form elements or a set of +// key/values into a query string +jQuery.param = function( a, traditional ) { + var prefix, + s = [], + add = function( key, valueOrFunction ) { + + // If value is a function, invoke it and use its return value + var value = isFunction( valueOrFunction ) ? + valueOrFunction() : + valueOrFunction; + + s[ s.length ] = encodeURIComponent( key ) + "=" + + encodeURIComponent( value == null ? "" : value ); + }; + + if ( a == null ) { + return ""; + } + + // If an array was passed in, assume that it is an array of form elements. + if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) { + + // Serialize the form elements + jQuery.each( a, function() { + add( this.name, this.value ); + } ); + + } else { + + // If traditional, encode the "old" way (the way 1.3.2 or older + // did it), otherwise encode params recursively. + for ( prefix in a ) { + buildParams( prefix, a[ prefix ], traditional, add ); + } + } + + // Return the resulting serialization + return s.join( "&" ); +}; + +jQuery.fn.extend( { + serialize: function() { + return jQuery.param( this.serializeArray() ); + }, + serializeArray: function() { + return this.map( function() { + + // Can add propHook for "elements" to filter or add form elements + var elements = jQuery.prop( this, "elements" ); + return elements ? jQuery.makeArray( elements ) : this; + } ) + .filter( function() { + var type = this.type; + + // Use .is( ":disabled" ) so that fieldset[disabled] works + return this.name && !jQuery( this ).is( ":disabled" ) && + rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) && + ( this.checked || !rcheckableType.test( type ) ); + } ) + .map( function( i, elem ) { + var val = jQuery( this ).val(); + + if ( val == null ) { + return null; + } + + if ( Array.isArray( val ) ) { + return jQuery.map( val, function( val ) { + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ); + } + + return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) }; + } ).get(); + } +} ); + + +var + r20 = /%20/g, + rhash = /#.*$/, + rantiCache = /([?&])_=[^&]*/, + rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg, + + // #7653, #8125, #8152: local protocol detection + rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/, + rnoContent = /^(?:GET|HEAD)$/, + rprotocol = /^\/\//, + + /* Prefilters + * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example) + * 2) These are called: + * - BEFORE asking for a transport + * - AFTER param serialization (s.data is a string if s.processData is true) + * 3) key is the dataType + * 4) the catchall symbol "*" can be used + * 5) execution will start with transport dataType and THEN continue down to "*" if needed + */ + prefilters = {}, + + /* Transports bindings + * 1) key is the dataType + * 2) the catchall symbol "*" can be used + * 3) selection will start with transport dataType and THEN go to "*" if needed + */ + transports = {}, + + // Avoid comment-prolog char sequence (#10098); must appease lint and evade compression + allTypes = "*/".concat( "*" ), + + // Anchor tag for parsing the document origin + originAnchor = document.createElement( "a" ); + originAnchor.href = location.href; + +// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport +function addToPrefiltersOrTransports( structure ) { + + // dataTypeExpression is optional and defaults to "*" + return function( dataTypeExpression, func ) { + + if ( typeof dataTypeExpression !== "string" ) { + func = dataTypeExpression; + dataTypeExpression = "*"; + } + + var dataType, + i = 0, + dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || []; + + if ( isFunction( func ) ) { + + // For each dataType in the dataTypeExpression + while ( ( dataType = dataTypes[ i++ ] ) ) { + + // Prepend if requested + if ( dataType[ 0 ] === "+" ) { + dataType = dataType.slice( 1 ) || "*"; + ( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func ); + + // Otherwise append + } else { + ( structure[ dataType ] = structure[ dataType ] || [] ).push( func ); + } + } + } + }; +} + +// Base inspection function for prefilters and transports +function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) { + + var inspected = {}, + seekingTransport = ( structure === transports ); + + function inspect( dataType ) { + var selected; + inspected[ dataType ] = true; + jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) { + var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR ); + if ( typeof dataTypeOrTransport === "string" && + !seekingTransport && !inspected[ dataTypeOrTransport ] ) { + + options.dataTypes.unshift( dataTypeOrTransport ); + inspect( dataTypeOrTransport ); + return false; + } else if ( seekingTransport ) { + return !( selected = dataTypeOrTransport ); + } + } ); + return selected; + } + + return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" ); +} + +// A special extend for ajax options +// that takes "flat" options (not to be deep extended) +// Fixes #9887 +function ajaxExtend( target, src ) { + var key, deep, + flatOptions = jQuery.ajaxSettings.flatOptions || {}; + + for ( key in src ) { + if ( src[ key ] !== undefined ) { + ( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ]; + } + } + if ( deep ) { + jQuery.extend( true, target, deep ); + } + + return target; +} + +/* Handles responses to an ajax request: + * - finds the right dataType (mediates between content-type and expected dataType) + * - returns the corresponding response + */ +function ajaxHandleResponses( s, jqXHR, responses ) { + + var ct, type, finalDataType, firstDataType, + contents = s.contents, + dataTypes = s.dataTypes; + + // Remove auto dataType and get content-type in the process + while ( dataTypes[ 0 ] === "*" ) { + dataTypes.shift(); + if ( ct === undefined ) { + ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" ); + } + } + + // Check if we're dealing with a known content-type + if ( ct ) { + for ( type in contents ) { + if ( contents[ type ] && contents[ type ].test( ct ) ) { + dataTypes.unshift( type ); + break; + } + } + } + + // Check to see if we have a response for the expected dataType + if ( dataTypes[ 0 ] in responses ) { + finalDataType = dataTypes[ 0 ]; + } else { + + // Try convertible dataTypes + for ( type in responses ) { + if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) { + finalDataType = type; + break; + } + if ( !firstDataType ) { + firstDataType = type; + } + } + + // Or just use first one + finalDataType = finalDataType || firstDataType; + } + + // If we found a dataType + // We add the dataType to the list if needed + // and return the corresponding response + if ( finalDataType ) { + if ( finalDataType !== dataTypes[ 0 ] ) { + dataTypes.unshift( finalDataType ); + } + return responses[ finalDataType ]; + } +} + +/* Chain conversions given the request and the original response + * Also sets the responseXXX fields on the jqXHR instance + */ +function ajaxConvert( s, response, jqXHR, isSuccess ) { + var conv2, current, conv, tmp, prev, + converters = {}, + + // Work with a copy of dataTypes in case we need to modify it for conversion + dataTypes = s.dataTypes.slice(); + + // Create converters map with lowercased keys + if ( dataTypes[ 1 ] ) { + for ( conv in s.converters ) { + converters[ conv.toLowerCase() ] = s.converters[ conv ]; + } + } + + current = dataTypes.shift(); + + // Convert to each sequential dataType + while ( current ) { + + if ( s.responseFields[ current ] ) { + jqXHR[ s.responseFields[ current ] ] = response; + } + + // Apply the dataFilter if provided + if ( !prev && isSuccess && s.dataFilter ) { + response = s.dataFilter( response, s.dataType ); + } + + prev = current; + current = dataTypes.shift(); + + if ( current ) { + + // There's only work to do if current dataType is non-auto + if ( current === "*" ) { + + current = prev; + + // Convert response if prev dataType is non-auto and differs from current + } else if ( prev !== "*" && prev !== current ) { + + // Seek a direct converter + conv = converters[ prev + " " + current ] || converters[ "* " + current ]; + + // If none found, seek a pair + if ( !conv ) { + for ( conv2 in converters ) { + + // If conv2 outputs current + tmp = conv2.split( " " ); + if ( tmp[ 1 ] === current ) { + + // If prev can be converted to accepted input + conv = converters[ prev + " " + tmp[ 0 ] ] || + converters[ "* " + tmp[ 0 ] ]; + if ( conv ) { + + // Condense equivalence converters + if ( conv === true ) { + conv = converters[ conv2 ]; + + // Otherwise, insert the intermediate dataType + } else if ( converters[ conv2 ] !== true ) { + current = tmp[ 0 ]; + dataTypes.unshift( tmp[ 1 ] ); + } + break; + } + } + } + } + + // Apply converter (if not an equivalence) + if ( conv !== true ) { + + // Unless errors are allowed to bubble, catch and return them + if ( conv && s.throws ) { + response = conv( response ); + } else { + try { + response = conv( response ); + } catch ( e ) { + return { + state: "parsererror", + error: conv ? e : "No conversion from " + prev + " to " + current + }; + } + } + } + } + } + } + + return { state: "success", data: response }; +} + +jQuery.extend( { + + // Counter for holding the number of active queries + active: 0, + + // Last-Modified header cache for next request + lastModified: {}, + etag: {}, + + ajaxSettings: { + url: location.href, + type: "GET", + isLocal: rlocalProtocol.test( location.protocol ), + global: true, + processData: true, + async: true, + contentType: "application/x-www-form-urlencoded; charset=UTF-8", + + /* + timeout: 0, + data: null, + dataType: null, + username: null, + password: null, + cache: null, + throws: false, + traditional: false, + headers: {}, + */ + + accepts: { + "*": allTypes, + text: "text/plain", + html: "text/html", + xml: "application/xml, text/xml", + json: "application/json, text/javascript" + }, + + contents: { + xml: /\bxml\b/, + html: /\bhtml/, + json: /\bjson\b/ + }, + + responseFields: { + xml: "responseXML", + text: "responseText", + json: "responseJSON" + }, + + // Data converters + // Keys separate source (or catchall "*") and destination types with a single space + converters: { + + // Convert anything to text + "* text": String, + + // Text to html (true = no transformation) + "text html": true, + + // Evaluate text as a json expression + "text json": JSON.parse, + + // Parse text as xml + "text xml": jQuery.parseXML + }, + + // For options that shouldn't be deep extended: + // you can add your own custom options here if + // and when you create one that shouldn't be + // deep extended (see ajaxExtend) + flatOptions: { + url: true, + context: true + } + }, + + // Creates a full fledged settings object into target + // with both ajaxSettings and settings fields. + // If target is omitted, writes into ajaxSettings. + ajaxSetup: function( target, settings ) { + return settings ? + + // Building a settings object + ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) : + + // Extending ajaxSettings + ajaxExtend( jQuery.ajaxSettings, target ); + }, + + ajaxPrefilter: addToPrefiltersOrTransports( prefilters ), + ajaxTransport: addToPrefiltersOrTransports( transports ), + + // Main method + ajax: function( url, options ) { + + // If url is an object, simulate pre-1.5 signature + if ( typeof url === "object" ) { + options = url; + url = undefined; + } + + // Force options to be an object + options = options || {}; + + var transport, + + // URL without anti-cache param + cacheURL, + + // Response headers + responseHeadersString, + responseHeaders, + + // timeout handle + timeoutTimer, + + // Url cleanup var + urlAnchor, + + // Request state (becomes false upon send and true upon completion) + completed, + + // To know if global events are to be dispatched + fireGlobals, + + // Loop variable + i, + + // uncached part of the url + uncached, + + // Create the final options object + s = jQuery.ajaxSetup( {}, options ), + + // Callbacks context + callbackContext = s.context || s, + + // Context for global events is callbackContext if it is a DOM node or jQuery collection + globalEventContext = s.context && + ( callbackContext.nodeType || callbackContext.jquery ) ? + jQuery( callbackContext ) : + jQuery.event, + + // Deferreds + deferred = jQuery.Deferred(), + completeDeferred = jQuery.Callbacks( "once memory" ), + + // Status-dependent callbacks + statusCode = s.statusCode || {}, + + // Headers (they are sent all at once) + requestHeaders = {}, + requestHeadersNames = {}, + + // Default abort message + strAbort = "canceled", + + // Fake xhr + jqXHR = { + readyState: 0, + + // Builds headers hashtable if needed + getResponseHeader: function( key ) { + var match; + if ( completed ) { + if ( !responseHeaders ) { + responseHeaders = {}; + while ( ( match = rheaders.exec( responseHeadersString ) ) ) { + responseHeaders[ match[ 1 ].toLowerCase() + " " ] = + ( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] ) + .concat( match[ 2 ] ); + } + } + match = responseHeaders[ key.toLowerCase() + " " ]; + } + return match == null ? null : match.join( ", " ); + }, + + // Raw string + getAllResponseHeaders: function() { + return completed ? responseHeadersString : null; + }, + + // Caches the header + setRequestHeader: function( name, value ) { + if ( completed == null ) { + name = requestHeadersNames[ name.toLowerCase() ] = + requestHeadersNames[ name.toLowerCase() ] || name; + requestHeaders[ name ] = value; + } + return this; + }, + + // Overrides response content-type header + overrideMimeType: function( type ) { + if ( completed == null ) { + s.mimeType = type; + } + return this; + }, + + // Status-dependent callbacks + statusCode: function( map ) { + var code; + if ( map ) { + if ( completed ) { + + // Execute the appropriate callbacks + jqXHR.always( map[ jqXHR.status ] ); + } else { + + // Lazy-add the new callbacks in a way that preserves old ones + for ( code in map ) { + statusCode[ code ] = [ statusCode[ code ], map[ code ] ]; + } + } + } + return this; + }, + + // Cancel the request + abort: function( statusText ) { + var finalText = statusText || strAbort; + if ( transport ) { + transport.abort( finalText ); + } + done( 0, finalText ); + return this; + } + }; + + // Attach deferreds + deferred.promise( jqXHR ); + + // Add protocol if not provided (prefilters might expect it) + // Handle falsy url in the settings object (#10093: consistency with old signature) + // We also use the url parameter if available + s.url = ( ( url || s.url || location.href ) + "" ) + .replace( rprotocol, location.protocol + "//" ); + + // Alias method option to type as per ticket #12004 + s.type = options.method || options.type || s.method || s.type; + + // Extract dataTypes list + s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ]; + + // A cross-domain request is in order when the origin doesn't match the current origin. + if ( s.crossDomain == null ) { + urlAnchor = document.createElement( "a" ); + + // Support: IE <=8 - 11, Edge 12 - 15 + // IE throws exception on accessing the href property if url is malformed, + // e.g. http://example.com:80x/ + try { + urlAnchor.href = s.url; + + // Support: IE <=8 - 11 only + // Anchor's host property isn't correctly set when s.url is relative + urlAnchor.href = urlAnchor.href; + s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !== + urlAnchor.protocol + "//" + urlAnchor.host; + } catch ( e ) { + + // If there is an error parsing the URL, assume it is crossDomain, + // it can be rejected by the transport if it is invalid + s.crossDomain = true; + } + } + + // Convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) { + s.data = jQuery.param( s.data, s.traditional ); + } + + // Apply prefilters + inspectPrefiltersOrTransports( prefilters, s, options, jqXHR ); + + // If request was aborted inside a prefilter, stop there + if ( completed ) { + return jqXHR; + } + + // We can fire global events as of now if asked to + // Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118) + fireGlobals = jQuery.event && s.global; + + // Watch for a new set of requests + if ( fireGlobals && jQuery.active++ === 0 ) { + jQuery.event.trigger( "ajaxStart" ); + } + + // Uppercase the type + s.type = s.type.toUpperCase(); + + // Determine if request has content + s.hasContent = !rnoContent.test( s.type ); + + // Save the URL in case we're toying with the If-Modified-Since + // and/or If-None-Match header later on + // Remove hash to simplify url manipulation + cacheURL = s.url.replace( rhash, "" ); + + // More options handling for requests with no content + if ( !s.hasContent ) { + + // Remember the hash so we can put it back + uncached = s.url.slice( cacheURL.length ); + + // If data is available and should be processed, append data to url + if ( s.data && ( s.processData || typeof s.data === "string" ) ) { + cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data; + + // #9682: remove data so that it's not used in an eventual retry + delete s.data; + } + + // Add or update anti-cache param if needed + if ( s.cache === false ) { + cacheURL = cacheURL.replace( rantiCache, "$1" ); + uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce++ ) + uncached; + } + + // Put hash and anti-cache on the URL that will be requested (gh-1732) + s.url = cacheURL + uncached; + + // Change '%20' to '+' if this is encoded form body content (gh-2658) + } else if ( s.data && s.processData && + ( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) { + s.data = s.data.replace( r20, "+" ); + } + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + if ( jQuery.lastModified[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] ); + } + if ( jQuery.etag[ cacheURL ] ) { + jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] ); + } + } + + // Set the correct header, if data is being sent + if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) { + jqXHR.setRequestHeader( "Content-Type", s.contentType ); + } + + // Set the Accepts header for the server, depending on the dataType + jqXHR.setRequestHeader( + "Accept", + s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ? + s.accepts[ s.dataTypes[ 0 ] ] + + ( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) : + s.accepts[ "*" ] + ); + + // Check for headers option + for ( i in s.headers ) { + jqXHR.setRequestHeader( i, s.headers[ i ] ); + } + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && + ( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) { + + // Abort if not done already and return + return jqXHR.abort(); + } + + // Aborting is no longer a cancellation + strAbort = "abort"; + + // Install callbacks on deferreds + completeDeferred.add( s.complete ); + jqXHR.done( s.success ); + jqXHR.fail( s.error ); + + // Get transport + transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR ); + + // If no transport, we auto-abort + if ( !transport ) { + done( -1, "No Transport" ); + } else { + jqXHR.readyState = 1; + + // Send global event + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] ); + } + + // If request was aborted inside ajaxSend, stop there + if ( completed ) { + return jqXHR; + } + + // Timeout + if ( s.async && s.timeout > 0 ) { + timeoutTimer = window.setTimeout( function() { + jqXHR.abort( "timeout" ); + }, s.timeout ); + } + + try { + completed = false; + transport.send( requestHeaders, done ); + } catch ( e ) { + + // Rethrow post-completion exceptions + if ( completed ) { + throw e; + } + + // Propagate others as results + done( -1, e ); + } + } + + // Callback for when everything is done + function done( status, nativeStatusText, responses, headers ) { + var isSuccess, success, error, response, modified, + statusText = nativeStatusText; + + // Ignore repeat invocations + if ( completed ) { + return; + } + + completed = true; + + // Clear timeout if it exists + if ( timeoutTimer ) { + window.clearTimeout( timeoutTimer ); + } + + // Dereference transport for early garbage collection + // (no matter how long the jqXHR object will be used) + transport = undefined; + + // Cache response headers + responseHeadersString = headers || ""; + + // Set readyState + jqXHR.readyState = status > 0 ? 4 : 0; + + // Determine if successful + isSuccess = status >= 200 && status < 300 || status === 304; + + // Get response data + if ( responses ) { + response = ajaxHandleResponses( s, jqXHR, responses ); + } + + // Convert no matter what (that way responseXXX fields are always set) + response = ajaxConvert( s, response, jqXHR, isSuccess ); + + // If successful, handle type chaining + if ( isSuccess ) { + + // Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode. + if ( s.ifModified ) { + modified = jqXHR.getResponseHeader( "Last-Modified" ); + if ( modified ) { + jQuery.lastModified[ cacheURL ] = modified; + } + modified = jqXHR.getResponseHeader( "etag" ); + if ( modified ) { + jQuery.etag[ cacheURL ] = modified; + } + } + + // if no content + if ( status === 204 || s.type === "HEAD" ) { + statusText = "nocontent"; + + // if not modified + } else if ( status === 304 ) { + statusText = "notmodified"; + + // If we have data, let's convert it + } else { + statusText = response.state; + success = response.data; + error = response.error; + isSuccess = !error; + } + } else { + + // Extract error from statusText and normalize for non-aborts + error = statusText; + if ( status || !statusText ) { + statusText = "error"; + if ( status < 0 ) { + status = 0; + } + } + } + + // Set data for the fake xhr object + jqXHR.status = status; + jqXHR.statusText = ( nativeStatusText || statusText ) + ""; + + // Success/Error + if ( isSuccess ) { + deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] ); + } else { + deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] ); + } + + // Status-dependent callbacks + jqXHR.statusCode( statusCode ); + statusCode = undefined; + + if ( fireGlobals ) { + globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError", + [ jqXHR, s, isSuccess ? success : error ] ); + } + + // Complete + completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] ); + + if ( fireGlobals ) { + globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] ); + + // Handle the global AJAX counter + if ( !( --jQuery.active ) ) { + jQuery.event.trigger( "ajaxStop" ); + } + } + } + + return jqXHR; + }, + + getJSON: function( url, data, callback ) { + return jQuery.get( url, data, callback, "json" ); + }, + + getScript: function( url, callback ) { + return jQuery.get( url, undefined, callback, "script" ); + } +} ); + +jQuery.each( [ "get", "post" ], function( i, method ) { + jQuery[ method ] = function( url, data, callback, type ) { + + // Shift arguments if data argument was omitted + if ( isFunction( data ) ) { + type = type || callback; + callback = data; + data = undefined; + } + + // The url can be an options object (which then must have .url) + return jQuery.ajax( jQuery.extend( { + url: url, + type: method, + dataType: type, + data: data, + success: callback + }, jQuery.isPlainObject( url ) && url ) ); + }; +} ); + + +jQuery._evalUrl = function( url, options ) { + return jQuery.ajax( { + url: url, + + // Make this explicit, since user can override this through ajaxSetup (#11264) + type: "GET", + dataType: "script", + cache: true, + async: false, + global: false, + + // Only evaluate the response if it is successful (gh-4126) + // dataFilter is not invoked for failure responses, so using it instead + // of the default converter is kludgy but it works. + converters: { + "text script": function() {} + }, + dataFilter: function( response ) { + jQuery.globalEval( response, options ); + } + } ); +}; + + +jQuery.fn.extend( { + wrapAll: function( html ) { + var wrap; + + if ( this[ 0 ] ) { + if ( isFunction( html ) ) { + html = html.call( this[ 0 ] ); + } + + // The elements to wrap the target around + wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true ); + + if ( this[ 0 ].parentNode ) { + wrap.insertBefore( this[ 0 ] ); + } + + wrap.map( function() { + var elem = this; + + while ( elem.firstElementChild ) { + elem = elem.firstElementChild; + } + + return elem; + } ).append( this ); + } + + return this; + }, + + wrapInner: function( html ) { + if ( isFunction( html ) ) { + return this.each( function( i ) { + jQuery( this ).wrapInner( html.call( this, i ) ); + } ); + } + + return this.each( function() { + var self = jQuery( this ), + contents = self.contents(); + + if ( contents.length ) { + contents.wrapAll( html ); + + } else { + self.append( html ); + } + } ); + }, + + wrap: function( html ) { + var htmlIsFunction = isFunction( html ); + + return this.each( function( i ) { + jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html ); + } ); + }, + + unwrap: function( selector ) { + this.parent( selector ).not( "body" ).each( function() { + jQuery( this ).replaceWith( this.childNodes ); + } ); + return this; + } +} ); + + +jQuery.expr.pseudos.hidden = function( elem ) { + return !jQuery.expr.pseudos.visible( elem ); +}; +jQuery.expr.pseudos.visible = function( elem ) { + return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length ); +}; + + + + +jQuery.ajaxSettings.xhr = function() { + try { + return new window.XMLHttpRequest(); + } catch ( e ) {} +}; + +var xhrSuccessStatus = { + + // File protocol always yields status code 0, assume 200 + 0: 200, + + // Support: IE <=9 only + // #1450: sometimes IE returns 1223 when it should be 204 + 1223: 204 + }, + xhrSupported = jQuery.ajaxSettings.xhr(); + +support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported ); +support.ajax = xhrSupported = !!xhrSupported; + +jQuery.ajaxTransport( function( options ) { + var callback, errorCallback; + + // Cross domain only allowed if supported through XMLHttpRequest + if ( support.cors || xhrSupported && !options.crossDomain ) { + return { + send: function( headers, complete ) { + var i, + xhr = options.xhr(); + + xhr.open( + options.type, + options.url, + options.async, + options.username, + options.password + ); + + // Apply custom fields if provided + if ( options.xhrFields ) { + for ( i in options.xhrFields ) { + xhr[ i ] = options.xhrFields[ i ]; + } + } + + // Override mime type if needed + if ( options.mimeType && xhr.overrideMimeType ) { + xhr.overrideMimeType( options.mimeType ); + } + + // X-Requested-With header + // For cross-domain requests, seeing as conditions for a preflight are + // akin to a jigsaw puzzle, we simply never set it to be sure. + // (it can always be set on a per-request basis or even using ajaxSetup) + // For same-domain requests, won't change header if already provided. + if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) { + headers[ "X-Requested-With" ] = "XMLHttpRequest"; + } + + // Set headers + for ( i in headers ) { + xhr.setRequestHeader( i, headers[ i ] ); + } + + // Callback + callback = function( type ) { + return function() { + if ( callback ) { + callback = errorCallback = xhr.onload = + xhr.onerror = xhr.onabort = xhr.ontimeout = + xhr.onreadystatechange = null; + + if ( type === "abort" ) { + xhr.abort(); + } else if ( type === "error" ) { + + // Support: IE <=9 only + // On a manual native abort, IE9 throws + // errors on any property access that is not readyState + if ( typeof xhr.status !== "number" ) { + complete( 0, "error" ); + } else { + complete( + + // File: protocol always yields status 0; see #8605, #14207 + xhr.status, + xhr.statusText + ); + } + } else { + complete( + xhrSuccessStatus[ xhr.status ] || xhr.status, + xhr.statusText, + + // Support: IE <=9 only + // IE9 has no XHR2 but throws on binary (trac-11426) + // For XHR2 non-text, let the caller handle it (gh-2498) + ( xhr.responseType || "text" ) !== "text" || + typeof xhr.responseText !== "string" ? + { binary: xhr.response } : + { text: xhr.responseText }, + xhr.getAllResponseHeaders() + ); + } + } + }; + }; + + // Listen to events + xhr.onload = callback(); + errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" ); + + // Support: IE 9 only + // Use onreadystatechange to replace onabort + // to handle uncaught aborts + if ( xhr.onabort !== undefined ) { + xhr.onabort = errorCallback; + } else { + xhr.onreadystatechange = function() { + + // Check readyState before timeout as it changes + if ( xhr.readyState === 4 ) { + + // Allow onerror to be called first, + // but that will not handle a native abort + // Also, save errorCallback to a variable + // as xhr.onerror cannot be accessed + window.setTimeout( function() { + if ( callback ) { + errorCallback(); + } + } ); + } + }; + } + + // Create the abort callback + callback = callback( "abort" ); + + try { + + // Do send the request (this may raise an exception) + xhr.send( options.hasContent && options.data || null ); + } catch ( e ) { + + // #14683: Only rethrow if this hasn't been notified as an error yet + if ( callback ) { + throw e; + } + } + }, + + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432) +jQuery.ajaxPrefilter( function( s ) { + if ( s.crossDomain ) { + s.contents.script = false; + } +} ); + +// Install script dataType +jQuery.ajaxSetup( { + accepts: { + script: "text/javascript, application/javascript, " + + "application/ecmascript, application/x-ecmascript" + }, + contents: { + script: /\b(?:java|ecma)script\b/ + }, + converters: { + "text script": function( text ) { + jQuery.globalEval( text ); + return text; + } + } +} ); + +// Handle cache's special case and crossDomain +jQuery.ajaxPrefilter( "script", function( s ) { + if ( s.cache === undefined ) { + s.cache = false; + } + if ( s.crossDomain ) { + s.type = "GET"; + } +} ); + +// Bind script tag hack transport +jQuery.ajaxTransport( "script", function( s ) { + + // This transport only deals with cross domain or forced-by-attrs requests + if ( s.crossDomain || s.scriptAttrs ) { + var script, callback; + return { + send: function( _, complete ) { + script = jQuery( "<script>" ) + .attr( s.scriptAttrs || {} ) + .prop( { charset: s.scriptCharset, src: s.url } ) + .on( "load error", callback = function( evt ) { + script.remove(); + callback = null; + if ( evt ) { + complete( evt.type === "error" ? 404 : 200, evt.type ); + } + } ); + + // Use native DOM manipulation to avoid our domManip AJAX trickery + document.head.appendChild( script[ 0 ] ); + }, + abort: function() { + if ( callback ) { + callback(); + } + } + }; + } +} ); + + + + +var oldCallbacks = [], + rjsonp = /(=)\?(?=&|$)|\?\?/; + +// Default jsonp settings +jQuery.ajaxSetup( { + jsonp: "callback", + jsonpCallback: function() { + var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce++ ) ); + this[ callback ] = true; + return callback; + } +} ); + +// Detect, normalize options and install callbacks for jsonp requests +jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) { + + var callbackName, overwritten, responseContainer, + jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ? + "url" : + typeof s.data === "string" && + ( s.contentType || "" ) + .indexOf( "application/x-www-form-urlencoded" ) === 0 && + rjsonp.test( s.data ) && "data" + ); + + // Handle iff the expected data type is "jsonp" or we have a parameter to set + if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) { + + // Get callback name, remembering preexisting value associated with it + callbackName = s.jsonpCallback = isFunction( s.jsonpCallback ) ? + s.jsonpCallback() : + s.jsonpCallback; + + // Insert callback into url or form data + if ( jsonProp ) { + s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName ); + } else if ( s.jsonp !== false ) { + s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName; + } + + // Use data converter to retrieve json after script execution + s.converters[ "script json" ] = function() { + if ( !responseContainer ) { + jQuery.error( callbackName + " was not called" ); + } + return responseContainer[ 0 ]; + }; + + // Force json dataType + s.dataTypes[ 0 ] = "json"; + + // Install callback + overwritten = window[ callbackName ]; + window[ callbackName ] = function() { + responseContainer = arguments; + }; + + // Clean-up function (fires after converters) + jqXHR.always( function() { + + // If previous value didn't exist - remove it + if ( overwritten === undefined ) { + jQuery( window ).removeProp( callbackName ); + + // Otherwise restore preexisting value + } else { + window[ callbackName ] = overwritten; + } + + // Save back as free + if ( s[ callbackName ] ) { + + // Make sure that re-using the options doesn't screw things around + s.jsonpCallback = originalSettings.jsonpCallback; + + // Save the callback name for future use + oldCallbacks.push( callbackName ); + } + + // Call if it was a function and we have a response + if ( responseContainer && isFunction( overwritten ) ) { + overwritten( responseContainer[ 0 ] ); + } + + responseContainer = overwritten = undefined; + } ); + + // Delegate to script + return "script"; + } +} ); + + + + +// Support: Safari 8 only +// In Safari 8 documents created via document.implementation.createHTMLDocument +// collapse sibling forms: the second one becomes a child of the first one. +// Because of that, this security measure has to be disabled in Safari 8. +// https://bugs.webkit.org/show_bug.cgi?id=137337 +support.createHTMLDocument = ( function() { + var body = document.implementation.createHTMLDocument( "" ).body; + body.innerHTML = "<form></form><form></form>"; + return body.childNodes.length === 2; +} )(); + + +// Argument "data" should be string of html +// context (optional): If specified, the fragment will be created in this context, +// defaults to document +// keepScripts (optional): If true, will include scripts passed in the html string +jQuery.parseHTML = function( data, context, keepScripts ) { + if ( typeof data !== "string" ) { + return []; + } + if ( typeof context === "boolean" ) { + keepScripts = context; + context = false; + } + + var base, parsed, scripts; + + if ( !context ) { + + // Stop scripts or inline event handlers from being executed immediately + // by using document.implementation + if ( support.createHTMLDocument ) { + context = document.implementation.createHTMLDocument( "" ); + + // Set the base href for the created document + // so any parsed elements with URLs + // are based on the document's URL (gh-2965) + base = context.createElement( "base" ); + base.href = document.location.href; + context.head.appendChild( base ); + } else { + context = document; + } + } + + parsed = rsingleTag.exec( data ); + scripts = !keepScripts && []; + + // Single tag + if ( parsed ) { + return [ context.createElement( parsed[ 1 ] ) ]; + } + + parsed = buildFragment( [ data ], context, scripts ); + + if ( scripts && scripts.length ) { + jQuery( scripts ).remove(); + } + + return jQuery.merge( [], parsed.childNodes ); +}; + + +/** + * Load a url into a page + */ +jQuery.fn.load = function( url, params, callback ) { + var selector, type, response, + self = this, + off = url.indexOf( " " ); + + if ( off > -1 ) { + selector = stripAndCollapse( url.slice( off ) ); + url = url.slice( 0, off ); + } + + // If it's a function + if ( isFunction( params ) ) { + + // We assume that it's the callback + callback = params; + params = undefined; + + // Otherwise, build a param string + } else if ( params && typeof params === "object" ) { + type = "POST"; + } + + // If we have elements to modify, make the request + if ( self.length > 0 ) { + jQuery.ajax( { + url: url, + + // If "type" variable is undefined, then "GET" method will be used. + // Make value of this field explicit since + // user can override it through ajaxSetup method + type: type || "GET", + dataType: "html", + data: params + } ).done( function( responseText ) { + + // Save response for use in complete callback + response = arguments; + + self.html( selector ? + + // If a selector was specified, locate the right elements in a dummy div + // Exclude scripts to avoid IE 'Permission Denied' errors + jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) : + + // Otherwise use the full result + responseText ); + + // If the request succeeds, this function gets "data", "status", "jqXHR" + // but they are ignored because response was set above. + // If it fails, this function gets "jqXHR", "status", "error" + } ).always( callback && function( jqXHR, status ) { + self.each( function() { + callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] ); + } ); + } ); + } + + return this; +}; + + + + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( [ + "ajaxStart", + "ajaxStop", + "ajaxComplete", + "ajaxError", + "ajaxSuccess", + "ajaxSend" +], function( i, type ) { + jQuery.fn[ type ] = function( fn ) { + return this.on( type, fn ); + }; +} ); + + + + +jQuery.expr.pseudos.animated = function( elem ) { + return jQuery.grep( jQuery.timers, function( fn ) { + return elem === fn.elem; + } ).length; +}; + + + + +jQuery.offset = { + setOffset: function( elem, options, i ) { + var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition, + position = jQuery.css( elem, "position" ), + curElem = jQuery( elem ), + props = {}; + + // Set position first, in-case top/left are set even on static elem + if ( position === "static" ) { + elem.style.position = "relative"; + } + + curOffset = curElem.offset(); + curCSSTop = jQuery.css( elem, "top" ); + curCSSLeft = jQuery.css( elem, "left" ); + calculatePosition = ( position === "absolute" || position === "fixed" ) && + ( curCSSTop + curCSSLeft ).indexOf( "auto" ) > -1; + + // Need to be able to calculate position if either + // top or left is auto and position is either absolute or fixed + if ( calculatePosition ) { + curPosition = curElem.position(); + curTop = curPosition.top; + curLeft = curPosition.left; + + } else { + curTop = parseFloat( curCSSTop ) || 0; + curLeft = parseFloat( curCSSLeft ) || 0; + } + + if ( isFunction( options ) ) { + + // Use jQuery.extend here to allow modification of coordinates argument (gh-1848) + options = options.call( elem, i, jQuery.extend( {}, curOffset ) ); + } + + if ( options.top != null ) { + props.top = ( options.top - curOffset.top ) + curTop; + } + if ( options.left != null ) { + props.left = ( options.left - curOffset.left ) + curLeft; + } + + if ( "using" in options ) { + options.using.call( elem, props ); + + } else { + curElem.css( props ); + } + } +}; + +jQuery.fn.extend( { + + // offset() relates an element's border box to the document origin + offset: function( options ) { + + // Preserve chaining for setter + if ( arguments.length ) { + return options === undefined ? + this : + this.each( function( i ) { + jQuery.offset.setOffset( this, options, i ); + } ); + } + + var rect, win, + elem = this[ 0 ]; + + if ( !elem ) { + return; + } + + // Return zeros for disconnected and hidden (display: none) elements (gh-2310) + // Support: IE <=11 only + // Running getBoundingClientRect on a + // disconnected node in IE throws an error + if ( !elem.getClientRects().length ) { + return { top: 0, left: 0 }; + } + + // Get document-relative position by adding viewport scroll to viewport-relative gBCR + rect = elem.getBoundingClientRect(); + win = elem.ownerDocument.defaultView; + return { + top: rect.top + win.pageYOffset, + left: rect.left + win.pageXOffset + }; + }, + + // position() relates an element's margin box to its offset parent's padding box + // This corresponds to the behavior of CSS absolute positioning + position: function() { + if ( !this[ 0 ] ) { + return; + } + + var offsetParent, offset, doc, + elem = this[ 0 ], + parentOffset = { top: 0, left: 0 }; + + // position:fixed elements are offset from the viewport, which itself always has zero offset + if ( jQuery.css( elem, "position" ) === "fixed" ) { + + // Assume position:fixed implies availability of getBoundingClientRect + offset = elem.getBoundingClientRect(); + + } else { + offset = this.offset(); + + // Account for the *real* offset parent, which can be the document or its root element + // when a statically positioned element is identified + doc = elem.ownerDocument; + offsetParent = elem.offsetParent || doc.documentElement; + while ( offsetParent && + ( offsetParent === doc.body || offsetParent === doc.documentElement ) && + jQuery.css( offsetParent, "position" ) === "static" ) { + + offsetParent = offsetParent.parentNode; + } + if ( offsetParent && offsetParent !== elem && offsetParent.nodeType === 1 ) { + + // Incorporate borders into its offset, since they are outside its content origin + parentOffset = jQuery( offsetParent ).offset(); + parentOffset.top += jQuery.css( offsetParent, "borderTopWidth", true ); + parentOffset.left += jQuery.css( offsetParent, "borderLeftWidth", true ); + } + } + + // Subtract parent offsets and element margins + return { + top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ), + left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true ) + }; + }, + + // This method will return documentElement in the following cases: + // 1) For the element inside the iframe without offsetParent, this method will return + // documentElement of the parent window + // 2) For the hidden or detached element + // 3) For body or html element, i.e. in case of the html node - it will return itself + // + // but those exceptions were never presented as a real life use-cases + // and might be considered as more preferable results. + // + // This logic, however, is not guaranteed and can change at any point in the future + offsetParent: function() { + return this.map( function() { + var offsetParent = this.offsetParent; + + while ( offsetParent && jQuery.css( offsetParent, "position" ) === "static" ) { + offsetParent = offsetParent.offsetParent; + } + + return offsetParent || documentElement; + } ); + } +} ); + +// Create scrollLeft and scrollTop methods +jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) { + var top = "pageYOffset" === prop; + + jQuery.fn[ method ] = function( val ) { + return access( this, function( elem, method, val ) { + + // Coalesce documents and windows + var win; + if ( isWindow( elem ) ) { + win = elem; + } else if ( elem.nodeType === 9 ) { + win = elem.defaultView; + } + + if ( val === undefined ) { + return win ? win[ prop ] : elem[ method ]; + } + + if ( win ) { + win.scrollTo( + !top ? val : win.pageXOffset, + top ? val : win.pageYOffset + ); + + } else { + elem[ method ] = val; + } + }, method, val, arguments.length ); + }; +} ); + +// Support: Safari <=7 - 9.1, Chrome <=37 - 49 +// Add the top/left cssHooks using jQuery.fn.position +// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084 +// Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347 +// getComputedStyle returns percent when specified for top/left/bottom/right; +// rather than make the css module depend on the offset module, just check for it here +jQuery.each( [ "top", "left" ], function( i, prop ) { + jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition, + function( elem, computed ) { + if ( computed ) { + computed = curCSS( elem, prop ); + + // If curCSS returns percentage, fallback to offset + return rnumnonpx.test( computed ) ? + jQuery( elem ).position()[ prop ] + "px" : + computed; + } + } + ); +} ); + + +// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods +jQuery.each( { Height: "height", Width: "width" }, function( name, type ) { + jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name }, + function( defaultExtra, funcName ) { + + // Margin is only for outerHeight, outerWidth + jQuery.fn[ funcName ] = function( margin, value ) { + var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ), + extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" ); + + return access( this, function( elem, type, value ) { + var doc; + + if ( isWindow( elem ) ) { + + // $( window ).outerWidth/Height return w/h including scrollbars (gh-1729) + return funcName.indexOf( "outer" ) === 0 ? + elem[ "inner" + name ] : + elem.document.documentElement[ "client" + name ]; + } + + // Get document width or height + if ( elem.nodeType === 9 ) { + doc = elem.documentElement; + + // Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height], + // whichever is greatest + return Math.max( + elem.body[ "scroll" + name ], doc[ "scroll" + name ], + elem.body[ "offset" + name ], doc[ "offset" + name ], + doc[ "client" + name ] + ); + } + + return value === undefined ? + + // Get width or height on the element, requesting but not forcing parseFloat + jQuery.css( elem, type, extra ) : + + // Set width or height on the element + jQuery.style( elem, type, value, extra ); + }, type, chainable ? margin : undefined, chainable ); + }; + } ); +} ); + + +jQuery.each( ( "blur focus focusin focusout resize scroll click dblclick " + + "mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " + + "change select submit keydown keypress keyup contextmenu" ).split( " " ), + function( i, name ) { + + // Handle event binding + jQuery.fn[ name ] = function( data, fn ) { + return arguments.length > 0 ? + this.on( name, null, data, fn ) : + this.trigger( name ); + }; +} ); + +jQuery.fn.extend( { + hover: function( fnOver, fnOut ) { + return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver ); + } +} ); + + + + +jQuery.fn.extend( { + + bind: function( types, data, fn ) { + return this.on( types, null, data, fn ); + }, + unbind: function( types, fn ) { + return this.off( types, null, fn ); + }, + + delegate: function( selector, types, data, fn ) { + return this.on( types, selector, data, fn ); + }, + undelegate: function( selector, types, fn ) { + + // ( namespace ) or ( selector, types [, fn] ) + return arguments.length === 1 ? + this.off( selector, "**" ) : + this.off( types, selector || "**", fn ); + } +} ); + +// Bind a function to a context, optionally partially applying any +// arguments. +// jQuery.proxy is deprecated to promote standards (specifically Function#bind) +// However, it is not slated for removal any time soon +jQuery.proxy = function( fn, context ) { + var tmp, args, proxy; + + if ( typeof context === "string" ) { + tmp = fn[ context ]; + context = fn; + fn = tmp; + } + + // Quick check to determine if target is callable, in the spec + // this throws a TypeError, but we will just return undefined. + if ( !isFunction( fn ) ) { + return undefined; + } + + // Simulated bind + args = slice.call( arguments, 2 ); + proxy = function() { + return fn.apply( context || this, args.concat( slice.call( arguments ) ) ); + }; + + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || jQuery.guid++; + + return proxy; +}; + +jQuery.holdReady = function( hold ) { + if ( hold ) { + jQuery.readyWait++; + } else { + jQuery.ready( true ); + } +}; +jQuery.isArray = Array.isArray; +jQuery.parseJSON = JSON.parse; +jQuery.nodeName = nodeName; +jQuery.isFunction = isFunction; +jQuery.isWindow = isWindow; +jQuery.camelCase = camelCase; +jQuery.type = toType; + +jQuery.now = Date.now; + +jQuery.isNumeric = function( obj ) { + + // As of jQuery 3.0, isNumeric is limited to + // strings and numbers (primitives or objects) + // that can be coerced to finite numbers (gh-2662) + var type = jQuery.type( obj ); + return ( type === "number" || type === "string" ) && + + // parseFloat NaNs numeric-cast false positives ("") + // ...but misinterprets leading-number strings, particularly hex literals ("0x...") + // subtraction forces infinities to NaN + !isNaN( obj - parseFloat( obj ) ); +}; + + + + +// Register as a named AMD module, since jQuery can be concatenated with other +// files that may use define, but not via a proper concatenation script that +// understands anonymous AMD modules. A named AMD is safest and most robust +// way to register. Lowercase jquery is used because AMD module names are +// derived from file names, and jQuery is normally delivered in a lowercase +// file name. Do this after creating the global so that if an AMD module wants +// to call noConflict to hide this version of jQuery, it will work. + +// Note that for maximum portability, libraries that are not jQuery should +// declare themselves as anonymous modules, and avoid setting a global if an +// AMD loader is present. jQuery is a special case. For more information, see +// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon + +if ( typeof define === "function" && define.amd ) { + define( "jquery", [], function() { + return jQuery; + } ); +} + + + + +var + + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + + // Map over the $ in case of overwrite + _$ = window.$; + +jQuery.noConflict = function( deep ) { + if ( window.$ === jQuery ) { + window.$ = _$; + } + + if ( deep && window.jQuery === jQuery ) { + window.jQuery = _jQuery; + } + + return jQuery; +}; + +// Expose jQuery and $ identifiers, even in AMD +// (#7102#comment:10, https://github.com/jquery/jquery/pull/557) +// and CommonJS for browser emulators (#13566) +if ( !noGlobal ) { + window.jQuery = window.$ = jQuery; +} + + + + +return jQuery; +} ); diff --git a/docs/build/html/_static/jquery.js b/docs/build/html/_static/jquery.js new file mode 100644 index 0000000000000000000000000000000000000000..a1c07fd803b5fc9c54f44e31123ae4fa11e134b0 --- /dev/null +++ b/docs/build/html/_static/jquery.js @@ -0,0 +1,2 @@ +/*! jQuery v3.4.1 | (c) JS Foundation and other contributors | jquery.org/license */ +!function(e,t){"use strict";"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(C,e){"use strict";var t=[],E=C.document,r=Object.getPrototypeOf,s=t.slice,g=t.concat,u=t.push,i=t.indexOf,n={},o=n.toString,v=n.hasOwnProperty,a=v.toString,l=a.call(Object),y={},m=function(e){return"function"==typeof e&&"number"!=typeof e.nodeType},x=function(e){return null!=e&&e===e.window},c={type:!0,src:!0,nonce:!0,noModule:!0};function b(e,t,n){var r,i,o=(n=n||E).createElement("script");if(o.text=e,t)for(r in c)(i=t[r]||t.getAttribute&&t.getAttribute(r))&&o.setAttribute(r,i);n.head.appendChild(o).parentNode.removeChild(o)}function w(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[o.call(e)]||"object":typeof e}var f="3.4.1",k=function(e,t){return new k.fn.init(e,t)},p=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;function d(e){var t=!!e&&"length"in e&&e.length,n=w(e);return!m(e)&&!x(e)&&("array"===n||0===t||"number"==typeof t&&0<t&&t-1 in e)}k.fn=k.prototype={jquery:f,constructor:k,length:0,toArray:function(){return s.call(this)},get:function(e){return null==e?s.call(this):e<0?this[e+this.length]:this[e]},pushStack:function(e){var t=k.merge(this.constructor(),e);return t.prevObject=this,t},each:function(e){return k.each(this,e)},map:function(n){return this.pushStack(k.map(this,function(e,t){return n.call(e,t,e)}))},slice:function(){return this.pushStack(s.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(e){var t=this.length,n=+e+(e<0?t:0);return this.pushStack(0<=n&&n<t?[this[n]]:[])},end:function(){return this.prevObject||this.constructor()},push:u,sort:t.sort,splice:t.splice},k.extend=k.fn.extend=function(){var e,t,n,r,i,o,a=arguments[0]||{},s=1,u=arguments.length,l=!1;for("boolean"==typeof a&&(l=a,a=arguments[s]||{},s++),"object"==typeof a||m(a)||(a={}),s===u&&(a=this,s--);s<u;s++)if(null!=(e=arguments[s]))for(t in e)r=e[t],"__proto__"!==t&&a!==r&&(l&&r&&(k.isPlainObject(r)||(i=Array.isArray(r)))?(n=a[t],o=i&&!Array.isArray(n)?[]:i||k.isPlainObject(n)?n:{},i=!1,a[t]=k.extend(l,o,r)):void 0!==r&&(a[t]=r));return a},k.extend({expando:"jQuery"+(f+Math.random()).replace(/\D/g,""),isReady:!0,error:function(e){throw new Error(e)},noop:function(){},isPlainObject:function(e){var t,n;return!(!e||"[object Object]"!==o.call(e))&&(!(t=r(e))||"function"==typeof(n=v.call(t,"constructor")&&t.constructor)&&a.call(n)===l)},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},globalEval:function(e,t){b(e,{nonce:t&&t.nonce})},each:function(e,t){var n,r=0;if(d(e)){for(n=e.length;r<n;r++)if(!1===t.call(e[r],r,e[r]))break}else for(r in e)if(!1===t.call(e[r],r,e[r]))break;return e},trim:function(e){return null==e?"":(e+"").replace(p,"")},makeArray:function(e,t){var n=t||[];return null!=e&&(d(Object(e))?k.merge(n,"string"==typeof e?[e]:e):u.call(n,e)),n},inArray:function(e,t,n){return null==t?-1:i.call(t,e,n)},merge:function(e,t){for(var n=+t.length,r=0,i=e.length;r<n;r++)e[i++]=t[r];return e.length=i,e},grep:function(e,t,n){for(var r=[],i=0,o=e.length,a=!n;i<o;i++)!t(e[i],i)!==a&&r.push(e[i]);return r},map:function(e,t,n){var r,i,o=0,a=[];if(d(e))for(r=e.length;o<r;o++)null!=(i=t(e[o],o,n))&&a.push(i);else for(o in e)null!=(i=t(e[o],o,n))&&a.push(i);return g.apply([],a)},guid:1,support:y}),"function"==typeof Symbol&&(k.fn[Symbol.iterator]=t[Symbol.iterator]),k.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){n["[object "+t+"]"]=t.toLowerCase()});var h=function(n){var e,d,b,o,i,h,f,g,w,u,l,T,C,a,E,v,s,c,y,k="sizzle"+1*new Date,m=n.document,S=0,r=0,p=ue(),x=ue(),N=ue(),A=ue(),D=function(e,t){return e===t&&(l=!0),0},j={}.hasOwnProperty,t=[],q=t.pop,L=t.push,H=t.push,O=t.slice,P=function(e,t){for(var n=0,r=e.length;n<r;n++)if(e[n]===t)return n;return-1},R="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",M="[\\x20\\t\\r\\n\\f]",I="(?:\\\\.|[\\w-]|[^\0-\\xa0])+",W="\\["+M+"*("+I+")(?:"+M+"*([*^$|!~]?=)"+M+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+I+"))|)"+M+"*\\]",$=":("+I+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+W+")*)|.*)\\)|)",F=new RegExp(M+"+","g"),B=new RegExp("^"+M+"+|((?:^|[^\\\\])(?:\\\\.)*)"+M+"+$","g"),_=new RegExp("^"+M+"*,"+M+"*"),z=new RegExp("^"+M+"*([>+~]|"+M+")"+M+"*"),U=new RegExp(M+"|>"),X=new RegExp($),V=new RegExp("^"+I+"$"),G={ID:new RegExp("^#("+I+")"),CLASS:new RegExp("^\\.("+I+")"),TAG:new RegExp("^("+I+"|[*])"),ATTR:new RegExp("^"+W),PSEUDO:new RegExp("^"+$),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+M+"*(even|odd|(([+-]|)(\\d*)n|)"+M+"*(?:([+-]|)"+M+"*(\\d+)|))"+M+"*\\)|)","i"),bool:new RegExp("^(?:"+R+")$","i"),needsContext:new RegExp("^"+M+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+M+"*((?:-\\d)?\\d*)"+M+"*\\)|)(?=[^-]|$)","i")},Y=/HTML$/i,Q=/^(?:input|select|textarea|button)$/i,J=/^h\d$/i,K=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,ee=/[+~]/,te=new RegExp("\\\\([\\da-f]{1,6}"+M+"?|("+M+")|.)","ig"),ne=function(e,t,n){var r="0x"+t-65536;return r!=r||n?t:r<0?String.fromCharCode(r+65536):String.fromCharCode(r>>10|55296,1023&r|56320)},re=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ie=function(e,t){return t?"\0"===e?"\ufffd":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e},oe=function(){T()},ae=be(function(e){return!0===e.disabled&&"fieldset"===e.nodeName.toLowerCase()},{dir:"parentNode",next:"legend"});try{H.apply(t=O.call(m.childNodes),m.childNodes),t[m.childNodes.length].nodeType}catch(e){H={apply:t.length?function(e,t){L.apply(e,O.call(t))}:function(e,t){var n=e.length,r=0;while(e[n++]=t[r++]);e.length=n-1}}}function se(t,e,n,r){var i,o,a,s,u,l,c,f=e&&e.ownerDocument,p=e?e.nodeType:9;if(n=n||[],"string"!=typeof t||!t||1!==p&&9!==p&&11!==p)return n;if(!r&&((e?e.ownerDocument||e:m)!==C&&T(e),e=e||C,E)){if(11!==p&&(u=Z.exec(t)))if(i=u[1]){if(9===p){if(!(a=e.getElementById(i)))return n;if(a.id===i)return n.push(a),n}else if(f&&(a=f.getElementById(i))&&y(e,a)&&a.id===i)return n.push(a),n}else{if(u[2])return H.apply(n,e.getElementsByTagName(t)),n;if((i=u[3])&&d.getElementsByClassName&&e.getElementsByClassName)return H.apply(n,e.getElementsByClassName(i)),n}if(d.qsa&&!A[t+" "]&&(!v||!v.test(t))&&(1!==p||"object"!==e.nodeName.toLowerCase())){if(c=t,f=e,1===p&&U.test(t)){(s=e.getAttribute("id"))?s=s.replace(re,ie):e.setAttribute("id",s=k),o=(l=h(t)).length;while(o--)l[o]="#"+s+" "+xe(l[o]);c=l.join(","),f=ee.test(t)&&ye(e.parentNode)||e}try{return H.apply(n,f.querySelectorAll(c)),n}catch(e){A(t,!0)}finally{s===k&&e.removeAttribute("id")}}}return g(t.replace(B,"$1"),e,n,r)}function ue(){var r=[];return function e(t,n){return r.push(t+" ")>b.cacheLength&&delete e[r.shift()],e[t+" "]=n}}function le(e){return e[k]=!0,e}function ce(e){var t=C.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function fe(e,t){var n=e.split("|"),r=n.length;while(r--)b.attrHandle[n[r]]=t}function pe(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&e.sourceIndex-t.sourceIndex;if(r)return r;if(n)while(n=n.nextSibling)if(n===t)return-1;return e?1:-1}function de(t){return function(e){return"input"===e.nodeName.toLowerCase()&&e.type===t}}function he(n){return function(e){var t=e.nodeName.toLowerCase();return("input"===t||"button"===t)&&e.type===n}}function ge(t){return function(e){return"form"in e?e.parentNode&&!1===e.disabled?"label"in e?"label"in e.parentNode?e.parentNode.disabled===t:e.disabled===t:e.isDisabled===t||e.isDisabled!==!t&&ae(e)===t:e.disabled===t:"label"in e&&e.disabled===t}}function ve(a){return le(function(o){return o=+o,le(function(e,t){var n,r=a([],e.length,o),i=r.length;while(i--)e[n=r[i]]&&(e[n]=!(t[n]=e[n]))})})}function ye(e){return e&&"undefined"!=typeof e.getElementsByTagName&&e}for(e in d=se.support={},i=se.isXML=function(e){var t=e.namespaceURI,n=(e.ownerDocument||e).documentElement;return!Y.test(t||n&&n.nodeName||"HTML")},T=se.setDocument=function(e){var t,n,r=e?e.ownerDocument||e:m;return r!==C&&9===r.nodeType&&r.documentElement&&(a=(C=r).documentElement,E=!i(C),m!==C&&(n=C.defaultView)&&n.top!==n&&(n.addEventListener?n.addEventListener("unload",oe,!1):n.attachEvent&&n.attachEvent("onunload",oe)),d.attributes=ce(function(e){return e.className="i",!e.getAttribute("className")}),d.getElementsByTagName=ce(function(e){return e.appendChild(C.createComment("")),!e.getElementsByTagName("*").length}),d.getElementsByClassName=K.test(C.getElementsByClassName),d.getById=ce(function(e){return a.appendChild(e).id=k,!C.getElementsByName||!C.getElementsByName(k).length}),d.getById?(b.filter.ID=function(e){var t=e.replace(te,ne);return function(e){return e.getAttribute("id")===t}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n=t.getElementById(e);return n?[n]:[]}}):(b.filter.ID=function(e){var n=e.replace(te,ne);return function(e){var t="undefined"!=typeof e.getAttributeNode&&e.getAttributeNode("id");return t&&t.value===n}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];i=t.getElementsByName(e),r=0;while(o=i[r++])if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),b.find.TAG=d.getElementsByTagName?function(e,t){return"undefined"!=typeof t.getElementsByTagName?t.getElementsByTagName(e):d.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){while(n=o[i++])1===n.nodeType&&r.push(n);return r}return o},b.find.CLASS=d.getElementsByClassName&&function(e,t){if("undefined"!=typeof t.getElementsByClassName&&E)return t.getElementsByClassName(e)},s=[],v=[],(d.qsa=K.test(C.querySelectorAll))&&(ce(function(e){a.appendChild(e).innerHTML="<a id='"+k+"'></a><select id='"+k+"-\r\\' msallowcapture=''><option selected=''></option></select>",e.querySelectorAll("[msallowcapture^='']").length&&v.push("[*^$]="+M+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||v.push("\\["+M+"*(?:value|"+R+")"),e.querySelectorAll("[id~="+k+"-]").length||v.push("~="),e.querySelectorAll(":checked").length||v.push(":checked"),e.querySelectorAll("a#"+k+"+*").length||v.push(".#.+[+~]")}),ce(function(e){e.innerHTML="<a href='' disabled='disabled'></a><select disabled='disabled'><option/></select>";var t=C.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&v.push("name"+M+"*[*^$|!~]?="),2!==e.querySelectorAll(":enabled").length&&v.push(":enabled",":disabled"),a.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&v.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),v.push(",.*:")})),(d.matchesSelector=K.test(c=a.matches||a.webkitMatchesSelector||a.mozMatchesSelector||a.oMatchesSelector||a.msMatchesSelector))&&ce(function(e){d.disconnectedMatch=c.call(e,"*"),c.call(e,"[s!='']:x"),s.push("!=",$)}),v=v.length&&new RegExp(v.join("|")),s=s.length&&new RegExp(s.join("|")),t=K.test(a.compareDocumentPosition),y=t||K.test(a.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)while(t=t.parentNode)if(t===e)return!0;return!1},D=t?function(e,t){if(e===t)return l=!0,0;var n=!e.compareDocumentPosition-!t.compareDocumentPosition;return n||(1&(n=(e.ownerDocument||e)===(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!d.sortDetached&&t.compareDocumentPosition(e)===n?e===C||e.ownerDocument===m&&y(m,e)?-1:t===C||t.ownerDocument===m&&y(m,t)?1:u?P(u,e)-P(u,t):0:4&n?-1:1)}:function(e,t){if(e===t)return l=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e===C?-1:t===C?1:i?-1:o?1:u?P(u,e)-P(u,t):0;if(i===o)return pe(e,t);n=e;while(n=n.parentNode)a.unshift(n);n=t;while(n=n.parentNode)s.unshift(n);while(a[r]===s[r])r++;return r?pe(a[r],s[r]):a[r]===m?-1:s[r]===m?1:0}),C},se.matches=function(e,t){return se(e,null,null,t)},se.matchesSelector=function(e,t){if((e.ownerDocument||e)!==C&&T(e),d.matchesSelector&&E&&!A[t+" "]&&(!s||!s.test(t))&&(!v||!v.test(t)))try{var n=c.call(e,t);if(n||d.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(e){A(t,!0)}return 0<se(t,C,null,[e]).length},se.contains=function(e,t){return(e.ownerDocument||e)!==C&&T(e),y(e,t)},se.attr=function(e,t){(e.ownerDocument||e)!==C&&T(e);var n=b.attrHandle[t.toLowerCase()],r=n&&j.call(b.attrHandle,t.toLowerCase())?n(e,t,!E):void 0;return void 0!==r?r:d.attributes||!E?e.getAttribute(t):(r=e.getAttributeNode(t))&&r.specified?r.value:null},se.escape=function(e){return(e+"").replace(re,ie)},se.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},se.uniqueSort=function(e){var t,n=[],r=0,i=0;if(l=!d.detectDuplicates,u=!d.sortStable&&e.slice(0),e.sort(D),l){while(t=e[i++])t===e[i]&&(r=n.push(i));while(r--)e.splice(n[r],1)}return u=null,e},o=se.getText=function(e){var t,n="",r=0,i=e.nodeType;if(i){if(1===i||9===i||11===i){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=o(e)}else if(3===i||4===i)return e.nodeValue}else while(t=e[r++])n+=o(t);return n},(b=se.selectors={cacheLength:50,createPseudo:le,match:G,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(te,ne),e[3]=(e[3]||e[4]||e[5]||"").replace(te,ne),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||se.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&se.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return G.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&X.test(n)&&(t=h(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(te,ne).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=p[e+" "];return t||(t=new RegExp("(^|"+M+")"+e+"("+M+"|$)"))&&p(e,function(e){return t.test("string"==typeof e.className&&e.className||"undefined"!=typeof e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(n,r,i){return function(e){var t=se.attr(e,n);return null==t?"!="===r:!r||(t+="","="===r?t===i:"!="===r?t!==i:"^="===r?i&&0===t.indexOf(i):"*="===r?i&&-1<t.indexOf(i):"$="===r?i&&t.slice(-i.length)===i:"~="===r?-1<(" "+t.replace(F," ")+" ").indexOf(i):"|="===r&&(t===i||t.slice(0,i.length+1)===i+"-"))}},CHILD:function(h,e,t,g,v){var y="nth"!==h.slice(0,3),m="last"!==h.slice(-4),x="of-type"===e;return 1===g&&0===v?function(e){return!!e.parentNode}:function(e,t,n){var r,i,o,a,s,u,l=y!==m?"nextSibling":"previousSibling",c=e.parentNode,f=x&&e.nodeName.toLowerCase(),p=!n&&!x,d=!1;if(c){if(y){while(l){a=e;while(a=a[l])if(x?a.nodeName.toLowerCase()===f:1===a.nodeType)return!1;u=l="only"===h&&!u&&"nextSibling"}return!0}if(u=[m?c.firstChild:c.lastChild],m&&p){d=(s=(r=(i=(o=(a=c)[k]||(a[k]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]||[])[0]===S&&r[1])&&r[2],a=s&&c.childNodes[s];while(a=++s&&a&&a[l]||(d=s=0)||u.pop())if(1===a.nodeType&&++d&&a===e){i[h]=[S,s,d];break}}else if(p&&(d=s=(r=(i=(o=(a=e)[k]||(a[k]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]||[])[0]===S&&r[1]),!1===d)while(a=++s&&a&&a[l]||(d=s=0)||u.pop())if((x?a.nodeName.toLowerCase()===f:1===a.nodeType)&&++d&&(p&&((i=(o=a[k]||(a[k]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]=[S,d]),a===e))break;return(d-=v)===g||d%g==0&&0<=d/g}}},PSEUDO:function(e,o){var t,a=b.pseudos[e]||b.setFilters[e.toLowerCase()]||se.error("unsupported pseudo: "+e);return a[k]?a(o):1<a.length?(t=[e,e,"",o],b.setFilters.hasOwnProperty(e.toLowerCase())?le(function(e,t){var n,r=a(e,o),i=r.length;while(i--)e[n=P(e,r[i])]=!(t[n]=r[i])}):function(e){return a(e,0,t)}):a}},pseudos:{not:le(function(e){var r=[],i=[],s=f(e.replace(B,"$1"));return s[k]?le(function(e,t,n,r){var i,o=s(e,null,r,[]),a=e.length;while(a--)(i=o[a])&&(e[a]=!(t[a]=i))}):function(e,t,n){return r[0]=e,s(r,null,n,i),r[0]=null,!i.pop()}}),has:le(function(t){return function(e){return 0<se(t,e).length}}),contains:le(function(t){return t=t.replace(te,ne),function(e){return-1<(e.textContent||o(e)).indexOf(t)}}),lang:le(function(n){return V.test(n||"")||se.error("unsupported lang: "+n),n=n.replace(te,ne).toLowerCase(),function(e){var t;do{if(t=E?e.lang:e.getAttribute("xml:lang")||e.getAttribute("lang"))return(t=t.toLowerCase())===n||0===t.indexOf(n+"-")}while((e=e.parentNode)&&1===e.nodeType);return!1}}),target:function(e){var t=n.location&&n.location.hash;return t&&t.slice(1)===e.id},root:function(e){return e===a},focus:function(e){return e===C.activeElement&&(!C.hasFocus||C.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:ge(!1),disabled:ge(!0),checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!b.pseudos.empty(e)},header:function(e){return J.test(e.nodeName)},input:function(e){return Q.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:ve(function(){return[0]}),last:ve(function(e,t){return[t-1]}),eq:ve(function(e,t,n){return[n<0?n+t:n]}),even:ve(function(e,t){for(var n=0;n<t;n+=2)e.push(n);return e}),odd:ve(function(e,t){for(var n=1;n<t;n+=2)e.push(n);return e}),lt:ve(function(e,t,n){for(var r=n<0?n+t:t<n?t:n;0<=--r;)e.push(r);return e}),gt:ve(function(e,t,n){for(var r=n<0?n+t:n;++r<t;)e.push(r);return e})}}).pseudos.nth=b.pseudos.eq,{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})b.pseudos[e]=de(e);for(e in{submit:!0,reset:!0})b.pseudos[e]=he(e);function me(){}function xe(e){for(var t=0,n=e.length,r="";t<n;t++)r+=e[t].value;return r}function be(s,e,t){var u=e.dir,l=e.next,c=l||u,f=t&&"parentNode"===c,p=r++;return e.first?function(e,t,n){while(e=e[u])if(1===e.nodeType||f)return s(e,t,n);return!1}:function(e,t,n){var r,i,o,a=[S,p];if(n){while(e=e[u])if((1===e.nodeType||f)&&s(e,t,n))return!0}else while(e=e[u])if(1===e.nodeType||f)if(i=(o=e[k]||(e[k]={}))[e.uniqueID]||(o[e.uniqueID]={}),l&&l===e.nodeName.toLowerCase())e=e[u]||e;else{if((r=i[c])&&r[0]===S&&r[1]===p)return a[2]=r[2];if((i[c]=a)[2]=s(e,t,n))return!0}return!1}}function we(i){return 1<i.length?function(e,t,n){var r=i.length;while(r--)if(!i[r](e,t,n))return!1;return!0}:i[0]}function Te(e,t,n,r,i){for(var o,a=[],s=0,u=e.length,l=null!=t;s<u;s++)(o=e[s])&&(n&&!n(o,r,i)||(a.push(o),l&&t.push(s)));return a}function Ce(d,h,g,v,y,e){return v&&!v[k]&&(v=Ce(v)),y&&!y[k]&&(y=Ce(y,e)),le(function(e,t,n,r){var i,o,a,s=[],u=[],l=t.length,c=e||function(e,t,n){for(var r=0,i=t.length;r<i;r++)se(e,t[r],n);return n}(h||"*",n.nodeType?[n]:n,[]),f=!d||!e&&h?c:Te(c,s,d,n,r),p=g?y||(e?d:l||v)?[]:t:f;if(g&&g(f,p,n,r),v){i=Te(p,u),v(i,[],n,r),o=i.length;while(o--)(a=i[o])&&(p[u[o]]=!(f[u[o]]=a))}if(e){if(y||d){if(y){i=[],o=p.length;while(o--)(a=p[o])&&i.push(f[o]=a);y(null,p=[],i,r)}o=p.length;while(o--)(a=p[o])&&-1<(i=y?P(e,a):s[o])&&(e[i]=!(t[i]=a))}}else p=Te(p===t?p.splice(l,p.length):p),y?y(null,t,p,r):H.apply(t,p)})}function Ee(e){for(var i,t,n,r=e.length,o=b.relative[e[0].type],a=o||b.relative[" "],s=o?1:0,u=be(function(e){return e===i},a,!0),l=be(function(e){return-1<P(i,e)},a,!0),c=[function(e,t,n){var r=!o&&(n||t!==w)||((i=t).nodeType?u(e,t,n):l(e,t,n));return i=null,r}];s<r;s++)if(t=b.relative[e[s].type])c=[be(we(c),t)];else{if((t=b.filter[e[s].type].apply(null,e[s].matches))[k]){for(n=++s;n<r;n++)if(b.relative[e[n].type])break;return Ce(1<s&&we(c),1<s&&xe(e.slice(0,s-1).concat({value:" "===e[s-2].type?"*":""})).replace(B,"$1"),t,s<n&&Ee(e.slice(s,n)),n<r&&Ee(e=e.slice(n)),n<r&&xe(e))}c.push(t)}return we(c)}return me.prototype=b.filters=b.pseudos,b.setFilters=new me,h=se.tokenize=function(e,t){var n,r,i,o,a,s,u,l=x[e+" "];if(l)return t?0:l.slice(0);a=e,s=[],u=b.preFilter;while(a){for(o in n&&!(r=_.exec(a))||(r&&(a=a.slice(r[0].length)||a),s.push(i=[])),n=!1,(r=z.exec(a))&&(n=r.shift(),i.push({value:n,type:r[0].replace(B," ")}),a=a.slice(n.length)),b.filter)!(r=G[o].exec(a))||u[o]&&!(r=u[o](r))||(n=r.shift(),i.push({value:n,type:o,matches:r}),a=a.slice(n.length));if(!n)break}return t?a.length:a?se.error(e):x(e,s).slice(0)},f=se.compile=function(e,t){var n,v,y,m,x,r,i=[],o=[],a=N[e+" "];if(!a){t||(t=h(e)),n=t.length;while(n--)(a=Ee(t[n]))[k]?i.push(a):o.push(a);(a=N(e,(v=o,m=0<(y=i).length,x=0<v.length,r=function(e,t,n,r,i){var o,a,s,u=0,l="0",c=e&&[],f=[],p=w,d=e||x&&b.find.TAG("*",i),h=S+=null==p?1:Math.random()||.1,g=d.length;for(i&&(w=t===C||t||i);l!==g&&null!=(o=d[l]);l++){if(x&&o){a=0,t||o.ownerDocument===C||(T(o),n=!E);while(s=v[a++])if(s(o,t||C,n)){r.push(o);break}i&&(S=h)}m&&((o=!s&&o)&&u--,e&&c.push(o))}if(u+=l,m&&l!==u){a=0;while(s=y[a++])s(c,f,t,n);if(e){if(0<u)while(l--)c[l]||f[l]||(f[l]=q.call(r));f=Te(f)}H.apply(r,f),i&&!e&&0<f.length&&1<u+y.length&&se.uniqueSort(r)}return i&&(S=h,w=p),c},m?le(r):r))).selector=e}return a},g=se.select=function(e,t,n,r){var i,o,a,s,u,l="function"==typeof e&&e,c=!r&&h(e=l.selector||e);if(n=n||[],1===c.length){if(2<(o=c[0]=c[0].slice(0)).length&&"ID"===(a=o[0]).type&&9===t.nodeType&&E&&b.relative[o[1].type]){if(!(t=(b.find.ID(a.matches[0].replace(te,ne),t)||[])[0]))return n;l&&(t=t.parentNode),e=e.slice(o.shift().value.length)}i=G.needsContext.test(e)?0:o.length;while(i--){if(a=o[i],b.relative[s=a.type])break;if((u=b.find[s])&&(r=u(a.matches[0].replace(te,ne),ee.test(o[0].type)&&ye(t.parentNode)||t))){if(o.splice(i,1),!(e=r.length&&xe(o)))return H.apply(n,r),n;break}}}return(l||f(e,c))(r,t,!E,n,!t||ee.test(e)&&ye(t.parentNode)||t),n},d.sortStable=k.split("").sort(D).join("")===k,d.detectDuplicates=!!l,T(),d.sortDetached=ce(function(e){return 1&e.compareDocumentPosition(C.createElement("fieldset"))}),ce(function(e){return e.innerHTML="<a href='#'></a>","#"===e.firstChild.getAttribute("href")})||fe("type|href|height|width",function(e,t,n){if(!n)return e.getAttribute(t,"type"===t.toLowerCase()?1:2)}),d.attributes&&ce(function(e){return e.innerHTML="<input/>",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||fe("value",function(e,t,n){if(!n&&"input"===e.nodeName.toLowerCase())return e.defaultValue}),ce(function(e){return null==e.getAttribute("disabled")})||fe(R,function(e,t,n){var r;if(!n)return!0===e[t]?t.toLowerCase():(r=e.getAttributeNode(t))&&r.specified?r.value:null}),se}(C);k.find=h,k.expr=h.selectors,k.expr[":"]=k.expr.pseudos,k.uniqueSort=k.unique=h.uniqueSort,k.text=h.getText,k.isXMLDoc=h.isXML,k.contains=h.contains,k.escapeSelector=h.escape;var T=function(e,t,n){var r=[],i=void 0!==n;while((e=e[t])&&9!==e.nodeType)if(1===e.nodeType){if(i&&k(e).is(n))break;r.push(e)}return r},S=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},N=k.expr.match.needsContext;function A(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()}var D=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function j(e,n,r){return m(n)?k.grep(e,function(e,t){return!!n.call(e,t,e)!==r}):n.nodeType?k.grep(e,function(e){return e===n!==r}):"string"!=typeof n?k.grep(e,function(e){return-1<i.call(n,e)!==r}):k.filter(n,e,r)}k.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?k.find.matchesSelector(r,e)?[r]:[]:k.find.matches(e,k.grep(t,function(e){return 1===e.nodeType}))},k.fn.extend({find:function(e){var t,n,r=this.length,i=this;if("string"!=typeof e)return this.pushStack(k(e).filter(function(){for(t=0;t<r;t++)if(k.contains(i[t],this))return!0}));for(n=this.pushStack([]),t=0;t<r;t++)k.find(e,i[t],n);return 1<r?k.uniqueSort(n):n},filter:function(e){return this.pushStack(j(this,e||[],!1))},not:function(e){return this.pushStack(j(this,e||[],!0))},is:function(e){return!!j(this,"string"==typeof e&&N.test(e)?k(e):e||[],!1).length}});var q,L=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/;(k.fn.init=function(e,t,n){var r,i;if(!e)return this;if(n=n||q,"string"==typeof e){if(!(r="<"===e[0]&&">"===e[e.length-1]&&3<=e.length?[null,e,null]:L.exec(e))||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof k?t[0]:t,k.merge(this,k.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:E,!0)),D.test(r[1])&&k.isPlainObject(t))for(r in t)m(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return(i=E.getElementById(r[2]))&&(this[0]=i,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):m(e)?void 0!==n.ready?n.ready(e):e(k):k.makeArray(e,this)}).prototype=k.fn,q=k(E);var H=/^(?:parents|prev(?:Until|All))/,O={children:!0,contents:!0,next:!0,prev:!0};function P(e,t){while((e=e[t])&&1!==e.nodeType);return e}k.fn.extend({has:function(e){var t=k(e,this),n=t.length;return this.filter(function(){for(var e=0;e<n;e++)if(k.contains(this,t[e]))return!0})},closest:function(e,t){var n,r=0,i=this.length,o=[],a="string"!=typeof e&&k(e);if(!N.test(e))for(;r<i;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(n.nodeType<11&&(a?-1<a.index(n):1===n.nodeType&&k.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(1<o.length?k.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?i.call(k(e),this[0]):i.call(this,e.jquery?e[0]:e):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(k.uniqueSort(k.merge(this.get(),k(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),k.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return T(e,"parentNode")},parentsUntil:function(e,t,n){return T(e,"parentNode",n)},next:function(e){return P(e,"nextSibling")},prev:function(e){return P(e,"previousSibling")},nextAll:function(e){return T(e,"nextSibling")},prevAll:function(e){return T(e,"previousSibling")},nextUntil:function(e,t,n){return T(e,"nextSibling",n)},prevUntil:function(e,t,n){return T(e,"previousSibling",n)},siblings:function(e){return S((e.parentNode||{}).firstChild,e)},children:function(e){return S(e.firstChild)},contents:function(e){return"undefined"!=typeof e.contentDocument?e.contentDocument:(A(e,"template")&&(e=e.content||e),k.merge([],e.childNodes))}},function(r,i){k.fn[r]=function(e,t){var n=k.map(this,i,e);return"Until"!==r.slice(-5)&&(t=e),t&&"string"==typeof t&&(n=k.filter(t,n)),1<this.length&&(O[r]||k.uniqueSort(n),H.test(r)&&n.reverse()),this.pushStack(n)}});var R=/[^\x20\t\r\n\f]+/g;function M(e){return e}function I(e){throw e}function W(e,t,n,r){var i;try{e&&m(i=e.promise)?i.call(e).done(t).fail(n):e&&m(i=e.then)?i.call(e,t,n):t.apply(void 0,[e].slice(r))}catch(e){n.apply(void 0,[e])}}k.Callbacks=function(r){var e,n;r="string"==typeof r?(e=r,n={},k.each(e.match(R)||[],function(e,t){n[t]=!0}),n):k.extend({},r);var i,t,o,a,s=[],u=[],l=-1,c=function(){for(a=a||r.once,o=i=!0;u.length;l=-1){t=u.shift();while(++l<s.length)!1===s[l].apply(t[0],t[1])&&r.stopOnFalse&&(l=s.length,t=!1)}r.memory||(t=!1),i=!1,a&&(s=t?[]:"")},f={add:function(){return s&&(t&&!i&&(l=s.length-1,u.push(t)),function n(e){k.each(e,function(e,t){m(t)?r.unique&&f.has(t)||s.push(t):t&&t.length&&"string"!==w(t)&&n(t)})}(arguments),t&&!i&&c()),this},remove:function(){return k.each(arguments,function(e,t){var n;while(-1<(n=k.inArray(t,s,n)))s.splice(n,1),n<=l&&l--}),this},has:function(e){return e?-1<k.inArray(e,s):0<s.length},empty:function(){return s&&(s=[]),this},disable:function(){return a=u=[],s=t="",this},disabled:function(){return!s},lock:function(){return a=u=[],t||i||(s=t=""),this},locked:function(){return!!a},fireWith:function(e,t){return a||(t=[e,(t=t||[]).slice?t.slice():t],u.push(t),i||c()),this},fire:function(){return f.fireWith(this,arguments),this},fired:function(){return!!o}};return f},k.extend({Deferred:function(e){var o=[["notify","progress",k.Callbacks("memory"),k.Callbacks("memory"),2],["resolve","done",k.Callbacks("once memory"),k.Callbacks("once memory"),0,"resolved"],["reject","fail",k.Callbacks("once memory"),k.Callbacks("once memory"),1,"rejected"]],i="pending",a={state:function(){return i},always:function(){return s.done(arguments).fail(arguments),this},"catch":function(e){return a.then(null,e)},pipe:function(){var i=arguments;return k.Deferred(function(r){k.each(o,function(e,t){var n=m(i[t[4]])&&i[t[4]];s[t[1]](function(){var e=n&&n.apply(this,arguments);e&&m(e.promise)?e.promise().progress(r.notify).done(r.resolve).fail(r.reject):r[t[0]+"With"](this,n?[e]:arguments)})}),i=null}).promise()},then:function(t,n,r){var u=0;function l(i,o,a,s){return function(){var n=this,r=arguments,e=function(){var e,t;if(!(i<u)){if((e=a.apply(n,r))===o.promise())throw new TypeError("Thenable self-resolution");t=e&&("object"==typeof e||"function"==typeof e)&&e.then,m(t)?s?t.call(e,l(u,o,M,s),l(u,o,I,s)):(u++,t.call(e,l(u,o,M,s),l(u,o,I,s),l(u,o,M,o.notifyWith))):(a!==M&&(n=void 0,r=[e]),(s||o.resolveWith)(n,r))}},t=s?e:function(){try{e()}catch(e){k.Deferred.exceptionHook&&k.Deferred.exceptionHook(e,t.stackTrace),u<=i+1&&(a!==I&&(n=void 0,r=[e]),o.rejectWith(n,r))}};i?t():(k.Deferred.getStackHook&&(t.stackTrace=k.Deferred.getStackHook()),C.setTimeout(t))}}return k.Deferred(function(e){o[0][3].add(l(0,e,m(r)?r:M,e.notifyWith)),o[1][3].add(l(0,e,m(t)?t:M)),o[2][3].add(l(0,e,m(n)?n:I))}).promise()},promise:function(e){return null!=e?k.extend(e,a):a}},s={};return k.each(o,function(e,t){var n=t[2],r=t[5];a[t[1]]=n.add,r&&n.add(function(){i=r},o[3-e][2].disable,o[3-e][3].disable,o[0][2].lock,o[0][3].lock),n.add(t[3].fire),s[t[0]]=function(){return s[t[0]+"With"](this===s?void 0:this,arguments),this},s[t[0]+"With"]=n.fireWith}),a.promise(s),e&&e.call(s,s),s},when:function(e){var n=arguments.length,t=n,r=Array(t),i=s.call(arguments),o=k.Deferred(),a=function(t){return function(e){r[t]=this,i[t]=1<arguments.length?s.call(arguments):e,--n||o.resolveWith(r,i)}};if(n<=1&&(W(e,o.done(a(t)).resolve,o.reject,!n),"pending"===o.state()||m(i[t]&&i[t].then)))return o.then();while(t--)W(i[t],a(t),o.reject);return o.promise()}});var $=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;k.Deferred.exceptionHook=function(e,t){C.console&&C.console.warn&&e&&$.test(e.name)&&C.console.warn("jQuery.Deferred exception: "+e.message,e.stack,t)},k.readyException=function(e){C.setTimeout(function(){throw e})};var F=k.Deferred();function B(){E.removeEventListener("DOMContentLoaded",B),C.removeEventListener("load",B),k.ready()}k.fn.ready=function(e){return F.then(e)["catch"](function(e){k.readyException(e)}),this},k.extend({isReady:!1,readyWait:1,ready:function(e){(!0===e?--k.readyWait:k.isReady)||(k.isReady=!0)!==e&&0<--k.readyWait||F.resolveWith(E,[k])}}),k.ready.then=F.then,"complete"===E.readyState||"loading"!==E.readyState&&!E.documentElement.doScroll?C.setTimeout(k.ready):(E.addEventListener("DOMContentLoaded",B),C.addEventListener("load",B));var _=function(e,t,n,r,i,o,a){var s=0,u=e.length,l=null==n;if("object"===w(n))for(s in i=!0,n)_(e,t,s,n[s],!0,o,a);else if(void 0!==r&&(i=!0,m(r)||(a=!0),l&&(a?(t.call(e,r),t=null):(l=t,t=function(e,t,n){return l.call(k(e),n)})),t))for(;s<u;s++)t(e[s],n,a?r:r.call(e[s],s,t(e[s],n)));return i?e:l?t.call(e):u?t(e[0],n):o},z=/^-ms-/,U=/-([a-z])/g;function X(e,t){return t.toUpperCase()}function V(e){return e.replace(z,"ms-").replace(U,X)}var G=function(e){return 1===e.nodeType||9===e.nodeType||!+e.nodeType};function Y(){this.expando=k.expando+Y.uid++}Y.uid=1,Y.prototype={cache:function(e){var t=e[this.expando];return t||(t={},G(e)&&(e.nodeType?e[this.expando]=t:Object.defineProperty(e,this.expando,{value:t,configurable:!0}))),t},set:function(e,t,n){var r,i=this.cache(e);if("string"==typeof t)i[V(t)]=n;else for(r in t)i[V(r)]=t[r];return i},get:function(e,t){return void 0===t?this.cache(e):e[this.expando]&&e[this.expando][V(t)]},access:function(e,t,n){return void 0===t||t&&"string"==typeof t&&void 0===n?this.get(e,t):(this.set(e,t,n),void 0!==n?n:t)},remove:function(e,t){var n,r=e[this.expando];if(void 0!==r){if(void 0!==t){n=(t=Array.isArray(t)?t.map(V):(t=V(t))in r?[t]:t.match(R)||[]).length;while(n--)delete r[t[n]]}(void 0===t||k.isEmptyObject(r))&&(e.nodeType?e[this.expando]=void 0:delete e[this.expando])}},hasData:function(e){var t=e[this.expando];return void 0!==t&&!k.isEmptyObject(t)}};var Q=new Y,J=new Y,K=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,Z=/[A-Z]/g;function ee(e,t,n){var r,i;if(void 0===n&&1===e.nodeType)if(r="data-"+t.replace(Z,"-$&").toLowerCase(),"string"==typeof(n=e.getAttribute(r))){try{n="true"===(i=n)||"false"!==i&&("null"===i?null:i===+i+""?+i:K.test(i)?JSON.parse(i):i)}catch(e){}J.set(e,t,n)}else n=void 0;return n}k.extend({hasData:function(e){return J.hasData(e)||Q.hasData(e)},data:function(e,t,n){return J.access(e,t,n)},removeData:function(e,t){J.remove(e,t)},_data:function(e,t,n){return Q.access(e,t,n)},_removeData:function(e,t){Q.remove(e,t)}}),k.fn.extend({data:function(n,e){var t,r,i,o=this[0],a=o&&o.attributes;if(void 0===n){if(this.length&&(i=J.get(o),1===o.nodeType&&!Q.get(o,"hasDataAttrs"))){t=a.length;while(t--)a[t]&&0===(r=a[t].name).indexOf("data-")&&(r=V(r.slice(5)),ee(o,r,i[r]));Q.set(o,"hasDataAttrs",!0)}return i}return"object"==typeof n?this.each(function(){J.set(this,n)}):_(this,function(e){var t;if(o&&void 0===e)return void 0!==(t=J.get(o,n))?t:void 0!==(t=ee(o,n))?t:void 0;this.each(function(){J.set(this,n,e)})},null,e,1<arguments.length,null,!0)},removeData:function(e){return this.each(function(){J.remove(this,e)})}}),k.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=Q.get(e,t),n&&(!r||Array.isArray(n)?r=Q.access(e,t,k.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=k.queue(e,t),r=n.length,i=n.shift(),o=k._queueHooks(e,t);"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,function(){k.dequeue(e,t)},o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return Q.get(e,n)||Q.access(e,n,{empty:k.Callbacks("once memory").add(function(){Q.remove(e,[t+"queue",n])})})}}),k.fn.extend({queue:function(t,n){var e=2;return"string"!=typeof t&&(n=t,t="fx",e--),arguments.length<e?k.queue(this[0],t):void 0===n?this:this.each(function(){var e=k.queue(this,t,n);k._queueHooks(this,t),"fx"===t&&"inprogress"!==e[0]&&k.dequeue(this,t)})},dequeue:function(e){return this.each(function(){k.dequeue(this,e)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=k.Deferred(),o=this,a=this.length,s=function(){--r||i.resolveWith(o,[o])};"string"!=typeof e&&(t=e,e=void 0),e=e||"fx";while(a--)(n=Q.get(o[a],e+"queueHooks"))&&n.empty&&(r++,n.empty.add(s));return s(),i.promise(t)}});var te=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,ne=new RegExp("^(?:([+-])=|)("+te+")([a-z%]*)$","i"),re=["Top","Right","Bottom","Left"],ie=E.documentElement,oe=function(e){return k.contains(e.ownerDocument,e)},ae={composed:!0};ie.getRootNode&&(oe=function(e){return k.contains(e.ownerDocument,e)||e.getRootNode(ae)===e.ownerDocument});var se=function(e,t){return"none"===(e=t||e).style.display||""===e.style.display&&oe(e)&&"none"===k.css(e,"display")},ue=function(e,t,n,r){var i,o,a={};for(o in t)a[o]=e.style[o],e.style[o]=t[o];for(o in i=n.apply(e,r||[]),t)e.style[o]=a[o];return i};function le(e,t,n,r){var i,o,a=20,s=r?function(){return r.cur()}:function(){return k.css(e,t,"")},u=s(),l=n&&n[3]||(k.cssNumber[t]?"":"px"),c=e.nodeType&&(k.cssNumber[t]||"px"!==l&&+u)&&ne.exec(k.css(e,t));if(c&&c[3]!==l){u/=2,l=l||c[3],c=+u||1;while(a--)k.style(e,t,c+l),(1-o)*(1-(o=s()/u||.5))<=0&&(a=0),c/=o;c*=2,k.style(e,t,c+l),n=n||[]}return n&&(c=+c||+u||0,i=n[1]?c+(n[1]+1)*n[2]:+n[2],r&&(r.unit=l,r.start=c,r.end=i)),i}var ce={};function fe(e,t){for(var n,r,i,o,a,s,u,l=[],c=0,f=e.length;c<f;c++)(r=e[c]).style&&(n=r.style.display,t?("none"===n&&(l[c]=Q.get(r,"display")||null,l[c]||(r.style.display="")),""===r.style.display&&se(r)&&(l[c]=(u=a=o=void 0,a=(i=r).ownerDocument,s=i.nodeName,(u=ce[s])||(o=a.body.appendChild(a.createElement(s)),u=k.css(o,"display"),o.parentNode.removeChild(o),"none"===u&&(u="block"),ce[s]=u)))):"none"!==n&&(l[c]="none",Q.set(r,"display",n)));for(c=0;c<f;c++)null!=l[c]&&(e[c].style.display=l[c]);return e}k.fn.extend({show:function(){return fe(this,!0)},hide:function(){return fe(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){se(this)?k(this).show():k(this).hide()})}});var pe=/^(?:checkbox|radio)$/i,de=/<([a-z][^\/\0>\x20\t\r\n\f]*)/i,he=/^$|^module$|\/(?:java|ecma)script/i,ge={option:[1,"<select multiple='multiple'>","</select>"],thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};function ve(e,t){var n;return n="undefined"!=typeof e.getElementsByTagName?e.getElementsByTagName(t||"*"):"undefined"!=typeof e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&A(e,t)?k.merge([e],n):n}function ye(e,t){for(var n=0,r=e.length;n<r;n++)Q.set(e[n],"globalEval",!t||Q.get(t[n],"globalEval"))}ge.optgroup=ge.option,ge.tbody=ge.tfoot=ge.colgroup=ge.caption=ge.thead,ge.th=ge.td;var me,xe,be=/<|&#?\w+;/;function we(e,t,n,r,i){for(var o,a,s,u,l,c,f=t.createDocumentFragment(),p=[],d=0,h=e.length;d<h;d++)if((o=e[d])||0===o)if("object"===w(o))k.merge(p,o.nodeType?[o]:o);else if(be.test(o)){a=a||f.appendChild(t.createElement("div")),s=(de.exec(o)||["",""])[1].toLowerCase(),u=ge[s]||ge._default,a.innerHTML=u[1]+k.htmlPrefilter(o)+u[2],c=u[0];while(c--)a=a.lastChild;k.merge(p,a.childNodes),(a=f.firstChild).textContent=""}else p.push(t.createTextNode(o));f.textContent="",d=0;while(o=p[d++])if(r&&-1<k.inArray(o,r))i&&i.push(o);else if(l=oe(o),a=ve(f.appendChild(o),"script"),l&&ye(a),n){c=0;while(o=a[c++])he.test(o.type||"")&&n.push(o)}return f}me=E.createDocumentFragment().appendChild(E.createElement("div")),(xe=E.createElement("input")).setAttribute("type","radio"),xe.setAttribute("checked","checked"),xe.setAttribute("name","t"),me.appendChild(xe),y.checkClone=me.cloneNode(!0).cloneNode(!0).lastChild.checked,me.innerHTML="<textarea>x</textarea>",y.noCloneChecked=!!me.cloneNode(!0).lastChild.defaultValue;var Te=/^key/,Ce=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,Ee=/^([^.]*)(?:\.(.+)|)/;function ke(){return!0}function Se(){return!1}function Ne(e,t){return e===function(){try{return E.activeElement}catch(e){}}()==("focus"===t)}function Ae(e,t,n,r,i,o){var a,s;if("object"==typeof t){for(s in"string"!=typeof n&&(r=r||n,n=void 0),t)Ae(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=Se;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return k().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=k.guid++)),e.each(function(){k.event.add(this,t,i,r,n)})}function De(e,i,o){o?(Q.set(e,i,!1),k.event.add(e,i,{namespace:!1,handler:function(e){var t,n,r=Q.get(this,i);if(1&e.isTrigger&&this[i]){if(r.length)(k.event.special[i]||{}).delegateType&&e.stopPropagation();else if(r=s.call(arguments),Q.set(this,i,r),t=o(this,i),this[i](),r!==(n=Q.get(this,i))||t?Q.set(this,i,!1):n={},r!==n)return e.stopImmediatePropagation(),e.preventDefault(),n.value}else r.length&&(Q.set(this,i,{value:k.event.trigger(k.extend(r[0],k.Event.prototype),r.slice(1),this)}),e.stopImmediatePropagation())}})):void 0===Q.get(e,i)&&k.event.add(e,i,ke)}k.event={global:{},add:function(t,e,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=Q.get(t);if(v){n.handler&&(n=(o=n).handler,i=o.selector),i&&k.find.matchesSelector(ie,i),n.guid||(n.guid=k.guid++),(u=v.events)||(u=v.events={}),(a=v.handle)||(a=v.handle=function(e){return"undefined"!=typeof k&&k.event.triggered!==e.type?k.event.dispatch.apply(t,arguments):void 0}),l=(e=(e||"").match(R)||[""]).length;while(l--)d=g=(s=Ee.exec(e[l])||[])[1],h=(s[2]||"").split(".").sort(),d&&(f=k.event.special[d]||{},d=(i?f.delegateType:f.bindType)||d,f=k.event.special[d]||{},c=k.extend({type:d,origType:g,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&k.expr.match.needsContext.test(i),namespace:h.join(".")},o),(p=u[d])||((p=u[d]=[]).delegateCount=0,f.setup&&!1!==f.setup.call(t,r,h,a)||t.addEventListener&&t.addEventListener(d,a)),f.add&&(f.add.call(t,c),c.handler.guid||(c.handler.guid=n.guid)),i?p.splice(p.delegateCount++,0,c):p.push(c),k.event.global[d]=!0)}},remove:function(e,t,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=Q.hasData(e)&&Q.get(e);if(v&&(u=v.events)){l=(t=(t||"").match(R)||[""]).length;while(l--)if(d=g=(s=Ee.exec(t[l])||[])[1],h=(s[2]||"").split(".").sort(),d){f=k.event.special[d]||{},p=u[d=(r?f.delegateType:f.bindType)||d]||[],s=s[2]&&new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"),a=o=p.length;while(o--)c=p[o],!i&&g!==c.origType||n&&n.guid!==c.guid||s&&!s.test(c.namespace)||r&&r!==c.selector&&("**"!==r||!c.selector)||(p.splice(o,1),c.selector&&p.delegateCount--,f.remove&&f.remove.call(e,c));a&&!p.length&&(f.teardown&&!1!==f.teardown.call(e,h,v.handle)||k.removeEvent(e,d,v.handle),delete u[d])}else for(d in u)k.event.remove(e,d+t[l],n,r,!0);k.isEmptyObject(u)&&Q.remove(e,"handle events")}},dispatch:function(e){var t,n,r,i,o,a,s=k.event.fix(e),u=new Array(arguments.length),l=(Q.get(this,"events")||{})[s.type]||[],c=k.event.special[s.type]||{};for(u[0]=s,t=1;t<arguments.length;t++)u[t]=arguments[t];if(s.delegateTarget=this,!c.preDispatch||!1!==c.preDispatch.call(this,s)){a=k.event.handlers.call(this,s,l),t=0;while((i=a[t++])&&!s.isPropagationStopped()){s.currentTarget=i.elem,n=0;while((o=i.handlers[n++])&&!s.isImmediatePropagationStopped())s.rnamespace&&!1!==o.namespace&&!s.rnamespace.test(o.namespace)||(s.handleObj=o,s.data=o.data,void 0!==(r=((k.event.special[o.origType]||{}).handle||o.handler).apply(i.elem,u))&&!1===(s.result=r)&&(s.preventDefault(),s.stopPropagation()))}return c.postDispatch&&c.postDispatch.call(this,s),s.result}},handlers:function(e,t){var n,r,i,o,a,s=[],u=t.delegateCount,l=e.target;if(u&&l.nodeType&&!("click"===e.type&&1<=e.button))for(;l!==this;l=l.parentNode||this)if(1===l.nodeType&&("click"!==e.type||!0!==l.disabled)){for(o=[],a={},n=0;n<u;n++)void 0===a[i=(r=t[n]).selector+" "]&&(a[i]=r.needsContext?-1<k(i,this).index(l):k.find(i,this,null,[l]).length),a[i]&&o.push(r);o.length&&s.push({elem:l,handlers:o})}return l=this,u<t.length&&s.push({elem:l,handlers:t.slice(u)}),s},addProp:function(t,e){Object.defineProperty(k.Event.prototype,t,{enumerable:!0,configurable:!0,get:m(e)?function(){if(this.originalEvent)return e(this.originalEvent)}:function(){if(this.originalEvent)return this.originalEvent[t]},set:function(e){Object.defineProperty(this,t,{enumerable:!0,configurable:!0,writable:!0,value:e})}})},fix:function(e){return e[k.expando]?e:new k.Event(e)},special:{load:{noBubble:!0},click:{setup:function(e){var t=this||e;return pe.test(t.type)&&t.click&&A(t,"input")&&De(t,"click",ke),!1},trigger:function(e){var t=this||e;return pe.test(t.type)&&t.click&&A(t,"input")&&De(t,"click"),!0},_default:function(e){var t=e.target;return pe.test(t.type)&&t.click&&A(t,"input")&&Q.get(t,"click")||A(t,"a")}},beforeunload:{postDispatch:function(e){void 0!==e.result&&e.originalEvent&&(e.originalEvent.returnValue=e.result)}}}},k.removeEvent=function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n)},k.Event=function(e,t){if(!(this instanceof k.Event))return new k.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||void 0===e.defaultPrevented&&!1===e.returnValue?ke:Se,this.target=e.target&&3===e.target.nodeType?e.target.parentNode:e.target,this.currentTarget=e.currentTarget,this.relatedTarget=e.relatedTarget):this.type=e,t&&k.extend(this,t),this.timeStamp=e&&e.timeStamp||Date.now(),this[k.expando]=!0},k.Event.prototype={constructor:k.Event,isDefaultPrevented:Se,isPropagationStopped:Se,isImmediatePropagationStopped:Se,isSimulated:!1,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=ke,e&&!this.isSimulated&&e.preventDefault()},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=ke,e&&!this.isSimulated&&e.stopPropagation()},stopImmediatePropagation:function(){var e=this.originalEvent;this.isImmediatePropagationStopped=ke,e&&!this.isSimulated&&e.stopImmediatePropagation(),this.stopPropagation()}},k.each({altKey:!0,bubbles:!0,cancelable:!0,changedTouches:!0,ctrlKey:!0,detail:!0,eventPhase:!0,metaKey:!0,pageX:!0,pageY:!0,shiftKey:!0,view:!0,"char":!0,code:!0,charCode:!0,key:!0,keyCode:!0,button:!0,buttons:!0,clientX:!0,clientY:!0,offsetX:!0,offsetY:!0,pointerId:!0,pointerType:!0,screenX:!0,screenY:!0,targetTouches:!0,toElement:!0,touches:!0,which:function(e){var t=e.button;return null==e.which&&Te.test(e.type)?null!=e.charCode?e.charCode:e.keyCode:!e.which&&void 0!==t&&Ce.test(e.type)?1&t?1:2&t?3:4&t?2:0:e.which}},k.event.addProp),k.each({focus:"focusin",blur:"focusout"},function(e,t){k.event.special[e]={setup:function(){return De(this,e,Ne),!1},trigger:function(){return De(this,e),!0},delegateType:t}}),k.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(e,i){k.event.special[e]={delegateType:i,bindType:i,handle:function(e){var t,n=e.relatedTarget,r=e.handleObj;return n&&(n===this||k.contains(this,n))||(e.type=r.origType,t=r.handler.apply(this,arguments),e.type=i),t}}}),k.fn.extend({on:function(e,t,n,r){return Ae(this,e,t,n,r)},one:function(e,t,n,r){return Ae(this,e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,k(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return!1!==t&&"function"!=typeof t||(n=t,t=void 0),!1===n&&(n=Se),this.each(function(){k.event.remove(this,e,n,t)})}});var je=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,qe=/<script|<style|<link/i,Le=/checked\s*(?:[^=]|=\s*.checked.)/i,He=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;function Oe(e,t){return A(e,"table")&&A(11!==t.nodeType?t:t.firstChild,"tr")&&k(e).children("tbody")[0]||e}function Pe(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function Re(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function Me(e,t){var n,r,i,o,a,s,u,l;if(1===t.nodeType){if(Q.hasData(e)&&(o=Q.access(e),a=Q.set(t,o),l=o.events))for(i in delete a.handle,a.events={},l)for(n=0,r=l[i].length;n<r;n++)k.event.add(t,i,l[i][n]);J.hasData(e)&&(s=J.access(e),u=k.extend({},s),J.set(t,u))}}function Ie(n,r,i,o){r=g.apply([],r);var e,t,a,s,u,l,c=0,f=n.length,p=f-1,d=r[0],h=m(d);if(h||1<f&&"string"==typeof d&&!y.checkClone&&Le.test(d))return n.each(function(e){var t=n.eq(e);h&&(r[0]=d.call(this,e,t.html())),Ie(t,r,i,o)});if(f&&(t=(e=we(r,n[0].ownerDocument,!1,n,o)).firstChild,1===e.childNodes.length&&(e=t),t||o)){for(s=(a=k.map(ve(e,"script"),Pe)).length;c<f;c++)u=e,c!==p&&(u=k.clone(u,!0,!0),s&&k.merge(a,ve(u,"script"))),i.call(n[c],u,c);if(s)for(l=a[a.length-1].ownerDocument,k.map(a,Re),c=0;c<s;c++)u=a[c],he.test(u.type||"")&&!Q.access(u,"globalEval")&&k.contains(l,u)&&(u.src&&"module"!==(u.type||"").toLowerCase()?k._evalUrl&&!u.noModule&&k._evalUrl(u.src,{nonce:u.nonce||u.getAttribute("nonce")}):b(u.textContent.replace(He,""),u,l))}return n}function We(e,t,n){for(var r,i=t?k.filter(t,e):e,o=0;null!=(r=i[o]);o++)n||1!==r.nodeType||k.cleanData(ve(r)),r.parentNode&&(n&&oe(r)&&ye(ve(r,"script")),r.parentNode.removeChild(r));return e}k.extend({htmlPrefilter:function(e){return e.replace(je,"<$1></$2>")},clone:function(e,t,n){var r,i,o,a,s,u,l,c=e.cloneNode(!0),f=oe(e);if(!(y.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||k.isXMLDoc(e)))for(a=ve(c),r=0,i=(o=ve(e)).length;r<i;r++)s=o[r],u=a[r],void 0,"input"===(l=u.nodeName.toLowerCase())&&pe.test(s.type)?u.checked=s.checked:"input"!==l&&"textarea"!==l||(u.defaultValue=s.defaultValue);if(t)if(n)for(o=o||ve(e),a=a||ve(c),r=0,i=o.length;r<i;r++)Me(o[r],a[r]);else Me(e,c);return 0<(a=ve(c,"script")).length&&ye(a,!f&&ve(e,"script")),c},cleanData:function(e){for(var t,n,r,i=k.event.special,o=0;void 0!==(n=e[o]);o++)if(G(n)){if(t=n[Q.expando]){if(t.events)for(r in t.events)i[r]?k.event.remove(n,r):k.removeEvent(n,r,t.handle);n[Q.expando]=void 0}n[J.expando]&&(n[J.expando]=void 0)}}}),k.fn.extend({detach:function(e){return We(this,e,!0)},remove:function(e){return We(this,e)},text:function(e){return _(this,function(e){return void 0===e?k.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=e)})},null,e,arguments.length)},append:function(){return Ie(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||Oe(this,e).appendChild(e)})},prepend:function(){return Ie(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=Oe(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return Ie(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return Ie(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++)1===e.nodeType&&(k.cleanData(ve(e,!1)),e.textContent="");return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return k.clone(this,e,t)})},html:function(e){return _(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e&&1===t.nodeType)return t.innerHTML;if("string"==typeof e&&!qe.test(e)&&!ge[(de.exec(e)||["",""])[1].toLowerCase()]){e=k.htmlPrefilter(e);try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(k.cleanData(ve(t,!1)),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var n=[];return Ie(this,arguments,function(e){var t=this.parentNode;k.inArray(this,n)<0&&(k.cleanData(ve(this)),t&&t.replaceChild(e,this))},n)}}),k.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,a){k.fn[e]=function(e){for(var t,n=[],r=k(e),i=r.length-1,o=0;o<=i;o++)t=o===i?this:this.clone(!0),k(r[o])[a](t),u.apply(n,t.get());return this.pushStack(n)}});var $e=new RegExp("^("+te+")(?!px)[a-z%]+$","i"),Fe=function(e){var t=e.ownerDocument.defaultView;return t&&t.opener||(t=C),t.getComputedStyle(e)},Be=new RegExp(re.join("|"),"i");function _e(e,t,n){var r,i,o,a,s=e.style;return(n=n||Fe(e))&&(""!==(a=n.getPropertyValue(t)||n[t])||oe(e)||(a=k.style(e,t)),!y.pixelBoxStyles()&&$e.test(a)&&Be.test(t)&&(r=s.width,i=s.minWidth,o=s.maxWidth,s.minWidth=s.maxWidth=s.width=a,a=n.width,s.width=r,s.minWidth=i,s.maxWidth=o)),void 0!==a?a+"":a}function ze(e,t){return{get:function(){if(!e())return(this.get=t).apply(this,arguments);delete this.get}}}!function(){function e(){if(u){s.style.cssText="position:absolute;left:-11111px;width:60px;margin-top:1px;padding:0;border:0",u.style.cssText="position:relative;display:block;box-sizing:border-box;overflow:scroll;margin:auto;border:1px;padding:1px;width:60%;top:1%",ie.appendChild(s).appendChild(u);var e=C.getComputedStyle(u);n="1%"!==e.top,a=12===t(e.marginLeft),u.style.right="60%",o=36===t(e.right),r=36===t(e.width),u.style.position="absolute",i=12===t(u.offsetWidth/3),ie.removeChild(s),u=null}}function t(e){return Math.round(parseFloat(e))}var n,r,i,o,a,s=E.createElement("div"),u=E.createElement("div");u.style&&(u.style.backgroundClip="content-box",u.cloneNode(!0).style.backgroundClip="",y.clearCloneStyle="content-box"===u.style.backgroundClip,k.extend(y,{boxSizingReliable:function(){return e(),r},pixelBoxStyles:function(){return e(),o},pixelPosition:function(){return e(),n},reliableMarginLeft:function(){return e(),a},scrollboxSize:function(){return e(),i}}))}();var Ue=["Webkit","Moz","ms"],Xe=E.createElement("div").style,Ve={};function Ge(e){var t=k.cssProps[e]||Ve[e];return t||(e in Xe?e:Ve[e]=function(e){var t=e[0].toUpperCase()+e.slice(1),n=Ue.length;while(n--)if((e=Ue[n]+t)in Xe)return e}(e)||e)}var Ye=/^(none|table(?!-c[ea]).+)/,Qe=/^--/,Je={position:"absolute",visibility:"hidden",display:"block"},Ke={letterSpacing:"0",fontWeight:"400"};function Ze(e,t,n){var r=ne.exec(t);return r?Math.max(0,r[2]-(n||0))+(r[3]||"px"):t}function et(e,t,n,r,i,o){var a="width"===t?1:0,s=0,u=0;if(n===(r?"border":"content"))return 0;for(;a<4;a+=2)"margin"===n&&(u+=k.css(e,n+re[a],!0,i)),r?("content"===n&&(u-=k.css(e,"padding"+re[a],!0,i)),"margin"!==n&&(u-=k.css(e,"border"+re[a]+"Width",!0,i))):(u+=k.css(e,"padding"+re[a],!0,i),"padding"!==n?u+=k.css(e,"border"+re[a]+"Width",!0,i):s+=k.css(e,"border"+re[a]+"Width",!0,i));return!r&&0<=o&&(u+=Math.max(0,Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-o-u-s-.5))||0),u}function tt(e,t,n){var r=Fe(e),i=(!y.boxSizingReliable()||n)&&"border-box"===k.css(e,"boxSizing",!1,r),o=i,a=_e(e,t,r),s="offset"+t[0].toUpperCase()+t.slice(1);if($e.test(a)){if(!n)return a;a="auto"}return(!y.boxSizingReliable()&&i||"auto"===a||!parseFloat(a)&&"inline"===k.css(e,"display",!1,r))&&e.getClientRects().length&&(i="border-box"===k.css(e,"boxSizing",!1,r),(o=s in e)&&(a=e[s])),(a=parseFloat(a)||0)+et(e,t,n||(i?"border":"content"),o,r,a)+"px"}function nt(e,t,n,r,i){return new nt.prototype.init(e,t,n,r,i)}k.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=_e(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,gridArea:!0,gridColumn:!0,gridColumnEnd:!0,gridColumnStart:!0,gridRow:!0,gridRowEnd:!0,gridRowStart:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=V(t),u=Qe.test(t),l=e.style;if(u||(t=Ge(s)),a=k.cssHooks[t]||k.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:l[t];"string"===(o=typeof n)&&(i=ne.exec(n))&&i[1]&&(n=le(e,t,i),o="number"),null!=n&&n==n&&("number"!==o||u||(n+=i&&i[3]||(k.cssNumber[s]?"":"px")),y.clearCloneStyle||""!==n||0!==t.indexOf("background")||(l[t]="inherit"),a&&"set"in a&&void 0===(n=a.set(e,n,r))||(u?l.setProperty(t,n):l[t]=n))}},css:function(e,t,n,r){var i,o,a,s=V(t);return Qe.test(t)||(t=Ge(s)),(a=k.cssHooks[t]||k.cssHooks[s])&&"get"in a&&(i=a.get(e,!0,n)),void 0===i&&(i=_e(e,t,r)),"normal"===i&&t in Ke&&(i=Ke[t]),""===n||n?(o=parseFloat(i),!0===n||isFinite(o)?o||0:i):i}}),k.each(["height","width"],function(e,u){k.cssHooks[u]={get:function(e,t,n){if(t)return!Ye.test(k.css(e,"display"))||e.getClientRects().length&&e.getBoundingClientRect().width?tt(e,u,n):ue(e,Je,function(){return tt(e,u,n)})},set:function(e,t,n){var r,i=Fe(e),o=!y.scrollboxSize()&&"absolute"===i.position,a=(o||n)&&"border-box"===k.css(e,"boxSizing",!1,i),s=n?et(e,u,n,a,i):0;return a&&o&&(s-=Math.ceil(e["offset"+u[0].toUpperCase()+u.slice(1)]-parseFloat(i[u])-et(e,u,"border",!1,i)-.5)),s&&(r=ne.exec(t))&&"px"!==(r[3]||"px")&&(e.style[u]=t,t=k.css(e,u)),Ze(0,t,s)}}}),k.cssHooks.marginLeft=ze(y.reliableMarginLeft,function(e,t){if(t)return(parseFloat(_e(e,"marginLeft"))||e.getBoundingClientRect().left-ue(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}))+"px"}),k.each({margin:"",padding:"",border:"Width"},function(i,o){k.cssHooks[i+o]={expand:function(e){for(var t=0,n={},r="string"==typeof e?e.split(" "):[e];t<4;t++)n[i+re[t]+o]=r[t]||r[t-2]||r[0];return n}},"margin"!==i&&(k.cssHooks[i+o].set=Ze)}),k.fn.extend({css:function(e,t){return _(this,function(e,t,n){var r,i,o={},a=0;if(Array.isArray(t)){for(r=Fe(e),i=t.length;a<i;a++)o[t[a]]=k.css(e,t[a],!1,r);return o}return void 0!==n?k.style(e,t,n):k.css(e,t)},e,t,1<arguments.length)}}),((k.Tween=nt).prototype={constructor:nt,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||k.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(k.cssNumber[n]?"":"px")},cur:function(){var e=nt.propHooks[this.prop];return e&&e.get?e.get(this):nt.propHooks._default.get(this)},run:function(e){var t,n=nt.propHooks[this.prop];return this.options.duration?this.pos=t=k.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):nt.propHooks._default.set(this),this}}).init.prototype=nt.prototype,(nt.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=k.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){k.fx.step[e.prop]?k.fx.step[e.prop](e):1!==e.elem.nodeType||!k.cssHooks[e.prop]&&null==e.elem.style[Ge(e.prop)]?e.elem[e.prop]=e.now:k.style(e.elem,e.prop,e.now+e.unit)}}}).scrollTop=nt.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},k.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},k.fx=nt.prototype.init,k.fx.step={};var rt,it,ot,at,st=/^(?:toggle|show|hide)$/,ut=/queueHooks$/;function lt(){it&&(!1===E.hidden&&C.requestAnimationFrame?C.requestAnimationFrame(lt):C.setTimeout(lt,k.fx.interval),k.fx.tick())}function ct(){return C.setTimeout(function(){rt=void 0}),rt=Date.now()}function ft(e,t){var n,r=0,i={height:e};for(t=t?1:0;r<4;r+=2-t)i["margin"+(n=re[r])]=i["padding"+n]=e;return t&&(i.opacity=i.width=e),i}function pt(e,t,n){for(var r,i=(dt.tweeners[t]||[]).concat(dt.tweeners["*"]),o=0,a=i.length;o<a;o++)if(r=i[o].call(n,t,e))return r}function dt(o,e,t){var n,a,r=0,i=dt.prefilters.length,s=k.Deferred().always(function(){delete u.elem}),u=function(){if(a)return!1;for(var e=rt||ct(),t=Math.max(0,l.startTime+l.duration-e),n=1-(t/l.duration||0),r=0,i=l.tweens.length;r<i;r++)l.tweens[r].run(n);return s.notifyWith(o,[l,n,t]),n<1&&i?t:(i||s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l]),!1)},l=s.promise({elem:o,props:k.extend({},e),opts:k.extend(!0,{specialEasing:{},easing:k.easing._default},t),originalProperties:e,originalOptions:t,startTime:rt||ct(),duration:t.duration,tweens:[],createTween:function(e,t){var n=k.Tween(o,l.opts,e,t,l.opts.specialEasing[e]||l.opts.easing);return l.tweens.push(n),n},stop:function(e){var t=0,n=e?l.tweens.length:0;if(a)return this;for(a=!0;t<n;t++)l.tweens[t].run(1);return e?(s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l,e])):s.rejectWith(o,[l,e]),this}}),c=l.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(i=t[r=V(n)],o=e[n],Array.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=k.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(c,l.opts.specialEasing);r<i;r++)if(n=dt.prefilters[r].call(l,o,c,l.opts))return m(n.stop)&&(k._queueHooks(l.elem,l.opts.queue).stop=n.stop.bind(n)),n;return k.map(c,pt,l),m(l.opts.start)&&l.opts.start.call(o,l),l.progress(l.opts.progress).done(l.opts.done,l.opts.complete).fail(l.opts.fail).always(l.opts.always),k.fx.timer(k.extend(u,{elem:o,anim:l,queue:l.opts.queue})),l}k.Animation=k.extend(dt,{tweeners:{"*":[function(e,t){var n=this.createTween(e,t);return le(n.elem,e,ne.exec(t),n),n}]},tweener:function(e,t){m(e)?(t=e,e=["*"]):e=e.match(R);for(var n,r=0,i=e.length;r<i;r++)n=e[r],dt.tweeners[n]=dt.tweeners[n]||[],dt.tweeners[n].unshift(t)},prefilters:[function(e,t,n){var r,i,o,a,s,u,l,c,f="width"in t||"height"in t,p=this,d={},h=e.style,g=e.nodeType&&se(e),v=Q.get(e,"fxshow");for(r in n.queue||(null==(a=k._queueHooks(e,"fx")).unqueued&&(a.unqueued=0,s=a.empty.fire,a.empty.fire=function(){a.unqueued||s()}),a.unqueued++,p.always(function(){p.always(function(){a.unqueued--,k.queue(e,"fx").length||a.empty.fire()})})),t)if(i=t[r],st.test(i)){if(delete t[r],o=o||"toggle"===i,i===(g?"hide":"show")){if("show"!==i||!v||void 0===v[r])continue;g=!0}d[r]=v&&v[r]||k.style(e,r)}if((u=!k.isEmptyObject(t))||!k.isEmptyObject(d))for(r in f&&1===e.nodeType&&(n.overflow=[h.overflow,h.overflowX,h.overflowY],null==(l=v&&v.display)&&(l=Q.get(e,"display")),"none"===(c=k.css(e,"display"))&&(l?c=l:(fe([e],!0),l=e.style.display||l,c=k.css(e,"display"),fe([e]))),("inline"===c||"inline-block"===c&&null!=l)&&"none"===k.css(e,"float")&&(u||(p.done(function(){h.display=l}),null==l&&(c=h.display,l="none"===c?"":c)),h.display="inline-block")),n.overflow&&(h.overflow="hidden",p.always(function(){h.overflow=n.overflow[0],h.overflowX=n.overflow[1],h.overflowY=n.overflow[2]})),u=!1,d)u||(v?"hidden"in v&&(g=v.hidden):v=Q.access(e,"fxshow",{display:l}),o&&(v.hidden=!g),g&&fe([e],!0),p.done(function(){for(r in g||fe([e]),Q.remove(e,"fxshow"),d)k.style(e,r,d[r])})),u=pt(g?v[r]:0,r,p),r in v||(v[r]=u.start,g&&(u.end=u.start,u.start=0))}],prefilter:function(e,t){t?dt.prefilters.unshift(e):dt.prefilters.push(e)}}),k.speed=function(e,t,n){var r=e&&"object"==typeof e?k.extend({},e):{complete:n||!n&&t||m(e)&&e,duration:e,easing:n&&t||t&&!m(t)&&t};return k.fx.off?r.duration=0:"number"!=typeof r.duration&&(r.duration in k.fx.speeds?r.duration=k.fx.speeds[r.duration]:r.duration=k.fx.speeds._default),null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){m(r.old)&&r.old.call(this),r.queue&&k.dequeue(this,r.queue)},r},k.fn.extend({fadeTo:function(e,t,n,r){return this.filter(se).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(t,e,n,r){var i=k.isEmptyObject(t),o=k.speed(e,n,r),a=function(){var e=dt(this,k.extend({},t),o);(i||Q.get(this,"finish"))&&e.stop(!0)};return a.finish=a,i||!1===o.queue?this.each(a):this.queue(o.queue,a)},stop:function(i,e,o){var a=function(e){var t=e.stop;delete e.stop,t(o)};return"string"!=typeof i&&(o=e,e=i,i=void 0),e&&!1!==i&&this.queue(i||"fx",[]),this.each(function(){var e=!0,t=null!=i&&i+"queueHooks",n=k.timers,r=Q.get(this);if(t)r[t]&&r[t].stop&&a(r[t]);else for(t in r)r[t]&&r[t].stop&&ut.test(t)&&a(r[t]);for(t=n.length;t--;)n[t].elem!==this||null!=i&&n[t].queue!==i||(n[t].anim.stop(o),e=!1,n.splice(t,1));!e&&o||k.dequeue(this,i)})},finish:function(a){return!1!==a&&(a=a||"fx"),this.each(function(){var e,t=Q.get(this),n=t[a+"queue"],r=t[a+"queueHooks"],i=k.timers,o=n?n.length:0;for(t.finish=!0,k.queue(this,a,[]),r&&r.stop&&r.stop.call(this,!0),e=i.length;e--;)i[e].elem===this&&i[e].queue===a&&(i[e].anim.stop(!0),i.splice(e,1));for(e=0;e<o;e++)n[e]&&n[e].finish&&n[e].finish.call(this);delete t.finish})}}),k.each(["toggle","show","hide"],function(e,r){var i=k.fn[r];k.fn[r]=function(e,t,n){return null==e||"boolean"==typeof e?i.apply(this,arguments):this.animate(ft(r,!0),e,t,n)}}),k.each({slideDown:ft("show"),slideUp:ft("hide"),slideToggle:ft("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,r){k.fn[e]=function(e,t,n){return this.animate(r,e,t,n)}}),k.timers=[],k.fx.tick=function(){var e,t=0,n=k.timers;for(rt=Date.now();t<n.length;t++)(e=n[t])()||n[t]!==e||n.splice(t--,1);n.length||k.fx.stop(),rt=void 0},k.fx.timer=function(e){k.timers.push(e),k.fx.start()},k.fx.interval=13,k.fx.start=function(){it||(it=!0,lt())},k.fx.stop=function(){it=null},k.fx.speeds={slow:600,fast:200,_default:400},k.fn.delay=function(r,e){return r=k.fx&&k.fx.speeds[r]||r,e=e||"fx",this.queue(e,function(e,t){var n=C.setTimeout(e,r);t.stop=function(){C.clearTimeout(n)}})},ot=E.createElement("input"),at=E.createElement("select").appendChild(E.createElement("option")),ot.type="checkbox",y.checkOn=""!==ot.value,y.optSelected=at.selected,(ot=E.createElement("input")).value="t",ot.type="radio",y.radioValue="t"===ot.value;var ht,gt=k.expr.attrHandle;k.fn.extend({attr:function(e,t){return _(this,k.attr,e,t,1<arguments.length)},removeAttr:function(e){return this.each(function(){k.removeAttr(this,e)})}}),k.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return"undefined"==typeof e.getAttribute?k.prop(e,t,n):(1===o&&k.isXMLDoc(e)||(i=k.attrHooks[t.toLowerCase()]||(k.expr.match.bool.test(t)?ht:void 0)),void 0!==n?null===n?void k.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=k.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!y.radioValue&&"radio"===t&&A(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r=0,i=t&&t.match(R);if(i&&1===e.nodeType)while(n=i[r++])e.removeAttribute(n)}}),ht={set:function(e,t,n){return!1===t?k.removeAttr(e,n):e.setAttribute(n,n),n}},k.each(k.expr.match.bool.source.match(/\w+/g),function(e,t){var a=gt[t]||k.find.attr;gt[t]=function(e,t,n){var r,i,o=t.toLowerCase();return n||(i=gt[o],gt[o]=r,r=null!=a(e,t,n)?o:null,gt[o]=i),r}});var vt=/^(?:input|select|textarea|button)$/i,yt=/^(?:a|area)$/i;function mt(e){return(e.match(R)||[]).join(" ")}function xt(e){return e.getAttribute&&e.getAttribute("class")||""}function bt(e){return Array.isArray(e)?e:"string"==typeof e&&e.match(R)||[]}k.fn.extend({prop:function(e,t){return _(this,k.prop,e,t,1<arguments.length)},removeProp:function(e){return this.each(function(){delete this[k.propFix[e]||e]})}}),k.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&k.isXMLDoc(e)||(t=k.propFix[t]||t,i=k.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=k.find.attr(e,"tabindex");return t?parseInt(t,10):vt.test(e.nodeName)||yt.test(e.nodeName)&&e.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),y.optSelected||(k.propHooks.selected={get:function(e){var t=e.parentNode;return t&&t.parentNode&&t.parentNode.selectedIndex,null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),k.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){k.propFix[this.toLowerCase()]=this}),k.fn.extend({addClass:function(t){var e,n,r,i,o,a,s,u=0;if(m(t))return this.each(function(e){k(this).addClass(t.call(this,e,xt(this)))});if((e=bt(t)).length)while(n=this[u++])if(i=xt(n),r=1===n.nodeType&&" "+mt(i)+" "){a=0;while(o=e[a++])r.indexOf(" "+o+" ")<0&&(r+=o+" ");i!==(s=mt(r))&&n.setAttribute("class",s)}return this},removeClass:function(t){var e,n,r,i,o,a,s,u=0;if(m(t))return this.each(function(e){k(this).removeClass(t.call(this,e,xt(this)))});if(!arguments.length)return this.attr("class","");if((e=bt(t)).length)while(n=this[u++])if(i=xt(n),r=1===n.nodeType&&" "+mt(i)+" "){a=0;while(o=e[a++])while(-1<r.indexOf(" "+o+" "))r=r.replace(" "+o+" "," ");i!==(s=mt(r))&&n.setAttribute("class",s)}return this},toggleClass:function(i,t){var o=typeof i,a="string"===o||Array.isArray(i);return"boolean"==typeof t&&a?t?this.addClass(i):this.removeClass(i):m(i)?this.each(function(e){k(this).toggleClass(i.call(this,e,xt(this),t),t)}):this.each(function(){var e,t,n,r;if(a){t=0,n=k(this),r=bt(i);while(e=r[t++])n.hasClass(e)?n.removeClass(e):n.addClass(e)}else void 0!==i&&"boolean"!==o||((e=xt(this))&&Q.set(this,"__className__",e),this.setAttribute&&this.setAttribute("class",e||!1===i?"":Q.get(this,"__className__")||""))})},hasClass:function(e){var t,n,r=0;t=" "+e+" ";while(n=this[r++])if(1===n.nodeType&&-1<(" "+mt(xt(n))+" ").indexOf(t))return!0;return!1}});var wt=/\r/g;k.fn.extend({val:function(n){var r,e,i,t=this[0];return arguments.length?(i=m(n),this.each(function(e){var t;1===this.nodeType&&(null==(t=i?n.call(this,e,k(this).val()):n)?t="":"number"==typeof t?t+="":Array.isArray(t)&&(t=k.map(t,function(e){return null==e?"":e+""})),(r=k.valHooks[this.type]||k.valHooks[this.nodeName.toLowerCase()])&&"set"in r&&void 0!==r.set(this,t,"value")||(this.value=t))})):t?(r=k.valHooks[t.type]||k.valHooks[t.nodeName.toLowerCase()])&&"get"in r&&void 0!==(e=r.get(t,"value"))?e:"string"==typeof(e=t.value)?e.replace(wt,""):null==e?"":e:void 0}}),k.extend({valHooks:{option:{get:function(e){var t=k.find.attr(e,"value");return null!=t?t:mt(k.text(e))}},select:{get:function(e){var t,n,r,i=e.options,o=e.selectedIndex,a="select-one"===e.type,s=a?null:[],u=a?o+1:i.length;for(r=o<0?u:a?o:0;r<u;r++)if(((n=i[r]).selected||r===o)&&!n.disabled&&(!n.parentNode.disabled||!A(n.parentNode,"optgroup"))){if(t=k(n).val(),a)return t;s.push(t)}return s},set:function(e,t){var n,r,i=e.options,o=k.makeArray(t),a=i.length;while(a--)((r=i[a]).selected=-1<k.inArray(k.valHooks.option.get(r),o))&&(n=!0);return n||(e.selectedIndex=-1),o}}}}),k.each(["radio","checkbox"],function(){k.valHooks[this]={set:function(e,t){if(Array.isArray(t))return e.checked=-1<k.inArray(k(e).val(),t)}},y.checkOn||(k.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})}),y.focusin="onfocusin"in C;var Tt=/^(?:focusinfocus|focusoutblur)$/,Ct=function(e){e.stopPropagation()};k.extend(k.event,{trigger:function(e,t,n,r){var i,o,a,s,u,l,c,f,p=[n||E],d=v.call(e,"type")?e.type:e,h=v.call(e,"namespace")?e.namespace.split("."):[];if(o=f=a=n=n||E,3!==n.nodeType&&8!==n.nodeType&&!Tt.test(d+k.event.triggered)&&(-1<d.indexOf(".")&&(d=(h=d.split(".")).shift(),h.sort()),u=d.indexOf(":")<0&&"on"+d,(e=e[k.expando]?e:new k.Event(d,"object"==typeof e&&e)).isTrigger=r?2:3,e.namespace=h.join("."),e.rnamespace=e.namespace?new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,e.result=void 0,e.target||(e.target=n),t=null==t?[e]:k.makeArray(t,[e]),c=k.event.special[d]||{},r||!c.trigger||!1!==c.trigger.apply(n,t))){if(!r&&!c.noBubble&&!x(n)){for(s=c.delegateType||d,Tt.test(s+d)||(o=o.parentNode);o;o=o.parentNode)p.push(o),a=o;a===(n.ownerDocument||E)&&p.push(a.defaultView||a.parentWindow||C)}i=0;while((o=p[i++])&&!e.isPropagationStopped())f=o,e.type=1<i?s:c.bindType||d,(l=(Q.get(o,"events")||{})[e.type]&&Q.get(o,"handle"))&&l.apply(o,t),(l=u&&o[u])&&l.apply&&G(o)&&(e.result=l.apply(o,t),!1===e.result&&e.preventDefault());return e.type=d,r||e.isDefaultPrevented()||c._default&&!1!==c._default.apply(p.pop(),t)||!G(n)||u&&m(n[d])&&!x(n)&&((a=n[u])&&(n[u]=null),k.event.triggered=d,e.isPropagationStopped()&&f.addEventListener(d,Ct),n[d](),e.isPropagationStopped()&&f.removeEventListener(d,Ct),k.event.triggered=void 0,a&&(n[u]=a)),e.result}},simulate:function(e,t,n){var r=k.extend(new k.Event,n,{type:e,isSimulated:!0});k.event.trigger(r,null,t)}}),k.fn.extend({trigger:function(e,t){return this.each(function(){k.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return k.event.trigger(e,t,n,!0)}}),y.focusin||k.each({focus:"focusin",blur:"focusout"},function(n,r){var i=function(e){k.event.simulate(r,e.target,k.event.fix(e))};k.event.special[r]={setup:function(){var e=this.ownerDocument||this,t=Q.access(e,r);t||e.addEventListener(n,i,!0),Q.access(e,r,(t||0)+1)},teardown:function(){var e=this.ownerDocument||this,t=Q.access(e,r)-1;t?Q.access(e,r,t):(e.removeEventListener(n,i,!0),Q.remove(e,r))}}});var Et=C.location,kt=Date.now(),St=/\?/;k.parseXML=function(e){var t;if(!e||"string"!=typeof e)return null;try{t=(new C.DOMParser).parseFromString(e,"text/xml")}catch(e){t=void 0}return t&&!t.getElementsByTagName("parsererror").length||k.error("Invalid XML: "+e),t};var Nt=/\[\]$/,At=/\r?\n/g,Dt=/^(?:submit|button|image|reset|file)$/i,jt=/^(?:input|select|textarea|keygen)/i;function qt(n,e,r,i){var t;if(Array.isArray(e))k.each(e,function(e,t){r||Nt.test(n)?i(n,t):qt(n+"["+("object"==typeof t&&null!=t?e:"")+"]",t,r,i)});else if(r||"object"!==w(e))i(n,e);else for(t in e)qt(n+"["+t+"]",e[t],r,i)}k.param=function(e,t){var n,r=[],i=function(e,t){var n=m(t)?t():t;r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(null==n?"":n)};if(null==e)return"";if(Array.isArray(e)||e.jquery&&!k.isPlainObject(e))k.each(e,function(){i(this.name,this.value)});else for(n in e)qt(n,e[n],t,i);return r.join("&")},k.fn.extend({serialize:function(){return k.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=k.prop(this,"elements");return e?k.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!k(this).is(":disabled")&&jt.test(this.nodeName)&&!Dt.test(e)&&(this.checked||!pe.test(e))}).map(function(e,t){var n=k(this).val();return null==n?null:Array.isArray(n)?k.map(n,function(e){return{name:t.name,value:e.replace(At,"\r\n")}}):{name:t.name,value:n.replace(At,"\r\n")}}).get()}});var Lt=/%20/g,Ht=/#.*$/,Ot=/([?&])_=[^&]*/,Pt=/^(.*?):[ \t]*([^\r\n]*)$/gm,Rt=/^(?:GET|HEAD)$/,Mt=/^\/\//,It={},Wt={},$t="*/".concat("*"),Ft=E.createElement("a");function Bt(o){return function(e,t){"string"!=typeof e&&(t=e,e="*");var n,r=0,i=e.toLowerCase().match(R)||[];if(m(t))while(n=i[r++])"+"===n[0]?(n=n.slice(1)||"*",(o[n]=o[n]||[]).unshift(t)):(o[n]=o[n]||[]).push(t)}}function _t(t,i,o,a){var s={},u=t===Wt;function l(e){var r;return s[e]=!0,k.each(t[e]||[],function(e,t){var n=t(i,o,a);return"string"!=typeof n||u||s[n]?u?!(r=n):void 0:(i.dataTypes.unshift(n),l(n),!1)}),r}return l(i.dataTypes[0])||!s["*"]&&l("*")}function zt(e,t){var n,r,i=k.ajaxSettings.flatOptions||{};for(n in t)void 0!==t[n]&&((i[n]?e:r||(r={}))[n]=t[n]);return r&&k.extend(!0,e,r),e}Ft.href=Et.href,k.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Et.href,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(Et.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":$t,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":k.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?zt(zt(e,k.ajaxSettings),t):zt(k.ajaxSettings,e)},ajaxPrefilter:Bt(It),ajaxTransport:Bt(Wt),ajax:function(e,t){"object"==typeof e&&(t=e,e=void 0),t=t||{};var c,f,p,n,d,r,h,g,i,o,v=k.ajaxSetup({},t),y=v.context||v,m=v.context&&(y.nodeType||y.jquery)?k(y):k.event,x=k.Deferred(),b=k.Callbacks("once memory"),w=v.statusCode||{},a={},s={},u="canceled",T={readyState:0,getResponseHeader:function(e){var t;if(h){if(!n){n={};while(t=Pt.exec(p))n[t[1].toLowerCase()+" "]=(n[t[1].toLowerCase()+" "]||[]).concat(t[2])}t=n[e.toLowerCase()+" "]}return null==t?null:t.join(", ")},getAllResponseHeaders:function(){return h?p:null},setRequestHeader:function(e,t){return null==h&&(e=s[e.toLowerCase()]=s[e.toLowerCase()]||e,a[e]=t),this},overrideMimeType:function(e){return null==h&&(v.mimeType=e),this},statusCode:function(e){var t;if(e)if(h)T.always(e[T.status]);else for(t in e)w[t]=[w[t],e[t]];return this},abort:function(e){var t=e||u;return c&&c.abort(t),l(0,t),this}};if(x.promise(T),v.url=((e||v.url||Et.href)+"").replace(Mt,Et.protocol+"//"),v.type=t.method||t.type||v.method||v.type,v.dataTypes=(v.dataType||"*").toLowerCase().match(R)||[""],null==v.crossDomain){r=E.createElement("a");try{r.href=v.url,r.href=r.href,v.crossDomain=Ft.protocol+"//"+Ft.host!=r.protocol+"//"+r.host}catch(e){v.crossDomain=!0}}if(v.data&&v.processData&&"string"!=typeof v.data&&(v.data=k.param(v.data,v.traditional)),_t(It,v,t,T),h)return T;for(i in(g=k.event&&v.global)&&0==k.active++&&k.event.trigger("ajaxStart"),v.type=v.type.toUpperCase(),v.hasContent=!Rt.test(v.type),f=v.url.replace(Ht,""),v.hasContent?v.data&&v.processData&&0===(v.contentType||"").indexOf("application/x-www-form-urlencoded")&&(v.data=v.data.replace(Lt,"+")):(o=v.url.slice(f.length),v.data&&(v.processData||"string"==typeof v.data)&&(f+=(St.test(f)?"&":"?")+v.data,delete v.data),!1===v.cache&&(f=f.replace(Ot,"$1"),o=(St.test(f)?"&":"?")+"_="+kt+++o),v.url=f+o),v.ifModified&&(k.lastModified[f]&&T.setRequestHeader("If-Modified-Since",k.lastModified[f]),k.etag[f]&&T.setRequestHeader("If-None-Match",k.etag[f])),(v.data&&v.hasContent&&!1!==v.contentType||t.contentType)&&T.setRequestHeader("Content-Type",v.contentType),T.setRequestHeader("Accept",v.dataTypes[0]&&v.accepts[v.dataTypes[0]]?v.accepts[v.dataTypes[0]]+("*"!==v.dataTypes[0]?", "+$t+"; q=0.01":""):v.accepts["*"]),v.headers)T.setRequestHeader(i,v.headers[i]);if(v.beforeSend&&(!1===v.beforeSend.call(y,T,v)||h))return T.abort();if(u="abort",b.add(v.complete),T.done(v.success),T.fail(v.error),c=_t(Wt,v,t,T)){if(T.readyState=1,g&&m.trigger("ajaxSend",[T,v]),h)return T;v.async&&0<v.timeout&&(d=C.setTimeout(function(){T.abort("timeout")},v.timeout));try{h=!1,c.send(a,l)}catch(e){if(h)throw e;l(-1,e)}}else l(-1,"No Transport");function l(e,t,n,r){var i,o,a,s,u,l=t;h||(h=!0,d&&C.clearTimeout(d),c=void 0,p=r||"",T.readyState=0<e?4:0,i=200<=e&&e<300||304===e,n&&(s=function(e,t,n){var r,i,o,a,s=e.contents,u=e.dataTypes;while("*"===u[0])u.shift(),void 0===r&&(r=e.mimeType||t.getResponseHeader("Content-Type"));if(r)for(i in s)if(s[i]&&s[i].test(r)){u.unshift(i);break}if(u[0]in n)o=u[0];else{for(i in n){if(!u[0]||e.converters[i+" "+u[0]]){o=i;break}a||(a=i)}o=o||a}if(o)return o!==u[0]&&u.unshift(o),n[o]}(v,T,n)),s=function(e,t,n,r){var i,o,a,s,u,l={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)l[a.toLowerCase()]=e.converters[a];o=c.shift();while(o)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!u&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),u=o,o=c.shift())if("*"===o)o=u;else if("*"!==u&&u!==o){if(!(a=l[u+" "+o]||l["* "+o]))for(i in l)if((s=i.split(" "))[1]===o&&(a=l[u+" "+s[0]]||l["* "+s[0]])){!0===a?a=l[i]:!0!==l[i]&&(o=s[0],c.unshift(s[1]));break}if(!0!==a)if(a&&e["throws"])t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+u+" to "+o}}}return{state:"success",data:t}}(v,s,T,i),i?(v.ifModified&&((u=T.getResponseHeader("Last-Modified"))&&(k.lastModified[f]=u),(u=T.getResponseHeader("etag"))&&(k.etag[f]=u)),204===e||"HEAD"===v.type?l="nocontent":304===e?l="notmodified":(l=s.state,o=s.data,i=!(a=s.error))):(a=l,!e&&l||(l="error",e<0&&(e=0))),T.status=e,T.statusText=(t||l)+"",i?x.resolveWith(y,[o,l,T]):x.rejectWith(y,[T,l,a]),T.statusCode(w),w=void 0,g&&m.trigger(i?"ajaxSuccess":"ajaxError",[T,v,i?o:a]),b.fireWith(y,[T,l]),g&&(m.trigger("ajaxComplete",[T,v]),--k.active||k.event.trigger("ajaxStop")))}return T},getJSON:function(e,t,n){return k.get(e,t,n,"json")},getScript:function(e,t){return k.get(e,void 0,t,"script")}}),k.each(["get","post"],function(e,i){k[i]=function(e,t,n,r){return m(t)&&(r=r||n,n=t,t=void 0),k.ajax(k.extend({url:e,type:i,dataType:r,data:t,success:n},k.isPlainObject(e)&&e))}}),k._evalUrl=function(e,t){return k.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,converters:{"text script":function(){}},dataFilter:function(e){k.globalEval(e,t)}})},k.fn.extend({wrapAll:function(e){var t;return this[0]&&(m(e)&&(e=e.call(this[0])),t=k(e,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstElementChild)e=e.firstElementChild;return e}).append(this)),this},wrapInner:function(n){return m(n)?this.each(function(e){k(this).wrapInner(n.call(this,e))}):this.each(function(){var e=k(this),t=e.contents();t.length?t.wrapAll(n):e.append(n)})},wrap:function(t){var n=m(t);return this.each(function(e){k(this).wrapAll(n?t.call(this,e):t)})},unwrap:function(e){return this.parent(e).not("body").each(function(){k(this).replaceWith(this.childNodes)}),this}}),k.expr.pseudos.hidden=function(e){return!k.expr.pseudos.visible(e)},k.expr.pseudos.visible=function(e){return!!(e.offsetWidth||e.offsetHeight||e.getClientRects().length)},k.ajaxSettings.xhr=function(){try{return new C.XMLHttpRequest}catch(e){}};var Ut={0:200,1223:204},Xt=k.ajaxSettings.xhr();y.cors=!!Xt&&"withCredentials"in Xt,y.ajax=Xt=!!Xt,k.ajaxTransport(function(i){var o,a;if(y.cors||Xt&&!i.crossDomain)return{send:function(e,t){var n,r=i.xhr();if(r.open(i.type,i.url,i.async,i.username,i.password),i.xhrFields)for(n in i.xhrFields)r[n]=i.xhrFields[n];for(n in i.mimeType&&r.overrideMimeType&&r.overrideMimeType(i.mimeType),i.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest"),e)r.setRequestHeader(n,e[n]);o=function(e){return function(){o&&(o=a=r.onload=r.onerror=r.onabort=r.ontimeout=r.onreadystatechange=null,"abort"===e?r.abort():"error"===e?"number"!=typeof r.status?t(0,"error"):t(r.status,r.statusText):t(Ut[r.status]||r.status,r.statusText,"text"!==(r.responseType||"text")||"string"!=typeof r.responseText?{binary:r.response}:{text:r.responseText},r.getAllResponseHeaders()))}},r.onload=o(),a=r.onerror=r.ontimeout=o("error"),void 0!==r.onabort?r.onabort=a:r.onreadystatechange=function(){4===r.readyState&&C.setTimeout(function(){o&&a()})},o=o("abort");try{r.send(i.hasContent&&i.data||null)}catch(e){if(o)throw e}},abort:function(){o&&o()}}}),k.ajaxPrefilter(function(e){e.crossDomain&&(e.contents.script=!1)}),k.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return k.globalEval(e),e}}}),k.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET")}),k.ajaxTransport("script",function(n){var r,i;if(n.crossDomain||n.scriptAttrs)return{send:function(e,t){r=k("<script>").attr(n.scriptAttrs||{}).prop({charset:n.scriptCharset,src:n.url}).on("load error",i=function(e){r.remove(),i=null,e&&t("error"===e.type?404:200,e.type)}),E.head.appendChild(r[0])},abort:function(){i&&i()}}});var Vt,Gt=[],Yt=/(=)\?(?=&|$)|\?\?/;k.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Gt.pop()||k.expando+"_"+kt++;return this[e]=!0,e}}),k.ajaxPrefilter("json jsonp",function(e,t,n){var r,i,o,a=!1!==e.jsonp&&(Yt.test(e.url)?"url":"string"==typeof e.data&&0===(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&Yt.test(e.data)&&"data");if(a||"jsonp"===e.dataTypes[0])return r=e.jsonpCallback=m(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,a?e[a]=e[a].replace(Yt,"$1"+r):!1!==e.jsonp&&(e.url+=(St.test(e.url)?"&":"?")+e.jsonp+"="+r),e.converters["script json"]=function(){return o||k.error(r+" was not called"),o[0]},e.dataTypes[0]="json",i=C[r],C[r]=function(){o=arguments},n.always(function(){void 0===i?k(C).removeProp(r):C[r]=i,e[r]&&(e.jsonpCallback=t.jsonpCallback,Gt.push(r)),o&&m(i)&&i(o[0]),o=i=void 0}),"script"}),y.createHTMLDocument=((Vt=E.implementation.createHTMLDocument("").body).innerHTML="<form></form><form></form>",2===Vt.childNodes.length),k.parseHTML=function(e,t,n){return"string"!=typeof e?[]:("boolean"==typeof t&&(n=t,t=!1),t||(y.createHTMLDocument?((r=(t=E.implementation.createHTMLDocument("")).createElement("base")).href=E.location.href,t.head.appendChild(r)):t=E),o=!n&&[],(i=D.exec(e))?[t.createElement(i[1])]:(i=we([e],t,o),o&&o.length&&k(o).remove(),k.merge([],i.childNodes)));var r,i,o},k.fn.load=function(e,t,n){var r,i,o,a=this,s=e.indexOf(" ");return-1<s&&(r=mt(e.slice(s)),e=e.slice(0,s)),m(t)?(n=t,t=void 0):t&&"object"==typeof t&&(i="POST"),0<a.length&&k.ajax({url:e,type:i||"GET",dataType:"html",data:t}).done(function(e){o=arguments,a.html(r?k("<div>").append(k.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},k.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){k.fn[t]=function(e){return this.on(t,e)}}),k.expr.pseudos.animated=function(t){return k.grep(k.timers,function(e){return t===e.elem}).length},k.offset={setOffset:function(e,t,n){var r,i,o,a,s,u,l=k.css(e,"position"),c=k(e),f={};"static"===l&&(e.style.position="relative"),s=c.offset(),o=k.css(e,"top"),u=k.css(e,"left"),("absolute"===l||"fixed"===l)&&-1<(o+u).indexOf("auto")?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(u)||0),m(t)&&(t=t.call(e,n,k.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):c.css(f)}},k.fn.extend({offset:function(t){if(arguments.length)return void 0===t?this:this.each(function(e){k.offset.setOffset(this,t,e)});var e,n,r=this[0];return r?r.getClientRects().length?(e=r.getBoundingClientRect(),n=r.ownerDocument.defaultView,{top:e.top+n.pageYOffset,left:e.left+n.pageXOffset}):{top:0,left:0}:void 0},position:function(){if(this[0]){var e,t,n,r=this[0],i={top:0,left:0};if("fixed"===k.css(r,"position"))t=r.getBoundingClientRect();else{t=this.offset(),n=r.ownerDocument,e=r.offsetParent||n.documentElement;while(e&&(e===n.body||e===n.documentElement)&&"static"===k.css(e,"position"))e=e.parentNode;e&&e!==r&&1===e.nodeType&&((i=k(e).offset()).top+=k.css(e,"borderTopWidth",!0),i.left+=k.css(e,"borderLeftWidth",!0))}return{top:t.top-i.top-k.css(r,"marginTop",!0),left:t.left-i.left-k.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var e=this.offsetParent;while(e&&"static"===k.css(e,"position"))e=e.offsetParent;return e||ie})}}),k.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(t,i){var o="pageYOffset"===i;k.fn[t]=function(e){return _(this,function(e,t,n){var r;if(x(e)?r=e:9===e.nodeType&&(r=e.defaultView),void 0===n)return r?r[i]:e[t];r?r.scrollTo(o?r.pageXOffset:n,o?n:r.pageYOffset):e[t]=n},t,e,arguments.length)}}),k.each(["top","left"],function(e,n){k.cssHooks[n]=ze(y.pixelPosition,function(e,t){if(t)return t=_e(e,n),$e.test(t)?k(e).position()[n]+"px":t})}),k.each({Height:"height",Width:"width"},function(a,s){k.each({padding:"inner"+a,content:s,"":"outer"+a},function(r,o){k.fn[o]=function(e,t){var n=arguments.length&&(r||"boolean"!=typeof e),i=r||(!0===e||!0===t?"margin":"border");return _(this,function(e,t,n){var r;return x(e)?0===o.indexOf("outer")?e["inner"+a]:e.document.documentElement["client"+a]:9===e.nodeType?(r=e.documentElement,Math.max(e.body["scroll"+a],r["scroll"+a],e.body["offset"+a],r["offset"+a],r["client"+a])):void 0===n?k.css(e,t,i):k.style(e,t,n,i)},s,n?e:void 0,n)}})}),k.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,n){k.fn[n]=function(e,t){return 0<arguments.length?this.on(n,null,e,t):this.trigger(n)}}),k.fn.extend({hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}}),k.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)}}),k.proxy=function(e,t){var n,r,i;if("string"==typeof t&&(n=e[t],t=e,e=n),m(e))return r=s.call(arguments,2),(i=function(){return e.apply(t||this,r.concat(s.call(arguments)))}).guid=e.guid=e.guid||k.guid++,i},k.holdReady=function(e){e?k.readyWait++:k.ready(!0)},k.isArray=Array.isArray,k.parseJSON=JSON.parse,k.nodeName=A,k.isFunction=m,k.isWindow=x,k.camelCase=V,k.type=w,k.now=Date.now,k.isNumeric=function(e){var t=k.type(e);return("number"===t||"string"===t)&&!isNaN(e-parseFloat(e))},"function"==typeof define&&define.amd&&define("jquery",[],function(){return k});var Qt=C.jQuery,Jt=C.$;return k.noConflict=function(e){return C.$===k&&(C.$=Jt),e&&C.jQuery===k&&(C.jQuery=Qt),k},e||(C.jQuery=C.$=k),k}); diff --git a/docs/build/html/_static/language_data.js b/docs/build/html/_static/language_data.js new file mode 100644 index 0000000000000000000000000000000000000000..5266fb19ecb24d085a338bdace79a063326b1cff --- /dev/null +++ b/docs/build/html/_static/language_data.js @@ -0,0 +1,297 @@ +/* + * language_data.js + * ~~~~~~~~~~~~~~~~ + * + * This script contains the language-specific data used by searchtools.js, + * namely the list of stopwords, stemmer, scorer and splitter. + * + * :copyright: Copyright 2007-2019 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +var stopwords = ["a","and","are","as","at","be","but","by","for","if","in","into","is","it","near","no","not","of","on","or","such","that","the","their","then","there","these","they","this","to","was","will","with"]; + + +/* Non-minified version JS is _stemmer.js if file is provided */ +/** + * Porter Stemmer + */ +var Stemmer = function() { + + var step2list = { + ational: 'ate', + tional: 'tion', + enci: 'ence', + anci: 'ance', + izer: 'ize', + bli: 'ble', + alli: 'al', + entli: 'ent', + eli: 'e', + ousli: 'ous', + ization: 'ize', + ation: 'ate', + ator: 'ate', + alism: 'al', + iveness: 'ive', + fulness: 'ful', + ousness: 'ous', + aliti: 'al', + iviti: 'ive', + biliti: 'ble', + logi: 'log' + }; + + var step3list = { + icate: 'ic', + ative: '', + alize: 'al', + iciti: 'ic', + ical: 'ic', + ful: '', + ness: '' + }; + + var c = "[^aeiou]"; // consonant + var v = "[aeiouy]"; // vowel + var C = c + "[^aeiouy]*"; // consonant sequence + var V = v + "[aeiou]*"; // vowel sequence + + var mgr0 = "^(" + C + ")?" + V + C; // [C]VC... is m>0 + var meq1 = "^(" + C + ")?" + V + C + "(" + V + ")?$"; // [C]VC[V] is m=1 + var mgr1 = "^(" + C + ")?" + V + C + V + C; // [C]VCVC... is m>1 + var s_v = "^(" + C + ")?" + v; // vowel in stem + + this.stemWord = function (w) { + var stem; + var suffix; + var firstch; + var origword = w; + + if (w.length < 3) + return w; + + var re; + var re2; + var re3; + var re4; + + firstch = w.substr(0,1); + if (firstch == "y") + w = firstch.toUpperCase() + w.substr(1); + + // Step 1a + re = /^(.+?)(ss|i)es$/; + re2 = /^(.+?)([^s])s$/; + + if (re.test(w)) + w = w.replace(re,"$1$2"); + else if (re2.test(w)) + w = w.replace(re2,"$1$2"); + + // Step 1b + re = /^(.+?)eed$/; + re2 = /^(.+?)(ed|ing)$/; + if (re.test(w)) { + var fp = re.exec(w); + re = new RegExp(mgr0); + if (re.test(fp[1])) { + re = /.$/; + w = w.replace(re,""); + } + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1]; + re2 = new RegExp(s_v); + if (re2.test(stem)) { + w = stem; + re2 = /(at|bl|iz)$/; + re3 = new RegExp("([^aeiouylsz])\\1$"); + re4 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re2.test(w)) + w = w + "e"; + else if (re3.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + else if (re4.test(w)) + w = w + "e"; + } + } + + // Step 1c + re = /^(.+?)y$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(s_v); + if (re.test(stem)) + w = stem + "i"; + } + + // Step 2 + re = /^(.+?)(ational|tional|enci|anci|izer|bli|alli|entli|eli|ousli|ization|ation|ator|alism|iveness|fulness|ousness|aliti|iviti|biliti|logi)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step2list[suffix]; + } + + // Step 3 + re = /^(.+?)(icate|ative|alize|iciti|ical|ful|ness)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + suffix = fp[2]; + re = new RegExp(mgr0); + if (re.test(stem)) + w = stem + step3list[suffix]; + } + + // Step 4 + re = /^(.+?)(al|ance|ence|er|ic|able|ible|ant|ement|ment|ent|ou|ism|ate|iti|ous|ive|ize)$/; + re2 = /^(.+?)(s|t)(ion)$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + if (re.test(stem)) + w = stem; + } + else if (re2.test(w)) { + var fp = re2.exec(w); + stem = fp[1] + fp[2]; + re2 = new RegExp(mgr1); + if (re2.test(stem)) + w = stem; + } + + // Step 5 + re = /^(.+?)e$/; + if (re.test(w)) { + var fp = re.exec(w); + stem = fp[1]; + re = new RegExp(mgr1); + re2 = new RegExp(meq1); + re3 = new RegExp("^" + C + v + "[^aeiouwxy]$"); + if (re.test(stem) || (re2.test(stem) && !(re3.test(stem)))) + w = stem; + } + re = /ll$/; + re2 = new RegExp(mgr1); + if (re.test(w) && re2.test(w)) { + re = /.$/; + w = w.replace(re,""); + } + + // and turn initial Y back to y + if (firstch == "y") + w = firstch.toLowerCase() + w.substr(1); + return w; + } +} + + + + + +var splitChars = (function() { + var result = {}; + var singles = [96, 180, 187, 191, 215, 247, 749, 885, 903, 907, 909, 930, 1014, 1648, + 1748, 1809, 2416, 2473, 2481, 2526, 2601, 2609, 2612, 2615, 2653, 2702, + 2706, 2729, 2737, 2740, 2857, 2865, 2868, 2910, 2928, 2948, 2961, 2971, + 2973, 3085, 3089, 3113, 3124, 3213, 3217, 3241, 3252, 3295, 3341, 3345, + 3369, 3506, 3516, 3633, 3715, 3721, 3736, 3744, 3748, 3750, 3756, 3761, + 3781, 3912, 4239, 4347, 4681, 4695, 4697, 4745, 4785, 4799, 4801, 4823, + 4881, 5760, 5901, 5997, 6313, 7405, 8024, 8026, 8028, 8030, 8117, 8125, + 8133, 8181, 8468, 8485, 8487, 8489, 8494, 8527, 11311, 11359, 11687, 11695, + 11703, 11711, 11719, 11727, 11735, 12448, 12539, 43010, 43014, 43019, 43587, + 43696, 43713, 64286, 64297, 64311, 64317, 64319, 64322, 64325, 65141]; + var i, j, start, end; + for (i = 0; i < singles.length; i++) { + result[singles[i]] = true; + } + var ranges = [[0, 47], [58, 64], [91, 94], [123, 169], [171, 177], [182, 184], [706, 709], + [722, 735], [741, 747], [751, 879], [888, 889], [894, 901], [1154, 1161], + [1318, 1328], [1367, 1368], [1370, 1376], [1416, 1487], [1515, 1519], [1523, 1568], + [1611, 1631], [1642, 1645], [1750, 1764], [1767, 1773], [1789, 1790], [1792, 1807], + [1840, 1868], [1958, 1968], [1970, 1983], [2027, 2035], [2038, 2041], [2043, 2047], + [2070, 2073], [2075, 2083], [2085, 2087], [2089, 2307], [2362, 2364], [2366, 2383], + [2385, 2391], [2402, 2405], [2419, 2424], [2432, 2436], [2445, 2446], [2449, 2450], + [2483, 2485], [2490, 2492], [2494, 2509], [2511, 2523], [2530, 2533], [2546, 2547], + [2554, 2564], [2571, 2574], [2577, 2578], [2618, 2648], [2655, 2661], [2672, 2673], + [2677, 2692], [2746, 2748], [2750, 2767], [2769, 2783], [2786, 2789], [2800, 2820], + [2829, 2830], [2833, 2834], [2874, 2876], [2878, 2907], [2914, 2917], [2930, 2946], + [2955, 2957], [2966, 2968], [2976, 2978], [2981, 2983], [2987, 2989], [3002, 3023], + [3025, 3045], [3059, 3076], [3130, 3132], [3134, 3159], [3162, 3167], [3170, 3173], + [3184, 3191], [3199, 3204], [3258, 3260], [3262, 3293], [3298, 3301], [3312, 3332], + [3386, 3388], [3390, 3423], [3426, 3429], [3446, 3449], [3456, 3460], [3479, 3481], + [3518, 3519], [3527, 3584], [3636, 3647], [3655, 3663], [3674, 3712], [3717, 3718], + [3723, 3724], [3726, 3731], [3752, 3753], [3764, 3772], [3774, 3775], [3783, 3791], + [3802, 3803], [3806, 3839], [3841, 3871], [3892, 3903], [3949, 3975], [3980, 4095], + [4139, 4158], [4170, 4175], [4182, 4185], [4190, 4192], [4194, 4196], [4199, 4205], + [4209, 4212], [4226, 4237], [4250, 4255], [4294, 4303], [4349, 4351], [4686, 4687], + [4702, 4703], [4750, 4751], [4790, 4791], [4806, 4807], [4886, 4887], [4955, 4968], + [4989, 4991], [5008, 5023], [5109, 5120], [5741, 5742], [5787, 5791], [5867, 5869], + [5873, 5887], [5906, 5919], [5938, 5951], [5970, 5983], [6001, 6015], [6068, 6102], + [6104, 6107], [6109, 6111], [6122, 6127], [6138, 6159], [6170, 6175], [6264, 6271], + [6315, 6319], [6390, 6399], [6429, 6469], [6510, 6511], [6517, 6527], [6572, 6592], + [6600, 6607], [6619, 6655], [6679, 6687], [6741, 6783], [6794, 6799], [6810, 6822], + [6824, 6916], [6964, 6980], [6988, 6991], [7002, 7042], [7073, 7085], [7098, 7167], + [7204, 7231], [7242, 7244], [7294, 7400], [7410, 7423], [7616, 7679], [7958, 7959], + [7966, 7967], [8006, 8007], [8014, 8015], [8062, 8063], [8127, 8129], [8141, 8143], + [8148, 8149], [8156, 8159], [8173, 8177], [8189, 8303], [8306, 8307], [8314, 8318], + [8330, 8335], [8341, 8449], [8451, 8454], [8456, 8457], [8470, 8472], [8478, 8483], + [8506, 8507], [8512, 8516], [8522, 8525], [8586, 9311], [9372, 9449], [9472, 10101], + [10132, 11263], [11493, 11498], [11503, 11516], [11518, 11519], [11558, 11567], + [11622, 11630], [11632, 11647], [11671, 11679], [11743, 11822], [11824, 12292], + [12296, 12320], [12330, 12336], [12342, 12343], [12349, 12352], [12439, 12444], + [12544, 12548], [12590, 12592], [12687, 12689], [12694, 12703], [12728, 12783], + [12800, 12831], [12842, 12880], [12896, 12927], [12938, 12976], [12992, 13311], + [19894, 19967], [40908, 40959], [42125, 42191], [42238, 42239], [42509, 42511], + [42540, 42559], [42592, 42593], [42607, 42622], [42648, 42655], [42736, 42774], + [42784, 42785], [42889, 42890], [42893, 43002], [43043, 43055], [43062, 43071], + [43124, 43137], [43188, 43215], [43226, 43249], [43256, 43258], [43260, 43263], + [43302, 43311], [43335, 43359], [43389, 43395], [43443, 43470], [43482, 43519], + [43561, 43583], [43596, 43599], [43610, 43615], [43639, 43641], [43643, 43647], + [43698, 43700], [43703, 43704], [43710, 43711], [43715, 43738], [43742, 43967], + [44003, 44015], [44026, 44031], [55204, 55215], [55239, 55242], [55292, 55295], + [57344, 63743], [64046, 64047], [64110, 64111], [64218, 64255], [64263, 64274], + [64280, 64284], [64434, 64466], [64830, 64847], [64912, 64913], [64968, 65007], + [65020, 65135], [65277, 65295], [65306, 65312], [65339, 65344], [65371, 65381], + [65471, 65473], [65480, 65481], [65488, 65489], [65496, 65497]]; + for (i = 0; i < ranges.length; i++) { + start = ranges[i][0]; + end = ranges[i][1]; + for (j = start; j <= end; j++) { + result[j] = true; + } + } + return result; +})(); + +function splitQuery(query) { + var result = []; + var start = -1; + for (var i = 0; i < query.length; i++) { + if (splitChars[query.charCodeAt(i)]) { + if (start !== -1) { + result.push(query.slice(start, i)); + start = -1; + } + } else if (start === -1) { + start = i; + } + } + if (start !== -1) { + result.push(query.slice(start)); + } + return result; +} + + diff --git a/docs/build/html/_static/minus.png b/docs/build/html/_static/minus.png new file mode 100644 index 0000000000000000000000000000000000000000..d96755fdaf8bb2214971e0db9c1fd3077d7c419d Binary files /dev/null and b/docs/build/html/_static/minus.png differ diff --git a/docs/build/html/_static/plus.png b/docs/build/html/_static/plus.png new file mode 100644 index 0000000000000000000000000000000000000000..7107cec93a979b9a5f64843235a16651d563ce2d Binary files /dev/null and b/docs/build/html/_static/plus.png differ diff --git a/docs/build/html/_static/pygments.css b/docs/build/html/_static/pygments.css new file mode 100644 index 0000000000000000000000000000000000000000..dd6621d88490a2b4e309579bce71d0638564fefe --- /dev/null +++ b/docs/build/html/_static/pygments.css @@ -0,0 +1,77 @@ +.highlight .hll { background-color: #ffffcc } +.highlight { background: #f8f8f8; } +.highlight .c { color: #8f5902; font-style: italic } /* Comment */ +.highlight .err { color: #a40000; border: 1px solid #ef2929 } /* Error */ +.highlight .g { color: #000000 } /* Generic */ +.highlight .k { color: #004461; font-weight: bold } /* Keyword */ +.highlight .l { color: #000000 } /* Literal */ +.highlight .n { color: #000000 } /* Name */ +.highlight .o { color: #582800 } /* Operator */ +.highlight .x { color: #000000 } /* Other */ +.highlight .p { color: #000000; font-weight: bold } /* Punctuation */ +.highlight .ch { color: #8f5902; font-style: italic } /* Comment.Hashbang */ +.highlight .cm { color: #8f5902; font-style: italic } /* Comment.Multiline */ +.highlight .cp { color: #8f5902 } /* Comment.Preproc */ +.highlight .cpf { color: #8f5902; font-style: italic } /* Comment.PreprocFile */ +.highlight .c1 { color: #8f5902; font-style: italic } /* Comment.Single */ +.highlight .cs { color: #8f5902; font-style: italic } /* Comment.Special */ +.highlight .gd { color: #a40000 } /* Generic.Deleted */ +.highlight .ge { color: #000000; font-style: italic } /* Generic.Emph */ +.highlight .gr { color: #ef2929 } /* Generic.Error */ +.highlight .gh { color: #000080; font-weight: bold } /* Generic.Heading */ +.highlight .gi { color: #00A000 } /* Generic.Inserted */ +.highlight .go { color: #888888 } /* Generic.Output */ +.highlight .gp { color: #745334 } /* Generic.Prompt */ +.highlight .gs { color: #000000; font-weight: bold } /* Generic.Strong */ +.highlight .gu { color: #800080; font-weight: bold } /* Generic.Subheading */ +.highlight .gt { color: #a40000; font-weight: bold } /* Generic.Traceback */ +.highlight .kc { color: #004461; font-weight: bold } /* Keyword.Constant */ +.highlight .kd { color: #004461; font-weight: bold } /* Keyword.Declaration */ +.highlight .kn { color: #004461; font-weight: bold } /* Keyword.Namespace */ +.highlight .kp { color: #004461; font-weight: bold } /* Keyword.Pseudo */ +.highlight .kr { color: #004461; font-weight: bold } /* Keyword.Reserved */ +.highlight .kt { color: #004461; font-weight: bold } /* Keyword.Type */ +.highlight .ld { color: #000000 } /* Literal.Date */ +.highlight .m { color: #990000 } /* Literal.Number */ +.highlight .s { color: #4e9a06 } /* Literal.String */ +.highlight .na { color: #c4a000 } /* Name.Attribute */ +.highlight .nb { color: #004461 } /* Name.Builtin */ +.highlight .nc { color: #000000 } /* Name.Class */ +.highlight .no { color: #000000 } /* Name.Constant */ +.highlight .nd { color: #888888 } /* Name.Decorator */ +.highlight .ni { color: #ce5c00 } /* Name.Entity */ +.highlight .ne { color: #cc0000; font-weight: bold } /* Name.Exception */ +.highlight .nf { color: #000000 } /* Name.Function */ +.highlight .nl { color: #f57900 } /* Name.Label */ +.highlight .nn { color: #000000 } /* Name.Namespace */ +.highlight .nx { color: #000000 } /* Name.Other */ +.highlight .py { color: #000000 } /* Name.Property */ +.highlight .nt { color: #004461; font-weight: bold } /* Name.Tag */ +.highlight .nv { color: #000000 } /* Name.Variable */ +.highlight .ow { color: #004461; font-weight: bold } /* Operator.Word */ +.highlight .w { color: #f8f8f8; text-decoration: underline } /* Text.Whitespace */ +.highlight .mb { color: #990000 } /* Literal.Number.Bin */ +.highlight .mf { color: #990000 } /* Literal.Number.Float */ +.highlight .mh { color: #990000 } /* Literal.Number.Hex */ +.highlight .mi { color: #990000 } /* Literal.Number.Integer */ +.highlight .mo { color: #990000 } /* Literal.Number.Oct */ +.highlight .sa { color: #4e9a06 } /* Literal.String.Affix */ +.highlight .sb { color: #4e9a06 } /* Literal.String.Backtick */ +.highlight .sc { color: #4e9a06 } /* Literal.String.Char */ +.highlight .dl { color: #4e9a06 } /* Literal.String.Delimiter */ +.highlight .sd { color: #8f5902; font-style: italic } /* Literal.String.Doc */ +.highlight .s2 { color: #4e9a06 } /* Literal.String.Double */ +.highlight .se { color: #4e9a06 } /* Literal.String.Escape */ +.highlight .sh { color: #4e9a06 } /* Literal.String.Heredoc */ +.highlight .si { color: #4e9a06 } /* Literal.String.Interpol */ +.highlight .sx { color: #4e9a06 } /* Literal.String.Other */ +.highlight .sr { color: #4e9a06 } /* Literal.String.Regex */ +.highlight .s1 { color: #4e9a06 } /* Literal.String.Single */ +.highlight .ss { color: #4e9a06 } /* Literal.String.Symbol */ +.highlight .bp { color: #3465a4 } /* Name.Builtin.Pseudo */ +.highlight .fm { color: #000000 } /* Name.Function.Magic */ +.highlight .vc { color: #000000 } /* Name.Variable.Class */ +.highlight .vg { color: #000000 } /* Name.Variable.Global */ +.highlight .vi { color: #000000 } /* Name.Variable.Instance */ +.highlight .vm { color: #000000 } /* Name.Variable.Magic */ +.highlight .il { color: #990000 } /* Literal.Number.Integer.Long */ \ No newline at end of file diff --git a/docs/build/html/_static/searchtools.js b/docs/build/html/_static/searchtools.js new file mode 100644 index 0000000000000000000000000000000000000000..6031f991319e4a258c6aba6ad0512fd7b91fe5cb --- /dev/null +++ b/docs/build/html/_static/searchtools.js @@ -0,0 +1,506 @@ +/* + * searchtools.js + * ~~~~~~~~~~~~~~~~ + * + * Sphinx JavaScript utilities for the full-text search. + * + * :copyright: Copyright 2007-2019 by the Sphinx team, see AUTHORS. + * :license: BSD, see LICENSE for details. + * + */ + +if (!Scorer) { + /** + * Simple result scoring code. + */ + var Scorer = { + // Implement the following function to further tweak the score for each result + // The function takes a result array [filename, title, anchor, descr, score] + // and returns the new score. + /* + score: function(result) { + return result[4]; + }, + */ + + // query matches the full name of an object + objNameMatch: 11, + // or matches in the last dotted part of the object name + objPartialMatch: 6, + // Additive scores depending on the priority of the object + objPrio: {0: 15, // used to be importantResults + 1: 5, // used to be objectResults + 2: -5}, // used to be unimportantResults + // Used when the priority is not in the mapping. + objPrioDefault: 0, + + // query found in title + title: 15, + partialTitle: 7, + // query found in terms + term: 5, + partialTerm: 2 + }; +} + +if (!splitQuery) { + function splitQuery(query) { + return query.split(/\s+/); + } +} + +/** + * Search Module + */ +var Search = { + + _index : null, + _queued_query : null, + _pulse_status : -1, + + htmlToText : function(htmlString) { + var htmlElement = document.createElement('span'); + htmlElement.innerHTML = htmlString; + $(htmlElement).find('.headerlink').remove(); + docContent = $(htmlElement).find('[role=main]')[0]; + return docContent.textContent || docContent.innerText; + }, + + init : function() { + var params = $.getQueryParameters(); + if (params.q) { + var query = params.q[0]; + $('input[name="q"]')[0].value = query; + this.performSearch(query); + } + }, + + loadIndex : function(url) { + $.ajax({type: "GET", url: url, data: null, + dataType: "script", cache: true, + complete: function(jqxhr, textstatus) { + if (textstatus != "success") { + document.getElementById("searchindexloader").src = url; + } + }}); + }, + + setIndex : function(index) { + var q; + this._index = index; + if ((q = this._queued_query) !== null) { + this._queued_query = null; + Search.query(q); + } + }, + + hasIndex : function() { + return this._index !== null; + }, + + deferQuery : function(query) { + this._queued_query = query; + }, + + stopPulse : function() { + this._pulse_status = 0; + }, + + startPulse : function() { + if (this._pulse_status >= 0) + return; + function pulse() { + var i; + Search._pulse_status = (Search._pulse_status + 1) % 4; + var dotString = ''; + for (i = 0; i < Search._pulse_status; i++) + dotString += '.'; + Search.dots.text(dotString); + if (Search._pulse_status > -1) + window.setTimeout(pulse, 500); + } + pulse(); + }, + + /** + * perform a search for something (or wait until index is loaded) + */ + performSearch : function(query) { + // create the required interface elements + this.out = $('#search-results'); + this.title = $('<h2>' + _('Searching') + '</h2>').appendTo(this.out); + this.dots = $('<span></span>').appendTo(this.title); + this.status = $('<p class="search-summary"> </p>').appendTo(this.out); + this.output = $('<ul class="search"/>').appendTo(this.out); + + $('#search-progress').text(_('Preparing search...')); + this.startPulse(); + + // index already loaded, the browser was quick! + if (this.hasIndex()) + this.query(query); + else + this.deferQuery(query); + }, + + /** + * execute search (requires search index to be loaded) + */ + query : function(query) { + var i; + + // stem the searchterms and add them to the correct list + var stemmer = new Stemmer(); + var searchterms = []; + var excluded = []; + var hlterms = []; + var tmp = splitQuery(query); + var objectterms = []; + for (i = 0; i < tmp.length; i++) { + if (tmp[i] !== "") { + objectterms.push(tmp[i].toLowerCase()); + } + + if ($u.indexOf(stopwords, tmp[i].toLowerCase()) != -1 || tmp[i].match(/^\d+$/) || + tmp[i] === "") { + // skip this "word" + continue; + } + // stem the word + var word = stemmer.stemWord(tmp[i].toLowerCase()); + // prevent stemmer from cutting word smaller than two chars + if(word.length < 3 && tmp[i].length >= 3) { + word = tmp[i]; + } + var toAppend; + // select the correct list + if (word[0] == '-') { + toAppend = excluded; + word = word.substr(1); + } + else { + toAppend = searchterms; + hlterms.push(tmp[i].toLowerCase()); + } + // only add if not already in the list + if (!$u.contains(toAppend, word)) + toAppend.push(word); + } + var highlightstring = '?highlight=' + $.urlencode(hlterms.join(" ")); + + // console.debug('SEARCH: searching for:'); + // console.info('required: ', searchterms); + // console.info('excluded: ', excluded); + + // prepare search + var terms = this._index.terms; + var titleterms = this._index.titleterms; + + // array of [filename, title, anchor, descr, score] + var results = []; + $('#search-progress').empty(); + + // lookup as object + for (i = 0; i < objectterms.length; i++) { + var others = [].concat(objectterms.slice(0, i), + objectterms.slice(i+1, objectterms.length)); + results = results.concat(this.performObjectSearch(objectterms[i], others)); + } + + // lookup as search terms in fulltext + results = results.concat(this.performTermsSearch(searchterms, excluded, terms, titleterms)); + + // let the scorer override scores with a custom scoring function + if (Scorer.score) { + for (i = 0; i < results.length; i++) + results[i][4] = Scorer.score(results[i]); + } + + // now sort the results by score (in opposite order of appearance, since the + // display function below uses pop() to retrieve items) and then + // alphabetically + results.sort(function(a, b) { + var left = a[4]; + var right = b[4]; + if (left > right) { + return 1; + } else if (left < right) { + return -1; + } else { + // same score: sort alphabetically + left = a[1].toLowerCase(); + right = b[1].toLowerCase(); + return (left > right) ? -1 : ((left < right) ? 1 : 0); + } + }); + + // for debugging + //Search.lastresults = results.slice(); // a copy + //console.info('search results:', Search.lastresults); + + // print the results + var resultCount = results.length; + function displayNextItem() { + // results left, load the summary and display it + if (results.length) { + var item = results.pop(); + var listItem = $('<li style="display:none"></li>'); + if (DOCUMENTATION_OPTIONS.FILE_SUFFIX === '') { + // dirhtml builder + var dirname = item[0] + '/'; + if (dirname.match(/\/index\/$/)) { + dirname = dirname.substring(0, dirname.length-6); + } else if (dirname == 'index/') { + dirname = ''; + } + listItem.append($('<a/>').attr('href', + DOCUMENTATION_OPTIONS.URL_ROOT + dirname + + highlightstring + item[2]).html(item[1])); + } else { + // normal html builders + listItem.append($('<a/>').attr('href', + item[0] + DOCUMENTATION_OPTIONS.FILE_SUFFIX + + highlightstring + item[2]).html(item[1])); + } + if (item[3]) { + listItem.append($('<span> (' + item[3] + ')</span>')); + Search.output.append(listItem); + listItem.slideDown(5, function() { + displayNextItem(); + }); + } else if (DOCUMENTATION_OPTIONS.HAS_SOURCE) { + $.ajax({url: DOCUMENTATION_OPTIONS.URL_ROOT + item[0] + DOCUMENTATION_OPTIONS.FILE_SUFFIX, + dataType: "text", + complete: function(jqxhr, textstatus) { + var data = jqxhr.responseText; + if (data !== '' && data !== undefined) { + listItem.append(Search.makeSearchSummary(data, searchterms, hlterms)); + } + Search.output.append(listItem); + listItem.slideDown(5, function() { + displayNextItem(); + }); + }}); + } else { + // no source available, just display title + Search.output.append(listItem); + listItem.slideDown(5, function() { + displayNextItem(); + }); + } + } + // search finished, update title and status message + else { + Search.stopPulse(); + Search.title.text(_('Search Results')); + if (!resultCount) + Search.status.text(_('Your search did not match any documents. Please make sure that all words are spelled correctly and that you\'ve selected enough categories.')); + else + Search.status.text(_('Search finished, found %s page(s) matching the search query.').replace('%s', resultCount)); + Search.status.fadeIn(500); + } + } + displayNextItem(); + }, + + /** + * search for object names + */ + performObjectSearch : function(object, otherterms) { + var filenames = this._index.filenames; + var docnames = this._index.docnames; + var objects = this._index.objects; + var objnames = this._index.objnames; + var titles = this._index.titles; + + var i; + var results = []; + + for (var prefix in objects) { + for (var name in objects[prefix]) { + var fullname = (prefix ? prefix + '.' : '') + name; + var fullnameLower = fullname.toLowerCase() + if (fullnameLower.indexOf(object) > -1) { + var score = 0; + var parts = fullnameLower.split('.'); + // check for different match types: exact matches of full name or + // "last name" (i.e. last dotted part) + if (fullnameLower == object || parts[parts.length - 1] == object) { + score += Scorer.objNameMatch; + // matches in last name + } else if (parts[parts.length - 1].indexOf(object) > -1) { + score += Scorer.objPartialMatch; + } + var match = objects[prefix][name]; + var objname = objnames[match[1]][2]; + var title = titles[match[0]]; + // If more than one term searched for, we require other words to be + // found in the name/title/description + if (otherterms.length > 0) { + var haystack = (prefix + ' ' + name + ' ' + + objname + ' ' + title).toLowerCase(); + var allfound = true; + for (i = 0; i < otherterms.length; i++) { + if (haystack.indexOf(otherterms[i]) == -1) { + allfound = false; + break; + } + } + if (!allfound) { + continue; + } + } + var descr = objname + _(', in ') + title; + + var anchor = match[3]; + if (anchor === '') + anchor = fullname; + else if (anchor == '-') + anchor = objnames[match[1]][1] + '-' + fullname; + // add custom score for some objects according to scorer + if (Scorer.objPrio.hasOwnProperty(match[2])) { + score += Scorer.objPrio[match[2]]; + } else { + score += Scorer.objPrioDefault; + } + results.push([docnames[match[0]], fullname, '#'+anchor, descr, score, filenames[match[0]]]); + } + } + } + + return results; + }, + + /** + * search for full-text terms in the index + */ + performTermsSearch : function(searchterms, excluded, terms, titleterms) { + var docnames = this._index.docnames; + var filenames = this._index.filenames; + var titles = this._index.titles; + + var i, j, file; + var fileMap = {}; + var scoreMap = {}; + var results = []; + + // perform the search on the required terms + for (i = 0; i < searchterms.length; i++) { + var word = searchterms[i]; + var files = []; + var _o = [ + {files: terms[word], score: Scorer.term}, + {files: titleterms[word], score: Scorer.title} + ]; + // add support for partial matches + if (word.length > 2) { + for (var w in terms) { + if (w.match(word) && !terms[word]) { + _o.push({files: terms[w], score: Scorer.partialTerm}) + } + } + for (var w in titleterms) { + if (w.match(word) && !titleterms[word]) { + _o.push({files: titleterms[w], score: Scorer.partialTitle}) + } + } + } + + // no match but word was a required one + if ($u.every(_o, function(o){return o.files === undefined;})) { + break; + } + // found search word in contents + $u.each(_o, function(o) { + var _files = o.files; + if (_files === undefined) + return + + if (_files.length === undefined) + _files = [_files]; + files = files.concat(_files); + + // set score for the word in each file to Scorer.term + for (j = 0; j < _files.length; j++) { + file = _files[j]; + if (!(file in scoreMap)) + scoreMap[file] = {} + scoreMap[file][word] = o.score; + } + }); + + // create the mapping + for (j = 0; j < files.length; j++) { + file = files[j]; + if (file in fileMap) + fileMap[file].push(word); + else + fileMap[file] = [word]; + } + } + + // now check if the files don't contain excluded terms + for (file in fileMap) { + var valid = true; + + // check if all requirements are matched + var filteredTermCount = // as search terms with length < 3 are discarded: ignore + searchterms.filter(function(term){return term.length > 2}).length + if ( + fileMap[file].length != searchterms.length && + fileMap[file].length != filteredTermCount + ) continue; + + // ensure that none of the excluded terms is in the search result + for (i = 0; i < excluded.length; i++) { + if (terms[excluded[i]] == file || + titleterms[excluded[i]] == file || + $u.contains(terms[excluded[i]] || [], file) || + $u.contains(titleterms[excluded[i]] || [], file)) { + valid = false; + break; + } + } + + // if we have still a valid result we can add it to the result list + if (valid) { + // select one (max) score for the file. + // for better ranking, we should calculate ranking by using words statistics like basic tf-idf... + var score = $u.max($u.map(fileMap[file], function(w){return scoreMap[file][w]})); + results.push([docnames[file], titles[file], '', null, score, filenames[file]]); + } + } + return results; + }, + + /** + * helper function to return a node containing the + * search summary for a given text. keywords is a list + * of stemmed words, hlwords is the list of normal, unstemmed + * words. the first one is used to find the occurrence, the + * latter for highlighting it. + */ + makeSearchSummary : function(htmlText, keywords, hlwords) { + var text = Search.htmlToText(htmlText); + var textLower = text.toLowerCase(); + var start = 0; + $.each(keywords, function() { + var i = textLower.indexOf(this.toLowerCase()); + if (i > -1) + start = i; + }); + start = Math.max(start - 120, 0); + var excerpt = ((start > 0) ? '...' : '') + + $.trim(text.substr(start, 240)) + + ((start + 240 - text.length) ? '...' : ''); + var rv = $('<div class="context"></div>').text(excerpt); + $.each(hlwords, function() { + rv = rv.highlightText(this, 'highlighted'); + }); + return rv; + } +}; + +$(document).ready(function() { + Search.init(); +}); diff --git a/docs/build/html/_static/underscore-1.3.1.js b/docs/build/html/_static/underscore-1.3.1.js new file mode 100644 index 0000000000000000000000000000000000000000..208d4cd890c3183d946092ebe982738ade565061 --- /dev/null +++ b/docs/build/html/_static/underscore-1.3.1.js @@ -0,0 +1,999 @@ +// Underscore.js 1.3.1 +// (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. +// Underscore is freely distributable under the MIT license. +// Portions of Underscore are inspired or borrowed from Prototype, +// Oliver Steele's Functional, and John Resig's Micro-Templating. +// For all details and documentation: +// http://documentcloud.github.com/underscore + +(function() { + + // Baseline setup + // -------------- + + // Establish the root object, `window` in the browser, or `global` on the server. + var root = this; + + // Save the previous value of the `_` variable. + var previousUnderscore = root._; + + // Establish the object that gets returned to break out of a loop iteration. + var breaker = {}; + + // Save bytes in the minified (but not gzipped) version: + var ArrayProto = Array.prototype, ObjProto = Object.prototype, FuncProto = Function.prototype; + + // Create quick reference variables for speed access to core prototypes. + var slice = ArrayProto.slice, + unshift = ArrayProto.unshift, + toString = ObjProto.toString, + hasOwnProperty = ObjProto.hasOwnProperty; + + // All **ECMAScript 5** native function implementations that we hope to use + // are declared here. + var + nativeForEach = ArrayProto.forEach, + nativeMap = ArrayProto.map, + nativeReduce = ArrayProto.reduce, + nativeReduceRight = ArrayProto.reduceRight, + nativeFilter = ArrayProto.filter, + nativeEvery = ArrayProto.every, + nativeSome = ArrayProto.some, + nativeIndexOf = ArrayProto.indexOf, + nativeLastIndexOf = ArrayProto.lastIndexOf, + nativeIsArray = Array.isArray, + nativeKeys = Object.keys, + nativeBind = FuncProto.bind; + + // Create a safe reference to the Underscore object for use below. + var _ = function(obj) { return new wrapper(obj); }; + + // Export the Underscore object for **Node.js**, with + // backwards-compatibility for the old `require()` API. If we're in + // the browser, add `_` as a global object via a string identifier, + // for Closure Compiler "advanced" mode. + if (typeof exports !== 'undefined') { + if (typeof module !== 'undefined' && module.exports) { + exports = module.exports = _; + } + exports._ = _; + } else { + root['_'] = _; + } + + // Current version. + _.VERSION = '1.3.1'; + + // Collection Functions + // -------------------- + + // The cornerstone, an `each` implementation, aka `forEach`. + // Handles objects with the built-in `forEach`, arrays, and raw objects. + // Delegates to **ECMAScript 5**'s native `forEach` if available. + var each = _.each = _.forEach = function(obj, iterator, context) { + if (obj == null) return; + if (nativeForEach && obj.forEach === nativeForEach) { + obj.forEach(iterator, context); + } else if (obj.length === +obj.length) { + for (var i = 0, l = obj.length; i < l; i++) { + if (i in obj && iterator.call(context, obj[i], i, obj) === breaker) return; + } + } else { + for (var key in obj) { + if (_.has(obj, key)) { + if (iterator.call(context, obj[key], key, obj) === breaker) return; + } + } + } + }; + + // Return the results of applying the iterator to each element. + // Delegates to **ECMAScript 5**'s native `map` if available. + _.map = _.collect = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + if (nativeMap && obj.map === nativeMap) return obj.map(iterator, context); + each(obj, function(value, index, list) { + results[results.length] = iterator.call(context, value, index, list); + }); + if (obj.length === +obj.length) results.length = obj.length; + return results; + }; + + // **Reduce** builds up a single result from a list of values, aka `inject`, + // or `foldl`. Delegates to **ECMAScript 5**'s native `reduce` if available. + _.reduce = _.foldl = _.inject = function(obj, iterator, memo, context) { + var initial = arguments.length > 2; + if (obj == null) obj = []; + if (nativeReduce && obj.reduce === nativeReduce) { + if (context) iterator = _.bind(iterator, context); + return initial ? obj.reduce(iterator, memo) : obj.reduce(iterator); + } + each(obj, function(value, index, list) { + if (!initial) { + memo = value; + initial = true; + } else { + memo = iterator.call(context, memo, value, index, list); + } + }); + if (!initial) throw new TypeError('Reduce of empty array with no initial value'); + return memo; + }; + + // The right-associative version of reduce, also known as `foldr`. + // Delegates to **ECMAScript 5**'s native `reduceRight` if available. + _.reduceRight = _.foldr = function(obj, iterator, memo, context) { + var initial = arguments.length > 2; + if (obj == null) obj = []; + if (nativeReduceRight && obj.reduceRight === nativeReduceRight) { + if (context) iterator = _.bind(iterator, context); + return initial ? obj.reduceRight(iterator, memo) : obj.reduceRight(iterator); + } + var reversed = _.toArray(obj).reverse(); + if (context && !initial) iterator = _.bind(iterator, context); + return initial ? _.reduce(reversed, iterator, memo, context) : _.reduce(reversed, iterator); + }; + + // Return the first value which passes a truth test. Aliased as `detect`. + _.find = _.detect = function(obj, iterator, context) { + var result; + any(obj, function(value, index, list) { + if (iterator.call(context, value, index, list)) { + result = value; + return true; + } + }); + return result; + }; + + // Return all the elements that pass a truth test. + // Delegates to **ECMAScript 5**'s native `filter` if available. + // Aliased as `select`. + _.filter = _.select = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + if (nativeFilter && obj.filter === nativeFilter) return obj.filter(iterator, context); + each(obj, function(value, index, list) { + if (iterator.call(context, value, index, list)) results[results.length] = value; + }); + return results; + }; + + // Return all the elements for which a truth test fails. + _.reject = function(obj, iterator, context) { + var results = []; + if (obj == null) return results; + each(obj, function(value, index, list) { + if (!iterator.call(context, value, index, list)) results[results.length] = value; + }); + return results; + }; + + // Determine whether all of the elements match a truth test. + // Delegates to **ECMAScript 5**'s native `every` if available. + // Aliased as `all`. + _.every = _.all = function(obj, iterator, context) { + var result = true; + if (obj == null) return result; + if (nativeEvery && obj.every === nativeEvery) return obj.every(iterator, context); + each(obj, function(value, index, list) { + if (!(result = result && iterator.call(context, value, index, list))) return breaker; + }); + return result; + }; + + // Determine if at least one element in the object matches a truth test. + // Delegates to **ECMAScript 5**'s native `some` if available. + // Aliased as `any`. + var any = _.some = _.any = function(obj, iterator, context) { + iterator || (iterator = _.identity); + var result = false; + if (obj == null) return result; + if (nativeSome && obj.some === nativeSome) return obj.some(iterator, context); + each(obj, function(value, index, list) { + if (result || (result = iterator.call(context, value, index, list))) return breaker; + }); + return !!result; + }; + + // Determine if a given value is included in the array or object using `===`. + // Aliased as `contains`. + _.include = _.contains = function(obj, target) { + var found = false; + if (obj == null) return found; + if (nativeIndexOf && obj.indexOf === nativeIndexOf) return obj.indexOf(target) != -1; + found = any(obj, function(value) { + return value === target; + }); + return found; + }; + + // Invoke a method (with arguments) on every item in a collection. + _.invoke = function(obj, method) { + var args = slice.call(arguments, 2); + return _.map(obj, function(value) { + return (_.isFunction(method) ? method || value : value[method]).apply(value, args); + }); + }; + + // Convenience version of a common use case of `map`: fetching a property. + _.pluck = function(obj, key) { + return _.map(obj, function(value){ return value[key]; }); + }; + + // Return the maximum element or (element-based computation). + _.max = function(obj, iterator, context) { + if (!iterator && _.isArray(obj)) return Math.max.apply(Math, obj); + if (!iterator && _.isEmpty(obj)) return -Infinity; + var result = {computed : -Infinity}; + each(obj, function(value, index, list) { + var computed = iterator ? iterator.call(context, value, index, list) : value; + computed >= result.computed && (result = {value : value, computed : computed}); + }); + return result.value; + }; + + // Return the minimum element (or element-based computation). + _.min = function(obj, iterator, context) { + if (!iterator && _.isArray(obj)) return Math.min.apply(Math, obj); + if (!iterator && _.isEmpty(obj)) return Infinity; + var result = {computed : Infinity}; + each(obj, function(value, index, list) { + var computed = iterator ? iterator.call(context, value, index, list) : value; + computed < result.computed && (result = {value : value, computed : computed}); + }); + return result.value; + }; + + // Shuffle an array. + _.shuffle = function(obj) { + var shuffled = [], rand; + each(obj, function(value, index, list) { + if (index == 0) { + shuffled[0] = value; + } else { + rand = Math.floor(Math.random() * (index + 1)); + shuffled[index] = shuffled[rand]; + shuffled[rand] = value; + } + }); + return shuffled; + }; + + // Sort the object's values by a criterion produced by an iterator. + _.sortBy = function(obj, iterator, context) { + return _.pluck(_.map(obj, function(value, index, list) { + return { + value : value, + criteria : iterator.call(context, value, index, list) + }; + }).sort(function(left, right) { + var a = left.criteria, b = right.criteria; + return a < b ? -1 : a > b ? 1 : 0; + }), 'value'); + }; + + // Groups the object's values by a criterion. Pass either a string attribute + // to group by, or a function that returns the criterion. + _.groupBy = function(obj, val) { + var result = {}; + var iterator = _.isFunction(val) ? val : function(obj) { return obj[val]; }; + each(obj, function(value, index) { + var key = iterator(value, index); + (result[key] || (result[key] = [])).push(value); + }); + return result; + }; + + // Use a comparator function to figure out at what index an object should + // be inserted so as to maintain order. Uses binary search. + _.sortedIndex = function(array, obj, iterator) { + iterator || (iterator = _.identity); + var low = 0, high = array.length; + while (low < high) { + var mid = (low + high) >> 1; + iterator(array[mid]) < iterator(obj) ? low = mid + 1 : high = mid; + } + return low; + }; + + // Safely convert anything iterable into a real, live array. + _.toArray = function(iterable) { + if (!iterable) return []; + if (iterable.toArray) return iterable.toArray(); + if (_.isArray(iterable)) return slice.call(iterable); + if (_.isArguments(iterable)) return slice.call(iterable); + return _.values(iterable); + }; + + // Return the number of elements in an object. + _.size = function(obj) { + return _.toArray(obj).length; + }; + + // Array Functions + // --------------- + + // Get the first element of an array. Passing **n** will return the first N + // values in the array. Aliased as `head`. The **guard** check allows it to work + // with `_.map`. + _.first = _.head = function(array, n, guard) { + return (n != null) && !guard ? slice.call(array, 0, n) : array[0]; + }; + + // Returns everything but the last entry of the array. Especcialy useful on + // the arguments object. Passing **n** will return all the values in + // the array, excluding the last N. The **guard** check allows it to work with + // `_.map`. + _.initial = function(array, n, guard) { + return slice.call(array, 0, array.length - ((n == null) || guard ? 1 : n)); + }; + + // Get the last element of an array. Passing **n** will return the last N + // values in the array. The **guard** check allows it to work with `_.map`. + _.last = function(array, n, guard) { + if ((n != null) && !guard) { + return slice.call(array, Math.max(array.length - n, 0)); + } else { + return array[array.length - 1]; + } + }; + + // Returns everything but the first entry of the array. Aliased as `tail`. + // Especially useful on the arguments object. Passing an **index** will return + // the rest of the values in the array from that index onward. The **guard** + // check allows it to work with `_.map`. + _.rest = _.tail = function(array, index, guard) { + return slice.call(array, (index == null) || guard ? 1 : index); + }; + + // Trim out all falsy values from an array. + _.compact = function(array) { + return _.filter(array, function(value){ return !!value; }); + }; + + // Return a completely flattened version of an array. + _.flatten = function(array, shallow) { + return _.reduce(array, function(memo, value) { + if (_.isArray(value)) return memo.concat(shallow ? value : _.flatten(value)); + memo[memo.length] = value; + return memo; + }, []); + }; + + // Return a version of the array that does not contain the specified value(s). + _.without = function(array) { + return _.difference(array, slice.call(arguments, 1)); + }; + + // Produce a duplicate-free version of the array. If the array has already + // been sorted, you have the option of using a faster algorithm. + // Aliased as `unique`. + _.uniq = _.unique = function(array, isSorted, iterator) { + var initial = iterator ? _.map(array, iterator) : array; + var result = []; + _.reduce(initial, function(memo, el, i) { + if (0 == i || (isSorted === true ? _.last(memo) != el : !_.include(memo, el))) { + memo[memo.length] = el; + result[result.length] = array[i]; + } + return memo; + }, []); + return result; + }; + + // Produce an array that contains the union: each distinct element from all of + // the passed-in arrays. + _.union = function() { + return _.uniq(_.flatten(arguments, true)); + }; + + // Produce an array that contains every item shared between all the + // passed-in arrays. (Aliased as "intersect" for back-compat.) + _.intersection = _.intersect = function(array) { + var rest = slice.call(arguments, 1); + return _.filter(_.uniq(array), function(item) { + return _.every(rest, function(other) { + return _.indexOf(other, item) >= 0; + }); + }); + }; + + // Take the difference between one array and a number of other arrays. + // Only the elements present in just the first array will remain. + _.difference = function(array) { + var rest = _.flatten(slice.call(arguments, 1)); + return _.filter(array, function(value){ return !_.include(rest, value); }); + }; + + // Zip together multiple lists into a single array -- elements that share + // an index go together. + _.zip = function() { + var args = slice.call(arguments); + var length = _.max(_.pluck(args, 'length')); + var results = new Array(length); + for (var i = 0; i < length; i++) results[i] = _.pluck(args, "" + i); + return results; + }; + + // If the browser doesn't supply us with indexOf (I'm looking at you, **MSIE**), + // we need this function. Return the position of the first occurrence of an + // item in an array, or -1 if the item is not included in the array. + // Delegates to **ECMAScript 5**'s native `indexOf` if available. + // If the array is large and already in sort order, pass `true` + // for **isSorted** to use binary search. + _.indexOf = function(array, item, isSorted) { + if (array == null) return -1; + var i, l; + if (isSorted) { + i = _.sortedIndex(array, item); + return array[i] === item ? i : -1; + } + if (nativeIndexOf && array.indexOf === nativeIndexOf) return array.indexOf(item); + for (i = 0, l = array.length; i < l; i++) if (i in array && array[i] === item) return i; + return -1; + }; + + // Delegates to **ECMAScript 5**'s native `lastIndexOf` if available. + _.lastIndexOf = function(array, item) { + if (array == null) return -1; + if (nativeLastIndexOf && array.lastIndexOf === nativeLastIndexOf) return array.lastIndexOf(item); + var i = array.length; + while (i--) if (i in array && array[i] === item) return i; + return -1; + }; + + // Generate an integer Array containing an arithmetic progression. A port of + // the native Python `range()` function. See + // [the Python documentation](http://docs.python.org/library/functions.html#range). + _.range = function(start, stop, step) { + if (arguments.length <= 1) { + stop = start || 0; + start = 0; + } + step = arguments[2] || 1; + + var len = Math.max(Math.ceil((stop - start) / step), 0); + var idx = 0; + var range = new Array(len); + + while(idx < len) { + range[idx++] = start; + start += step; + } + + return range; + }; + + // Function (ahem) Functions + // ------------------ + + // Reusable constructor function for prototype setting. + var ctor = function(){}; + + // Create a function bound to a given object (assigning `this`, and arguments, + // optionally). Binding with arguments is also known as `curry`. + // Delegates to **ECMAScript 5**'s native `Function.bind` if available. + // We check for `func.bind` first, to fail fast when `func` is undefined. + _.bind = function bind(func, context) { + var bound, args; + if (func.bind === nativeBind && nativeBind) return nativeBind.apply(func, slice.call(arguments, 1)); + if (!_.isFunction(func)) throw new TypeError; + args = slice.call(arguments, 2); + return bound = function() { + if (!(this instanceof bound)) return func.apply(context, args.concat(slice.call(arguments))); + ctor.prototype = func.prototype; + var self = new ctor; + var result = func.apply(self, args.concat(slice.call(arguments))); + if (Object(result) === result) return result; + return self; + }; + }; + + // Bind all of an object's methods to that object. Useful for ensuring that + // all callbacks defined on an object belong to it. + _.bindAll = function(obj) { + var funcs = slice.call(arguments, 1); + if (funcs.length == 0) funcs = _.functions(obj); + each(funcs, function(f) { obj[f] = _.bind(obj[f], obj); }); + return obj; + }; + + // Memoize an expensive function by storing its results. + _.memoize = function(func, hasher) { + var memo = {}; + hasher || (hasher = _.identity); + return function() { + var key = hasher.apply(this, arguments); + return _.has(memo, key) ? memo[key] : (memo[key] = func.apply(this, arguments)); + }; + }; + + // Delays a function for the given number of milliseconds, and then calls + // it with the arguments supplied. + _.delay = function(func, wait) { + var args = slice.call(arguments, 2); + return setTimeout(function(){ return func.apply(func, args); }, wait); + }; + + // Defers a function, scheduling it to run after the current call stack has + // cleared. + _.defer = function(func) { + return _.delay.apply(_, [func, 1].concat(slice.call(arguments, 1))); + }; + + // Returns a function, that, when invoked, will only be triggered at most once + // during a given window of time. + _.throttle = function(func, wait) { + var context, args, timeout, throttling, more; + var whenDone = _.debounce(function(){ more = throttling = false; }, wait); + return function() { + context = this; args = arguments; + var later = function() { + timeout = null; + if (more) func.apply(context, args); + whenDone(); + }; + if (!timeout) timeout = setTimeout(later, wait); + if (throttling) { + more = true; + } else { + func.apply(context, args); + } + whenDone(); + throttling = true; + }; + }; + + // Returns a function, that, as long as it continues to be invoked, will not + // be triggered. The function will be called after it stops being called for + // N milliseconds. + _.debounce = function(func, wait) { + var timeout; + return function() { + var context = this, args = arguments; + var later = function() { + timeout = null; + func.apply(context, args); + }; + clearTimeout(timeout); + timeout = setTimeout(later, wait); + }; + }; + + // Returns a function that will be executed at most one time, no matter how + // often you call it. Useful for lazy initialization. + _.once = function(func) { + var ran = false, memo; + return function() { + if (ran) return memo; + ran = true; + return memo = func.apply(this, arguments); + }; + }; + + // Returns the first function passed as an argument to the second, + // allowing you to adjust arguments, run code before and after, and + // conditionally execute the original function. + _.wrap = function(func, wrapper) { + return function() { + var args = [func].concat(slice.call(arguments, 0)); + return wrapper.apply(this, args); + }; + }; + + // Returns a function that is the composition of a list of functions, each + // consuming the return value of the function that follows. + _.compose = function() { + var funcs = arguments; + return function() { + var args = arguments; + for (var i = funcs.length - 1; i >= 0; i--) { + args = [funcs[i].apply(this, args)]; + } + return args[0]; + }; + }; + + // Returns a function that will only be executed after being called N times. + _.after = function(times, func) { + if (times <= 0) return func(); + return function() { + if (--times < 1) { return func.apply(this, arguments); } + }; + }; + + // Object Functions + // ---------------- + + // Retrieve the names of an object's properties. + // Delegates to **ECMAScript 5**'s native `Object.keys` + _.keys = nativeKeys || function(obj) { + if (obj !== Object(obj)) throw new TypeError('Invalid object'); + var keys = []; + for (var key in obj) if (_.has(obj, key)) keys[keys.length] = key; + return keys; + }; + + // Retrieve the values of an object's properties. + _.values = function(obj) { + return _.map(obj, _.identity); + }; + + // Return a sorted list of the function names available on the object. + // Aliased as `methods` + _.functions = _.methods = function(obj) { + var names = []; + for (var key in obj) { + if (_.isFunction(obj[key])) names.push(key); + } + return names.sort(); + }; + + // Extend a given object with all the properties in passed-in object(s). + _.extend = function(obj) { + each(slice.call(arguments, 1), function(source) { + for (var prop in source) { + obj[prop] = source[prop]; + } + }); + return obj; + }; + + // Fill in a given object with default properties. + _.defaults = function(obj) { + each(slice.call(arguments, 1), function(source) { + for (var prop in source) { + if (obj[prop] == null) obj[prop] = source[prop]; + } + }); + return obj; + }; + + // Create a (shallow-cloned) duplicate of an object. + _.clone = function(obj) { + if (!_.isObject(obj)) return obj; + return _.isArray(obj) ? obj.slice() : _.extend({}, obj); + }; + + // Invokes interceptor with the obj, and then returns obj. + // The primary purpose of this method is to "tap into" a method chain, in + // order to perform operations on intermediate results within the chain. + _.tap = function(obj, interceptor) { + interceptor(obj); + return obj; + }; + + // Internal recursive comparison function. + function eq(a, b, stack) { + // Identical objects are equal. `0 === -0`, but they aren't identical. + // See the Harmony `egal` proposal: http://wiki.ecmascript.org/doku.php?id=harmony:egal. + if (a === b) return a !== 0 || 1 / a == 1 / b; + // A strict comparison is necessary because `null == undefined`. + if (a == null || b == null) return a === b; + // Unwrap any wrapped objects. + if (a._chain) a = a._wrapped; + if (b._chain) b = b._wrapped; + // Invoke a custom `isEqual` method if one is provided. + if (a.isEqual && _.isFunction(a.isEqual)) return a.isEqual(b); + if (b.isEqual && _.isFunction(b.isEqual)) return b.isEqual(a); + // Compare `[[Class]]` names. + var className = toString.call(a); + if (className != toString.call(b)) return false; + switch (className) { + // Strings, numbers, dates, and booleans are compared by value. + case '[object String]': + // Primitives and their corresponding object wrappers are equivalent; thus, `"5"` is + // equivalent to `new String("5")`. + return a == String(b); + case '[object Number]': + // `NaN`s are equivalent, but non-reflexive. An `egal` comparison is performed for + // other numeric values. + return a != +a ? b != +b : (a == 0 ? 1 / a == 1 / b : a == +b); + case '[object Date]': + case '[object Boolean]': + // Coerce dates and booleans to numeric primitive values. Dates are compared by their + // millisecond representations. Note that invalid dates with millisecond representations + // of `NaN` are not equivalent. + return +a == +b; + // RegExps are compared by their source patterns and flags. + case '[object RegExp]': + return a.source == b.source && + a.global == b.global && + a.multiline == b.multiline && + a.ignoreCase == b.ignoreCase; + } + if (typeof a != 'object' || typeof b != 'object') return false; + // Assume equality for cyclic structures. The algorithm for detecting cyclic + // structures is adapted from ES 5.1 section 15.12.3, abstract operation `JO`. + var length = stack.length; + while (length--) { + // Linear search. Performance is inversely proportional to the number of + // unique nested structures. + if (stack[length] == a) return true; + } + // Add the first object to the stack of traversed objects. + stack.push(a); + var size = 0, result = true; + // Recursively compare objects and arrays. + if (className == '[object Array]') { + // Compare array lengths to determine if a deep comparison is necessary. + size = a.length; + result = size == b.length; + if (result) { + // Deep compare the contents, ignoring non-numeric properties. + while (size--) { + // Ensure commutative equality for sparse arrays. + if (!(result = size in a == size in b && eq(a[size], b[size], stack))) break; + } + } + } else { + // Objects with different constructors are not equivalent. + if ('constructor' in a != 'constructor' in b || a.constructor != b.constructor) return false; + // Deep compare objects. + for (var key in a) { + if (_.has(a, key)) { + // Count the expected number of properties. + size++; + // Deep compare each member. + if (!(result = _.has(b, key) && eq(a[key], b[key], stack))) break; + } + } + // Ensure that both objects contain the same number of properties. + if (result) { + for (key in b) { + if (_.has(b, key) && !(size--)) break; + } + result = !size; + } + } + // Remove the first object from the stack of traversed objects. + stack.pop(); + return result; + } + + // Perform a deep comparison to check if two objects are equal. + _.isEqual = function(a, b) { + return eq(a, b, []); + }; + + // Is a given array, string, or object empty? + // An "empty" object has no enumerable own-properties. + _.isEmpty = function(obj) { + if (_.isArray(obj) || _.isString(obj)) return obj.length === 0; + for (var key in obj) if (_.has(obj, key)) return false; + return true; + }; + + // Is a given value a DOM element? + _.isElement = function(obj) { + return !!(obj && obj.nodeType == 1); + }; + + // Is a given value an array? + // Delegates to ECMA5's native Array.isArray + _.isArray = nativeIsArray || function(obj) { + return toString.call(obj) == '[object Array]'; + }; + + // Is a given variable an object? + _.isObject = function(obj) { + return obj === Object(obj); + }; + + // Is a given variable an arguments object? + _.isArguments = function(obj) { + return toString.call(obj) == '[object Arguments]'; + }; + if (!_.isArguments(arguments)) { + _.isArguments = function(obj) { + return !!(obj && _.has(obj, 'callee')); + }; + } + + // Is a given value a function? + _.isFunction = function(obj) { + return toString.call(obj) == '[object Function]'; + }; + + // Is a given value a string? + _.isString = function(obj) { + return toString.call(obj) == '[object String]'; + }; + + // Is a given value a number? + _.isNumber = function(obj) { + return toString.call(obj) == '[object Number]'; + }; + + // Is the given value `NaN`? + _.isNaN = function(obj) { + // `NaN` is the only value for which `===` is not reflexive. + return obj !== obj; + }; + + // Is a given value a boolean? + _.isBoolean = function(obj) { + return obj === true || obj === false || toString.call(obj) == '[object Boolean]'; + }; + + // Is a given value a date? + _.isDate = function(obj) { + return toString.call(obj) == '[object Date]'; + }; + + // Is the given value a regular expression? + _.isRegExp = function(obj) { + return toString.call(obj) == '[object RegExp]'; + }; + + // Is a given value equal to null? + _.isNull = function(obj) { + return obj === null; + }; + + // Is a given variable undefined? + _.isUndefined = function(obj) { + return obj === void 0; + }; + + // Has own property? + _.has = function(obj, key) { + return hasOwnProperty.call(obj, key); + }; + + // Utility Functions + // ----------------- + + // Run Underscore.js in *noConflict* mode, returning the `_` variable to its + // previous owner. Returns a reference to the Underscore object. + _.noConflict = function() { + root._ = previousUnderscore; + return this; + }; + + // Keep the identity function around for default iterators. + _.identity = function(value) { + return value; + }; + + // Run a function **n** times. + _.times = function (n, iterator, context) { + for (var i = 0; i < n; i++) iterator.call(context, i); + }; + + // Escape a string for HTML interpolation. + _.escape = function(string) { + return (''+string).replace(/&/g, '&').replace(/</g, '<').replace(/>/g, '>').replace(/"/g, '"').replace(/'/g, ''').replace(/\//g,'/'); + }; + + // Add your own custom functions to the Underscore object, ensuring that + // they're correctly added to the OOP wrapper as well. + _.mixin = function(obj) { + each(_.functions(obj), function(name){ + addToWrapper(name, _[name] = obj[name]); + }); + }; + + // Generate a unique integer id (unique within the entire client session). + // Useful for temporary DOM ids. + var idCounter = 0; + _.uniqueId = function(prefix) { + var id = idCounter++; + return prefix ? prefix + id : id; + }; + + // By default, Underscore uses ERB-style template delimiters, change the + // following template settings to use alternative delimiters. + _.templateSettings = { + evaluate : /<%([\s\S]+?)%>/g, + interpolate : /<%=([\s\S]+?)%>/g, + escape : /<%-([\s\S]+?)%>/g + }; + + // When customizing `templateSettings`, if you don't want to define an + // interpolation, evaluation or escaping regex, we need one that is + // guaranteed not to match. + var noMatch = /.^/; + + // Within an interpolation, evaluation, or escaping, remove HTML escaping + // that had been previously added. + var unescape = function(code) { + return code.replace(/\\\\/g, '\\').replace(/\\'/g, "'"); + }; + + // JavaScript micro-templating, similar to John Resig's implementation. + // Underscore templating handles arbitrary delimiters, preserves whitespace, + // and correctly escapes quotes within interpolated code. + _.template = function(str, data) { + var c = _.templateSettings; + var tmpl = 'var __p=[],print=function(){__p.push.apply(__p,arguments);};' + + 'with(obj||{}){__p.push(\'' + + str.replace(/\\/g, '\\\\') + .replace(/'/g, "\\'") + .replace(c.escape || noMatch, function(match, code) { + return "',_.escape(" + unescape(code) + "),'"; + }) + .replace(c.interpolate || noMatch, function(match, code) { + return "'," + unescape(code) + ",'"; + }) + .replace(c.evaluate || noMatch, function(match, code) { + return "');" + unescape(code).replace(/[\r\n\t]/g, ' ') + ";__p.push('"; + }) + .replace(/\r/g, '\\r') + .replace(/\n/g, '\\n') + .replace(/\t/g, '\\t') + + "');}return __p.join('');"; + var func = new Function('obj', '_', tmpl); + if (data) return func(data, _); + return function(data) { + return func.call(this, data, _); + }; + }; + + // Add a "chain" function, which will delegate to the wrapper. + _.chain = function(obj) { + return _(obj).chain(); + }; + + // The OOP Wrapper + // --------------- + + // If Underscore is called as a function, it returns a wrapped object that + // can be used OO-style. This wrapper holds altered versions of all the + // underscore functions. Wrapped objects may be chained. + var wrapper = function(obj) { this._wrapped = obj; }; + + // Expose `wrapper.prototype` as `_.prototype` + _.prototype = wrapper.prototype; + + // Helper function to continue chaining intermediate results. + var result = function(obj, chain) { + return chain ? _(obj).chain() : obj; + }; + + // A method to easily add functions to the OOP wrapper. + var addToWrapper = function(name, func) { + wrapper.prototype[name] = function() { + var args = slice.call(arguments); + unshift.call(args, this._wrapped); + return result(func.apply(_, args), this._chain); + }; + }; + + // Add all of the Underscore functions to the wrapper object. + _.mixin(_); + + // Add all mutator Array functions to the wrapper. + each(['pop', 'push', 'reverse', 'shift', 'sort', 'splice', 'unshift'], function(name) { + var method = ArrayProto[name]; + wrapper.prototype[name] = function() { + var wrapped = this._wrapped; + method.apply(wrapped, arguments); + var length = wrapped.length; + if ((name == 'shift' || name == 'splice') && length === 0) delete wrapped[0]; + return result(wrapped, this._chain); + }; + }); + + // Add all accessor Array functions to the wrapper. + each(['concat', 'join', 'slice'], function(name) { + var method = ArrayProto[name]; + wrapper.prototype[name] = function() { + return result(method.apply(this._wrapped, arguments), this._chain); + }; + }); + + // Start chaining a wrapped Underscore object. + wrapper.prototype.chain = function() { + this._chain = true; + return this; + }; + + // Extracts the result from a wrapped and chained object. + wrapper.prototype.value = function() { + return this._wrapped; + }; + +}).call(this); diff --git a/docs/build/html/_static/underscore.js b/docs/build/html/_static/underscore.js new file mode 100644 index 0000000000000000000000000000000000000000..5b55f32beaca186f84cca115514f02cddbd1bbd5 --- /dev/null +++ b/docs/build/html/_static/underscore.js @@ -0,0 +1,31 @@ +// Underscore.js 1.3.1 +// (c) 2009-2012 Jeremy Ashkenas, DocumentCloud Inc. +// Underscore is freely distributable under the MIT license. +// Portions of Underscore are inspired or borrowed from Prototype, +// Oliver Steele's Functional, and John Resig's Micro-Templating. +// For all details and documentation: +// http://documentcloud.github.com/underscore +(function(){function q(a,c,d){if(a===c)return a!==0||1/a==1/c;if(a==null||c==null)return a===c;if(a._chain)a=a._wrapped;if(c._chain)c=c._wrapped;if(a.isEqual&&b.isFunction(a.isEqual))return a.isEqual(c);if(c.isEqual&&b.isFunction(c.isEqual))return c.isEqual(a);var e=l.call(a);if(e!=l.call(c))return false;switch(e){case "[object String]":return a==String(c);case "[object Number]":return a!=+a?c!=+c:a==0?1/a==1/c:a==+c;case "[object Date]":case "[object Boolean]":return+a==+c;case "[object RegExp]":return a.source== +c.source&&a.global==c.global&&a.multiline==c.multiline&&a.ignoreCase==c.ignoreCase}if(typeof a!="object"||typeof c!="object")return false;for(var f=d.length;f--;)if(d[f]==a)return true;d.push(a);var f=0,g=true;if(e=="[object Array]"){if(f=a.length,g=f==c.length)for(;f--;)if(!(g=f in a==f in c&&q(a[f],c[f],d)))break}else{if("constructor"in a!="constructor"in c||a.constructor!=c.constructor)return false;for(var h in a)if(b.has(a,h)&&(f++,!(g=b.has(c,h)&&q(a[h],c[h],d))))break;if(g){for(h in c)if(b.has(c, +h)&&!f--)break;g=!f}}d.pop();return g}var r=this,G=r._,n={},k=Array.prototype,o=Object.prototype,i=k.slice,H=k.unshift,l=o.toString,I=o.hasOwnProperty,w=k.forEach,x=k.map,y=k.reduce,z=k.reduceRight,A=k.filter,B=k.every,C=k.some,p=k.indexOf,D=k.lastIndexOf,o=Array.isArray,J=Object.keys,s=Function.prototype.bind,b=function(a){return new m(a)};if(typeof exports!=="undefined"){if(typeof module!=="undefined"&&module.exports)exports=module.exports=b;exports._=b}else r._=b;b.VERSION="1.3.1";var j=b.each= +b.forEach=function(a,c,d){if(a!=null)if(w&&a.forEach===w)a.forEach(c,d);else if(a.length===+a.length)for(var e=0,f=a.length;e<f;e++){if(e in a&&c.call(d,a[e],e,a)===n)break}else for(e in a)if(b.has(a,e)&&c.call(d,a[e],e,a)===n)break};b.map=b.collect=function(a,c,b){var e=[];if(a==null)return e;if(x&&a.map===x)return a.map(c,b);j(a,function(a,g,h){e[e.length]=c.call(b,a,g,h)});if(a.length===+a.length)e.length=a.length;return e};b.reduce=b.foldl=b.inject=function(a,c,d,e){var f=arguments.length>2;a== +null&&(a=[]);if(y&&a.reduce===y)return e&&(c=b.bind(c,e)),f?a.reduce(c,d):a.reduce(c);j(a,function(a,b,i){f?d=c.call(e,d,a,b,i):(d=a,f=true)});if(!f)throw new TypeError("Reduce of empty array with no initial value");return d};b.reduceRight=b.foldr=function(a,c,d,e){var f=arguments.length>2;a==null&&(a=[]);if(z&&a.reduceRight===z)return e&&(c=b.bind(c,e)),f?a.reduceRight(c,d):a.reduceRight(c);var g=b.toArray(a).reverse();e&&!f&&(c=b.bind(c,e));return f?b.reduce(g,c,d,e):b.reduce(g,c)};b.find=b.detect= +function(a,c,b){var e;E(a,function(a,g,h){if(c.call(b,a,g,h))return e=a,true});return e};b.filter=b.select=function(a,c,b){var e=[];if(a==null)return e;if(A&&a.filter===A)return a.filter(c,b);j(a,function(a,g,h){c.call(b,a,g,h)&&(e[e.length]=a)});return e};b.reject=function(a,c,b){var e=[];if(a==null)return e;j(a,function(a,g,h){c.call(b,a,g,h)||(e[e.length]=a)});return e};b.every=b.all=function(a,c,b){var e=true;if(a==null)return e;if(B&&a.every===B)return a.every(c,b);j(a,function(a,g,h){if(!(e= +e&&c.call(b,a,g,h)))return n});return e};var E=b.some=b.any=function(a,c,d){c||(c=b.identity);var e=false;if(a==null)return e;if(C&&a.some===C)return a.some(c,d);j(a,function(a,b,h){if(e||(e=c.call(d,a,b,h)))return n});return!!e};b.include=b.contains=function(a,c){var b=false;if(a==null)return b;return p&&a.indexOf===p?a.indexOf(c)!=-1:b=E(a,function(a){return a===c})};b.invoke=function(a,c){var d=i.call(arguments,2);return b.map(a,function(a){return(b.isFunction(c)?c||a:a[c]).apply(a,d)})};b.pluck= +function(a,c){return b.map(a,function(a){return a[c]})};b.max=function(a,c,d){if(!c&&b.isArray(a))return Math.max.apply(Math,a);if(!c&&b.isEmpty(a))return-Infinity;var e={computed:-Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b>=e.computed&&(e={value:a,computed:b})});return e.value};b.min=function(a,c,d){if(!c&&b.isArray(a))return Math.min.apply(Math,a);if(!c&&b.isEmpty(a))return Infinity;var e={computed:Infinity};j(a,function(a,b,h){b=c?c.call(d,a,b,h):a;b<e.computed&&(e={value:a,computed:b})}); +return e.value};b.shuffle=function(a){var b=[],d;j(a,function(a,f){f==0?b[0]=a:(d=Math.floor(Math.random()*(f+1)),b[f]=b[d],b[d]=a)});return b};b.sortBy=function(a,c,d){return b.pluck(b.map(a,function(a,b,g){return{value:a,criteria:c.call(d,a,b,g)}}).sort(function(a,b){var c=a.criteria,d=b.criteria;return c<d?-1:c>d?1:0}),"value")};b.groupBy=function(a,c){var d={},e=b.isFunction(c)?c:function(a){return a[c]};j(a,function(a,b){var c=e(a,b);(d[c]||(d[c]=[])).push(a)});return d};b.sortedIndex=function(a, +c,d){d||(d=b.identity);for(var e=0,f=a.length;e<f;){var g=e+f>>1;d(a[g])<d(c)?e=g+1:f=g}return e};b.toArray=function(a){return!a?[]:a.toArray?a.toArray():b.isArray(a)?i.call(a):b.isArguments(a)?i.call(a):b.values(a)};b.size=function(a){return b.toArray(a).length};b.first=b.head=function(a,b,d){return b!=null&&!d?i.call(a,0,b):a[0]};b.initial=function(a,b,d){return i.call(a,0,a.length-(b==null||d?1:b))};b.last=function(a,b,d){return b!=null&&!d?i.call(a,Math.max(a.length-b,0)):a[a.length-1]};b.rest= +b.tail=function(a,b,d){return i.call(a,b==null||d?1:b)};b.compact=function(a){return b.filter(a,function(a){return!!a})};b.flatten=function(a,c){return b.reduce(a,function(a,e){if(b.isArray(e))return a.concat(c?e:b.flatten(e));a[a.length]=e;return a},[])};b.without=function(a){return b.difference(a,i.call(arguments,1))};b.uniq=b.unique=function(a,c,d){var d=d?b.map(a,d):a,e=[];b.reduce(d,function(d,g,h){if(0==h||(c===true?b.last(d)!=g:!b.include(d,g)))d[d.length]=g,e[e.length]=a[h];return d},[]); +return e};b.union=function(){return b.uniq(b.flatten(arguments,true))};b.intersection=b.intersect=function(a){var c=i.call(arguments,1);return b.filter(b.uniq(a),function(a){return b.every(c,function(c){return b.indexOf(c,a)>=0})})};b.difference=function(a){var c=b.flatten(i.call(arguments,1));return b.filter(a,function(a){return!b.include(c,a)})};b.zip=function(){for(var a=i.call(arguments),c=b.max(b.pluck(a,"length")),d=Array(c),e=0;e<c;e++)d[e]=b.pluck(a,""+e);return d};b.indexOf=function(a,c, +d){if(a==null)return-1;var e;if(d)return d=b.sortedIndex(a,c),a[d]===c?d:-1;if(p&&a.indexOf===p)return a.indexOf(c);for(d=0,e=a.length;d<e;d++)if(d in a&&a[d]===c)return d;return-1};b.lastIndexOf=function(a,b){if(a==null)return-1;if(D&&a.lastIndexOf===D)return a.lastIndexOf(b);for(var d=a.length;d--;)if(d in a&&a[d]===b)return d;return-1};b.range=function(a,b,d){arguments.length<=1&&(b=a||0,a=0);for(var d=arguments[2]||1,e=Math.max(Math.ceil((b-a)/d),0),f=0,g=Array(e);f<e;)g[f++]=a,a+=d;return g}; +var F=function(){};b.bind=function(a,c){var d,e;if(a.bind===s&&s)return s.apply(a,i.call(arguments,1));if(!b.isFunction(a))throw new TypeError;e=i.call(arguments,2);return d=function(){if(!(this instanceof d))return a.apply(c,e.concat(i.call(arguments)));F.prototype=a.prototype;var b=new F,g=a.apply(b,e.concat(i.call(arguments)));return Object(g)===g?g:b}};b.bindAll=function(a){var c=i.call(arguments,1);c.length==0&&(c=b.functions(a));j(c,function(c){a[c]=b.bind(a[c],a)});return a};b.memoize=function(a, +c){var d={};c||(c=b.identity);return function(){var e=c.apply(this,arguments);return b.has(d,e)?d[e]:d[e]=a.apply(this,arguments)}};b.delay=function(a,b){var d=i.call(arguments,2);return setTimeout(function(){return a.apply(a,d)},b)};b.defer=function(a){return b.delay.apply(b,[a,1].concat(i.call(arguments,1)))};b.throttle=function(a,c){var d,e,f,g,h,i=b.debounce(function(){h=g=false},c);return function(){d=this;e=arguments;var b;f||(f=setTimeout(function(){f=null;h&&a.apply(d,e);i()},c));g?h=true: +a.apply(d,e);i();g=true}};b.debounce=function(a,b){var d;return function(){var e=this,f=arguments;clearTimeout(d);d=setTimeout(function(){d=null;a.apply(e,f)},b)}};b.once=function(a){var b=false,d;return function(){if(b)return d;b=true;return d=a.apply(this,arguments)}};b.wrap=function(a,b){return function(){var d=[a].concat(i.call(arguments,0));return b.apply(this,d)}};b.compose=function(){var a=arguments;return function(){for(var b=arguments,d=a.length-1;d>=0;d--)b=[a[d].apply(this,b)];return b[0]}}; +b.after=function(a,b){return a<=0?b():function(){if(--a<1)return b.apply(this,arguments)}};b.keys=J||function(a){if(a!==Object(a))throw new TypeError("Invalid object");var c=[],d;for(d in a)b.has(a,d)&&(c[c.length]=d);return c};b.values=function(a){return b.map(a,b.identity)};b.functions=b.methods=function(a){var c=[],d;for(d in a)b.isFunction(a[d])&&c.push(d);return c.sort()};b.extend=function(a){j(i.call(arguments,1),function(b){for(var d in b)a[d]=b[d]});return a};b.defaults=function(a){j(i.call(arguments, +1),function(b){for(var d in b)a[d]==null&&(a[d]=b[d])});return a};b.clone=function(a){return!b.isObject(a)?a:b.isArray(a)?a.slice():b.extend({},a)};b.tap=function(a,b){b(a);return a};b.isEqual=function(a,b){return q(a,b,[])};b.isEmpty=function(a){if(b.isArray(a)||b.isString(a))return a.length===0;for(var c in a)if(b.has(a,c))return false;return true};b.isElement=function(a){return!!(a&&a.nodeType==1)};b.isArray=o||function(a){return l.call(a)=="[object Array]"};b.isObject=function(a){return a===Object(a)}; +b.isArguments=function(a){return l.call(a)=="[object Arguments]"};if(!b.isArguments(arguments))b.isArguments=function(a){return!(!a||!b.has(a,"callee"))};b.isFunction=function(a){return l.call(a)=="[object Function]"};b.isString=function(a){return l.call(a)=="[object String]"};b.isNumber=function(a){return l.call(a)=="[object Number]"};b.isNaN=function(a){return a!==a};b.isBoolean=function(a){return a===true||a===false||l.call(a)=="[object Boolean]"};b.isDate=function(a){return l.call(a)=="[object Date]"}; +b.isRegExp=function(a){return l.call(a)=="[object RegExp]"};b.isNull=function(a){return a===null};b.isUndefined=function(a){return a===void 0};b.has=function(a,b){return I.call(a,b)};b.noConflict=function(){r._=G;return this};b.identity=function(a){return a};b.times=function(a,b,d){for(var e=0;e<a;e++)b.call(d,e)};b.escape=function(a){return(""+a).replace(/&/g,"&").replace(/</g,"<").replace(/>/g,">").replace(/"/g,""").replace(/'/g,"'").replace(/\//g,"/")};b.mixin=function(a){j(b.functions(a), +function(c){K(c,b[c]=a[c])})};var L=0;b.uniqueId=function(a){var b=L++;return a?a+b:b};b.templateSettings={evaluate:/<%([\s\S]+?)%>/g,interpolate:/<%=([\s\S]+?)%>/g,escape:/<%-([\s\S]+?)%>/g};var t=/.^/,u=function(a){return a.replace(/\\\\/g,"\\").replace(/\\'/g,"'")};b.template=function(a,c){var d=b.templateSettings,d="var __p=[],print=function(){__p.push.apply(__p,arguments);};with(obj||{}){__p.push('"+a.replace(/\\/g,"\\\\").replace(/'/g,"\\'").replace(d.escape||t,function(a,b){return"',_.escape("+ +u(b)+"),'"}).replace(d.interpolate||t,function(a,b){return"',"+u(b)+",'"}).replace(d.evaluate||t,function(a,b){return"');"+u(b).replace(/[\r\n\t]/g," ")+";__p.push('"}).replace(/\r/g,"\\r").replace(/\n/g,"\\n").replace(/\t/g,"\\t")+"');}return __p.join('');",e=new Function("obj","_",d);return c?e(c,b):function(a){return e.call(this,a,b)}};b.chain=function(a){return b(a).chain()};var m=function(a){this._wrapped=a};b.prototype=m.prototype;var v=function(a,c){return c?b(a).chain():a},K=function(a,c){m.prototype[a]= +function(){var a=i.call(arguments);H.call(a,this._wrapped);return v(c.apply(b,a),this._chain)}};b.mixin(b);j("pop,push,reverse,shift,sort,splice,unshift".split(","),function(a){var b=k[a];m.prototype[a]=function(){var d=this._wrapped;b.apply(d,arguments);var e=d.length;(a=="shift"||a=="splice")&&e===0&&delete d[0];return v(d,this._chain)}});j(["concat","join","slice"],function(a){var b=k[a];m.prototype[a]=function(){return v(b.apply(this._wrapped,arguments),this._chain)}});m.prototype.chain=function(){this._chain= +true;return this};m.prototype.value=function(){return this._wrapped}}).call(this); diff --git a/docs/build/html/custom_logging_functions.html b/docs/build/html/custom_logging_functions.html new file mode 100644 index 0000000000000000000000000000000000000000..20e373ca93820b2fe587d79e7ee701ff6fa0f4ff --- /dev/null +++ b/docs/build/html/custom_logging_functions.html @@ -0,0 +1,189 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>custom_logging_functions module — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="search.html" /> + <link rel="next" title="functions module" href="functions.html" /> + <link rel="prev" title="binaryc_python_utils" href="modules.html" /> + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + <div class="section" id="module-custom_logging_functions"> +<span id="custom-logging-functions-module"></span><h1>custom_logging_functions module<a class="headerlink" href="#module-custom_logging_functions" title="Permalink to this headline">¶</a></h1> +<dl class="function"> +<dt id="custom_logging_functions.autogen_C_logging_code"> +<code class="sig-prename descclassname">custom_logging_functions.</code><code class="sig-name descname">autogen_C_logging_code</code><span class="sig-paren">(</span><em class="sig-param">logging_dict</em><span class="sig-paren">)</span><a class="headerlink" href="#custom_logging_functions.autogen_C_logging_code" title="Permalink to this definition">¶</a></dt> +<dd><p>Function that autogenerates PRINTF statements for binaryc. intput is a dictionary where the key is the header of that logging line and items which are lists of parameters that will be put in that logging line</p> +<p>Example:</p> +<div class="highlight-default notranslate"><div class="highlight"><pre><span></span><span class="p">{</span><span class="s1">'MY_STELLAR_DATA'</span><span class="p">:</span> + <span class="p">[</span> + <span class="s1">'model.time'</span><span class="p">,</span> + <span class="s1">'star[0].mass'</span><span class="p">,</span> + <span class="s1">'model.probability'</span><span class="p">,</span> + <span class="s1">'model.dt'</span> + <span class="p">]</span> +<span class="p">}</span> +</pre></div> +</div> +</dd></dl> + +<dl class="function"> +<dt id="custom_logging_functions.binary_c_log_code"> +<code class="sig-prename descclassname">custom_logging_functions.</code><code class="sig-name descname">binary_c_log_code</code><span class="sig-paren">(</span><em class="sig-param">code</em><span class="sig-paren">)</span><a class="headerlink" href="#custom_logging_functions.binary_c_log_code" title="Permalink to this definition">¶</a></dt> +<dd><p>Function to construct the code to construct the custom logging function</p> +</dd></dl> + +<dl class="function"> +<dt id="custom_logging_functions.binary_c_write_log_code"> +<code class="sig-prename descclassname">custom_logging_functions.</code><code class="sig-name descname">binary_c_write_log_code</code><span class="sig-paren">(</span><em class="sig-param">code</em>, <em class="sig-param">filename</em><span class="sig-paren">)</span><a class="headerlink" href="#custom_logging_functions.binary_c_write_log_code" title="Permalink to this definition">¶</a></dt> +<dd><p>Function to write the generated logging code to a file</p> +</dd></dl> + +<dl class="function"> +<dt id="custom_logging_functions.compile_shared_lib"> +<code class="sig-prename descclassname">custom_logging_functions.</code><code class="sig-name descname">compile_shared_lib</code><span class="sig-paren">(</span><em class="sig-param">code</em>, <em class="sig-param">sourcefile_name</em>, <em class="sig-param">outfile_name</em><span class="sig-paren">)</span><a class="headerlink" href="#custom_logging_functions.compile_shared_lib" title="Permalink to this definition">¶</a></dt> +<dd><p>Function to write the custom logging code to a file and then compile it.</p> +</dd></dl> + +<dl class="function"> +<dt id="custom_logging_functions.create_and_load_logging_function"> +<code class="sig-prename descclassname">custom_logging_functions.</code><code class="sig-name descname">create_and_load_logging_function</code><span class="sig-paren">(</span><em class="sig-param">custom_logging_code</em><span class="sig-paren">)</span><a class="headerlink" href="#custom_logging_functions.create_and_load_logging_function" title="Permalink to this definition">¶</a></dt> +<dd><p>Function to automatically compile the shared library with the given custom logging code and load it with ctypes</p> +<dl class="simple"> +<dt>returns:</dt><dd><p>memory adress of the custom logging function in a int type.</p> +</dd> +</dl> +</dd></dl> + +<dl class="function"> +<dt id="custom_logging_functions.from_binary_c_config"> +<code class="sig-prename descclassname">custom_logging_functions.</code><code class="sig-name descname">from_binary_c_config</code><span class="sig-paren">(</span><em class="sig-param">config_file</em>, <em class="sig-param">flag</em><span class="sig-paren">)</span><a class="headerlink" href="#custom_logging_functions.from_binary_c_config" title="Permalink to this definition">¶</a></dt> +<dd><p>Function to run the binaryc_config command with flags</p> +</dd></dl> + +<dl class="function"> +<dt id="custom_logging_functions.return_compilation_dict"> +<code class="sig-prename descclassname">custom_logging_functions.</code><code class="sig-name descname">return_compilation_dict</code><span class="sig-paren">(</span><span class="sig-paren">)</span><a class="headerlink" href="#custom_logging_functions.return_compilation_dict" title="Permalink to this definition">¶</a></dt> +<dd><p>Function to build the compile command for the shared library</p> +<p>inspired by binary_c_inline_config command in perl</p> +<p>TODO: this function still has some cleaning up to do wrt default values for the compile command +# <a class="reference external" href="https://developers.redhat.com/blog/2018/03/21/compiler-and-linker-flags-gcc/">https://developers.redhat.com/blog/2018/03/21/compiler-and-linker-flags-gcc/</a></p> +<dl class="simple"> +<dt>returns:</dt><dd><ul class="simple"> +<li><p>string containing the command to build the shared library</p></li> +</ul> +</dd> +</dl> +</dd></dl> + +<dl class="function"> +<dt id="custom_logging_functions.temp_custom_logging_dir"> +<code class="sig-prename descclassname">custom_logging_functions.</code><code class="sig-name descname">temp_custom_logging_dir</code><span class="sig-paren">(</span><span class="sig-paren">)</span><a class="headerlink" href="#custom_logging_functions.temp_custom_logging_dir" title="Permalink to this definition">¶</a></dt> +<dd><p>Function to return the path the custom logging library shared object and script will be written to.</p> +<p>Makes use of os.makedirs exist_ok which requires python 3.2+</p> +</dd></dl> + +</div> + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul class="current"> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1 current"><a class="reference internal" href="modules.html">binaryc_python_utils</a><ul class="current"> +<li class="toctree-l2 current"><a class="current reference internal" href="#">custom_logging_functions module</a></li> +<li class="toctree-l2"><a class="reference internal" href="functions.html">functions module</a></li> +</ul> +</li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + <li><a href="modules.html">binaryc_python_utils</a><ul> + <li>Previous: <a href="modules.html" title="previous chapter">binaryc_python_utils</a></li> + <li>Next: <a href="functions.html" title="next chapter">functions module</a></li> + </ul></li> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + | + <a href="_sources/custom_logging_functions.rst.txt" + rel="nofollow">Page source</a> + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/examples.html b/docs/build/html/examples.html new file mode 100644 index 0000000000000000000000000000000000000000..ce43a726633bad33f693456cbce11d41c3216396 --- /dev/null +++ b/docs/build/html/examples.html @@ -0,0 +1,141 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>examples — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="search.html" /> + <link rel="next" title="binaryc_python_utils" href="modules.html" /> + <link rel="prev" title="Python module for binary_c" href="readme_link.html" /> + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + <div class="section" id="examples"> +<h1>examples<a class="headerlink" href="#examples" title="Permalink to this headline">¶</a></h1> +<p>This chapter serves to document several of the example usages</p> +<span class="target" id="module-examples.examples"></span><dl class="function"> +<dt id="examples.examples.run_example_binary"> +<code class="sig-prename descclassname">examples.examples.</code><code class="sig-name descname">run_example_binary</code><span class="sig-paren">(</span><span class="sig-paren">)</span><a class="headerlink" href="#examples.examples.run_example_binary" title="Permalink to this definition">¶</a></dt> +<dd><p>Function to run a binary system. Very basic approach which directly adresses the run_binary(..) python-c wrapper function.</p> +</dd></dl> + +<dl class="function"> +<dt id="examples.examples.run_example_binary_with_custom_logging"> +<code class="sig-prename descclassname">examples.examples.</code><code class="sig-name descname">run_example_binary_with_custom_logging</code><span class="sig-paren">(</span><span class="sig-paren">)</span><a class="headerlink" href="#examples.examples.run_example_binary_with_custom_logging" title="Permalink to this definition">¶</a></dt> +<dd><p>Function that will use a automatically generated piece of logging code. Compile it, load it +into memory and run a binary system. See run_system on how several things are done in the background here.</p> +</dd></dl> + +<dl class="function"> +<dt id="examples.examples.run_example_binary_with_run_system"> +<code class="sig-prename descclassname">examples.examples.</code><code class="sig-name descname">run_example_binary_with_run_system</code><span class="sig-paren">(</span><span class="sig-paren">)</span><a class="headerlink" href="#examples.examples.run_example_binary_with_run_system" title="Permalink to this definition">¶</a></dt> +<dd><p>This function serves as an example on the function run_system and parse_output. +There is more functionality with this method and several tasks are done behind the scene.</p> +<p>Requires pandas, numpy to run.</p> +<p>run_system: mostly just makes passing arguments to the function easier. It also loads all the necessary defaults in the background +parse_output: Takes the raw output of binary_c and selects those lines that start with the given header. +Note, if you dont use the custom_logging functionality binary_c should be configured to have output that starts with that given header</p> +</dd></dl> + +<dl class="function"> +<dt id="examples.examples.run_example_binary_with_writing_logfile"> +<code class="sig-prename descclassname">examples.examples.</code><code class="sig-name descname">run_example_binary_with_writing_logfile</code><span class="sig-paren">(</span><span class="sig-paren">)</span><a class="headerlink" href="#examples.examples.run_example_binary_with_writing_logfile" title="Permalink to this definition">¶</a></dt> +<dd><p>Same as above but when giving the log_filename argument the log filename will be written</p> +</dd></dl> + +</div> + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul class="current"> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1 current"><a class="current reference internal" href="#">examples</a></li> +<li class="toctree-l1"><a class="reference internal" href="modules.html">binaryc_python_utils</a></li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + <li>Previous: <a href="readme_link.html" title="previous chapter">Python module for binary_c</a></li> + <li>Next: <a href="modules.html" title="next chapter">binaryc_python_utils</a></li> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + | + <a href="_sources/examples.rst.txt" + rel="nofollow">Page source</a> + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/functions.html b/docs/build/html/functions.html new file mode 100644 index 0000000000000000000000000000000000000000..41d8727423ce3a541ec39e27011b2567d8e2dfcd --- /dev/null +++ b/docs/build/html/functions.html @@ -0,0 +1,160 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>functions module — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="search.html" /> + <link rel="prev" title="custom_logging_functions module" href="custom_logging_functions.html" /> + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + <div class="section" id="module-functions"> +<span id="functions-module"></span><h1>functions module<a class="headerlink" href="#module-functions" title="Permalink to this headline">¶</a></h1> +<dl class="function"> +<dt id="functions.create_arg_string"> +<code class="sig-prename descclassname">functions.</code><code class="sig-name descname">create_arg_string</code><span class="sig-paren">(</span><em class="sig-param">arg_dict</em><span class="sig-paren">)</span><a class="headerlink" href="#functions.create_arg_string" title="Permalink to this definition">¶</a></dt> +<dd><p>Function that creates the arg string</p> +</dd></dl> + +<dl class="function"> +<dt id="functions.get_arg_keys"> +<code class="sig-prename descclassname">functions.</code><code class="sig-name descname">get_arg_keys</code><span class="sig-paren">(</span><span class="sig-paren">)</span><a class="headerlink" href="#functions.get_arg_keys" title="Permalink to this definition">¶</a></dt> +<dd><p>Function that return the list of possible keys to give in the arg string</p> +</dd></dl> + +<dl class="function"> +<dt id="functions.get_defaults"> +<code class="sig-prename descclassname">functions.</code><code class="sig-name descname">get_defaults</code><span class="sig-paren">(</span><span class="sig-paren">)</span><a class="headerlink" href="#functions.get_defaults" title="Permalink to this definition">¶</a></dt> +<dd><p>Function that calls the binaryc get args function and cast it into a dictionary +All the values are strings</p> +</dd></dl> + +<dl class="function"> +<dt id="functions.parse_output"> +<code class="sig-prename descclassname">functions.</code><code class="sig-name descname">parse_output</code><span class="sig-paren">(</span><em class="sig-param">output</em>, <em class="sig-param">selected_header</em><span class="sig-paren">)</span><a class="headerlink" href="#functions.parse_output" title="Permalink to this definition">¶</a></dt> +<dd><p>Function that parses output of binaryc when it is construction like this: +DAVID_SINGLE_ANALYSIS t=0 mass=20</p> +<p>You can give a ‘selected_header’ to catch any line that starts with that. +Then the values will be put into a dictionary. +TODO: Think about exporting to numpy array or pandas</p> +</dd></dl> + +<dl class="function"> +<dt id="functions.run_system"> +<code class="sig-prename descclassname">functions.</code><code class="sig-name descname">run_system</code><span class="sig-paren">(</span><em class="sig-param">**kwargs</em><span class="sig-paren">)</span><a class="headerlink" href="#functions.run_system" title="Permalink to this definition">¶</a></dt> +<dd><p>Wrapper to run a system with settings</p> +<p>This function determines which underlying python-c api function will be called based upon the arguments that are passed via kwargs.</p> +<ul class="simple"> +<li><p>if custom_logging_code or custom_logging_dict is included in the kwargs then it will</p></li> +<li><p>if</p></li> +</ul> +</dd></dl> + +<dl class="function"> +<dt id="functions.run_system_with_log"> +<code class="sig-prename descclassname">functions.</code><code class="sig-name descname">run_system_with_log</code><span class="sig-paren">(</span><em class="sig-param">**kwargs</em><span class="sig-paren">)</span><a class="headerlink" href="#functions.run_system_with_log" title="Permalink to this definition">¶</a></dt> +<dd><p>Wrapper to run a system with settings AND logs the files to a designated place defined by the log_filename parameter.</p> +</dd></dl> + +</div> + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul class="current"> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1 current"><a class="reference internal" href="modules.html">binaryc_python_utils</a><ul class="current"> +<li class="toctree-l2"><a class="reference internal" href="custom_logging_functions.html">custom_logging_functions module</a></li> +<li class="toctree-l2 current"><a class="current reference internal" href="#">functions module</a></li> +</ul> +</li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + <li><a href="modules.html">binaryc_python_utils</a><ul> + <li>Previous: <a href="custom_logging_functions.html" title="previous chapter">custom_logging_functions module</a></li> + </ul></li> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + | + <a href="_sources/functions.rst.txt" + rel="nofollow">Page source</a> + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/genindex.html b/docs/build/html/genindex.html new file mode 100644 index 0000000000000000000000000000000000000000..a1f032b8e9c2ababac8e5328fa11e9f05e150638 --- /dev/null +++ b/docs/build/html/genindex.html @@ -0,0 +1,231 @@ + + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>Index — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="#" /> + <link rel="search" title="Search" href="search.html" /> + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + +<h1 id="index">Index</h1> + +<div class="genindex-jumpbox"> + <a href="#A"><strong>A</strong></a> + | <a href="#B"><strong>B</strong></a> + | <a href="#C"><strong>C</strong></a> + | <a href="#E"><strong>E</strong></a> + | <a href="#F"><strong>F</strong></a> + | <a href="#G"><strong>G</strong></a> + | <a href="#P"><strong>P</strong></a> + | <a href="#R"><strong>R</strong></a> + | <a href="#S"><strong>S</strong></a> + | <a href="#T"><strong>T</strong></a> + +</div> +<h2 id="A">A</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="custom_logging_functions.html#custom_logging_functions.autogen_C_logging_code">autogen_C_logging_code() (in module custom_logging_functions)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="B">B</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="custom_logging_functions.html#custom_logging_functions.binary_c_log_code">binary_c_log_code() (in module custom_logging_functions)</a> +</li> + </ul></td> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="custom_logging_functions.html#custom_logging_functions.binary_c_write_log_code">binary_c_write_log_code() (in module custom_logging_functions)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="C">C</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="custom_logging_functions.html#custom_logging_functions.compile_shared_lib">compile_shared_lib() (in module custom_logging_functions)</a> +</li> + <li><a href="custom_logging_functions.html#custom_logging_functions.create_and_load_logging_function">create_and_load_logging_function() (in module custom_logging_functions)</a> +</li> + </ul></td> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="functions.html#functions.create_arg_string">create_arg_string() (in module functions)</a> +</li> + <li><a href="custom_logging_functions.html#module-custom_logging_functions">custom_logging_functions (module)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="E">E</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="examples.html#module-examples.examples">examples.examples (module)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="F">F</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="custom_logging_functions.html#custom_logging_functions.from_binary_c_config">from_binary_c_config() (in module custom_logging_functions)</a> +</li> + </ul></td> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="functions.html#module-functions">functions (module)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="G">G</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="functions.html#functions.get_arg_keys">get_arg_keys() (in module functions)</a> +</li> + </ul></td> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="functions.html#functions.get_defaults">get_defaults() (in module functions)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="P">P</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="functions.html#functions.parse_output">parse_output() (in module functions)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="R">R</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="custom_logging_functions.html#custom_logging_functions.return_compilation_dict">return_compilation_dict() (in module custom_logging_functions)</a> +</li> + <li><a href="examples.html#examples.examples.run_example_binary">run_example_binary() (in module examples.examples)</a> +</li> + <li><a href="examples.html#examples.examples.run_example_binary_with_custom_logging">run_example_binary_with_custom_logging() (in module examples.examples)</a> +</li> + </ul></td> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="examples.html#examples.examples.run_example_binary_with_run_system">run_example_binary_with_run_system() (in module examples.examples)</a> +</li> + <li><a href="examples.html#examples.examples.run_example_binary_with_writing_logfile">run_example_binary_with_writing_logfile() (in module examples.examples)</a> +</li> + <li><a href="functions.html#functions.run_system">run_system() (in module functions)</a> +</li> + <li><a href="functions.html#functions.run_system_with_log">run_system_with_log() (in module functions)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="S">S</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="stellar_types.html#module-stellar_types">stellar_types (module)</a> +</li> + </ul></td> +</tr></table> + +<h2 id="T">T</h2> +<table style="width: 100%" class="indextable genindextable"><tr> + <td style="width: 33%; vertical-align: top;"><ul> + <li><a href="custom_logging_functions.html#custom_logging_functions.temp_custom_logging_dir">temp_custom_logging_dir() (in module custom_logging_functions)</a> +</li> + </ul></td> +</tr></table> + + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1"><a class="reference internal" href="modules.html">binaryc_python_utils</a></li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/index.html b/docs/build/html/index.html new file mode 100644 index 0000000000000000000000000000000000000000..bf41e422cdb46a5704ec612e7841b2961302aaea --- /dev/null +++ b/docs/build/html/index.html @@ -0,0 +1,134 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>Welcome to binary_c-python’s documentation! — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="search.html" /> + <link rel="next" title="Python module for binary_c" href="readme_link.html" /> + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + <div class="section" id="welcome-to-binary-c-python-s-documentation"> +<h1>Welcome to binary_c-python’s documentation!<a class="headerlink" href="#welcome-to-binary-c-python-s-documentation" title="Permalink to this headline">¶</a></h1> +<div class="toctree-wrapper compound"> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a><ul> +<li class="toctree-l2"><a class="reference internal" href="readme_link.html#requirements">Requirements</a></li> +<li class="toctree-l2"><a class="reference internal" href="readme_link.html#environment-variables">Environment variables</a></li> +<li class="toctree-l2"><a class="reference internal" href="readme_link.html#build-instructions">Build instructions</a></li> +<li class="toctree-l2"><a class="reference internal" href="readme_link.html#usage-notes">Usage notes</a></li> +</ul> +</li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1"><a class="reference internal" href="modules.html">binaryc_python_utils</a><ul> +<li class="toctree-l2"><a class="reference internal" href="custom_logging_functions.html">custom_logging_functions module</a></li> +<li class="toctree-l2"><a class="reference internal" href="functions.html">functions module</a></li> +</ul> +</li> +</ul> +</div> +</div> +<div class="section" id="indices-and-tables"> +<h1>Indices and tables<a class="headerlink" href="#indices-and-tables" title="Permalink to this headline">¶</a></h1> +<ul class="simple"> +<li><p><a class="reference internal" href="genindex.html"><span class="std std-ref">Index</span></a></p></li> +<li><p><a class="reference internal" href="py-modindex.html"><span class="std std-ref">Module Index</span></a></p></li> +<li><p><a class="reference internal" href="search.html"><span class="std std-ref">Search Page</span></a></p></li> +</ul> +</div> + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="#">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1"><a class="reference internal" href="modules.html">binaryc_python_utils</a></li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="#">Documentation overview</a><ul> + <li>Next: <a href="readme_link.html" title="next chapter">Python module for binary_c</a></li> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + | + <a href="_sources/index.rst.txt" + rel="nofollow">Page source</a> + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/modules.html b/docs/build/html/modules.html new file mode 100644 index 0000000000000000000000000000000000000000..3d63a908964fe64e01beb5d6ffeeb53c5e8ccb03 --- /dev/null +++ b/docs/build/html/modules.html @@ -0,0 +1,120 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>binaryc_python_utils — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="search.html" /> + <link rel="next" title="custom_logging_functions module" href="custom_logging_functions.html" /> + <link rel="prev" title="examples" href="examples.html" /> + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + <div class="section" id="binaryc-python-utils"> +<h1>binaryc_python_utils<a class="headerlink" href="#binaryc-python-utils" title="Permalink to this headline">¶</a></h1> +<div class="toctree-wrapper compound"> +<ul> +<li class="toctree-l1"><a class="reference internal" href="custom_logging_functions.html">custom_logging_functions module</a></li> +<li class="toctree-l1"><a class="reference internal" href="functions.html">functions module</a></li> +</ul> +</div> +</div> + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul class="current"> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1 current"><a class="current reference internal" href="#">binaryc_python_utils</a><ul> +<li class="toctree-l2"><a class="reference internal" href="custom_logging_functions.html">custom_logging_functions module</a></li> +<li class="toctree-l2"><a class="reference internal" href="functions.html">functions module</a></li> +</ul> +</li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + <li>Previous: <a href="examples.html" title="previous chapter">examples</a></li> + <li>Next: <a href="custom_logging_functions.html" title="next chapter">custom_logging_functions module</a></li> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + | + <a href="_sources/modules.rst.txt" + rel="nofollow">Page source</a> + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/objects.inv b/docs/build/html/objects.inv new file mode 100644 index 0000000000000000000000000000000000000000..b2b12e4ee947f36334b110656b6cb83b55de96fd --- /dev/null +++ b/docs/build/html/objects.inv @@ -0,0 +1,8 @@ +# Sphinx inventory version 2 +# Project: binary_c-python +# Version: +# The remainder of this file is compressed using zlib. +xÚµU;NÄ0ís +#h³‚––Š ‰‚Òòړı-{,HÇ5¸'ÁY'!Ÿ »+….™™÷Þx>6MM•)K©KZÍQí‰mîk#‚rKøJЮÂZ]§°ü†äÙj hJÐôaðq# écÈÝ ™?ù÷R3×PÞºþ‹úÝI„শRõs ¨’û ¹°˜4Ó‘×0±ˆØN©pÑ<ÔŠ]Èr;vœ¦©T¬µQ!9n'€P[:ó +é.€V[~×LiðÎgÛ¹ i÷Ó•u–Ë”ë\ú.±štCâÖ!i»xm¹cºE\”“ÌÇ/±õ[k¹.®¤Ý²4Gþk*È7hü¥8 +/ÂYæ<Pм·Ú£3Q©)±§á1\)æ(6v¶ ÏÙïH„‰{a8ÉOì⪗$•aúÆŒ“IšÌÑ(h¦³ Ž¯œÔ>Åö ZToM Çö3û ë¨G¯ â] éïÔÜ6XýýùåI„4n«,JÑ´MÞ;éS*~ROéNŽÖ™Rp’å4©Ò€Rù,®‡¨ã(õÛ82'ðóԒ¸á™æx5Í4Ùô%ùŸY ³ñ .§gjê›ñ²ÎV \ No newline at end of file diff --git a/docs/build/html/py-modindex.html b/docs/build/html/py-modindex.html new file mode 100644 index 0000000000000000000000000000000000000000..b89f31983805c58b9b8f7a2b564177bcde0a881d --- /dev/null +++ b/docs/build/html/py-modindex.html @@ -0,0 +1,157 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>Python Module Index — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="search.html" /> + + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + + <script type="text/javascript"> + DOCUMENTATION_OPTIONS.COLLAPSE_INDEX = true; + </script> + + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + + <h1>Python Module Index</h1> + + <div class="modindex-jumpbox"> + <a href="#cap-c"><strong>c</strong></a> | + <a href="#cap-e"><strong>e</strong></a> | + <a href="#cap-f"><strong>f</strong></a> | + <a href="#cap-s"><strong>s</strong></a> + </div> + + <table class="indextable modindextable"> + <tr class="pcap"><td></td><td> </td><td></td></tr> + <tr class="cap" id="cap-c"><td></td><td> + <strong>c</strong></td><td></td></tr> + <tr> + <td></td> + <td> + <a href="custom_logging_functions.html#module-custom_logging_functions"><code class="xref">custom_logging_functions</code></a></td><td> + <em></em></td></tr> + <tr class="pcap"><td></td><td> </td><td></td></tr> + <tr class="cap" id="cap-e"><td></td><td> + <strong>e</strong></td><td></td></tr> + <tr> + <td><img src="_static/minus.png" class="toggler" + id="toggle-1" style="display: none" alt="-" /></td> + <td> + <code class="xref">examples</code></td><td> + <em></em></td></tr> + <tr class="cg-1"> + <td></td> + <td>    + <a href="examples.html#module-examples.examples"><code class="xref">examples.examples</code></a></td><td> + <em></em></td></tr> + <tr class="pcap"><td></td><td> </td><td></td></tr> + <tr class="cap" id="cap-f"><td></td><td> + <strong>f</strong></td><td></td></tr> + <tr> + <td></td> + <td> + <a href="functions.html#module-functions"><code class="xref">functions</code></a></td><td> + <em></em></td></tr> + <tr class="pcap"><td></td><td> </td><td></td></tr> + <tr class="cap" id="cap-s"><td></td><td> + <strong>s</strong></td><td></td></tr> + <tr> + <td></td> + <td> + <a href="stellar_types.html#module-stellar_types"><code class="xref">stellar_types</code></a></td><td> + <em></em></td></tr> + </table> + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1"><a class="reference internal" href="modules.html">binaryc_python_utils</a></li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/readme_link.html b/docs/build/html/readme_link.html new file mode 100644 index 0000000000000000000000000000000000000000..6b967e0efe6cef5dd403bd31219bb628ec8b7ced --- /dev/null +++ b/docs/build/html/readme_link.html @@ -0,0 +1,163 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>Python module for binary_c — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="search.html" /> + <link rel="next" title="examples" href="examples.html" /> + <link rel="prev" title="Welcome to binary_c-python’s documentation!" href="index.html" /> + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + <div class="section" id="python-module-for-binary-c"> +<h1>Python module for binary_c<a class="headerlink" href="#python-module-for-binary-c" title="Permalink to this headline">¶</a></h1> +<p>Based on a original work by Jeff Andrews (can be found in old_solution/ directory) +updated and extended for Python3 by Robert Izzard, David hendriks</p> +<p>Warning : THIS CODE IS EXPERIMENTAL!</p> +<p><a class="reference external" href="mailto:r.izzard%40surrey.ac.uk">r<span>.</span>izzard<span>@</span>surrey<span>.</span>ac<span>.</span>uk</a> +<a class="reference external" href="http://personal.ph.surrey.ac.uk/~ri0005/binary_c.html">http://personal.ph.surrey.ac.uk/~ri0005/binary_c.html</a> +09/06/2019</p> +<div class="section" id="requirements"> +<h2>Requirements<a class="headerlink" href="#requirements" title="Permalink to this headline">¶</a></h2> +<ul class="simple"> +<li><p>Python3</p></li> +<li><p>binary_c version 2.1+</p></li> +<li><p>requirements.txt (no?)</p></li> +</ul> +</div> +<div class="section" id="environment-variables"> +<h2>Environment variables<a class="headerlink" href="#environment-variables" title="Permalink to this headline">¶</a></h2> +<p>Before compilation you should set the following environment variables:</p> +<ul class="simple"> +<li><p>required: <code class="docutils literal notranslate"><span class="pre">BINARY_C</span></code> should point to the root directory of your binary_c installation</p></li> +<li><p>recommended: <code class="docutils literal notranslate"><span class="pre">LD_LIBRARY_PATH</span></code> should include $BINARY_C/src and whatever directories are required to run binary_c (e.g. locations of libgsl, libmemoize, librinterpolate, etc.)</p></li> +<li><p>recommended: <code class="docutils literal notranslate"><span class="pre">LIBRARY_PATH</span></code> should include whatever directories are required to build binary_c (e.g. locations of libgsl, libmemoize, librinterpolate, etc.)</p></li> +</ul> +</div> +<div class="section" id="build-instructions"> +<h2>Build instructions<a class="headerlink" href="#build-instructions" title="Permalink to this headline">¶</a></h2> +<p>To build the module, make sure you have built binary_c (with <code class="docutils literal notranslate"><span class="pre">make</span></code> in the binary_c root directory), its shared library (with <code class="docutils literal notranslate"><span class="pre">make</span> <span class="pre">libbinary_c.so</span></code> in the binary_c root directory), and set environment variables as described above, then run the following code in t:</p> +<div class="highlight-guess notranslate"><div class="highlight"><pre><span></span><span class="n">make</span> <span class="n">clean</span> +<span class="n">make</span> +</pre></div> +</div> +<p>Then to test the Python module:</p> +<div class="highlight-guess notranslate"><div class="highlight"><pre><span></span><span class="n">python3</span> <span class="p">.</span><span class="o">/</span><span class="n">python_API_test</span><span class="p">.</span><span class="n">py</span> +</pre></div> +</div> +<p>You will require whatever libraries with which binary_c was compiled, as well as the compiler with which Python was built (usually gcc, which is easily installed on most systems).</p> +<p>If you want to be able to import the binary_c module correctly for child directories (or anywhere for that matter), execute or put the following code in your .bashrc/.zshrc:</p> +<div class="highlight-guess notranslate"><div class="highlight"><pre><span></span>export LD_LIBRARY_PATH=<full path to directory containing libbinary_c_api.so>:$LD_LIBRARY_PATH +export PYTHONPATH=<full path to directory containing libbinary_c_api.so>:$PYTHONPATH +</pre></div> +</div> +</div> +<div class="section" id="usage-notes"> +<h2>Usage notes<a class="headerlink" href="#usage-notes" title="Permalink to this headline">¶</a></h2> +<p>When running a jupyter notebook and importing binary_c, it might happen that the module binary_c cannot be found. I experienced this when I executed Jupyter Notebook from a virtual environment which didnt use the same python (version/binary/shim) as the one I built this library with. Make sure jupyter does use the same underlying python version/binary/shim. That resolved the issue for me.</p> +<p>Also: I figured that having binaryc output the log like “<span class="raw-html-m2r"><LOG HEADER></span> t=10e4 …†(i.e. printing the parameter names as well as their values) would be useful because in that way one can easily have python read that out automatically instead of having to manually copy the list of parameter names.</p> +<p>See examples/ dir for some working examples</p> +</div> +</div> + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul class="current"> +<li class="toctree-l1 current"><a class="current reference internal" href="#">Python module for binary_c</a><ul> +<li class="toctree-l2"><a class="reference internal" href="#requirements">Requirements</a></li> +<li class="toctree-l2"><a class="reference internal" href="#environment-variables">Environment variables</a></li> +<li class="toctree-l2"><a class="reference internal" href="#build-instructions">Build instructions</a></li> +<li class="toctree-l2"><a class="reference internal" href="#usage-notes">Usage notes</a></li> +</ul> +</li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1"><a class="reference internal" href="modules.html">binaryc_python_utils</a></li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + <li>Previous: <a href="index.html" title="previous chapter">Welcome to binary_c-python’s documentation!</a></li> + <li>Next: <a href="examples.html" title="next chapter">examples</a></li> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + | + <a href="_sources/readme_link.rst.txt" + rel="nofollow">Page source</a> + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/search.html b/docs/build/html/search.html new file mode 100644 index 0000000000000000000000000000000000000000..36956058ece377020082d193ebd9b62ae099f292 --- /dev/null +++ b/docs/build/html/search.html @@ -0,0 +1,117 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>Search — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <script type="text/javascript" src="_static/searchtools.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="#" /> + <script type="text/javascript" src="searchindex.js" defer></script> + + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + <h1 id="search-documentation">Search</h1> + <div id="fallback" class="admonition warning"> + <script type="text/javascript">$('#fallback').hide();</script> + <p> + Please activate JavaScript to enable the search + functionality. + </p> + </div> + <p> + From here you can search these documents. Enter your search + words into the box below and click "search". Note that the search + function will automatically search for all of the words. Pages + containing fewer words won't appear in the result list. + </p> + <form action="" method="get"> + <input type="text" name="q" aria-labelledby="search-documentation" value="" /> + <input type="submit" value="search" /> + <span id="search-progress" style="padding-left: 10px"></span> + </form> + + <div id="search-results"> + + </div> + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1"><a class="reference internal" href="modules.html">binaryc_python_utils</a></li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + </ul></li> +</ul> +</div> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/html/searchindex.js b/docs/build/html/searchindex.js new file mode 100644 index 0000000000000000000000000000000000000000..529fed3149f4b0d51d556c9090482ea9c86c8aa3 --- /dev/null +++ b/docs/build/html/searchindex.js @@ -0,0 +1 @@ +Search.setIndex({docnames:["custom_logging_functions","examples","functions","index","modules","readme_link","stellar_types"],envversion:{"sphinx.domains.c":1,"sphinx.domains.changeset":1,"sphinx.domains.citation":1,"sphinx.domains.cpp":1,"sphinx.domains.javascript":1,"sphinx.domains.math":2,"sphinx.domains.python":1,"sphinx.domains.rst":1,"sphinx.domains.std":1,sphinx:56},filenames:["custom_logging_functions.rst","examples.rst","functions.rst","index.rst","modules.rst","readme_link.rst","stellar_types.rst"],objects:{"":{custom_logging_functions:[0,0,0,"-"],functions:[2,0,0,"-"],stellar_types:[6,0,0,"-"]},"examples.examples":{run_example_binary:[1,1,1,""],run_example_binary_with_custom_logging:[1,1,1,""],run_example_binary_with_run_system:[1,1,1,""],run_example_binary_with_writing_logfile:[1,1,1,""]},custom_logging_functions:{autogen_C_logging_code:[0,1,1,""],binary_c_log_code:[0,1,1,""],binary_c_write_log_code:[0,1,1,""],compile_shared_lib:[0,1,1,""],create_and_load_logging_function:[0,1,1,""],from_binary_c_config:[0,1,1,""],return_compilation_dict:[0,1,1,""],temp_custom_logging_dir:[0,1,1,""]},examples:{examples:[1,0,0,"-"]},functions:{create_arg_string:[2,1,1,""],get_arg_keys:[2,1,1,""],get_defaults:[2,1,1,""],parse_output:[2,1,1,""],run_system:[2,1,1,""],run_system_with_log:[2,1,1,""]}},objnames:{"0":["py","module","Python module"],"1":["py","function","Python function"]},objtypes:{"0":"py:module","1":"py:function"},terms:{"10e4":5,"catch":2,"default":[0,1],"export":[2,5],"function":[0,1,3,4],"import":5,"int":0,"return":[0,2],AND:2,That:5,Then:[2,5],There:1,abl:5,about:2,abov:[1,5],adress:[0,1],all:[1,2],also:[1,5],andrew:5,ani:2,anywher:5,api:2,approach:1,arg:2,arg_dict:2,argument:[1,2],arrai:2,autofunct:[],autogen_c_logging_cod:0,autogener:0,automat:[0,1,5],background:1,base:[2,5],bashrc:5,basic:1,becaus:5,befor:5,behind:1,binari:[1,5],binary_c:1,binary_c_inline_config:0,binary_c_log_cod:0,binary_c_write_log_cod:0,binaryc:[0,2,5],binaryc_config:0,binaryc_python_util:3,blog:0,build:[0,3],built:5,call:2,can:[2,5],cannot:5,cast:2,chapter:1,check:[],child:5,clean:[0,5],code:[0,1,5],com:0,command:0,compil:[0,1,5],compile_shared_lib:0,config_fil:0,configur:1,construct:[0,2],contain:[0,5],content:3,copi:5,correctli:5,creat:2,create_and_load_logging_funct:0,create_arg_str:2,ctype:0,custom:0,custom_log:1,custom_logging_cod:[0,2],custom_logging_dict:2,custom_logging_funct:[3,4],david:5,david_single_analysi:2,defin:2,describ:5,design:2,determin:2,develop:0,dictionari:[0,2],didnt:5,dir:5,directli:1,directori:5,document:1,doe:5,done:1,dont:1,easier:1,easili:5,environ:3,etc:5,exampl:[0,3,5],execut:5,exist_ok:0,experienc:5,experiment:5,extend:5,figur:5,file:[0,2],filenam:[0,1],flag:0,follow:5,found:5,from:5,from_binary_c_config:0,full:5,gcc:[0,5],gener:[0,1],get:2,get_arg_kei:2,get_default:2,give:[1,2],given:[0,1],happen:5,has:0,have:[1,5],header:[0,1],hendrik:5,here:1,how:1,html:5,http:[0,5],includ:[2,5],index:3,inspir:0,instal:5,instead:5,instruct:3,intput:0,issu:5,item:0,its:5,izzard:5,jeff:5,jupyt:5,just:1,kei:[0,2],kwarg:2,ld_library_path:5,libbinary_c:5,libbinary_c_api:5,libgsl:5,libmemo:5,librari:[0,5],library_path:5,librinterpol:5,like:[2,5],line:[0,1,2],linker:0,list:[0,2,5],load:[0,1],locat:5,log:[0,1,2,5],log_filenam:[1,2],logging_dict:0,make:[0,1,5],makedir:0,manual:5,mass:[0,2],matter:5,memori:[0,1],method:1,might:5,model:0,modul:[3,4],more:1,most:5,mostli:1,my_stellar_data:0,name:5,necessari:1,note:[1,3],notebook:5,numpi:[1,2],object:0,old_solut:5,one:5,origin:5,out:5,outfile_nam:0,output:[1,2,5],page:3,panda:[1,2],paramet:[0,2,5],pars:2,parse_output:[1,2],pass:[1,2],path:[0,5],perl:0,person:5,piec:1,place:2,point:5,possibl:2,print:5,printf:0,probabl:0,put:[0,2,5],python3:5,python:[0,1,2],python_api_test:5,pythonpath:5,raw:1,read:5,recommend:5,redhat:0,requir:[0,1,3],resolv:5,return_compilation_dict:0,ri0005:5,robert:5,root:5,run:[0,1,2,5],run_binari:1,run_example_binari:1,run_example_binary_with_custom_log:1,run_example_binary_with_run_system:1,run_example_binary_with_writing_logfil:1,run_system:[1,2],run_system_with_log:2,same:[1,5],scene:1,script:0,search:3,see:[1,5],select:1,selected_head:2,serv:1,set:[2,5],sever:1,share:[0,5],shim:5,should:[1,5],some:[0,5],sourcefile_nam:0,src:5,star:0,start:[1,2],statement:0,still:0,string:[0,2],sure:5,surrei:5,system:[1,2,5],take:1,task:1,temp_custom_logging_dir:0,test:5,thi:[0,1,2,5],thing:1,think:2,those:1,time:0,todo:[0,2],txt:5,type:0,underli:[2,5],updat:5,upon:2,usag:[1,3],use:[0,1,5],useful:5,usual:5,valu:[0,2,5],variabl:3,veri:1,version:5,via:2,virtual:5,wai:5,want:5,warn:5,well:5,whatev:5,when:[1,2,5],where:0,which:[0,1,2,5],work:5,would:5,wrapper:[1,2],write:0,written:[0,1],wrt:0,you:[1,2,5],your:5,zshrc:5},titles:["custom_logging_functions module","examples","functions module","Welcome to binary_c-python\u2019s documentation!","binaryc_python_utils","Python module for binary_c","stellar_types module"],titleterms:{"function":2,binary_c:[3,5],binaryc_python_util:4,build:5,check:[],custom_logging_funct:0,document:3,environ:5,exampl:1,indic:3,instruct:5,modul:[0,2,5,6],note:5,python:[3,5],requir:5,stellar_typ:6,tabl:3,thi:[],usag:5,variabl:5,welcom:3,work:[]}}) \ No newline at end of file diff --git a/docs/build/html/stellar_types.html b/docs/build/html/stellar_types.html new file mode 100644 index 0000000000000000000000000000000000000000..ca7c36ac5674e7d997b1f5c9cffb5cf7744a41e6 --- /dev/null +++ b/docs/build/html/stellar_types.html @@ -0,0 +1,106 @@ + +<!DOCTYPE html> + +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <meta charset="utf-8" /> + <title>stellar_types module — binary_c-python documentation</title> + <link rel="stylesheet" href="_static/alabaster.css" type="text/css" /> + <link rel="stylesheet" href="_static/pygments.css" type="text/css" /> + <script type="text/javascript" id="documentation_options" data-url_root="./" src="_static/documentation_options.js"></script> + <script type="text/javascript" src="_static/jquery.js"></script> + <script type="text/javascript" src="_static/underscore.js"></script> + <script type="text/javascript" src="_static/doctools.js"></script> + <script type="text/javascript" src="_static/language_data.js"></script> + <link rel="index" title="Index" href="genindex.html" /> + <link rel="search" title="Search" href="search.html" /> + + <link rel="stylesheet" href="_static/custom.css" type="text/css" /> + + + <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> + + </head><body> + + + <div class="document"> + <div class="documentwrapper"> + <div class="bodywrapper"> + + + <div class="body" role="main"> + + <div class="section" id="module-stellar_types"> +<span id="stellar-types-module"></span><h1>stellar_types module<a class="headerlink" href="#module-stellar_types" title="Permalink to this headline">¶</a></h1> +</div> + + + </div> + + </div> + </div> + <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> + <div class="sphinxsidebarwrapper"> +<h1 class="logo"><a href="index.html">binary_c-python</a></h1> + + + + + + + + +<h3>Navigation</h3> +<p class="caption"><span class="caption-text">Contents:</span></p> +<ul> +<li class="toctree-l1"><a class="reference internal" href="readme_link.html">Python module for binary_c</a></li> +<li class="toctree-l1"><a class="reference internal" href="examples.html">examples</a></li> +<li class="toctree-l1"><a class="reference internal" href="modules.html">binaryc_python_utils</a></li> +</ul> + +<div class="relations"> +<h3>Related Topics</h3> +<ul> + <li><a href="index.html">Documentation overview</a><ul> + </ul></li> +</ul> +</div> +<div id="searchbox" style="display: none" role="search"> + <h3 id="searchlabel">Quick search</h3> + <div class="searchformwrapper"> + <form class="search" action="search.html" method="get"> + <input type="text" name="q" aria-labelledby="searchlabel" /> + <input type="submit" value="Go" /> + </form> + </div> +</div> +<script type="text/javascript">$('#searchbox').show(0);</script> + + + + + + + + + </div> + </div> + <div class="clearer"></div> + </div> + <div class="footer"> + ©2019, Jeff Andrews, Robert Izzard, David Hendriks. + + | + Powered by <a href="http://sphinx-doc.org/">Sphinx 2.2.1</a> + & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> + + | + <a href="_sources/stellar_types.rst.txt" + rel="nofollow">Page source</a> + </div> + + + + + </body> +</html> \ No newline at end of file diff --git a/docs/build/latex/LICRcyr2utf8.xdy b/docs/build/latex/LICRcyr2utf8.xdy new file mode 100644 index 0000000000000000000000000000000000000000..a9ca1c82cd661cfa1583e86fa881644d029d061f --- /dev/null +++ b/docs/build/latex/LICRcyr2utf8.xdy @@ -0,0 +1,101 @@ +;; -*- coding: utf-8; mode: Lisp; -*- +;; style file for xindy +;; filename: LICRcyr2utf8.xdy +;; description: style file for xindy which maps back LaTeX Internal +;; Character Representation of Cyrillic to utf-8 +;; usage: for use with pdflatex produced .idx files. +;; Contributed by the Sphinx team, July 2018. +(merge-rule "\IeC {\'\CYRG }" "Ѓ" :string) +(merge-rule "\IeC {\'\CYRK }" "ÐŒ" :string) +(merge-rule "\IeC {\'\cyrg }" "Ñ“" :string) +(merge-rule "\IeC {\'\cyrk }" "Ñœ" :string) +(merge-rule "\IeC {\CYRA }" "Ð" :string) +(merge-rule "\IeC {\CYRB }" "Б" :string) +(merge-rule "\IeC {\CYRC }" "Ц" :string) +(merge-rule "\IeC {\CYRCH }" "Ч" :string) +(merge-rule "\IeC {\CYRD }" "Д" :string) +(merge-rule "\IeC {\CYRDJE }" "Ђ" :string) +(merge-rule "\IeC {\CYRDZE }" "Ð…" :string) +(merge-rule "\IeC {\CYRDZHE }" "Ð" :string) +(merge-rule "\IeC {\CYRE }" "Е" :string) +(merge-rule "\IeC {\CYREREV }" "Ð" :string) +(merge-rule "\IeC {\CYRERY }" "Ы" :string) +(merge-rule "\IeC {\CYRF }" "Ф" :string) +(merge-rule "\IeC {\CYRG }" "Г" :string) +(merge-rule "\IeC {\CYRGUP }" "Ò" :string) +(merge-rule "\IeC {\CYRH }" "Ð¥" :string) +(merge-rule "\IeC {\CYRHRDSN }" "Ъ" :string) +(merge-rule "\IeC {\CYRI }" "И" :string) +(merge-rule "\IeC {\CYRIE }" "Є" :string) +(merge-rule "\IeC {\CYRII }" "І" :string) +(merge-rule "\IeC {\CYRISHRT }" "Й" :string) +(merge-rule "\IeC {\CYRJE }" "Ј" :string) +(merge-rule "\IeC {\CYRK }" "К" :string) +(merge-rule "\IeC {\CYRL }" "Л" :string) +(merge-rule "\IeC {\CYRLJE }" "Љ" :string) +(merge-rule "\IeC {\CYRM }" "Ðœ" :string) +(merge-rule "\IeC {\CYRN }" "Ð" :string) +(merge-rule "\IeC {\CYRNJE }" "Њ" :string) +(merge-rule "\IeC {\CYRO }" "О" :string) +(merge-rule "\IeC {\CYRP }" "П" :string) +(merge-rule "\IeC {\CYRR }" "Ð " :string) +(merge-rule "\IeC {\CYRS }" "С" :string) +(merge-rule "\IeC {\CYRSFTSN }" "Ь" :string) +(merge-rule "\IeC {\CYRSH }" "Ш" :string) +(merge-rule "\IeC {\CYRSHCH }" "Щ" :string) +(merge-rule "\IeC {\CYRT }" "Т" :string) +(merge-rule "\IeC {\CYRTSHE }" "Ћ" :string) +(merge-rule "\IeC {\CYRU }" "У" :string) +(merge-rule "\IeC {\CYRUSHRT }" "ÐŽ" :string) +(merge-rule "\IeC {\CYRV }" "Ð’" :string) +(merge-rule "\IeC {\CYRYA }" "Я" :string) +(merge-rule "\IeC {\CYRYI }" "Ї" :string) +(merge-rule "\IeC {\CYRYO }" "Ð" :string) +(merge-rule "\IeC {\CYRYU }" "Ю" :string) +(merge-rule "\IeC {\CYRZ }" "З" :string) +(merge-rule "\IeC {\CYRZH }" "Ж" :string) +(merge-rule "\IeC {\cyra }" "а" :string) +(merge-rule "\IeC {\cyrb }" "б" :string) +(merge-rule "\IeC {\cyrc }" "ц" :string) +(merge-rule "\IeC {\cyrch }" "ч" :string) +(merge-rule "\IeC {\cyrd }" "д" :string) +(merge-rule "\IeC {\cyrdje }" "Ñ’" :string) +(merge-rule "\IeC {\cyrdze }" "Ñ•" :string) +(merge-rule "\IeC {\cyrdzhe }" "ÑŸ" :string) +(merge-rule "\IeC {\cyre }" "е" :string) +(merge-rule "\IeC {\cyrerev }" "Ñ" :string) +(merge-rule "\IeC {\cyrery }" "Ñ‹" :string) +(merge-rule "\IeC {\cyrf }" "Ñ„" :string) +(merge-rule "\IeC {\cyrg }" "г" :string) +(merge-rule "\IeC {\cyrgup }" "Ò‘" :string) +(merge-rule "\IeC {\cyrh }" "Ñ…" :string) +(merge-rule "\IeC {\cyrhrdsn }" "ÑŠ" :string) +(merge-rule "\IeC {\cyri }" "и" :string) +(merge-rule "\IeC {\cyrie }" "Ñ”" :string) +(merge-rule "\IeC {\cyrii }" "Ñ–" :string) +(merge-rule "\IeC {\cyrishrt }" "й" :string) +(merge-rule "\IeC {\cyrje }" "ј" :string) +(merge-rule "\IeC {\cyrk }" "к" :string) +(merge-rule "\IeC {\cyrl }" "л" :string) +(merge-rule "\IeC {\cyrlje }" "Ñ™" :string) +(merge-rule "\IeC {\cyrm }" "м" :string) +(merge-rule "\IeC {\cyrn }" "н" :string) +(merge-rule "\IeC {\cyrnje }" "Ñš" :string) +(merge-rule "\IeC {\cyro }" "о" :string) +(merge-rule "\IeC {\cyrp }" "п" :string) +(merge-rule "\IeC {\cyrr }" "Ñ€" :string) +(merge-rule "\IeC {\cyrs }" "Ñ" :string) +(merge-rule "\IeC {\cyrsftsn }" "ÑŒ" :string) +(merge-rule "\IeC {\cyrsh }" "ш" :string) +(merge-rule "\IeC {\cyrshch }" "щ" :string) +(merge-rule "\IeC {\cyrt }" "Ñ‚" :string) +(merge-rule "\IeC {\cyrtshe }" "Ñ›" :string) +(merge-rule "\IeC {\cyru }" "у" :string) +(merge-rule "\IeC {\cyrushrt }" "Ñž" :string) +(merge-rule "\IeC {\cyrv }" "в" :string) +(merge-rule "\IeC {\cyrya }" "Ñ" :string) +(merge-rule "\IeC {\cyryi }" "Ñ—" :string) +(merge-rule "\IeC {\cyryo }" "Ñ‘" :string) +(merge-rule "\IeC {\cyryu }" "ÑŽ" :string) +(merge-rule "\IeC {\cyrz }" "з" :string) +(merge-rule "\IeC {\cyrzh }" "ж" :string) diff --git a/docs/build/latex/LICRlatin2utf8.xdy b/docs/build/latex/LICRlatin2utf8.xdy new file mode 100644 index 0000000000000000000000000000000000000000..31c80f97ce0bff10be2125d818241a829e014a4e --- /dev/null +++ b/docs/build/latex/LICRlatin2utf8.xdy @@ -0,0 +1,239 @@ +;; style file for xindy +;; filename: LICRlatin2utf8.xdy +;; description: style file for xindy which maps back LaTeX Internal +;; Character Representation of letters (as arising in .idx index +;; file) to UTF-8 encoding for correct sorting by xindy. +;; usage: for use with the pdflatex engine, +;; *not* for use with xelatex or lualatex. +;; +;; This is based upon xindy's distributed file tex/inputenc/utf8.xdy. +;; The modifications include: +;; +;; - Updates for compatibility with current LaTeX macro encoding. +;; +;; - Systematic usage of the \IeC {...} mark-up, because mark-up in +;; tex/inputenc/utf8.xdy was using it on seemingly random basis, and +;; Sphinx coercing of xindy usability for both Latin and Cyrillic scripts +;; with pdflatex requires its systematic presence here. +;; +;; - Support for some extra letters: Ÿ, ÅŠ, Å‹, Å’, Å“, IJ, ij, È· and ẞ. +;; +;; Indeed Sphinx needs to support for pdflatex engine all Unicode letters +;; available in TeX T1 font encoding. The above letters are found in +;; that encoding but not in the Latin1, 2, 3 charsets which are those +;; covered by original tex/inputenc/utf8.xdy. +;; +;; - There is a problem that È· is not supported out-of-the box by LaTeX +;; with inputenc, one must add explicitely +;; \DeclareUnicodeCharacter{0237}{\j} +;; to preamble of LaTeX document. However this character is not supported +;; by the TeX "times" font used by default by Sphinx for pdflatex engine. +;; +;; **Update**: since LaTeX 2018/12/01, the \j as well as \SS, \k{} and +;; \.{} need no extra user declaration anymore. +;; +;; - ẞ needs \DeclareUnicodeCharacter{1E9E}{\SS} (but ß needs no extra set-up). +;; +;; - U+02DB (Ë›) and U+02D9 (Ë™) are also not supported by inputenc +;; out of the box and require +;; \DeclareUnicodeCharacter{02DB}{\k{}} +;; \DeclareUnicodeCharacter{02D9}{\.{}} +;; to be added to preamble. +;; +;; - U+0127 ħ and U+0126 Ħ are absent from TeX T1+TS1 font encodings. +;; +;; - Characters ÅŠ and Å‹ are not supported by TeX font "times" used by +;; default by Sphinx for pdflatex engine but they are supported by +;; some TeX fonts, in particular by the default LaTeX font for T1 +;; encoding. +;; +;; - " and ~ must be escaped as ~" and resp. ~~ in xindy merge rules. +;; +;; Contributed by the Sphinx team, July 2018. +;; +;; See sphinx.xdy for superior figures, as they are escaped by LaTeX writer. +(merge-rule "\IeC {\textonesuperior }" "¹" :string) +(merge-rule "\IeC {\texttwosuperior }" "²" :string) +(merge-rule "\IeC {\textthreesuperior }" "³" :string) +(merge-rule "\IeC {\'a}" "á" :string) +(merge-rule "\IeC {\'A}" "Ã" :string) +(merge-rule "\IeC {\`a}" "à " :string) +(merge-rule "\IeC {\`A}" "À" :string) +(merge-rule "\IeC {\^a}" "â" :string) +(merge-rule "\IeC {\^A}" "Â" :string) +(merge-rule "\IeC {\~"a}" "ä" :string) +(merge-rule "\IeC {\~"A}" "Ä" :string) +(merge-rule "\IeC {\~~a}" "ã" :string) +(merge-rule "\IeC {\~~A}" "Ã" :string) +(merge-rule "\IeC {\c c}" "ç" :string) +(merge-rule "\IeC {\c C}" "Ç" :string) +(merge-rule "\IeC {\'c}" "ć" :string) +(merge-rule "\IeC {\'C}" "Ć" :string) +(merge-rule "\IeC {\^c}" "ĉ" :string) +(merge-rule "\IeC {\^C}" "Ĉ" :string) +(merge-rule "\IeC {\.c}" "Ä‹" :string) +(merge-rule "\IeC {\.C}" "ÄŠ" :string) +(merge-rule "\IeC {\c s}" "ÅŸ" :string) +(merge-rule "\IeC {\c S}" "Åž" :string) +(merge-rule "\IeC {\c t}" "Å£" :string) +(merge-rule "\IeC {\c T}" "Å¢" :string) +(merge-rule "\IeC {\-}" "Â" :string); soft hyphen +(merge-rule "\IeC {\textdiv }" "÷" :string) +(merge-rule "\IeC {\'e}" "é" :string) +(merge-rule "\IeC {\'E}" "É" :string) +(merge-rule "\IeC {\`e}" "è" :string) +(merge-rule "\IeC {\`E}" "È" :string) +(merge-rule "\IeC {\^e}" "ê" :string) +(merge-rule "\IeC {\^E}" "Ê" :string) +(merge-rule "\IeC {\~"e}" "ë" :string) +(merge-rule "\IeC {\~"E}" "Ë" :string) +(merge-rule "\IeC {\^g}" "Ä" :string) +(merge-rule "\IeC {\^G}" "Äœ" :string) +(merge-rule "\IeC {\.g}" "Ä¡" :string) +(merge-rule "\IeC {\.G}" "Ä " :string) +(merge-rule "\IeC {\^h}" "Ä¥" :string) +(merge-rule "\IeC {\^H}" "Ĥ" :string) +(merge-rule "\IeC {\H o}" "Å‘" :string) +(merge-rule "\IeC {\H O}" "Å" :string) +(merge-rule "\IeC {\textacutedbl }" "Ë" :string) +(merge-rule "\IeC {\H u}" "ű" :string) +(merge-rule "\IeC {\H U}" "Å°" :string) +(merge-rule "\IeC {\ae }" "æ" :string) +(merge-rule "\IeC {\AE }" "Æ" :string) +(merge-rule "\IeC {\textcopyright }" "©" :string) +(merge-rule "\IeC {\c \ }" "¸" :string) +(merge-rule "\IeC {\dh }" "ð" :string) +(merge-rule "\IeC {\DH }" "Ã" :string) +(merge-rule "\IeC {\dj }" "Ä‘" :string) +(merge-rule "\IeC {\DJ }" "Ä" :string) +(merge-rule "\IeC {\guillemotleft }" "«" :string) +(merge-rule "\IeC {\guillemotright }" "»" :string) +(merge-rule "\IeC {\'\i }" "Ã" :string) +(merge-rule "\IeC {\`\i }" "ì" :string) +(merge-rule "\IeC {\^\i }" "î" :string) +(merge-rule "\IeC {\~"\i }" "ï" :string) +(merge-rule "\IeC {\i }" "ı" :string) +(merge-rule "\IeC {\^\j }" "ĵ" :string) +(merge-rule "\IeC {\k {}}" "Ë›" :string) +(merge-rule "\IeC {\l }" "Å‚" :string) +(merge-rule "\IeC {\L }" "Å" :string) +(merge-rule "\IeC {\nobreakspace }" " " :string) +(merge-rule "\IeC {\o }" "ø" :string) +(merge-rule "\IeC {\O }" "Ø" :string) +(merge-rule "\IeC {\textsterling }" "£" :string) +(merge-rule "\IeC {\textparagraph }" "¶" :string) +(merge-rule "\IeC {\ss }" "ß" :string) +(merge-rule "\IeC {\textsection }" "§" :string) +(merge-rule "\IeC {\textbrokenbar }" "¦" :string) +(merge-rule "\IeC {\textcent }" "¢" :string) +(merge-rule "\IeC {\textcurrency }" "¤" :string) +(merge-rule "\IeC {\textdegree }" "°" :string) +(merge-rule "\IeC {\textexclamdown }" "¡" :string) +(merge-rule "\IeC {\texthbar }" "ħ" :string) +(merge-rule "\IeC {\textHbar }" "Ħ" :string) +(merge-rule "\IeC {\textonehalf }" "½" :string) +(merge-rule "\IeC {\textonequarter }" "¼" :string) +(merge-rule "\IeC {\textordfeminine }" "ª" :string) +(merge-rule "\IeC {\textordmasculine }" "º" :string) +(merge-rule "\IeC {\textperiodcentered }" "·" :string) +(merge-rule "\IeC {\textquestiondown }" "¿" :string) +(merge-rule "\IeC {\textregistered }" "®" :string) +(merge-rule "\IeC {\textthreequarters }" "¾" :string) +(merge-rule "\IeC {\textyen }" "Â¥" :string) +(merge-rule "\IeC {\th }" "þ" :string) +(merge-rule "\IeC {\TH }" "Þ" :string) +(merge-rule "\IeC {\'I}" "Ã" :string) +(merge-rule "\IeC {\`I}" "ÃŒ" :string) +(merge-rule "\IeC {\^I}" "ÃŽ" :string) +(merge-rule "\IeC {\~"I}" "Ã" :string) +(merge-rule "\IeC {\.I}" "Ä°" :string) +(merge-rule "\IeC {\^J}" "Ä´" :string) +(merge-rule "\IeC {\k a}" "Ä…" :string) +(merge-rule "\IeC {\k A}" "Ä„" :string) +(merge-rule "\IeC {\k e}" "Ä™" :string) +(merge-rule "\IeC {\k E}" "Ę" :string) +(merge-rule "\IeC {\'l}" "ĺ" :string) +(merge-rule "\IeC {\'L}" "Ĺ" :string) +(merge-rule "\IeC {\textlnot }" "¬" :string) +(merge-rule "\IeC {\textmu }" "µ" :string) +(merge-rule "\IeC {\'n}" "Å„" :string) +(merge-rule "\IeC {\'N}" "Ń" :string) +(merge-rule "\IeC {\~~n}" "ñ" :string) +(merge-rule "\IeC {\~~N}" "Ñ" :string) +(merge-rule "\IeC {\'o}" "ó" :string) +(merge-rule "\IeC {\'O}" "Ó" :string) +(merge-rule "\IeC {\`o}" "ò" :string) +(merge-rule "\IeC {\`O}" "Ã’" :string) +(merge-rule "\IeC {\^o}" "ô" :string) +(merge-rule "\IeC {\^O}" "Ô" :string) +(merge-rule "\IeC {\~"o}" "ö" :string) +(merge-rule "\IeC {\~"O}" "Ö" :string) +(merge-rule "\IeC {\~~o}" "õ" :string) +(merge-rule "\IeC {\~~O}" "Õ" :string) +(merge-rule "\IeC {\textpm }" "±" :string) +(merge-rule "\IeC {\r a}" "Ã¥" :string) +(merge-rule "\IeC {\r A}" "Ã…" :string) +(merge-rule "\IeC {\'r}" "Å•" :string) +(merge-rule "\IeC {\'R}" "Å”" :string) +(merge-rule "\IeC {\r u}" "ů" :string) +(merge-rule "\IeC {\r U}" "Å®" :string) +(merge-rule "\IeC {\'s}" "Å›" :string) +(merge-rule "\IeC {\'S}" "Åš" :string) +(merge-rule "\IeC {\^s}" "Å" :string) +(merge-rule "\IeC {\^S}" "Åœ" :string) +(merge-rule "\IeC {\textasciidieresis }" "¨" :string) +(merge-rule "\IeC {\textasciimacron }" "¯" :string) +(merge-rule "\IeC {\.{}}" "Ë™" :string) +(merge-rule "\IeC {\textasciiacute }" "´" :string) +(merge-rule "\IeC {\texttimes }" "×" :string) +(merge-rule "\IeC {\u a}" "ă" :string) +(merge-rule "\IeC {\u A}" "Ä‚" :string) +(merge-rule "\IeC {\u g}" "ÄŸ" :string) +(merge-rule "\IeC {\u G}" "Äž" :string) +(merge-rule "\IeC {\textasciibreve }" "˘" :string) +(merge-rule "\IeC {\'u}" "ú" :string) +(merge-rule "\IeC {\'U}" "Ú" :string) +(merge-rule "\IeC {\`u}" "ù" :string) +(merge-rule "\IeC {\`U}" "Ù" :string) +(merge-rule "\IeC {\^u}" "û" :string) +(merge-rule "\IeC {\^U}" "Û" :string) +(merge-rule "\IeC {\~"u}" "ü" :string) +(merge-rule "\IeC {\~"U}" "Ãœ" :string) +(merge-rule "\IeC {\u u}" "Å" :string) +(merge-rule "\IeC {\u U}" "Ŭ" :string) +(merge-rule "\IeC {\v c}" "Ä" :string) +(merge-rule "\IeC {\v C}" "ÄŒ" :string) +(merge-rule "\IeC {\v d}" "Ä" :string) +(merge-rule "\IeC {\v D}" "ÄŽ" :string) +(merge-rule "\IeC {\v e}" "Ä›" :string) +(merge-rule "\IeC {\v E}" "Äš" :string) +(merge-rule "\IeC {\v l}" "ľ" :string) +(merge-rule "\IeC {\v L}" "Ľ" :string) +(merge-rule "\IeC {\v n}" "ň" :string) +(merge-rule "\IeC {\v N}" "Ň" :string) +(merge-rule "\IeC {\v r}" "Å™" :string) +(merge-rule "\IeC {\v R}" "Ř" :string) +(merge-rule "\IeC {\v s}" "Å¡" :string) +(merge-rule "\IeC {\v S}" "Å " :string) +(merge-rule "\IeC {\textasciicaron }" "ˇ" :string) +(merge-rule "\IeC {\v t}" "Å¥" :string) +(merge-rule "\IeC {\v T}" "Ť" :string) +(merge-rule "\IeC {\v z}" "ž" :string) +(merge-rule "\IeC {\v Z}" "Ž" :string) +(merge-rule "\IeC {\'y}" "ý" :string) +(merge-rule "\IeC {\'Y}" "Ã" :string) +(merge-rule "\IeC {\~"y}" "ÿ" :string) +(merge-rule "\IeC {\'z}" "ź" :string) +(merge-rule "\IeC {\'Z}" "Ź" :string) +(merge-rule "\IeC {\.z}" "ż" :string) +(merge-rule "\IeC {\.Z}" "Å»" :string) +;; letters not in Latin1, 2, 3 but available in TeX T1 font encoding +(merge-rule "\IeC {\~"Y}" "Ÿ" :string) +(merge-rule "\IeC {\NG }" "ÅŠ" :string) +(merge-rule "\IeC {\ng }" "Å‹" :string) +(merge-rule "\IeC {\OE }" "Å’" :string) +(merge-rule "\IeC {\oe }" "Å“" :string) +(merge-rule "\IeC {\IJ }" "IJ" :string) +(merge-rule "\IeC {\ij }" "ij" :string) +(merge-rule "\IeC {\j }" "È·" :string) +(merge-rule "\IeC {\SS }" "ẞ" :string) diff --git a/docs/build/latex/LatinRules.xdy b/docs/build/latex/LatinRules.xdy new file mode 100644 index 0000000000000000000000000000000000000000..99f14a2ee856d0ec3078dd78700f43524f4a702c --- /dev/null +++ b/docs/build/latex/LatinRules.xdy @@ -0,0 +1,607 @@ +;; style file for xindy +;; filename: LatinRules.xdy +;; +;; It is based upon xindy's files lang/general/utf8.xdy and +;; lang/general/utf8-lang.xdy which implement +;; "a general sorting order for Western European languages" +;; +;; The aim for Sphinx is to be able to index in a Cyrillic document +;; also terms using the Latin alphabets, inclusive of letters +;; with diacritics. To this effect the xindy rules from lang/general +;; got manually re-coded to avoid collisions with the encoding +;; done by xindy for sorting words in Cyrillic languages, which was +;; observed not to use bytes with octal encoding 0o266 or higher. +;; +;; So here we use only 0o266 or higher bytes. +;; (ÅŠ, Å‹, IJ, and ij are absent from +;; lang/general/utf8.xdy and not included here) +;; Contributed by the Sphinx team, 2018. + +(define-letter-group "A" :prefixes ("¶")) +(define-letter-group "B" :after "A" :prefixes ("·")) +(define-letter-group "C" :after "B" :prefixes ("¸")) +(define-letter-group "D" :after "C" :prefixes ("¹")) +(define-letter-group "E" :after "D" :prefixes ("º")) +(define-letter-group "F" :after "E" :prefixes ("»")) +(define-letter-group "G" :after "F" :prefixes ("¼")) +(define-letter-group "H" :after "G" :prefixes ("½")) +(define-letter-group "I" :after "H" :prefixes ("¾")) +(define-letter-group "J" :after "I" :prefixes ("¿")) +(define-letter-group "K" :after "J" :prefixes ("À")) +(define-letter-group "L" :after "K" :prefixes ("Á")) +(define-letter-group "M" :after "L" :prefixes ("Â")) +(define-letter-group "N" :after "M" :prefixes ("Ã")) +(define-letter-group "O" :after "N" :prefixes ("Ä")) +(define-letter-group "P" :after "O" :prefixes ("È")) +(define-letter-group "Q" :after "P" :prefixes ("Ê")) +(define-letter-group "R" :after "Q" :prefixes ("Ë")) +(define-letter-group "S" :after "R" :prefixes ("Ð")) +(define-letter-group "T" :after "S" :prefixes ("Ú")) +(define-letter-group "U" :after "T" :prefixes ("à")) +(define-letter-group "V" :after "U" :prefixes ("å")) +(define-letter-group "W" :after "V" :prefixes ("æ")) +(define-letter-group "X" :after "W" :prefixes ("ë")) +(define-letter-group "Y" :after "X" :prefixes ("í")) +(define-letter-group "Z" :after "Y" :prefixes ("ð")) + +(define-rule-set "sphinx-xy-alphabetize" + + :rules (("À" "¶" :string) + ("Ä‚" "¶" :string) + ("â" "¶" :string) + ("Ä" "¶" :string) + ("à " "¶" :string) + ("Ã…" "¶" :string) + ("Ã" "¶" :string) + ("Ã" "¶" :string) + ("á" "¶" :string) + ("ã" "¶" :string) + ("Â" "¶" :string) + ("ă" "¶" :string) + ("Ã¥" "¶" :string) + ("Ä…" "¶" :string) + ("ä" "¶" :string) + ("Ä„" "¶" :string) + ("æ" "¶º" :string) + ("Æ" "¶º" :string) + ("ć" "¸" :string) + ("ĉ" "¸" :string) + ("ç" "¸" :string) + ("ÄŒ" "¸" :string) + ("Ä" "¸" :string) + ("Ĉ" "¸" :string) + ("Ç" "¸" :string) + ("Ć" "¸" :string) + ("Ä" "¹" :string) + ("Ä" "¹" :string) + ("ÄŽ" "¹" :string) + ("Ä‘" "¹" :string) + ("ê" "º" :string) + ("Ę" "º" :string) + ("Äš" "º" :string) + ("ë" "º" :string) + ("Ä›" "º" :string) + ("é" "º" :string) + ("È" "º" :string) + ("Ë" "º" :string) + ("É" "º" :string) + ("è" "º" :string) + ("Ê" "º" :string) + ("Ä™" "º" :string) + ("Ä" "¼" :string) + ("ÄŸ" "¼" :string) + ("Äž" "¼" :string) + ("Äœ" "¼" :string) + ("Ä¥" "½" :string) + ("Ĥ" "½" :string) + ("Ã" "¾" :string) + ("Ã" "¾" :string) + ("ï" "¾" :string) + ("ÃŽ" "¾" :string) + ("î" "¾" :string) + ("ı" "¾" :string) + ("Ä°" "¾" :string) + ("Ã" "¾" :string) + ("ÃŒ" "¾" :string) + ("ì" "¾" :string) + ("Ä´" "¿" :string) + ("ĵ" "¿" :string) + ("Å‚" "Á" :string) + ("Å" "Á" :string) + ("ľ" "Á" :string) + ("Ľ" "Á" :string) + ("Å„" "Ã" :string) + ("Ń" "Ã" :string) + ("ñ" "Ã" :string) + ("ň" "Ã" :string) + ("Ñ" "Ã" :string) + ("Ň" "Ã" :string) + ("Õ" "Ä" :string) + ("Å" "Ä" :string) + ("ó" "Ä" :string) + ("ö" "Ä" :string) + ("ô" "Ä" :string) + ("Å‘" "Ä" :string) + ("Ø" "Ä" :string) + ("Ö" "Ä" :string) + ("õ" "Ä" :string) + ("Ô" "Ä" :string) + ("ø" "Ä" :string) + ("Ó" "Ä" :string) + ("Ã’" "Ä" :string) + ("ò" "Ä" :string) + ("Å“" "ĺ" :string) + ("Å’" "ĺ" :string) + ("Ř" "Ë" :string) + ("Å™" "Ë" :string) + ("Å”" "Ë" :string) + ("Å•" "Ë" :string) + ("Å" "Ð" :string) + ("Åš" "Ð" :string) + ("È™" "Ð" :string) + ("ÅŸ" "Ð" :string) + ("Åœ" "Ð" :string) + ("Å›" "Ð" :string) + ("Ș" "Ð" :string) + ("Å¡" "Ð" :string) + ("Åž" "Ð" :string) + ("Å " "Ð" :string) + ("ß" "ÐÐ" :string) + ("Èš" "Ú" :string) + ("Ť" "Ú" :string) + ("È›" "Ú" :string) + ("Å¥" "Ú" :string) + ("û" "à" :string) + ("Å" "à" :string) + ("ů" "à" :string) + ("ű" "à" :string) + ("ù" "à" :string) + ("Ŭ" "à" :string) + ("Ù" "à" :string) + ("Å°" "à" :string) + ("Ãœ" "à" :string) + ("Å®" "à" :string) + ("ú" "à" :string) + ("Ú" "à" :string) + ("Û" "à" :string) + ("ü" "à" :string) + ("ÿ" "í" :string) + ("Ã" "í" :string) + ("Ÿ" "í" :string) + ("ý" "í" :string) + ("Å»" "ð" :string) + ("Ž" "ð" :string) + ("Ź" "ð" :string) + ("ž" "ð" :string) + ("ż" "ð" :string) + ("ź" "ð" :string) + ("a" "¶" :string) + ("A" "¶" :string) + ("b" "·" :string) + ("B" "·" :string) + ("c" "¸" :string) + ("C" "¸" :string) + ("d" "¹" :string) + ("D" "¹" :string) + ("e" "º" :string) + ("E" "º" :string) + ("F" "»" :string) + ("f" "»" :string) + ("G" "¼" :string) + ("g" "¼" :string) + ("H" "½" :string) + ("h" "½" :string) + ("i" "¾" :string) + ("I" "¾" :string) + ("J" "¿" :string) + ("j" "¿" :string) + ("K" "À" :string) + ("k" "À" :string) + ("L" "Á" :string) + ("l" "Á" :string) + ("M" "Â" :string) + ("m" "Â" :string) + ("n" "Ã" :string) + ("N" "Ã" :string) + ("O" "Ä" :string) + ("o" "Ä" :string) + ("p" "È" :string) + ("P" "È" :string) + ("Q" "Ê" :string) + ("q" "Ê" :string) + ("r" "Ë" :string) + ("R" "Ë" :string) + ("S" "Ð" :string) + ("s" "Ð" :string) + ("t" "Ú" :string) + ("T" "Ú" :string) + ("u" "à" :string) + ("U" "à" :string) + ("v" "å" :string) + ("V" "å" :string) + ("W" "æ" :string) + ("w" "æ" :string) + ("x" "ë" :string) + ("X" "ë" :string) + ("Y" "í" :string) + ("y" "í" :string) + ("z" "ð" :string) + ("Z" "ð" :string) + )) + +(define-rule-set "sphinx-xy-resolve-diacritics" + + :rules (("Ĥ" "£" :string) + ("ó" "£" :string) + ("ľ" "£" :string) + ("Ř" "£" :string) + ("Ä" "£" :string) + ("Ä" "£" :string) + ("Äš" "£" :string) + ("Ä¥" "£" :string) + ("ÄŒ" "£" :string) + ("Ä´" "£" :string) + ("Ä›" "£" :string) + ("ž" "£" :string) + ("ÄŽ" "£" :string) + ("Å™" "£" :string) + ("Ž" "£" :string) + ("ı" "£" :string) + ("Ť" "£" :string) + ("á" "£" :string) + ("Ä" "£" :string) + ("Ã" "£" :string) + ("ň" "£" :string) + ("Å " "£" :string) + ("Ň" "£" :string) + ("ĵ" "£" :string) + ("Å¥" "£" :string) + ("Ó" "£" :string) + ("ý" "£" :string) + ("Äœ" "£" :string) + ("Ú" "£" :string) + ("Ľ" "£" :string) + ("Å¡" "£" :string) + ("Ã" "£" :string) + ("ú" "£" :string) + ("Åš" "¤" :string) + ("ć" "¤" :string) + ("Å" "¤" :string) + ("Å‚" "¤" :string) + ("Å„" "¤" :string) + ("À" "¤" :string) + ("Ź" "¤" :string) + ("à " "¤" :string) + ("Ń" "¤" :string) + ("Ä" "¤" :string) + ("ÿ" "¤" :string) + ("Å›" "¤" :string) + ("Äž" "¤" :string) + ("ÄŸ" "¤" :string) + ("Ù" "¤" :string) + ("Ä°" "¤" :string) + ("Ä‘" "¤" :string) + ("ù" "¤" :string) + ("Èš" "¤" :string) + ("é" "¤" :string) + ("Å•" "¤" :string) + ("Ć" "¤" :string) + ("È›" "¤" :string) + ("ò" "¤" :string) + ("ź" "¤" :string) + ("Ã’" "¤" :string) + ("Ÿ" "¤" :string) + ("Å”" "¤" :string) + ("É" "¤" :string) + ("ĉ" "¥" :string) + ("ô" "¥" :string) + ("Ã" "¥" :string) + ("Å" "¥" :string) + ("Å»" "¥" :string) + ("Ä‚" "¥" :string) + ("Åœ" "¥" :string) + ("ñ" "¥" :string) + ("Å" "¥" :string) + ("Ã" "¥" :string) + ("È" "¥" :string) + ("Ô" "¥" :string) + ("Ŭ" "¥" :string) + ("ż" "¥" :string) + ("Ñ" "¥" :string) + ("è" "¥" :string) + ("Ĉ" "¥" :string) + ("ă" "¥" :string) + ("â" "¦" :string) + ("û" "¦" :string) + ("ê" "¦" :string) + ("Õ" "¦" :string) + ("õ" "¦" :string) + ("È™" "¦" :string) + ("ç" "¦" :string) + ("Â" "¦" :string) + ("Ê" "¦" :string) + ("Û" "¦" :string) + ("Ç" "¦" :string) + ("ì" "¦" :string) + ("ÃŒ" "¦" :string) + ("Ș" "¦" :string) + ("ö" "§" :string) + ("Ö" "§" :string) + ("ÅŸ" "§" :string) + ("ů" "§" :string) + ("ë" "§" :string) + ("ã" "§" :string) + ("î" "§" :string) + ("ÃŽ" "§" :string) + ("Ã" "§" :string) + ("Åž" "§" :string) + ("Å®" "§" :string) + ("Ë" "§" :string) + ("ï" "¨" :string) + ("Å" "¨" :string) + ("Ã" "¨" :string) + ("Ę" "¨" :string) + ("Å‘" "¨" :string) + ("Ãœ" "¨" :string) + ("Ã…" "¨" :string) + ("ü" "¨" :string) + ("Ä™" "¨" :string) + ("Ã¥" "¨" :string) + ("Ä" "©" :string) + ("ű" "©" :string) + ("Ø" "©" :string) + ("ø" "©" :string) + ("Å°" "©" :string) + ("ä" "©" :string) + ("Ä„" "ª" :string) + ("Ä…" "ª" :string) + ("Å“" "ÿ" :string) + ("ß" "ÿ" :string) + ("Æ" "ÿ" :string) + ("Å’" "ÿ" :string) + ("æ" "ÿ" :string) + ("e" "¢" :string) + ("t" "¢" :string) + ("L" "¢" :string) + ("Y" "¢" :string) + ("J" "¢" :string) + ("a" "¢" :string) + ("p" "¢" :string) + ("u" "¢" :string) + ("j" "¢" :string) + ("b" "¢" :string) + ("G" "¢" :string) + ("U" "¢" :string) + ("F" "¢" :string) + ("H" "¢" :string) + ("i" "¢" :string) + ("z" "¢" :string) + ("c" "¢" :string) + ("l" "¢" :string) + ("A" "¢" :string) + ("Q" "¢" :string) + ("w" "¢" :string) + ("D" "¢" :string) + ("R" "¢" :string) + ("d" "¢" :string) + ("s" "¢" :string) + ("r" "¢" :string) + ("k" "¢" :string) + ("v" "¢" :string) + ("m" "¢" :string) + ("P" "¢" :string) + ("y" "¢" :string) + ("K" "¢" :string) + ("q" "¢" :string) + ("S" "¢" :string) + ("I" "¢" :string) + ("C" "¢" :string) + ("M" "¢" :string) + ("Z" "¢" :string) + ("T" "¢" :string) + ("W" "¢" :string) + ("B" "¢" :string) + ("h" "¢" :string) + ("x" "¢" :string) + ("X" "¢" :string) + ("f" "¢" :string) + ("E" "¢" :string) + ("V" "¢" :string) + ("N" "¢" :string) + ("O" "¢" :string) + ("o" "¢" :string) + ("g" "¢" :string) + ("n" "¢" :string) + )) + +(define-rule-set "sphinx-xy-resolve-case" + + :rules (("Ú" "8" :string) + ("Ÿ" "8" :string) + ("Ç" "8" :string) + ("Ĉ" "8" :string) + ("Å”" "8" :string) + ("Ľ" "8" :string) + ("Å®" "8" :string) + ("Ã" "8" :string) + ("É" "8" :string) + ("Ë" "8" :string) + ("Ș" "8" :string) + ("ÃŒ" "8" :string) + ("Ê" "8" :string) + ("Ň" "8" :string) + ("Ä„" "8" :string) + ("Å " "8" :string) + ("Û" "8" :string) + ("Åž" "8" :string) + ("Ć" "8" :string) + ("Ã’" "8" :string) + ("Äœ" "8" :string) + ("Ñ" "8" :string) + ("Ó" "8" :string) + ("ÃŽ" "8" :string) + ("Ã" "8" :string) + ("Ã" "8" :string) + ("Èš" "8" :string) + ("Ã…" "8" :string) + ("Äž" "8" :string) + ("Ãœ" "8" :string) + ("È" "8" :string) + ("Ô" "8" :string) + ("Ä°" "8" :string) + ("Å°" "8" :string) + ("Ù" "8" :string) + ("Ŭ" "8" :string) + ("Â" "8" :string) + ("Ť" "8" :string) + ("Ń" "8" :string) + ("ÄŽ" "8" :string) + ("Ź" "8" :string) + ("Ž" "8" :string) + ("Ä" "8" :string) + ("Åœ" "8" :string) + ("ÄŒ" "8" :string) + ("Ä´" "8" :string) + ("Ö" "8" :string) + ("Ø" "8" :string) + ("Å»" "8" :string) + ("Å" "8" :string) + ("Ä‚" "8" :string) + ("Äš" "8" :string) + ("Å" "8" :string) + ("Õ" "8" :string) + ("Ę" "8" :string) + ("Ã" "8" :string) + ("À" "8" :string) + ("Ĥ" "8" :string) + ("Ä" "8" :string) + ("Åš" "8" :string) + ("Ř" "8" :string) + ("Ã" "8" :string) + ("Å’" "89" :string) + ("Æ" "89" :string) + ("ì" "9" :string) + ("è" "9" :string) + ("Ä…" "9" :string) + ("Å¡" "9" :string) + ("ú" "9" :string) + ("Ã¥" "9" :string) + ("ă" "9" :string) + ("Ä™" "9" :string) + ("ü" "9" :string) + ("ź" "9" :string) + ("ò" "9" :string) + ("Å¥" "9" :string) + ("È›" "9" :string) + ("ĵ" "9" :string) + ("Å•" "9" :string) + ("ż" "9" :string) + ("ä" "9" :string) + ("ý" "9" :string) + ("ù" "9" :string) + ("á" "9" :string) + ("é" "9" :string) + ("Ä" "9" :string) + ("ň" "9" :string) + ("Å›" "9" :string) + ("ø" "9" :string) + ("Ã" "9" :string) + ("Ä‘" "9" :string) + ("ı" "9" :string) + ("ÄŸ" "9" :string) + ("î" "9" :string) + ("ã" "9" :string) + ("à " "9" :string) + ("Å™" "9" :string) + ("Å‘" "9" :string) + ("ů" "9" :string) + ("È™" "9" :string) + ("ÿ" "9" :string) + ("ë" "9" :string) + ("Å" "9" :string) + ("ç" "9" :string) + ("ű" "9" :string) + ("ñ" "9" :string) + ("õ" "9" :string) + ("Ä›" "9" :string) + ("ÅŸ" "9" :string) + ("ž" "9" :string) + ("Ä" "9" :string) + ("Å" "9" :string) + ("Å„" "9" :string) + ("û" "9" :string) + ("Å‚" "9" :string) + ("Ä" "9" :string) + ("Ä¥" "9" :string) + ("ê" "9" :string) + ("ô" "9" :string) + ("ĉ" "9" :string) + ("â" "9" :string) + ("ć" "9" :string) + ("ï" "9" :string) + ("ö" "9" :string) + ("ľ" "9" :string) + ("ó" "9" :string) + ("æ" "99" :string) + ("ß" "99" :string) + ("Å“" "99" :string) + ("N" "8" :string) + ("V" "8" :string) + ("O" "8" :string) + ("X" "8" :string) + ("E" "8" :string) + ("P" "8" :string) + ("K" "8" :string) + ("T" "8" :string) + ("Z" "8" :string) + ("M" "8" :string) + ("C" "8" :string) + ("I" "8" :string) + ("S" "8" :string) + ("B" "8" :string) + ("W" "8" :string) + ("D" "8" :string) + ("R" "8" :string) + ("H" "8" :string) + ("F" "8" :string) + ("Q" "8" :string) + ("A" "8" :string) + ("G" "8" :string) + ("U" "8" :string) + ("J" "8" :string) + ("Y" "8" :string) + ("L" "8" :string) + ("o" "9" :string) + ("n" "9" :string) + ("g" "9" :string) + ("x" "9" :string) + ("f" "9" :string) + ("y" "9" :string) + ("q" "9" :string) + ("h" "9" :string) + ("w" "9" :string) + ("s" "9" :string) + ("d" "9" :string) + ("v" "9" :string) + ("k" "9" :string) + ("r" "9" :string) + ("m" "9" :string) + ("z" "9" :string) + ("c" "9" :string) + ("i" "9" :string) + ("l" "9" :string) + ("b" "9" :string) + ("j" "9" :string) + ("a" "9" :string) + ("p" "9" :string) + ("u" "9" :string) + ("t" "9" :string) + ("e" "9" :string) + )) + +(use-rule-set :run 0 + :rule-set ("sphinx-xy-alphabetize")) +(use-rule-set :run 1 + :rule-set ("sphinx-xy-resolve-diacritics")) +(use-rule-set :run 2 + :rule-set ("sphinx-xy-resolve-case")) diff --git a/docs/build/latex/Makefile b/docs/build/latex/Makefile new file mode 100644 index 0000000000000000000000000000000000000000..c561680ad7527ea0d93e7a2f38501733513802fa --- /dev/null +++ b/docs/build/latex/Makefile @@ -0,0 +1,68 @@ +# Makefile for Sphinx LaTeX output + +ALLDOCS = $(basename $(wildcard *.tex)) +ALLPDF = $(addsuffix .pdf,$(ALLDOCS)) +ALLDVI = $(addsuffix .dvi,$(ALLDOCS)) +ALLXDV = +ALLPS = $(addsuffix .ps,$(ALLDOCS)) +ALLIMGS = $(wildcard *.png *.gif *.jpg *.jpeg) + +# Prefix for archive names +ARCHIVEPREFIX = +# Additional LaTeX options (passed via variables in latexmkrc/latexmkjarc file) +export LATEXOPTS = +# Additional latexmk options +LATEXMKOPTS = +# format: pdf or dvi (used only by archive targets) +FMT = pdf + +LATEX = latexmk -dvi +PDFLATEX = latexmk -pdf -dvi- -ps- + + +%.png %.gif %.jpg %.jpeg: FORCE_MAKE + extractbb '$@' + +%.dvi: %.tex FORCE_MAKE + $(LATEX) $(LATEXMKOPTS) '$<' + +%.ps: %.dvi + dvips '$<' + +%.pdf: %.tex FORCE_MAKE + $(PDFLATEX) $(LATEXMKOPTS) '$<' + +all: $(ALLPDF) + +all-dvi: $(ALLDVI) + +all-ps: $(ALLPS) + +all-pdf: $(ALLPDF) + +zip: all-$(FMT) + mkdir $(ARCHIVEPREFIX)docs-$(FMT) + cp $(ALLPDF) $(ARCHIVEPREFIX)docs-$(FMT) + zip -q -r -9 $(ARCHIVEPREFIX)docs-$(FMT).zip $(ARCHIVEPREFIX)docs-$(FMT) + rm -r $(ARCHIVEPREFIX)docs-$(FMT) + +tar: all-$(FMT) + mkdir $(ARCHIVEPREFIX)docs-$(FMT) + cp $(ALLPDF) $(ARCHIVEPREFIX)docs-$(FMT) + tar cf $(ARCHIVEPREFIX)docs-$(FMT).tar $(ARCHIVEPREFIX)docs-$(FMT) + rm -r $(ARCHIVEPREFIX)docs-$(FMT) + +gz: tar + gzip -9 < $(ARCHIVEPREFIX)docs-$(FMT).tar > $(ARCHIVEPREFIX)docs-$(FMT).tar.gz + +bz2: tar + bzip2 -9 -k $(ARCHIVEPREFIX)docs-$(FMT).tar + +xz: tar + xz -9 -k $(ARCHIVEPREFIX)docs-$(FMT).tar + +clean: + rm -f *.log *.ind *.aux *.toc *.syn *.idx *.out *.ilg *.pla *.ps *.tar *.tar.gz *.tar.bz2 *.tar.xz $(ALLPDF) $(ALLDVI) $(ALLXDV) *.fls *.fdb_latexmk + +.PHONY: all all-pdf all-dvi all-ps clean zip tar gz bz2 xz +.PHONY: FORCE_MAKE \ No newline at end of file diff --git a/docs/build/latex/binary_c-python.aux b/docs/build/latex/binary_c-python.aux new file mode 100644 index 0000000000000000000000000000000000000000..7cbe4ccab4dd42d823bcacaac90af4c406ed8fb5 --- /dev/null +++ b/docs/build/latex/binary_c-python.aux @@ -0,0 +1,76 @@ +\relax +\providecommand\hyper@newdestlabel[2]{} +\providecommand\HyperFirstAtBeginDocument{\AtBeginDocument} +\HyperFirstAtBeginDocument{\ifx\hyper@anchor\@undefined +\global\let\oldcontentsline\contentsline +\gdef\contentsline#1#2#3#4{\oldcontentsline{#1}{#2}{#3}} +\global\let\oldnewlabel\newlabel +\gdef\newlabel#1#2{\newlabelxx{#1}#2} +\gdef\newlabelxx#1#2#3#4#5#6{\oldnewlabel{#1}{{#2}{#3}}} +\AtEndDocument{\ifx\hyper@anchor\@undefined +\let\contentsline\oldcontentsline +\let\newlabel\oldnewlabel +\fi} +\fi} +\global\let\hyper@last\relax +\gdef\HyperFirstAtBeginDocument#1{#1} +\providecommand\HyField@AuxAddToFields[1]{} +\providecommand\HyField@AuxAddToCoFields[2]{} +\babel@aux{english}{} +\newlabel{index::doc}{{}{1}{}{section*.2}{}} +\@writefile{toc}{\contentsline {chapter}{\numberline {1}Python module for binary\_c}{1}{chapter.1}} +\@writefile{lof}{\addvspace {10\p@ }} +\@writefile{lot}{\addvspace {10\p@ }} +\newlabel{readme_link:python-module-for-binary-c}{{1}{1}{Python module for binary\_c}{chapter.1}{}} +\newlabel{readme_link::doc}{{1}{1}{Python module for binary\_c}{chapter.1}{}} +\@writefile{toc}{\contentsline {section}{\numberline {1.1}Requirements}{1}{section.1.1}} +\newlabel{readme_link:requirements}{{1.1}{1}{Requirements}{section.1.1}{}} +\@writefile{toc}{\contentsline {section}{\numberline {1.2}Environment variables}{1}{section.1.2}} +\newlabel{readme_link:environment-variables}{{1.2}{1}{Environment variables}{section.1.2}{}} +\@writefile{toc}{\contentsline {section}{\numberline {1.3}Build instructions}{1}{section.1.3}} +\newlabel{readme_link:build-instructions}{{1.3}{1}{Build instructions}{section.1.3}{}} +\@writefile{toc}{\contentsline {section}{\numberline {1.4}Usage notes}{2}{section.1.4}} +\newlabel{readme_link:usage-notes}{{1.4}{2}{Usage notes}{section.1.4}{}} +\@writefile{toc}{\contentsline {chapter}{\numberline {2}examples}{3}{chapter.2}} +\@writefile{lof}{\addvspace {10\p@ }} +\@writefile{lot}{\addvspace {10\p@ }} +\newlabel{examples:examples}{{2}{3}{examples}{chapter.2}{}} +\newlabel{examples::doc}{{2}{3}{examples}{chapter.2}{}} +\newlabel{examples:module-examples.examples}{{2}{3}{examples}{section*.3}{}} +\newlabel{examples:examples.examples.run_example_binary}{{2}{3}{examples}{section*.4}{}} +\newlabel{examples:examples.examples.run_example_binary_with_custom_logging}{{2}{3}{examples}{section*.5}{}} +\newlabel{examples:examples.examples.run_example_binary_with_run_system}{{2}{3}{examples}{section*.6}{}} +\newlabel{examples:examples.examples.run_example_binary_with_writing_logfile}{{2}{3}{examples}{section*.7}{}} +\@writefile{toc}{\contentsline {chapter}{\numberline {3}binaryc\_python\_utils}{5}{chapter.3}} +\@writefile{lof}{\addvspace {10\p@ }} +\@writefile{lot}{\addvspace {10\p@ }} +\newlabel{modules:binaryc-python-utils}{{3}{5}{binaryc\_python\_utils}{chapter.3}{}} +\newlabel{modules::doc}{{3}{5}{binaryc\_python\_utils}{chapter.3}{}} +\@writefile{toc}{\contentsline {section}{\numberline {3.1}custom\_logging\_functions module}{5}{section.3.1}} +\newlabel{custom_logging_functions:module-custom_logging_functions}{{3.1}{5}{custom\_logging\_functions module}{section.3.1}{}} +\newlabel{custom_logging_functions:custom-logging-functions-module}{{3.1}{5}{custom\_logging\_functions module}{section.3.1}{}} +\newlabel{custom_logging_functions::doc}{{3.1}{5}{custom\_logging\_functions module}{section.3.1}{}} +\newlabel{custom_logging_functions:custom_logging_functions.autogen_C_logging_code}{{3.1}{5}{custom\_logging\_functions module}{section*.8}{}} +\newlabel{custom_logging_functions:custom_logging_functions.binary_c_log_code}{{3.1}{5}{custom\_logging\_functions module}{section*.9}{}} +\newlabel{custom_logging_functions:custom_logging_functions.binary_c_write_log_code}{{3.1}{5}{custom\_logging\_functions module}{section*.10}{}} +\newlabel{custom_logging_functions:custom_logging_functions.compile_shared_lib}{{3.1}{5}{custom\_logging\_functions module}{section*.11}{}} +\newlabel{custom_logging_functions:custom_logging_functions.create_and_load_logging_function}{{3.1}{5}{custom\_logging\_functions module}{section*.12}{}} +\newlabel{custom_logging_functions:custom_logging_functions.from_binary_c_config}{{3.1}{5}{custom\_logging\_functions module}{section*.13}{}} +\newlabel{custom_logging_functions:custom_logging_functions.return_compilation_dict}{{3.1}{5}{custom\_logging\_functions module}{section*.14}{}} +\newlabel{custom_logging_functions:custom_logging_functions.temp_custom_logging_dir}{{3.1}{5}{custom\_logging\_functions module}{section*.15}{}} +\@writefile{toc}{\contentsline {section}{\numberline {3.2}functions module}{6}{section.3.2}} +\newlabel{functions:module-functions}{{3.2}{6}{functions module}{section.3.2}{}} +\newlabel{functions:functions-module}{{3.2}{6}{functions module}{section.3.2}{}} +\newlabel{functions::doc}{{3.2}{6}{functions module}{section.3.2}{}} +\newlabel{functions:functions.create_arg_string}{{3.2}{6}{functions module}{section*.16}{}} +\newlabel{functions:functions.get_arg_keys}{{3.2}{6}{functions module}{section*.17}{}} +\newlabel{functions:functions.get_defaults}{{3.2}{6}{functions module}{section*.18}{}} +\newlabel{functions:functions.parse_output}{{3.2}{6}{functions module}{section*.19}{}} +\newlabel{functions:functions.run_system}{{3.2}{6}{functions module}{section*.20}{}} +\newlabel{functions:functions.run_system_with_log}{{3.2}{6}{functions module}{section*.21}{}} +\@writefile{toc}{\contentsline {chapter}{\numberline {4}Indices and tables}{7}{chapter.4}} +\@writefile{lof}{\addvspace {10\p@ }} +\@writefile{lot}{\addvspace {10\p@ }} +\newlabel{index:indices-and-tables}{{4}{7}{Indices and tables}{chapter.4}{}} +\@writefile{toc}{\contentsline {chapter}{Python Module Index}{9}{section*.22}} +\@writefile{toc}{\contentsline {chapter}{Index}{11}{section*.23}} diff --git a/docs/build/latex/binary_c-python.fdb_latexmk b/docs/build/latex/binary_c-python.fdb_latexmk new file mode 100644 index 0000000000000000000000000000000000000000..af4fe43f289e98ddde2581f3ddb3932d7f022cda --- /dev/null +++ b/docs/build/latex/binary_c-python.fdb_latexmk @@ -0,0 +1,172 @@ +# Fdb version 3 +["makeindex binary_c-python.idx"] 1574288781 "binary_c-python.idx" "binary_c-python.ind" "binary_c-python" 1574288781 + "binary_c-python.idx" 1574288781 3225 aa74b1d7bb65ae135e08b22704750cba "" + (generated) + "binary_c-python.ilg" + "binary_c-python.ind" +["pdflatex"] 1574288781 "binary_c-python.tex" "binary_c-python.pdf" "binary_c-python" 1574288781 + "/etc/texmf/web2c/texmf.cnf" 1571601231 475 c0e671620eb5563b2130f56340a5fde8 "" + "/usr/share/texlive/texmf-dist/fonts/enc/dvips/base/8r.enc" 1480098666 4850 80dc9bab7f31fb78a000ccfed0e27cab "" + "/usr/share/texlive/texmf-dist/fonts/map/fontname/texfonts.map" 1511824771 3332 103109f5612ad95229751940c61aada0 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrb8r.tfm" 1480098688 1292 3059476c50a24578715759f22652f3d0 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrb8t.tfm" 1480098688 1384 87406e4336af44af883a035f17f319d9 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8c.tfm" 1480098688 1268 8bd405dc5751cfed76cb6fb2db78cb50 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8r.tfm" 1480098688 1292 bd42be2f344128bff6d35d98474adfe3 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8t.tfm" 1480098688 1384 4632f5e54900a7dadbb83f555bc61e56 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8r.tfm" 1480098688 4484 b828043cbd581d289d955903c1339981 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8t.tfm" 1480098688 6628 34c39492c0adc454c1c199922bba8363 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvbo8t.tfm" 1480098688 6880 fe6c7967f27585f6fa9876f3af14edd2 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvr8r.tfm" 1480098688 4712 9ef4d7d106579d4b136e1529e1a4533c "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvr8t.tfm" 1480098688 7040 b2bd27e2bfe6f6948cbc3239cae7444f "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmb8r.tfm" 1480098689 4524 6bce29db5bc272ba5f332261583fee9c "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmb8t.tfm" 1480098689 6880 f19b8995b61c334d78fc734065f6b4d4 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmr8c.tfm" 1480098689 1352 fa28a7e6d323c65ce7d13d5342ff6be2 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmr8r.tfm" 1480098689 4408 25b74d011a4c66b7f212c0cc3c90061b "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmr8t.tfm" 1480098689 6672 e3ab9e37e925f3045c9005e6d1473d56 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmri8r.tfm" 1480098689 4640 532ca3305aad10cc01d769f3f91f1029 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmri8t.tfm" 1480098689 6944 94c55ad86e6ea2826f78ba2240d50df9 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/jknappen/ec/ecrm1000.tfm" 1480098696 3584 adb004a0c8e7c46ee66cad73671f37b4 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/cmextra/cmex7.tfm" 1480098698 1004 54797486969f23fa377b128694d548df "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msam10.tfm" 1480098698 916 f87d7c45f9c908e672703b83b72241a3 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msam5.tfm" 1480098698 924 9904cf1d39e9767e7a3622f2a125a565 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msam7.tfm" 1480098698 928 2dc8d444221b7a635bb58038579b861a "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msbm10.tfm" 1480098698 908 2921f8a10601f252058503cc6570e581 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msbm5.tfm" 1480098698 940 75ac932a52f80982a9f8ea75d03a34cf "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msbm7.tfm" 1480098698 940 228d6584342e91276bf566bcf9716b83 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmex10.tfm" 1480098701 992 662f679a0b3d2d53c1b94050fdaa3f50 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmmi12.tfm" 1480098701 1524 4414a8315f39513458b80dfc63bff03a "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmr12.tfm" 1480098701 1288 655e228510b4c2a1abe905c368440826 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmr17.tfm" 1480098701 1292 296a67155bdbfc32aa9c636f21e91433 "" + "/usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmsy10.tfm" 1480098701 1124 6c73e740cf17375f03eec0ee63599741 "" + "/usr/share/texlive/texmf-dist/fonts/type1/public/amsfonts/cm/cmmi5.pfb" 1480098733 37912 77d683123f92148345f3fc36a38d9ab1 "" + "/usr/share/texlive/texmf-dist/fonts/type1/public/amsfonts/cm/cmsy5.pfb" 1480098733 32915 7bf7720c61a5b3a7ff25b0964421c9b6 "" + "/usr/share/texlive/texmf-dist/fonts/type1/urw/courier/ucrb8a.pfb" 1480098746 50493 4ed1f7e9eba8f1f3e1ec25195460190d "" + "/usr/share/texlive/texmf-dist/fonts/type1/urw/courier/ucrr8a.pfb" 1480098746 45758 19968a0990191524e34e1994d4a31cb6 "" + "/usr/share/texlive/texmf-dist/fonts/type1/urw/helvetic/uhvb8a.pfb" 1480098746 35941 f27169cc74234d5bd5e4cca5abafaabb "" + "/usr/share/texlive/texmf-dist/fonts/type1/urw/helvetic/uhvr8a.pfb" 1480098746 44648 23115b2a545ebfe2c526c3ca99db8b95 "" + "/usr/share/texlive/texmf-dist/fonts/type1/urw/times/utmb8a.pfb" 1480098746 44729 811d6c62865936705a31c797a1d5dada "" + "/usr/share/texlive/texmf-dist/fonts/type1/urw/times/utmr8a.pfb" 1480098746 46026 6dab18b61c907687b520c72847215a68 "" + "/usr/share/texlive/texmf-dist/fonts/type1/urw/times/utmri8a.pfb" 1480098746 45458 a3faba884469519614ca56ba5f6b1de1 "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/courier/pcrb8t.vf" 1480098757 2184 5d20c8b00cd914e50251116c274e2d0b "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/courier/pcrr8c.vf" 1480098757 3552 6a7911d0b338a7c32cbfc3a9e985ccca "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/courier/pcrr8t.vf" 1480098757 2184 8475af1b9cfa983db5f46f5ed4b8f9f7 "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/helvetic/phvb8t.vf" 1480098757 2340 0efed6a948c3c37d870e4e7ddb85c7c3 "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/helvetic/phvr8t.vf" 1480098757 2344 44ff28c9ef2fc97180cd884f900fee71 "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/times/ptmb8t.vf" 1480098758 2340 df9c920cc5688ebbf16a93f45ce7bdd3 "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/times/ptmr8c.vf" 1480098758 3556 8a9a6dcbcd146ef985683f677f4758a6 "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/times/ptmr8t.vf" 1480098758 2348 91706c542228501c410c266421fbe30c "" + "/usr/share/texlive/texmf-dist/fonts/vf/adobe/times/ptmri8t.vf" 1480098758 2328 6cd7df782b09b29cfc4d93e55b6b9a59 "" + "/usr/share/texlive/texmf-dist/tex/context/base/mkii/supp-pdf.mkii" 1480098806 71627 94eb9990bed73c364d7f53f960cc8c5b "" + "/usr/share/texlive/texmf-dist/tex/generic/babel-english/english.ldf" 1496785618 7008 9ff5fdcc865b01beca2b0fe4a46231d4 "" + "/usr/share/texlive/texmf-dist/tex/generic/babel/babel.def" 1518644053 67244 2dce3d67c354c8d92f638d0f8682fb73 "" + "/usr/share/texlive/texmf-dist/tex/generic/babel/babel.sty" 1518644053 15861 065fe343082d0cd2428cf984d6b2ef66 "" + "/usr/share/texlive/texmf-dist/tex/generic/babel/switch.def" 1518644053 12523 d80bc74bf5e02fe4304443a6de8d01be "" + "/usr/share/texlive/texmf-dist/tex/generic/babel/txtbabel.def" 1518644053 7434 1b3955075683beb1c883a0fcf92ed2d5 "" + "/usr/share/texlive/texmf-dist/tex/generic/ifxetex/ifxetex.sty" 1480098815 1458 43ab4710dc82f3edeabecd0d099626b2 "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/etexcmds.sty" 1480098815 7612 729a8cc22a1ee0029997c7f74717ae05 "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/gettitlestring.sty" 1480098815 8237 3b62ef1f7e2c23a328c814b3893bc11f "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-generic.sty" 1517006633 185082 6c11d4e30ed78e2a12957b7e77030856 "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-hyperref.sty" 1480098815 70864 bcd5b216757bd619ae692a151d90085d "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifluatex.sty" 1480098815 7324 2310d1247db0114eb4726807c8837a0e "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifpdf.sty" 1490564930 1251 d170e11a3246c3392bc7f59595af42cb "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifvtex.sty" 1480098815 6797 90b7f83b0ad46826bc16058b1e3d48df "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/infwarerr.sty" 1480098815 8253 473e0e41f9adadb1977e8631b8f72ea6 "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/kvsetkeys.sty" 1480098815 14040 ac8866aac45982ac84021584b0abb252 "" + "/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ltxcmds.sty" 1480098815 18425 5b3c0c59d76fac78978b5558e83c1f36 "" + "/usr/share/texlive/texmf-dist/tex/latex/amsfonts/amsfonts.sty" 1480098820 5949 3f3fd50a8cc94c3d4cbf4fc66cd3df1c "" + "/usr/share/texlive/texmf-dist/tex/latex/amsfonts/amssymb.sty" 1480098820 13829 94730e64147574077f8ecfea9bb69af4 "" + "/usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsa.fd" 1480098820 961 6518c6525a34feb5e8250ffa91731cff "" + "/usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsb.fd" 1480098820 961 d02606146ba5601b5645f987c92e6193 "" + "/usr/share/texlive/texmf-dist/tex/latex/amsmath/amsbsy.sty" 1480098820 2210 5c54ab129b848a5071554186d0168766 "" + "/usr/share/texlive/texmf-dist/tex/latex/amsmath/amsgen.sty" 1480098820 4160 c115536cf8d4ff25aa8c1c9bc4ecb79a "" + "/usr/share/texlive/texmf-dist/tex/latex/amsmath/amsmath.sty" 1504905757 84352 897a476d96a0681047a5b0f91178a3d2 "" + "/usr/share/texlive/texmf-dist/tex/latex/amsmath/amsopn.sty" 1480098820 4115 318a66090112f3aa3f415aeb6fe8540f "" + "/usr/share/texlive/texmf-dist/tex/latex/amsmath/amstext.sty" 1480098820 2431 fe3078ec12fc30287f568596f8e0b948 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/alltt.sty" 1480098821 3140 977eaf314c97ac67b8675753fb15f67f "" + "/usr/share/texlive/texmf-dist/tex/latex/base/fontenc.sty" 1492297155 4571 13977df0eda144b93597fc709035ad1f "" + "/usr/share/texlive/texmf-dist/tex/latex/base/inputenc.sty" 1480098821 4732 d63eda807ac82cca2ca8488efd31a966 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/makeidx.sty" 1480098821 1940 c559b92ca91f1b2a0e60d836d4973f41 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/omsenc.dfu" 1487721667 2004 ac51aeac484f08c01026120d62677eca "" + "/usr/share/texlive/texmf-dist/tex/latex/base/ot1enc.dfu" 1487721667 3181 1cb3e9ad01f4a01127b2ffd821bfeec7 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/report.cls" 1480098821 22880 e7be6f7dd8c05d5108bf3a7d8cabe59a "" + "/usr/share/texlive/texmf-dist/tex/latex/base/size10.clo" 1480098821 8292 e897c12e1e886ce77fe26afc5d470886 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/t1enc.def" 1492297155 10006 a90ba4035cf778f32f424e297d92e235 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/t1enc.dfu" 1487721667 11255 9d97362866549d3d3c994b5f28d1b9b5 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/textcomp.sty" 1492297155 16154 f2c73e20ca771d534a8516c62c6b0eae "" + "/usr/share/texlive/texmf-dist/tex/latex/base/ts1cmr.fd" 1480098821 2217 d274654bda1292013bdf48d5f720a495 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.def" 1480098821 7767 aa88823823f5e767d79ea1166ab1ae74 "" + "/usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.dfu" 1487721667 4919 76510afd60e8282294f944c2f9f5103b "" + "/usr/share/texlive/texmf-dist/tex/latex/base/utf8.def" 1487721667 7784 325a2a09984cb5c4ff230f9867145ad3 "" + "/usr/share/texlive/texmf-dist/tex/latex/capt-of/capt-of.sty" 1480098823 1311 063f8536a047a2d9cb1803321f793f37 "" + "/usr/share/texlive/texmf-dist/tex/latex/carlisle/remreset.sty" 1480098823 1096 6a75275ca00e32428c6f059d2f618ea7 "" + "/usr/share/texlive/texmf-dist/tex/latex/cmap/cmap.sty" 1480098825 2883 427a7f7cb58418a0394dbd85c80668f6 "" + "/usr/share/texlive/texmf-dist/tex/latex/cmap/ot1.cmap" 1480098825 1207 4e0d96772f0d338847cbfb4eca683c81 "" + "/usr/share/texlive/texmf-dist/tex/latex/cmap/t1.cmap" 1480098825 1938 beaa4a8467aa0074076e0e19f2992e29 "" + "/usr/share/texlive/texmf-dist/tex/latex/fancyhdr/fancyhdr.sty" 1498861448 10663 d7fcc0dc4f35e8998b8cfeef8407d37d "" + "/usr/share/texlive/texmf-dist/tex/latex/fancyvrb/fancyvrb.sty" 1480098827 45360 a0833d32f1b541964596b02870342d5a "" + "/usr/share/texlive/texmf-dist/tex/latex/float/float.sty" 1480098828 6749 16d2656a1984957e674b149555f1ea1d "" + "/usr/share/texlive/texmf-dist/tex/latex/fncychap/fncychap.sty" 1480098828 19488 fdd52eb173b3197d748e1ec25acb042f "" + "/usr/share/texlive/texmf-dist/tex/latex/framed/framed.sty" 1480098829 22449 7ec15c16d0d66790f28e90343c5434a3 "" + "/usr/share/texlive/texmf-dist/tex/latex/geometry/geometry.sty" 1480098829 40502 e003406220954b0716679d7928aedd8a "" + "/usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/color.cfg" 1480098830 1213 620bba36b25224fa9b7e1ccb4ecb76fd "" + "/usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/graphics.cfg" 1480098830 1224 978390e9c2234eab29404bc21b268d1e "" + "/usr/share/texlive/texmf-dist/tex/latex/graphics-def/pdftex.def" 1515537368 17334 520b9b85ad8a2a48eda3f643e27a5179 "" + "/usr/share/texlive/texmf-dist/tex/latex/graphics/graphics.sty" 1498427532 15275 7d676729b1bedd3e7f3c6717affb366c "" + "/usr/share/texlive/texmf-dist/tex/latex/graphics/graphicx.sty" 1498427532 9066 649f2ccf62888e3d8c3e57256b70b8e1 "" + "/usr/share/texlive/texmf-dist/tex/latex/graphics/keyval.sty" 1480098830 2594 d18d5e19aa8239cf867fa670c556d2e9 "" + "/usr/share/texlive/texmf-dist/tex/latex/graphics/trig.sty" 1480098830 3980 0a268fbfda01e381fa95821ab13b6aee "" + "/usr/share/texlive/texmf-dist/tex/latex/hyperref/hpdftex.def" 1518041854 51699 9069fc983fff0db91d59a15af144ad62 "" + "/usr/share/texlive/texmf-dist/tex/latex/hyperref/hyperref.sty" 1518041854 234088 2c849389d62d41c593d9f5176c4116ab "" + "/usr/share/texlive/texmf-dist/tex/latex/hyperref/nameref.sty" 1480098831 12949 81e4e808884a8f0e276b69410e234656 "" + "/usr/share/texlive/texmf-dist/tex/latex/hyperref/pd1enc.def" 1518041854 14098 4e70bf396c7c265bd8b0e5cab3fd3d4d "" + "/usr/share/texlive/texmf-dist/tex/latex/hyperref/puenc.def" 1518041854 122411 10b605a58a28bbe5d61db37da4a85beb "" + "/usr/share/texlive/texmf-dist/tex/latex/latexconfig/epstopdf-sys.cfg" 1480098833 678 4792914a8f45be57bb98413425e4c7af "" + "/usr/share/texlive/texmf-dist/tex/latex/latexconfig/hyperref.cfg" 1480098833 235 6031e5765137be07eed51a510b2b8fb7 "" + "/usr/share/texlive/texmf-dist/tex/latex/mmap/oml.cmap" 1480098835 1866 c1c12138091b4a8edd4a24a940e6f792 "" + "/usr/share/texlive/texmf-dist/tex/latex/mmap/oms.cmap" 1480098835 2370 3b1f71b14b974f07cef532db09ae9ee0 "" + "/usr/share/texlive/texmf-dist/tex/latex/mmap/omx.cmap" 1480098835 3001 252c8ca42b06a22cb1a11c0e47790c6e "" + "/usr/share/texlive/texmf-dist/tex/latex/needspace/needspace.sty" 1480098835 852 0e34dbb72efc69fa07602405ad95585e "" + "/usr/share/texlive/texmf-dist/tex/latex/oberdiek/auxhook.sty" 1480098836 3834 4363110eb0ef1eb2b71c8fcbcdb6c357 "" + "/usr/share/texlive/texmf-dist/tex/latex/oberdiek/epstopdf-base.sty" 1480098836 12095 5337833c991d80788a43d3ce26bd1c46 "" + "/usr/share/texlive/texmf-dist/tex/latex/oberdiek/grfext.sty" 1480098836 7075 2fe3d848bba95f139de11ded085e74aa "" + "/usr/share/texlive/texmf-dist/tex/latex/oberdiek/hypcap.sty" 1480098836 3720 63669daeb0b67d5fbec899824e2f1491 "" + "/usr/share/texlive/texmf-dist/tex/latex/oberdiek/kvoptions.sty" 1480098836 22417 1d9df1eb66848aa31b18a593099cf45c "" + "/usr/share/texlive/texmf-dist/tex/latex/oberdiek/rerunfilecheck.sty" 1480098836 9581 023642318cef9f4677efe364de1e2a27 "" + "/usr/share/texlive/texmf-dist/tex/latex/parskip/parskip.sty" 1480098836 2763 02a40cc5a32805c41d919cfbdba7e99a "" + "/usr/share/texlive/texmf-dist/tex/latex/psnfss/t1pcr.fd" 1480098837 798 d5895e9edc628f2be019beb2c0ec66df "" + "/usr/share/texlive/texmf-dist/tex/latex/psnfss/t1phv.fd" 1480098837 1488 9a55ac1cde6b4798a7f56844bb75a553 "" + "/usr/share/texlive/texmf-dist/tex/latex/psnfss/t1ptm.fd" 1480098837 774 61d7da1e9f9e74989b196d147e623736 "" + "/usr/share/texlive/texmf-dist/tex/latex/psnfss/times.sty" 1480098837 857 6c716f26c5eadfb81029fcd6ce2d45e6 "" + "/usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1pcr.fd" 1480098837 643 92c451bb86386a4e36a174603ddb5a13 "" + "/usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1ptm.fd" 1480098837 619 96f56dc5d1ef1fe1121f1cfeec70ee0c "" + "/usr/share/texlive/texmf-dist/tex/latex/tabulary/tabulary.sty" 1480098840 13791 8c83287d79183c3bf58fd70871e8a70b "" + "/usr/share/texlive/texmf-dist/tex/latex/titlesec/titlesec.sty" 1480098841 37387 afa86533e532701faf233f3f592c61e0 "" + "/usr/share/texlive/texmf-dist/tex/latex/tools/array.sty" 1485129666 12396 d41f82b039f900e95f351e54ae740f31 "" + "/usr/share/texlive/texmf-dist/tex/latex/tools/longtable.sty" 1480098841 12083 80916157594a8e4354985aaefae4f367 "" + "/usr/share/texlive/texmf-dist/tex/latex/upquote/upquote.sty" 1480098842 1048 517e01cde97c1c0baf72e69d43aa5a2e "" + "/usr/share/texlive/texmf-dist/tex/latex/url/url.sty" 1480098842 12796 8edb7d69a20b857904dd0ea757c14ec9 "" + "/usr/share/texlive/texmf-dist/tex/latex/varwidth/varwidth.sty" 1480098842 10894 d359a13923460b2a73d4312d613554c8 "" + "/usr/share/texlive/texmf-dist/tex/latex/wrapfig/wrapfig.sty" 1480098843 26220 3701aebf80ccdef248c0c20dd062fea9 "" + "/usr/share/texlive/texmf-dist/tex/latex/xcolor/xcolor.sty" 1480098843 55589 34128738f682d033422ca125f82e5d62 "" + "/usr/share/texlive/texmf-dist/web2c/texmf.cnf" 1520210507 32485 c64754543d8ac501bea6e75e209ea521 "" + "/usr/share/texmf/web2c/texmf.cnf" 1520210507 32485 c64754543d8ac501bea6e75e209ea521 "" + "/var/lib/texmf/fonts/map/pdftex/updmap/pdftex.map" 1571933265 2700761 ac0584cc9514ab21918550a6948c4ee2 "" + "/var/lib/texmf/web2c/pdftex/pdflatex.fmt" 1571933283 4127049 2405b3f44d10220df7960de22302550a "" + "binary_c-python.aux" 1574288781 5733 43f4adf309cd1a6d00a228ecc76acb2d "" + "binary_c-python.ind" 1574288781 2513 cdcfff08a36b5731307fc073b0760af0 "makeindex binary_c-python.idx" + "binary_c-python.out" 1574288781 1665 e1564592c69d66ddf198a9ea56a34d1b "" + "binary_c-python.tex" 1574288780 19447 d83282ed156ea83811fa3028b611a6a4 "" + "binary_c-python.toc" 1574288781 892 cc5e2f0ca84f121d18d123b2c783f968 "" + "footnotehyper-sphinx.sty" 1574288720 8888 1bbd7bdeae8c8bed1d10d551bddb1cc9 "" + "sphinx.sty" 1574288720 77684 8fb97306ac83d50d8517c97072345a1d "" + "sphinxhighlight.sty" 1574288780 8137 38a433148fcb7611515a989ff1750dd5 "" + "sphinxmanual.cls" 1574288720 3764 e7c0a8da02dc45450256dd4cfdafb426 "" + "sphinxmessages.sty" 1574288780 731 4c7a75a0ce6092b44bece19aa46febe9 "" + "sphinxmulticell.sty" 1574288720 14618 0defbdc8536ad2e67f1eac6a1431bc55 "" + (generated) + "binary_c-python.pdf" + "binary_c-python.log" + "binary_c-python.out" + "binary_c-python.idx" + "binary_c-python.toc" + "binary_c-python.aux" diff --git a/docs/build/latex/binary_c-python.fls b/docs/build/latex/binary_c-python.fls new file mode 100644 index 0000000000000000000000000000000000000000..c6c887ab6dd150869155b5c4518f747cc491f8c1 --- /dev/null +++ b/docs/build/latex/binary_c-python.fls @@ -0,0 +1,302 @@ +PWD /home/david/projects/binary_c_root/binary_c-python/docs/build/latex +INPUT /etc/texmf/web2c/texmf.cnf +INPUT /usr/share/texmf/web2c/texmf.cnf +INPUT /usr/share/texlive/texmf-dist/web2c/texmf.cnf +INPUT /var/lib/texmf/web2c/pdftex/pdflatex.fmt +INPUT binary_c-python.tex +OUTPUT binary_c-python.log +INPUT sphinxmanual.cls +INPUT sphinxmanual.cls +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/report.cls +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/report.cls +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/size10.clo +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/size10.clo +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/inputenc.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/inputenc.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/utf8.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/utf8.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/t1enc.dfu +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/t1enc.dfu +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/ot1enc.dfu +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/ot1enc.dfu +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/omsenc.dfu +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/omsenc.dfu +INPUT /usr/share/texlive/texmf-dist/tex/latex/cmap/cmap.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/cmap/cmap.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/fontenc.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/fontenc.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/t1enc.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/t1enc.def +INPUT /usr/share/texlive/texmf-dist/fonts/map/fontname/texfonts.map +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/jknappen/ec/ecrm1000.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/cmap/t1.cmap +OUTPUT binary_c-python.pdf +INPUT /usr/share/texlive/texmf-dist/tex/latex/cmap/t1.cmap +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amsmath.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amsmath.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amstext.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amstext.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amsgen.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amsgen.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amsbsy.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amsbsy.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amsopn.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsmath/amsopn.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsfonts/amssymb.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsfonts/amssymb.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsfonts/amsfonts.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsfonts/amsfonts.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/babel/babel.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/babel/babel.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/babel/switch.def +INPUT /usr/share/texlive/texmf-dist/tex/generic/babel-english/english.ldf +INPUT /usr/share/texlive/texmf-dist/tex/generic/babel-english/english.ldf +INPUT /usr/share/texlive/texmf-dist/tex/generic/babel-english/english.ldf +INPUT /usr/share/texlive/texmf-dist/tex/generic/babel/babel.def +INPUT /usr/share/texlive/texmf-dist/tex/generic/babel/txtbabel.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/times.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/times.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/fncychap/fncychap.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/fncychap/fncychap.sty +INPUT sphinx.sty +INPUT sphinx.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/ltxcmds.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/ltxcmds.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics/graphicx.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics/graphicx.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics/keyval.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics/keyval.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics/graphics.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics/graphics.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics/trig.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics/trig.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/graphics.cfg +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/graphics.cfg +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics-def/pdftex.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics-def/pdftex.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/fancyhdr/fancyhdr.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/fancyhdr/fancyhdr.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/textcomp.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/textcomp.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.dfu +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.dfu +INPUT /usr/share/texlive/texmf-dist/tex/latex/titlesec/titlesec.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/titlesec/titlesec.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/tabulary/tabulary.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/tabulary/tabulary.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/tools/array.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/tools/array.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/tools/longtable.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/tools/longtable.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/varwidth/varwidth.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/varwidth/varwidth.sty +INPUT sphinxmulticell.sty +INPUT sphinxmulticell.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/makeidx.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/makeidx.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/framed/framed.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/framed/framed.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/xcolor/xcolor.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/xcolor/xcolor.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/xcolor/xcolor.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/color.cfg +INPUT /usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/color.cfg +INPUT /usr/share/texlive/texmf-dist/tex/latex/fancyvrb/fancyvrb.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/fancyvrb/fancyvrb.sty +INPUT footnotehyper-sphinx.sty +INPUT footnotehyper-sphinx.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/float/float.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/float/float.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/wrapfig/wrapfig.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/wrapfig/wrapfig.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/parskip/parskip.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/parskip/parskip.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/alltt.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/alltt.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/upquote/upquote.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/upquote/upquote.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/capt-of/capt-of.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/capt-of/capt-of.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/needspace/needspace.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/needspace/needspace.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/carlisle/remreset.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/carlisle/remreset.sty +INPUT sphinxhighlight.sty +INPUT sphinxhighlight.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/kvoptions.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/kvoptions.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/kvsetkeys.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/kvsetkeys.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/infwarerr.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/infwarerr.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/etexcmds.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/etexcmds.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifluatex.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifluatex.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/geometry/geometry.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/geometry/geometry.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifpdf.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifpdf.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifvtex.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifvtex.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/ifxetex/ifxetex.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/ifxetex/ifxetex.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/hyperref.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/hyperref.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-hyperref.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-hyperref.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-hyperref.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-generic.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-generic.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/auxhook.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/auxhook.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/pd1enc.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/pd1enc.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/latexconfig/hyperref.cfg +INPUT /usr/share/texlive/texmf-dist/tex/latex/latexconfig/hyperref.cfg +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/puenc.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/puenc.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/url/url.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/url/url.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/hpdftex.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/hpdftex.def +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/rerunfilecheck.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/rerunfilecheck.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/hypcap.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/hypcap.sty +INPUT sphinxmessages.sty +INPUT sphinxmessages.sty +OUTPUT binary_c-python.idx +INPUT binary_c-python.aux +INPUT binary_c-python.aux +OUTPUT binary_c-python.aux +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/ts1cmr.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/base/ts1cmr.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/t1ptm.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/t1ptm.fd +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmr8t.tfm +INPUT /usr/share/texlive/texmf-dist/tex/context/base/mkii/supp-pdf.mkii +INPUT /usr/share/texlive/texmf-dist/tex/context/base/mkii/supp-pdf.mkii +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/epstopdf-base.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/epstopdf-base.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/grfext.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/oberdiek/grfext.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/latexconfig/epstopdf-sys.cfg +INPUT /usr/share/texlive/texmf-dist/tex/latex/latexconfig/epstopdf-sys.cfg +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/nameref.sty +INPUT /usr/share/texlive/texmf-dist/tex/latex/hyperref/nameref.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/gettitlestring.sty +INPUT /usr/share/texlive/texmf-dist/tex/generic/oberdiek/gettitlestring.sty +INPUT binary_c-python.out +INPUT binary_c-python.out +INPUT binary_c-python.out +INPUT binary_c-python.out +INPUT ./binary_c-python.out +INPUT ./binary_c-python.out +OUTPUT binary_c-python.out +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/t1phv.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/t1phv.fd +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvr8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvbo8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvbo8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmr17.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/cmap/ot1.cmap +INPUT /usr/share/texlive/texmf-dist/tex/latex/cmap/ot1.cmap +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmr12.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmmi12.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/mmap/oml.cmap +INPUT /usr/share/texlive/texmf-dist/tex/latex/mmap/oml.cmap +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmmi12.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmsy10.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/mmap/oms.cmap +INPUT /usr/share/texlive/texmf-dist/tex/latex/mmap/oms.cmap +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmsy10.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmex10.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/mmap/omx.cmap +INPUT /usr/share/texlive/texmf-dist/tex/latex/mmap/omx.cmap +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/cm/cmex10.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsa.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsa.fd +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msam10.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msam10.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msam10.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsb.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsb.fd +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msbm10.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msbm10.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msbm10.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/helvetic/phvb8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8r.tfm +INPUT /var/lib/texmf/fonts/map/pdftex/updmap/pdftex.map +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/helvetic/phvb8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/helvetic/phvb8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmr8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvr8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8t.tfm +INPUT binary_c-python.toc +INPUT binary_c-python.toc +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmb8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/cmextra/cmex7.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/cmextra/cmex7.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msam7.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msam5.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msbm7.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/public/amsfonts/symbols/msbm5.tfm +OUTPUT binary_c-python.toc +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/helvetic/phvb8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/times/ptmb8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmb8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/times/ptmr8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmr8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/helvetic/phvb8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvb8r.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1ptm.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1ptm.fd +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmr8c.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/t1pcr.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/t1pcr.fd +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmr8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/times/ptmr8c.vf +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/courier/pcrr8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/courier/pcrr8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrb8t.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/courier/pcrb8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrb8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmri8t.tfm +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1pcr.fd +INPUT /usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1pcr.fd +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/courier/pcrr8c.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/times/ptmri8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/times/ptmri8r.tfm +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/courier/pcrr8c.vf +INPUT /usr/share/texlive/texmf-dist/fonts/vf/adobe/helvetic/phvr8t.vf +INPUT /usr/share/texlive/texmf-dist/fonts/tfm/adobe/helvetic/phvr8r.tfm +INPUT binary_c-python.ind +INPUT binary_c-python.ind +INPUT binary_c-python.aux +INPUT ./binary_c-python.out +INPUT ./binary_c-python.out +INPUT /usr/share/texlive/texmf-dist/fonts/enc/dvips/base/8r.enc +INPUT /usr/share/texlive/texmf-dist/fonts/type1/public/amsfonts/cm/cmmi5.pfb +INPUT /usr/share/texlive/texmf-dist/fonts/type1/public/amsfonts/cm/cmsy5.pfb +INPUT /usr/share/texlive/texmf-dist/fonts/type1/urw/courier/ucrb8a.pfb +INPUT /usr/share/texlive/texmf-dist/fonts/type1/urw/courier/ucrr8a.pfb +INPUT /usr/share/texlive/texmf-dist/fonts/type1/urw/helvetic/uhvb8a.pfb +INPUT /usr/share/texlive/texmf-dist/fonts/type1/urw/helvetic/uhvr8a.pfb +INPUT /usr/share/texlive/texmf-dist/fonts/type1/urw/times/utmb8a.pfb +INPUT /usr/share/texlive/texmf-dist/fonts/type1/urw/times/utmr8a.pfb +INPUT /usr/share/texlive/texmf-dist/fonts/type1/urw/times/utmri8a.pfb diff --git a/docs/build/latex/binary_c-python.idx b/docs/build/latex/binary_c-python.idx new file mode 100644 index 0000000000000000000000000000000000000000..829d398d27e4931dccda179293f02b037be8931e --- /dev/null +++ b/docs/build/latex/binary_c-python.idx @@ -0,0 +1,21 @@ +\indexentry{examples.examples (module)@\spxentry{examples.examples}\spxextra{module}|hyperpage}{3} +\indexentry{run\_example\_binary() (in module examples.examples)@\spxentry{run\_example\_binary()}\spxextra{in module examples.examples}|hyperpage}{3} +\indexentry{run\_example\_binary\_with\_custom\_logging() (in module examples.examples)@\spxentry{run\_example\_binary\_with\_custom\_logging()}\spxextra{in module examples.examples}|hyperpage}{3} +\indexentry{run\_example\_binary\_with\_run\_system() (in module examples.examples)@\spxentry{run\_example\_binary\_with\_run\_system()}\spxextra{in module examples.examples}|hyperpage}{3} +\indexentry{run\_example\_binary\_with\_writing\_logfile() (in module examples.examples)@\spxentry{run\_example\_binary\_with\_writing\_logfile()}\spxextra{in module examples.examples}|hyperpage}{3} +\indexentry{custom\_logging\_functions (module)@\spxentry{custom\_logging\_functions}\spxextra{module}|hyperpage}{5} +\indexentry{autogen\_C\_logging\_code() (in module custom\_logging\_functions)@\spxentry{autogen\_C\_logging\_code()}\spxextra{in module custom\_logging\_functions}|hyperpage}{5} +\indexentry{binary\_c\_log\_code() (in module custom\_logging\_functions)@\spxentry{binary\_c\_log\_code()}\spxextra{in module custom\_logging\_functions}|hyperpage}{5} +\indexentry{binary\_c\_write\_log\_code() (in module custom\_logging\_functions)@\spxentry{binary\_c\_write\_log\_code()}\spxextra{in module custom\_logging\_functions}|hyperpage}{5} +\indexentry{compile\_shared\_lib() (in module custom\_logging\_functions)@\spxentry{compile\_shared\_lib()}\spxextra{in module custom\_logging\_functions}|hyperpage}{5} +\indexentry{create\_and\_load\_logging\_function() (in module custom\_logging\_functions)@\spxentry{create\_and\_load\_logging\_function()}\spxextra{in module custom\_logging\_functions}|hyperpage}{5} +\indexentry{from\_binary\_c\_config() (in module custom\_logging\_functions)@\spxentry{from\_binary\_c\_config()}\spxextra{in module custom\_logging\_functions}|hyperpage}{5} +\indexentry{return\_compilation\_dict() (in module custom\_logging\_functions)@\spxentry{return\_compilation\_dict()}\spxextra{in module custom\_logging\_functions}|hyperpage}{5} +\indexentry{temp\_custom\_logging\_dir() (in module custom\_logging\_functions)@\spxentry{temp\_custom\_logging\_dir()}\spxextra{in module custom\_logging\_functions}|hyperpage}{5} +\indexentry{functions (module)@\spxentry{functions}\spxextra{module}|hyperpage}{6} +\indexentry{create\_arg\_string() (in module functions)@\spxentry{create\_arg\_string()}\spxextra{in module functions}|hyperpage}{6} +\indexentry{get\_arg\_keys() (in module functions)@\spxentry{get\_arg\_keys()}\spxextra{in module functions}|hyperpage}{6} +\indexentry{get\_defaults() (in module functions)@\spxentry{get\_defaults()}\spxextra{in module functions}|hyperpage}{6} +\indexentry{parse\_output() (in module functions)@\spxentry{parse\_output()}\spxextra{in module functions}|hyperpage}{6} +\indexentry{run\_system() (in module functions)@\spxentry{run\_system()}\spxextra{in module functions}|hyperpage}{6} +\indexentry{run\_system\_with\_log() (in module functions)@\spxentry{run\_system\_with\_log()}\spxextra{in module functions}|hyperpage}{6} diff --git a/docs/build/latex/binary_c-python.ilg b/docs/build/latex/binary_c-python.ilg new file mode 100644 index 0000000000000000000000000000000000000000..862f7b48e60433df7cdd54667532fcf3b736c96b --- /dev/null +++ b/docs/build/latex/binary_c-python.ilg @@ -0,0 +1,7 @@ +This is makeindex, version 2.15 [TeX Live 2017] (kpathsea + Thai support). +Scanning style file ./python.ist.......done (7 attributes redefined, 0 ignored). +Scanning input file binary_c-python.idx....done (21 entries accepted, 0 rejected). +Sorting entries....done (96 comparisons). +Generating output file binary_c-python.ind....done (65 lines written, 0 warnings). +Output written in binary_c-python.ind. +Transcript written in binary_c-python.ilg. diff --git a/docs/build/latex/binary_c-python.ind b/docs/build/latex/binary_c-python.ind new file mode 100644 index 0000000000000000000000000000000000000000..bb8332b10b0c14e2ab220b55ab162d54a3e725eb --- /dev/null +++ b/docs/build/latex/binary_c-python.ind @@ -0,0 +1,65 @@ +\begin{sphinxtheindex} +\let\bigletter\sphinxstyleindexlettergroup +\let\spxpagem \sphinxstyleindexpagemain +\let\spxentry \sphinxstyleindexentry +\let\spxextra \sphinxstyleindexextra + + \bigletter A + \item \spxentry{autogen\_C\_logging\_code()}\spxextra{in module custom\_logging\_functions}, + \hyperpage{5} + + \indexspace + \bigletter B + \item \spxentry{binary\_c\_log\_code()}\spxextra{in module custom\_logging\_functions}, + \hyperpage{5} + \item \spxentry{binary\_c\_write\_log\_code()}\spxextra{in module custom\_logging\_functions}, + \hyperpage{5} + + \indexspace + \bigletter C + \item \spxentry{compile\_shared\_lib()}\spxextra{in module custom\_logging\_functions}, + \hyperpage{5} + \item \spxentry{create\_and\_load\_logging\_function()}\spxextra{in module custom\_logging\_functions}, + \hyperpage{5} + \item \spxentry{create\_arg\_string()}\spxextra{in module functions}, \hyperpage{6} + \item \spxentry{custom\_logging\_functions}\spxextra{module}, \hyperpage{5} + + \indexspace + \bigletter E + \item \spxentry{examples.examples}\spxextra{module}, \hyperpage{3} + + \indexspace + \bigletter F + \item \spxentry{from\_binary\_c\_config()}\spxextra{in module custom\_logging\_functions}, + \hyperpage{5} + \item \spxentry{functions}\spxextra{module}, \hyperpage{6} + + \indexspace + \bigletter G + \item \spxentry{get\_arg\_keys()}\spxextra{in module functions}, \hyperpage{6} + \item \spxentry{get\_defaults()}\spxextra{in module functions}, \hyperpage{6} + + \indexspace + \bigletter P + \item \spxentry{parse\_output()}\spxextra{in module functions}, \hyperpage{6} + + \indexspace + \bigletter R + \item \spxentry{return\_compilation\_dict()}\spxextra{in module custom\_logging\_functions}, + \hyperpage{5} + \item \spxentry{run\_example\_binary()}\spxextra{in module examples.examples}, \hyperpage{3} + \item \spxentry{run\_example\_binary\_with\_custom\_logging()}\spxextra{in module examples.examples}, + \hyperpage{3} + \item \spxentry{run\_example\_binary\_with\_run\_system()}\spxextra{in module examples.examples}, + \hyperpage{3} + \item \spxentry{run\_example\_binary\_with\_writing\_logfile()}\spxextra{in module examples.examples}, + \hyperpage{3} + \item \spxentry{run\_system()}\spxextra{in module functions}, \hyperpage{6} + \item \spxentry{run\_system\_with\_log()}\spxextra{in module functions}, \hyperpage{6} + + \indexspace + \bigletter T + \item \spxentry{temp\_custom\_logging\_dir()}\spxextra{in module custom\_logging\_functions}, + \hyperpage{5} + +\end{sphinxtheindex} diff --git a/docs/build/latex/binary_c-python.log b/docs/build/latex/binary_c-python.log new file mode 100644 index 0000000000000000000000000000000000000000..448c04d4d3bafe5b9234c6db8a56790ee9c6ef97 --- /dev/null +++ b/docs/build/latex/binary_c-python.log @@ -0,0 +1,1275 @@ +This is pdfTeX, Version 3.14159265-2.6-1.40.18 (TeX Live 2017/Debian) (preloaded format=pdflatex 2019.10.24) 20 NOV 2019 22:26 +entering extended mode + restricted \write18 enabled. + %&-line parsing enabled. +**binary_c-python.tex +(./binary_c-python.tex +LaTeX2e <2017-04-15> +Babel <3.18> and hyphenation patterns for 84 language(s) loaded. +(./sphinxmanual.cls +Document Class: sphinxmanual 2018/12/23 v2.0 Document class (Sphinx manual) +(/usr/share/texlive/texmf-dist/tex/latex/base/report.cls +Document Class: report 2014/09/29 v1.4h Standard LaTeX document class +(/usr/share/texlive/texmf-dist/tex/latex/base/size10.clo +File: size10.clo 2014/09/29 v1.4h Standard LaTeX file (size option) +) +\c@part=\count79 +\c@chapter=\count80 +\c@section=\count81 +\c@subsection=\count82 +\c@subsubsection=\count83 +\c@paragraph=\count84 +\c@subparagraph=\count85 +\c@figure=\count86 +\c@table=\count87 +\abovecaptionskip=\skip41 +\belowcaptionskip=\skip42 +\bibindent=\dimen102 +)) +(/usr/share/texlive/texmf-dist/tex/latex/base/inputenc.sty +Package: inputenc 2015/03/17 v1.2c Input encoding file +\inpenc@prehook=\toks14 +\inpenc@posthook=\toks15 + +(/usr/share/texlive/texmf-dist/tex/latex/base/utf8.def +File: utf8.def 2017/01/28 v1.1t UTF-8 support for inputenc +Now handling font encoding OML ... +... no UTF-8 mapping file for font encoding OML +Now handling font encoding T1 ... +... processing UTF-8 mapping file for font encoding T1 + +(/usr/share/texlive/texmf-dist/tex/latex/base/t1enc.dfu +File: t1enc.dfu 2017/01/28 v1.1t UTF-8 support for inputenc + defining Unicode char U+00A0 (decimal 160) + defining Unicode char U+00A1 (decimal 161) + defining Unicode char U+00A3 (decimal 163) + defining Unicode char U+00AB (decimal 171) + defining Unicode char U+00AD (decimal 173) + defining Unicode char U+00BB (decimal 187) + defining Unicode char U+00BF (decimal 191) + defining Unicode char U+00C0 (decimal 192) + defining Unicode char U+00C1 (decimal 193) + defining Unicode char U+00C2 (decimal 194) + defining Unicode char U+00C3 (decimal 195) + defining Unicode char U+00C4 (decimal 196) + defining Unicode char U+00C5 (decimal 197) + defining Unicode char U+00C6 (decimal 198) + defining Unicode char U+00C7 (decimal 199) + defining Unicode char U+00C8 (decimal 200) + defining Unicode char U+00C9 (decimal 201) + defining Unicode char U+00CA (decimal 202) + defining Unicode char U+00CB (decimal 203) + defining Unicode char U+00CC (decimal 204) + defining Unicode char U+00CD (decimal 205) + defining Unicode char U+00CE (decimal 206) + defining Unicode char U+00CF (decimal 207) + defining Unicode char U+00D0 (decimal 208) + defining Unicode char U+00D1 (decimal 209) + defining Unicode char U+00D2 (decimal 210) + defining Unicode char U+00D3 (decimal 211) + defining Unicode char U+00D4 (decimal 212) + defining Unicode char U+00D5 (decimal 213) + defining Unicode char U+00D6 (decimal 214) + defining Unicode char U+00D8 (decimal 216) + defining Unicode char U+00D9 (decimal 217) + defining Unicode char U+00DA (decimal 218) + defining Unicode char U+00DB (decimal 219) + defining Unicode char U+00DC (decimal 220) + defining Unicode char U+00DD (decimal 221) + defining Unicode char U+00DE (decimal 222) + defining Unicode char U+00DF (decimal 223) + defining Unicode char U+00E0 (decimal 224) + defining Unicode char U+00E1 (decimal 225) + defining Unicode char U+00E2 (decimal 226) + defining Unicode char U+00E3 (decimal 227) + defining Unicode char U+00E4 (decimal 228) + defining Unicode char U+00E5 (decimal 229) + defining Unicode char U+00E6 (decimal 230) + defining Unicode char U+00E7 (decimal 231) + defining Unicode char U+00E8 (decimal 232) + defining Unicode char U+00E9 (decimal 233) + defining Unicode char U+00EA (decimal 234) + defining Unicode char U+00EB (decimal 235) + defining Unicode char U+00EC (decimal 236) + defining Unicode char U+00ED (decimal 237) + defining Unicode char U+00EE (decimal 238) + defining Unicode char U+00EF (decimal 239) + defining Unicode char U+00F0 (decimal 240) + defining Unicode char U+00F1 (decimal 241) + defining Unicode char U+00F2 (decimal 242) + defining Unicode char U+00F3 (decimal 243) + defining Unicode char U+00F4 (decimal 244) + defining Unicode char U+00F5 (decimal 245) + defining Unicode char U+00F6 (decimal 246) + defining Unicode char U+00F8 (decimal 248) + defining Unicode char U+00F9 (decimal 249) + defining Unicode char U+00FA (decimal 250) + defining Unicode char U+00FB (decimal 251) + defining Unicode char U+00FC (decimal 252) + defining Unicode char U+00FD (decimal 253) + defining Unicode char U+00FE (decimal 254) + defining Unicode char U+00FF (decimal 255) + defining Unicode char U+0100 (decimal 256) + defining Unicode char U+0101 (decimal 257) + defining Unicode char U+0102 (decimal 258) + defining Unicode char U+0103 (decimal 259) + defining Unicode char U+0104 (decimal 260) + defining Unicode char U+0105 (decimal 261) + defining Unicode char U+0106 (decimal 262) + defining Unicode char U+0107 (decimal 263) + defining Unicode char U+0108 (decimal 264) + defining Unicode char U+0109 (decimal 265) + defining Unicode char U+010A (decimal 266) + defining Unicode char U+010B (decimal 267) + defining Unicode char U+010C (decimal 268) + defining Unicode char U+010D (decimal 269) + defining Unicode char U+010E (decimal 270) + defining Unicode char U+010F (decimal 271) + defining Unicode char U+0110 (decimal 272) + defining Unicode char U+0111 (decimal 273) + defining Unicode char U+0112 (decimal 274) + defining Unicode char U+0113 (decimal 275) + defining Unicode char U+0114 (decimal 276) + defining Unicode char U+0115 (decimal 277) + defining Unicode char U+0116 (decimal 278) + defining Unicode char U+0117 (decimal 279) + defining Unicode char U+0118 (decimal 280) + defining Unicode char U+0119 (decimal 281) + defining Unicode char U+011A (decimal 282) + defining Unicode char U+011B (decimal 283) + defining Unicode char U+011C (decimal 284) + defining Unicode char U+011D (decimal 285) + defining Unicode char U+011E (decimal 286) + defining Unicode char U+011F (decimal 287) + defining Unicode char U+0120 (decimal 288) + defining Unicode char U+0121 (decimal 289) + defining Unicode char U+0122 (decimal 290) + defining Unicode char U+0123 (decimal 291) + defining Unicode char U+0124 (decimal 292) + defining Unicode char U+0125 (decimal 293) + defining Unicode char U+0128 (decimal 296) + defining Unicode char U+0129 (decimal 297) + defining Unicode char U+012A (decimal 298) + defining Unicode char U+012B (decimal 299) + defining Unicode char U+012C (decimal 300) + defining Unicode char U+012D (decimal 301) + defining Unicode char U+012E (decimal 302) + defining Unicode char U+012F (decimal 303) + defining Unicode char U+0130 (decimal 304) + defining Unicode char U+0131 (decimal 305) + defining Unicode char U+0132 (decimal 306) + defining Unicode char U+0133 (decimal 307) + defining Unicode char U+0134 (decimal 308) + defining Unicode char U+0135 (decimal 309) + defining Unicode char U+0136 (decimal 310) + defining Unicode char U+0137 (decimal 311) + defining Unicode char U+0139 (decimal 313) + defining Unicode char U+013A (decimal 314) + defining Unicode char U+013B (decimal 315) + defining Unicode char U+013C (decimal 316) + defining Unicode char U+013D (decimal 317) + defining Unicode char U+013E (decimal 318) + defining Unicode char U+0141 (decimal 321) + defining Unicode char U+0142 (decimal 322) + defining Unicode char U+0143 (decimal 323) + defining Unicode char U+0144 (decimal 324) + defining Unicode char U+0145 (decimal 325) + defining Unicode char U+0146 (decimal 326) + defining Unicode char U+0147 (decimal 327) + defining Unicode char U+0148 (decimal 328) + defining Unicode char U+014A (decimal 330) + defining Unicode char U+014B (decimal 331) + defining Unicode char U+014C (decimal 332) + defining Unicode char U+014D (decimal 333) + defining Unicode char U+014E (decimal 334) + defining Unicode char U+014F (decimal 335) + defining Unicode char U+0150 (decimal 336) + defining Unicode char U+0151 (decimal 337) + defining Unicode char U+0152 (decimal 338) + defining Unicode char U+0153 (decimal 339) + defining Unicode char U+0154 (decimal 340) + defining Unicode char U+0155 (decimal 341) + defining Unicode char U+0156 (decimal 342) + defining Unicode char U+0157 (decimal 343) + defining Unicode char U+0158 (decimal 344) + defining Unicode char U+0159 (decimal 345) + defining Unicode char U+015A (decimal 346) + defining Unicode char U+015B (decimal 347) + defining Unicode char U+015C (decimal 348) + defining Unicode char U+015D (decimal 349) + defining Unicode char U+015E (decimal 350) + defining Unicode char U+015F (decimal 351) + defining Unicode char U+0160 (decimal 352) + defining Unicode char U+0161 (decimal 353) + defining Unicode char U+0162 (decimal 354) + defining Unicode char U+0163 (decimal 355) + defining Unicode char U+0164 (decimal 356) + defining Unicode char U+0165 (decimal 357) + defining Unicode char U+0168 (decimal 360) + defining Unicode char U+0169 (decimal 361) + defining Unicode char U+016A (decimal 362) + defining Unicode char U+016B (decimal 363) + defining Unicode char U+016C (decimal 364) + defining Unicode char U+016D (decimal 365) + defining Unicode char U+016E (decimal 366) + defining Unicode char U+016F (decimal 367) + defining Unicode char U+0170 (decimal 368) + defining Unicode char U+0171 (decimal 369) + defining Unicode char U+0172 (decimal 370) + defining Unicode char U+0173 (decimal 371) + defining Unicode char U+0174 (decimal 372) + defining Unicode char U+0175 (decimal 373) + defining Unicode char U+0176 (decimal 374) + defining Unicode char U+0177 (decimal 375) + defining Unicode char U+0178 (decimal 376) + defining Unicode char U+0179 (decimal 377) + defining Unicode char U+017A (decimal 378) + defining Unicode char U+017B (decimal 379) + defining Unicode char U+017C (decimal 380) + defining Unicode char U+017D (decimal 381) + defining Unicode char U+017E (decimal 382) + defining Unicode char U+01CD (decimal 461) + defining Unicode char U+01CE (decimal 462) + defining Unicode char U+01CF (decimal 463) + defining Unicode char U+01D0 (decimal 464) + defining Unicode char U+01D1 (decimal 465) + defining Unicode char U+01D2 (decimal 466) + defining Unicode char U+01D3 (decimal 467) + defining Unicode char U+01D4 (decimal 468) + defining Unicode char U+01E2 (decimal 482) + defining Unicode char U+01E3 (decimal 483) + defining Unicode char U+01E6 (decimal 486) + defining Unicode char U+01E7 (decimal 487) + defining Unicode char U+01E8 (decimal 488) + defining Unicode char U+01E9 (decimal 489) + defining Unicode char U+01EA (decimal 490) + defining Unicode char U+01EB (decimal 491) + defining Unicode char U+01F0 (decimal 496) + defining Unicode char U+01F4 (decimal 500) + defining Unicode char U+01F5 (decimal 501) + defining Unicode char U+0218 (decimal 536) + defining Unicode char U+0219 (decimal 537) + defining Unicode char U+021A (decimal 538) + defining Unicode char U+021B (decimal 539) + defining Unicode char U+0232 (decimal 562) + defining Unicode char U+0233 (decimal 563) + defining Unicode char U+1E02 (decimal 7682) + defining Unicode char U+1E03 (decimal 7683) + defining Unicode char U+200C (decimal 8204) + defining Unicode char U+2010 (decimal 8208) + defining Unicode char U+2011 (decimal 8209) + defining Unicode char U+2012 (decimal 8210) + defining Unicode char U+2013 (decimal 8211) + defining Unicode char U+2014 (decimal 8212) + defining Unicode char U+2015 (decimal 8213) + defining Unicode char U+2018 (decimal 8216) + defining Unicode char U+2019 (decimal 8217) + defining Unicode char U+201A (decimal 8218) + defining Unicode char U+201C (decimal 8220) + defining Unicode char U+201D (decimal 8221) + defining Unicode char U+201E (decimal 8222) + defining Unicode char U+2030 (decimal 8240) + defining Unicode char U+2031 (decimal 8241) + defining Unicode char U+2039 (decimal 8249) + defining Unicode char U+203A (decimal 8250) + defining Unicode char U+2423 (decimal 9251) + defining Unicode char U+1E20 (decimal 7712) + defining Unicode char U+1E21 (decimal 7713) +) +Now handling font encoding OT1 ... +... processing UTF-8 mapping file for font encoding OT1 + +(/usr/share/texlive/texmf-dist/tex/latex/base/ot1enc.dfu +File: ot1enc.dfu 2017/01/28 v1.1t UTF-8 support for inputenc + defining Unicode char U+00A0 (decimal 160) + defining Unicode char U+00A1 (decimal 161) + defining Unicode char U+00A3 (decimal 163) + defining Unicode char U+00AD (decimal 173) + defining Unicode char U+00B8 (decimal 184) + defining Unicode char U+00BF (decimal 191) + defining Unicode char U+00C5 (decimal 197) + defining Unicode char U+00C6 (decimal 198) + defining Unicode char U+00D8 (decimal 216) + defining Unicode char U+00DF (decimal 223) + defining Unicode char U+00E6 (decimal 230) + defining Unicode char U+00EC (decimal 236) + defining Unicode char U+00ED (decimal 237) + defining Unicode char U+00EE (decimal 238) + defining Unicode char U+00EF (decimal 239) + defining Unicode char U+00F8 (decimal 248) + defining Unicode char U+0131 (decimal 305) + defining Unicode char U+0141 (decimal 321) + defining Unicode char U+0142 (decimal 322) + defining Unicode char U+0152 (decimal 338) + defining Unicode char U+0153 (decimal 339) + defining Unicode char U+0174 (decimal 372) + defining Unicode char U+0175 (decimal 373) + defining Unicode char U+0176 (decimal 374) + defining Unicode char U+0177 (decimal 375) + defining Unicode char U+0218 (decimal 536) + defining Unicode char U+0219 (decimal 537) + defining Unicode char U+021A (decimal 538) + defining Unicode char U+021B (decimal 539) + defining Unicode char U+2013 (decimal 8211) + defining Unicode char U+2014 (decimal 8212) + defining Unicode char U+2018 (decimal 8216) + defining Unicode char U+2019 (decimal 8217) + defining Unicode char U+201C (decimal 8220) + defining Unicode char U+201D (decimal 8221) +) +Now handling font encoding OMS ... +... processing UTF-8 mapping file for font encoding OMS + +(/usr/share/texlive/texmf-dist/tex/latex/base/omsenc.dfu +File: omsenc.dfu 2017/01/28 v1.1t UTF-8 support for inputenc + defining Unicode char U+00A7 (decimal 167) + defining Unicode char U+00B6 (decimal 182) + defining Unicode char U+00B7 (decimal 183) + defining Unicode char U+2020 (decimal 8224) + defining Unicode char U+2021 (decimal 8225) + defining Unicode char U+2022 (decimal 8226) +) +Now handling font encoding OMX ... +... no UTF-8 mapping file for font encoding OMX +Now handling font encoding U ... +... no UTF-8 mapping file for font encoding U + defining Unicode char U+00A9 (decimal 169) + defining Unicode char U+00AA (decimal 170) + defining Unicode char U+00AE (decimal 174) + defining Unicode char U+00BA (decimal 186) + defining Unicode char U+02C6 (decimal 710) + defining Unicode char U+02DC (decimal 732) + defining Unicode char U+200C (decimal 8204) + defining Unicode char U+2026 (decimal 8230) + defining Unicode char U+2122 (decimal 8482) + defining Unicode char U+2423 (decimal 9251) +)) + defining Unicode char U+00A0 (decimal 160) + defining Unicode char U+2500 (decimal 9472) + defining Unicode char U+2502 (decimal 9474) + defining Unicode char U+2514 (decimal 9492) + defining Unicode char U+251C (decimal 9500) + defining Unicode char U+2572 (decimal 9586) + +(/usr/share/texlive/texmf-dist/tex/latex/cmap/cmap.sty +Package: cmap 2008/03/06 v1.0h CMap support: searchable PDF +) +(/usr/share/texlive/texmf-dist/tex/latex/base/fontenc.sty +Package: fontenc 2017/04/05 v2.0i Standard LaTeX package + +(/usr/share/texlive/texmf-dist/tex/latex/base/t1enc.def +File: t1enc.def 2017/04/05 v2.0i Standard LaTeX file +LaTeX Font Info: Redeclaring font encoding T1 on input line 48. +)<<t1.cmap>>) +(/usr/share/texlive/texmf-dist/tex/latex/amsmath/amsmath.sty +Package: amsmath 2017/09/02 v2.17a AMS math features +\@mathmargin=\skip43 + +For additional information on amsmath, use the `?' option. +(/usr/share/texlive/texmf-dist/tex/latex/amsmath/amstext.sty +Package: amstext 2000/06/29 v2.01 AMS text + +(/usr/share/texlive/texmf-dist/tex/latex/amsmath/amsgen.sty +File: amsgen.sty 1999/11/30 v2.0 generic functions +\@emptytoks=\toks16 +\ex@=\dimen103 +)) +(/usr/share/texlive/texmf-dist/tex/latex/amsmath/amsbsy.sty +Package: amsbsy 1999/11/29 v1.2d Bold Symbols +\pmbraise@=\dimen104 +) +(/usr/share/texlive/texmf-dist/tex/latex/amsmath/amsopn.sty +Package: amsopn 2016/03/08 v2.02 operator names +) +\inf@bad=\count88 +LaTeX Info: Redefining \frac on input line 213. +\uproot@=\count89 +\leftroot@=\count90 +LaTeX Info: Redefining \overline on input line 375. +\classnum@=\count91 +\DOTSCASE@=\count92 +LaTeX Info: Redefining \ldots on input line 472. +LaTeX Info: Redefining \dots on input line 475. +LaTeX Info: Redefining \cdots on input line 596. +\Mathstrutbox@=\box26 +\strutbox@=\box27 +\big@size=\dimen105 +LaTeX Font Info: Redeclaring font encoding OML on input line 712. +LaTeX Font Info: Redeclaring font encoding OMS on input line 713. +\macc@depth=\count93 +\c@MaxMatrixCols=\count94 +\dotsspace@=\muskip10 +\c@parentequation=\count95 +\dspbrk@lvl=\count96 +\tag@help=\toks17 +\row@=\count97 +\column@=\count98 +\maxfields@=\count99 +\andhelp@=\toks18 +\eqnshift@=\dimen106 +\alignsep@=\dimen107 +\tagshift@=\dimen108 +\tagwidth@=\dimen109 +\totwidth@=\dimen110 +\lineht@=\dimen111 +\@envbody=\toks19 +\multlinegap=\skip44 +\multlinetaggap=\skip45 +\mathdisplay@stack=\toks20 +LaTeX Info: Redefining \[ on input line 2817. +LaTeX Info: Redefining \] on input line 2818. +) +(/usr/share/texlive/texmf-dist/tex/latex/amsfonts/amssymb.sty +Package: amssymb 2013/01/14 v3.01 AMS font symbols + +(/usr/share/texlive/texmf-dist/tex/latex/amsfonts/amsfonts.sty +Package: amsfonts 2013/01/14 v3.01 Basic AMSFonts support +\symAMSa=\mathgroup4 +\symAMSb=\mathgroup5 +LaTeX Font Info: Overwriting math alphabet `\mathfrak' in version `bold' +(Font) U/euf/m/n --> U/euf/b/n on input line 106. +)) +(/usr/share/texlive/texmf-dist/tex/generic/babel/babel.sty +Package: babel 2018/02/14 3.18 The Babel package + +(/usr/share/texlive/texmf-dist/tex/generic/babel/switch.def +File: switch.def 2018/02/14 3.18 Babel switching mechanism +) +(/usr/share/texlive/texmf-dist/tex/generic/babel-english/english.ldf +Language: english 2017/06/06 v3.3r English support from the babel system + +(/usr/share/texlive/texmf-dist/tex/generic/babel/babel.def +File: babel.def 2018/02/14 3.18 Babel common definitions +\babel@savecnt=\count100 +\U@D=\dimen112 + +(/usr/share/texlive/texmf-dist/tex/generic/babel/txtbabel.def) +\bbl@dirlevel=\count101 +) +\l@canadian = a dialect from \language\l@american +\l@australian = a dialect from \language\l@british +\l@newzealand = a dialect from \language\l@british +)) +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/times.sty +Package: times 2005/04/12 PSNFSS-v9.2a (SPQR) +) +(/usr/share/texlive/texmf-dist/tex/latex/fncychap/fncychap.sty +Package: fncychap 2007/07/30 v1.34 LaTeX package (Revised chapters) +\RW=\skip46 +\mylen=\skip47 +\myhi=\skip48 +\px=\skip49 +\py=\skip50 +\pyy=\skip51 +\pxx=\skip52 +\c@AlphaCnt=\count102 +\c@AlphaDecCnt=\count103 +) (./sphinx.sty +Package: sphinx 2019/09/02 v2.2.1 LaTeX package (Sphinx markup) + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ltxcmds.sty +Package: ltxcmds 2016/05/16 v1.23 LaTeX kernel commands for general use (HO) +) +(/usr/share/texlive/texmf-dist/tex/latex/graphics/graphicx.sty +Package: graphicx 2017/06/01 v1.1a Enhanced LaTeX Graphics (DPC,SPQR) + +(/usr/share/texlive/texmf-dist/tex/latex/graphics/keyval.sty +Package: keyval 2014/10/28 v1.15 key=value parser (DPC) +\KV@toks@=\toks21 +) +(/usr/share/texlive/texmf-dist/tex/latex/graphics/graphics.sty +Package: graphics 2017/06/25 v1.2c Standard LaTeX Graphics (DPC,SPQR) + +(/usr/share/texlive/texmf-dist/tex/latex/graphics/trig.sty +Package: trig 2016/01/03 v1.10 sin cos tan (DPC) +) +(/usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/graphics.cfg +File: graphics.cfg 2016/06/04 v1.11 sample graphics configuration +) +Package graphics Info: Driver file: pdftex.def on input line 99. + +(/usr/share/texlive/texmf-dist/tex/latex/graphics-def/pdftex.def +File: pdftex.def 2018/01/08 v1.0l Graphics/color driver for pdftex +)) +\Gin@req@height=\dimen113 +\Gin@req@width=\dimen114 +) +(/usr/share/texlive/texmf-dist/tex/latex/fancyhdr/fancyhdr.sty +Package: fancyhdr 2017/06/30 v3.9a Extensive control of page headers and footer +s +\f@nch@headwidth=\skip53 +\f@nch@O@elh=\skip54 +\f@nch@O@erh=\skip55 +\f@nch@O@olh=\skip56 +\f@nch@O@orh=\skip57 +\f@nch@O@elf=\skip58 +\f@nch@O@erf=\skip59 +\f@nch@O@olf=\skip60 +\f@nch@O@orf=\skip61 +) +(/usr/share/texlive/texmf-dist/tex/latex/base/textcomp.sty +Package: textcomp 2017/04/05 v2.0i Standard LaTeX package +Package textcomp Info: Sub-encoding information: +(textcomp) 5 = only ISO-Adobe without \textcurrency +(textcomp) 4 = 5 + \texteuro +(textcomp) 3 = 4 + \textohm +(textcomp) 2 = 3 + \textestimated + \textcurrency +(textcomp) 1 = TS1 - \textcircled - \t +(textcomp) 0 = TS1 (full) +(textcomp) Font families with sub-encoding setting implement +(textcomp) only a restricted character set as indicated. +(textcomp) Family '?' is the default used for unknown fonts. +(textcomp) See the documentation for details. +Package textcomp Info: Setting ? sub-encoding to TS1/1 on input line 79. + +(/usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.def +File: ts1enc.def 2001/06/05 v3.0e (jk/car/fm) Standard LaTeX file +Now handling font encoding TS1 ... +... processing UTF-8 mapping file for font encoding TS1 + +(/usr/share/texlive/texmf-dist/tex/latex/base/ts1enc.dfu +File: ts1enc.dfu 2017/01/28 v1.1t UTF-8 support for inputenc + defining Unicode char U+00A2 (decimal 162) + defining Unicode char U+00A3 (decimal 163) + defining Unicode char U+00A4 (decimal 164) + defining Unicode char U+00A5 (decimal 165) + defining Unicode char U+00A6 (decimal 166) + defining Unicode char U+00A7 (decimal 167) + defining Unicode char U+00A8 (decimal 168) + defining Unicode char U+00A9 (decimal 169) + defining Unicode char U+00AA (decimal 170) + defining Unicode char U+00AC (decimal 172) + defining Unicode char U+00AE (decimal 174) + defining Unicode char U+00AF (decimal 175) + defining Unicode char U+00B0 (decimal 176) + defining Unicode char U+00B1 (decimal 177) + defining Unicode char U+00B2 (decimal 178) + defining Unicode char U+00B3 (decimal 179) + defining Unicode char U+00B4 (decimal 180) + defining Unicode char U+00B5 (decimal 181) + defining Unicode char U+00B6 (decimal 182) + defining Unicode char U+00B7 (decimal 183) + defining Unicode char U+00B9 (decimal 185) + defining Unicode char U+00BA (decimal 186) + defining Unicode char U+00BC (decimal 188) + defining Unicode char U+00BD (decimal 189) + defining Unicode char U+00BE (decimal 190) + defining Unicode char U+00D7 (decimal 215) + defining Unicode char U+00F7 (decimal 247) + defining Unicode char U+0192 (decimal 402) + defining Unicode char U+02C7 (decimal 711) + defining Unicode char U+02D8 (decimal 728) + defining Unicode char U+02DD (decimal 733) + defining Unicode char U+0E3F (decimal 3647) + defining Unicode char U+2016 (decimal 8214) + defining Unicode char U+2020 (decimal 8224) + defining Unicode char U+2021 (decimal 8225) + defining Unicode char U+2022 (decimal 8226) + defining Unicode char U+2030 (decimal 8240) + defining Unicode char U+2031 (decimal 8241) + defining Unicode char U+203B (decimal 8251) + defining Unicode char U+203D (decimal 8253) + defining Unicode char U+2044 (decimal 8260) + defining Unicode char U+204E (decimal 8270) + defining Unicode char U+2052 (decimal 8274) + defining Unicode char U+20A1 (decimal 8353) + defining Unicode char U+20A4 (decimal 8356) + defining Unicode char U+20A6 (decimal 8358) + defining Unicode char U+20A9 (decimal 8361) + defining Unicode char U+20AB (decimal 8363) + defining Unicode char U+20AC (decimal 8364) + defining Unicode char U+20B1 (decimal 8369) + defining Unicode char U+2103 (decimal 8451) + defining Unicode char U+2116 (decimal 8470) + defining Unicode char U+2117 (decimal 8471) + defining Unicode char U+211E (decimal 8478) + defining Unicode char U+2120 (decimal 8480) + defining Unicode char U+2122 (decimal 8482) + defining Unicode char U+2126 (decimal 8486) + defining Unicode char U+2127 (decimal 8487) + defining Unicode char U+212E (decimal 8494) + defining Unicode char U+2190 (decimal 8592) + defining Unicode char U+2191 (decimal 8593) + defining Unicode char U+2192 (decimal 8594) + defining Unicode char U+2193 (decimal 8595) + defining Unicode char U+2329 (decimal 9001) + defining Unicode char U+232A (decimal 9002) + defining Unicode char U+2422 (decimal 9250) + defining Unicode char U+25E6 (decimal 9702) + defining Unicode char U+25EF (decimal 9711) + defining Unicode char U+266A (decimal 9834) +)) +LaTeX Info: Redefining \oldstylenums on input line 334. +Package textcomp Info: Setting cmr sub-encoding to TS1/0 on input line 349. +Package textcomp Info: Setting cmss sub-encoding to TS1/0 on input line 350. +Package textcomp Info: Setting cmtt sub-encoding to TS1/0 on input line 351. +Package textcomp Info: Setting cmvtt sub-encoding to TS1/0 on input line 352. +Package textcomp Info: Setting cmbr sub-encoding to TS1/0 on input line 353. +Package textcomp Info: Setting cmtl sub-encoding to TS1/0 on input line 354. +Package textcomp Info: Setting ccr sub-encoding to TS1/0 on input line 355. +Package textcomp Info: Setting ptm sub-encoding to TS1/4 on input line 356. +Package textcomp Info: Setting pcr sub-encoding to TS1/4 on input line 357. +Package textcomp Info: Setting phv sub-encoding to TS1/4 on input line 358. +Package textcomp Info: Setting ppl sub-encoding to TS1/3 on input line 359. +Package textcomp Info: Setting pag sub-encoding to TS1/4 on input line 360. +Package textcomp Info: Setting pbk sub-encoding to TS1/4 on input line 361. +Package textcomp Info: Setting pnc sub-encoding to TS1/4 on input line 362. +Package textcomp Info: Setting pzc sub-encoding to TS1/4 on input line 363. +Package textcomp Info: Setting bch sub-encoding to TS1/4 on input line 364. +Package textcomp Info: Setting put sub-encoding to TS1/5 on input line 365. +Package textcomp Info: Setting uag sub-encoding to TS1/5 on input line 366. +Package textcomp Info: Setting ugq sub-encoding to TS1/5 on input line 367. +Package textcomp Info: Setting ul8 sub-encoding to TS1/4 on input line 368. +Package textcomp Info: Setting ul9 sub-encoding to TS1/4 on input line 369. +Package textcomp Info: Setting augie sub-encoding to TS1/5 on input line 370. +Package textcomp Info: Setting dayrom sub-encoding to TS1/3 on input line 371. +Package textcomp Info: Setting dayroms sub-encoding to TS1/3 on input line 372. + +Package textcomp Info: Setting pxr sub-encoding to TS1/0 on input line 373. +Package textcomp Info: Setting pxss sub-encoding to TS1/0 on input line 374. +Package textcomp Info: Setting pxtt sub-encoding to TS1/0 on input line 375. +Package textcomp Info: Setting txr sub-encoding to TS1/0 on input line 376. +Package textcomp Info: Setting txss sub-encoding to TS1/0 on input line 377. +Package textcomp Info: Setting txtt sub-encoding to TS1/0 on input line 378. +Package textcomp Info: Setting lmr sub-encoding to TS1/0 on input line 379. +Package textcomp Info: Setting lmdh sub-encoding to TS1/0 on input line 380. +Package textcomp Info: Setting lmss sub-encoding to TS1/0 on input line 381. +Package textcomp Info: Setting lmssq sub-encoding to TS1/0 on input line 382. +Package textcomp Info: Setting lmvtt sub-encoding to TS1/0 on input line 383. +Package textcomp Info: Setting lmtt sub-encoding to TS1/0 on input line 384. +Package textcomp Info: Setting qhv sub-encoding to TS1/0 on input line 385. +Package textcomp Info: Setting qag sub-encoding to TS1/0 on input line 386. +Package textcomp Info: Setting qbk sub-encoding to TS1/0 on input line 387. +Package textcomp Info: Setting qcr sub-encoding to TS1/0 on input line 388. +Package textcomp Info: Setting qcs sub-encoding to TS1/0 on input line 389. +Package textcomp Info: Setting qpl sub-encoding to TS1/0 on input line 390. +Package textcomp Info: Setting qtm sub-encoding to TS1/0 on input line 391. +Package textcomp Info: Setting qzc sub-encoding to TS1/0 on input line 392. +Package textcomp Info: Setting qhvc sub-encoding to TS1/0 on input line 393. +Package textcomp Info: Setting futs sub-encoding to TS1/4 on input line 394. +Package textcomp Info: Setting futx sub-encoding to TS1/4 on input line 395. +Package textcomp Info: Setting futj sub-encoding to TS1/4 on input line 396. +Package textcomp Info: Setting hlh sub-encoding to TS1/3 on input line 397. +Package textcomp Info: Setting hls sub-encoding to TS1/3 on input line 398. +Package textcomp Info: Setting hlst sub-encoding to TS1/3 on input line 399. +Package textcomp Info: Setting hlct sub-encoding to TS1/5 on input line 400. +Package textcomp Info: Setting hlx sub-encoding to TS1/5 on input line 401. +Package textcomp Info: Setting hlce sub-encoding to TS1/5 on input line 402. +Package textcomp Info: Setting hlcn sub-encoding to TS1/5 on input line 403. +Package textcomp Info: Setting hlcw sub-encoding to TS1/5 on input line 404. +Package textcomp Info: Setting hlcf sub-encoding to TS1/5 on input line 405. +Package textcomp Info: Setting pplx sub-encoding to TS1/3 on input line 406. +Package textcomp Info: Setting pplj sub-encoding to TS1/3 on input line 407. +Package textcomp Info: Setting ptmx sub-encoding to TS1/4 on input line 408. +Package textcomp Info: Setting ptmj sub-encoding to TS1/4 on input line 409. +) +(/usr/share/texlive/texmf-dist/tex/latex/titlesec/titlesec.sty +Package: titlesec 2016/03/21 v2.10.2 Sectioning titles +\ttl@box=\box28 +\beforetitleunit=\skip62 +\aftertitleunit=\skip63 +\ttl@plus=\dimen115 +\ttl@minus=\dimen116 +\ttl@toksa=\toks22 +\titlewidth=\dimen117 +\titlewidthlast=\dimen118 +\titlewidthfirst=\dimen119 +) +(/usr/share/texlive/texmf-dist/tex/latex/tabulary/tabulary.sty +Package: tabulary 2014/06/11 v0.10 tabulary package (DPC) + +(/usr/share/texlive/texmf-dist/tex/latex/tools/array.sty +Package: array 2016/10/06 v2.4d Tabular extension package (FMi) +\col@sep=\dimen120 +\extrarowheight=\dimen121 +\NC@list=\toks23 +\extratabsurround=\skip64 +\backup@length=\skip65 +) +\TY@count=\count104 +\TY@linewidth=\dimen122 +\tymin=\dimen123 +\tymax=\dimen124 +\TY@tablewidth=\dimen125 +) +(/usr/share/texlive/texmf-dist/tex/latex/tools/longtable.sty +Package: longtable 2014/10/28 v4.11 Multi-page Table package (DPC) +\LTleft=\skip66 +\LTright=\skip67 +\LTpre=\skip68 +\LTpost=\skip69 +\LTchunksize=\count105 +\LTcapwidth=\dimen126 +\LT@head=\box29 +\LT@firsthead=\box30 +\LT@foot=\box31 +\LT@lastfoot=\box32 +\LT@cols=\count106 +\LT@rows=\count107 +\c@LT@tables=\count108 +\c@LT@chunks=\count109 +\LT@p@ftn=\toks24 +) +(/usr/share/texlive/texmf-dist/tex/latex/varwidth/varwidth.sty +Package: varwidth 2009/03/30 ver 0.92; Variable-width minipages +\@vwid@box=\box33 +\sift@deathcycles=\count110 +\@vwid@loff=\dimen127 +\@vwid@roff=\dimen128 +) +(./sphinxmulticell.sty +Package: sphinxmulticell 2017/02/23 v1.6 better span rows and columns of a tabl +e (Sphinx team) +\sphinx@TY@tablewidth=\dimen129 +) +(/usr/share/texlive/texmf-dist/tex/latex/base/makeidx.sty +Package: makeidx 2014/09/29 v1.0m Standard LaTeX package +) +(/usr/share/texlive/texmf-dist/tex/latex/framed/framed.sty +Package: framed 2011/10/22 v 0.96: framed or shaded text with page breaks +\OuterFrameSep=\skip70 +\fb@frw=\dimen130 +\fb@frh=\dimen131 +\FrameRule=\dimen132 +\FrameSep=\dimen133 +) +(/usr/share/texlive/texmf-dist/tex/latex/xcolor/xcolor.sty +Package: xcolor 2016/05/11 v2.12 LaTeX color extensions (UK) + +(/usr/share/texlive/texmf-dist/tex/latex/graphics-cfg/color.cfg +File: color.cfg 2016/01/02 v1.6 sample color configuration +) +Package xcolor Info: Driver file: pdftex.def on input line 225. +Package xcolor Info: Model `cmy' substituted by `cmy0' on input line 1348. +Package xcolor Info: Model `hsb' substituted by `rgb' on input line 1352. +Package xcolor Info: Model `RGB' extended on input line 1364. +Package xcolor Info: Model `HTML' substituted by `rgb' on input line 1366. +Package xcolor Info: Model `Hsb' substituted by `hsb' on input line 1367. +Package xcolor Info: Model `tHsb' substituted by `hsb' on input line 1368. +Package xcolor Info: Model `HSB' substituted by `hsb' on input line 1369. +Package xcolor Info: Model `Gray' substituted by `gray' on input line 1370. +Package xcolor Info: Model `wave' substituted by `hsb' on input line 1371. +) +(/usr/share/texlive/texmf-dist/tex/latex/fancyvrb/fancyvrb.sty +Package: fancyvrb 2008/02/07 + +Style option: `fancyvrb' v2.7a, with DG/SPQR fixes, and firstline=lastline fix +<2008/02/07> (tvz) +\FV@CodeLineNo=\count111 +\FV@InFile=\read1 +\FV@TabBox=\box34 +\c@FancyVerbLine=\count112 +\FV@StepNumber=\count113 +\FV@OutFile=\write3 +) (./footnotehyper-sphinx.sty +Package: footnotehyper-sphinx 2017/10/27 v1.7 hyperref aware footnote.sty for s +phinx (JFB) +\FNH@notes=\box35 +\FNH@width=\dimen134 +) +(/usr/share/texlive/texmf-dist/tex/latex/float/float.sty +Package: float 2001/11/08 v1.3d Float enhancements (AL) +\c@float@type=\count114 +\float@exts=\toks25 +\float@box=\box36 +\@float@everytoks=\toks26 +\@floatcapt=\box37 +) +(/usr/share/texlive/texmf-dist/tex/latex/wrapfig/wrapfig.sty +\wrapoverhang=\dimen135 +\WF@size=\dimen136 +\c@WF@wrappedlines=\count115 +\WF@box=\box38 +\WF@everypar=\toks27 +Package: wrapfig 2003/01/31 v 3.6 +) +(/usr/share/texlive/texmf-dist/tex/latex/parskip/parskip.sty +Package: parskip 2001/04/09 non-zero parskip adjustments +) +(/usr/share/texlive/texmf-dist/tex/latex/base/alltt.sty +Package: alltt 1997/06/16 v2.0g defines alltt environment +) +(/usr/share/texlive/texmf-dist/tex/latex/upquote/upquote.sty +Package: upquote 2012/04/19 v1.3 upright-quote and grave-accent glyphs in verba +tim +) +(/usr/share/texlive/texmf-dist/tex/latex/capt-of/capt-of.sty +Package: capt-of 2009/12/29 v0.2 standard captions outside of floats +) +(/usr/share/texlive/texmf-dist/tex/latex/needspace/needspace.sty +Package: needspace 2010/09/12 v1.3d reserve vertical space +) +(/usr/share/texlive/texmf-dist/tex/latex/carlisle/remreset.sty) +(./sphinxhighlight.sty +Package: sphinxhighlight 2016/05/29 stylesheet for highlighting with pygments +) +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/kvoptions.sty +Package: kvoptions 2016/05/16 v3.12 Key value format for package options (HO) + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/kvsetkeys.sty +Package: kvsetkeys 2016/05/16 v1.17 Key value parser (HO) + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/infwarerr.sty +Package: infwarerr 2016/05/16 v1.4 Providing info/warning/error messages (HO) +) +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/etexcmds.sty +Package: etexcmds 2016/05/16 v1.6 Avoid name clashes with e-TeX commands (HO) + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifluatex.sty +Package: ifluatex 2016/05/16 v1.4 Provides the ifluatex switch (HO) +Package ifluatex Info: LuaTeX not detected. +) +Package etexcmds Info: Could not find \expanded. +(etexcmds) That can mean that you are not using pdfTeX 1.50 or +(etexcmds) that some package has redefined \expanded. +(etexcmds) In the latter case, load this package earlier. +))) +\sphinxverbatimsep=\dimen137 +\sphinxverbatimborder=\dimen138 +\sphinxshadowsep=\dimen139 +\sphinxshadowsize=\dimen140 +\sphinxshadowrule=\dimen141 +\spx@notice@border=\dimen142 +\spx@image@maxheight=\dimen143 +\spx@image@box=\dimen144 +\c@literalblock=\count116 +\sphinxcontinuationbox=\box39 +\sphinxvisiblespacebox=\box40 +\sphinxVerbatim@TitleBox=\box41 +\py@argswidth=\skip71 +\lineblockindentation=\skip72 +\DUlineblockindent=\skip73 +) +(/usr/share/texlive/texmf-dist/tex/latex/geometry/geometry.sty +Package: geometry 2010/09/12 v5.6 Page Geometry + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifpdf.sty +Package: ifpdf 2017/03/15 v3.2 Provides the ifpdf switch +) +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/ifvtex.sty +Package: ifvtex 2016/05/16 v1.6 Detect VTeX and its facilities (HO) +Package ifvtex Info: VTeX not detected. +) +(/usr/share/texlive/texmf-dist/tex/generic/ifxetex/ifxetex.sty +Package: ifxetex 2010/09/12 v0.6 Provides ifxetex conditional +) +\Gm@cnth=\count117 +\Gm@cntv=\count118 +\c@Gm@tempcnt=\count119 +\Gm@bindingoffset=\dimen145 +\Gm@wd@mp=\dimen146 +\Gm@odd@mp=\dimen147 +\Gm@even@mp=\dimen148 +\Gm@layoutwidth=\dimen149 +\Gm@layoutheight=\dimen150 +\Gm@layouthoffset=\dimen151 +\Gm@layoutvoffset=\dimen152 +\Gm@dimlist=\toks28 +) +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/hyperref.sty +Package: hyperref 2018/02/06 v6.86b Hypertext links for LaTeX + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-hyperref.sty +Package: hobsub-hyperref 2016/05/16 v1.14 Bundle oberdiek, subset hyperref (HO) + + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/hobsub-generic.sty +Package: hobsub-generic 2016/05/16 v1.14 Bundle oberdiek, subset generic (HO) +Package: hobsub 2016/05/16 v1.14 Construct package bundles (HO) +Package hobsub Info: Skipping package `infwarerr' (already loaded). +Package hobsub Info: Skipping package `ltxcmds' (already loaded). +Package hobsub Info: Skipping package `ifluatex' (already loaded). +Package hobsub Info: Skipping package `ifvtex' (already loaded). +Package: intcalc 2016/05/16 v1.2 Expandable calculations with integers (HO) +Package hobsub Info: Skipping package `ifpdf' (already loaded). +Package hobsub Info: Skipping package `etexcmds' (already loaded). +Package hobsub Info: Skipping package `kvsetkeys' (already loaded). +Package: kvdefinekeys 2016/05/16 v1.4 Define keys (HO) +Package: pdftexcmds 2018/01/21 v0.26 Utility functions of pdfTeX for LuaTeX (HO +) +Package pdftexcmds Info: LuaTeX not detected. +Package pdftexcmds Info: \pdf@primitive is available. +Package pdftexcmds Info: \pdf@ifprimitive is available. +Package pdftexcmds Info: \pdfdraftmode found. +Package: pdfescape 2016/05/16 v1.14 Implements pdfTeX's escape features (HO) +Package: bigintcalc 2016/05/16 v1.4 Expandable calculations on big integers (HO +) +Package: bitset 2016/05/16 v1.2 Handle bit-vector datatype (HO) +Package: uniquecounter 2016/05/16 v1.3 Provide unlimited unique counter (HO) +) +Package hobsub Info: Skipping package `hobsub' (already loaded). +Package: letltxmacro 2016/05/16 v1.5 Let assignment for LaTeX macros (HO) +Package: hopatch 2016/05/16 v1.3 Wrapper for package hooks (HO) +Package: xcolor-patch 2016/05/16 xcolor patch +Package: atveryend 2016/05/16 v1.9 Hooks at the very end of document (HO) +Package atveryend Info: \enddocument detected (standard20110627). +Package: atbegshi 2016/06/09 v1.18 At begin shipout hook (HO) +Package: refcount 2016/05/16 v3.5 Data extraction from label references (HO) +Package: hycolor 2016/05/16 v1.8 Color options for hyperref/bookmark (HO) +) +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/auxhook.sty +Package: auxhook 2016/05/16 v1.4 Hooks for auxiliary files (HO) +) +\@linkdim=\dimen153 +\Hy@linkcounter=\count120 +\Hy@pagecounter=\count121 + +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/pd1enc.def +File: pd1enc.def 2018/02/06 v6.86b Hyperref: PDFDocEncoding definition (HO) +Now handling font encoding PD1 ... +... no UTF-8 mapping file for font encoding PD1 +) +\Hy@SavedSpaceFactor=\count122 + +(/usr/share/texlive/texmf-dist/tex/latex/latexconfig/hyperref.cfg +File: hyperref.cfg 2002/06/06 v1.2 hyperref configuration of TeXLive +) +Package hyperref Info: Option `unicode' set `true' on input line 4383. + +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/puenc.def +File: puenc.def 2018/02/06 v6.86b Hyperref: PDF Unicode definition (HO) +Now handling font encoding PU ... +... no UTF-8 mapping file for font encoding PU +) +Package hyperref Info: Option `colorlinks' set `true' on input line 4383. +Package hyperref Info: Option `breaklinks' set `true' on input line 4383. +Package hyperref Info: Hyper figures OFF on input line 4509. +Package hyperref Info: Link nesting OFF on input line 4514. +Package hyperref Info: Hyper index ON on input line 4517. +Package hyperref Info: Plain pages OFF on input line 4524. +Package hyperref Info: Backreferencing OFF on input line 4529. +Package hyperref Info: Implicit mode ON; LaTeX internals redefined. +Package hyperref Info: Bookmarks ON on input line 4762. +\c@Hy@tempcnt=\count123 + +(/usr/share/texlive/texmf-dist/tex/latex/url/url.sty +\Urlmuskip=\muskip11 +Package: url 2013/09/16 ver 3.4 Verb mode for urls, etc. +) +LaTeX Info: Redefining \url on input line 5115. +\XeTeXLinkMargin=\dimen154 +\Fld@menulength=\count124 +\Field@Width=\dimen155 +\Fld@charsize=\dimen156 +Package hyperref Info: Hyper figures OFF on input line 6369. +Package hyperref Info: Link nesting OFF on input line 6374. +Package hyperref Info: Hyper index ON on input line 6377. +Package hyperref Info: backreferencing OFF on input line 6384. +Package hyperref Info: Link coloring ON on input line 6387. +Package hyperref Info: Link coloring with OCG OFF on input line 6394. +Package hyperref Info: PDF/A mode OFF on input line 6399. +LaTeX Info: Redefining \ref on input line 6439. +LaTeX Info: Redefining \pageref on input line 6443. +\Hy@abspage=\count125 +\c@Item=\count126 +\c@Hfootnote=\count127 +) +Package hyperref Info: Driver (autodetected): hpdftex. + +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/hpdftex.def +File: hpdftex.def 2018/02/06 v6.86b Hyperref driver for pdfTeX +\Fld@listcount=\count128 +\c@bookmark@seq@number=\count129 + +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/rerunfilecheck.sty +Package: rerunfilecheck 2016/05/16 v1.8 Rerun checks for auxiliary files (HO) +Package uniquecounter Info: New unique counter `rerunfilecheck' on input line 2 +82. +) +\Hy@SectionHShift=\skip74 +) +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/hypcap.sty +Package: hypcap 2016/05/16 v1.12 Adjusting the anchors of captions (HO) +) +(./sphinxmessages.sty +Package: sphinxmessages 2019/01/04 v2.0 Localized LaTeX macros (Sphinx team) +) +\@indexfile=\write4 +\openout4 = `binary_c-python.idx'. + + +Writing index file binary_c-python.idx +(./binary_c-python.aux) +\openout1 = `binary_c-python.aux'. + +LaTeX Font Info: Checking defaults for OML/cmm/m/it on input line 81. +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Checking defaults for T1/cmr/m/n on input line 81. +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Checking defaults for OT1/cmr/m/n on input line 81. +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Checking defaults for OMS/cmsy/m/n on input line 81. +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Checking defaults for OMX/cmex/m/n on input line 81. +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Checking defaults for U/cmr/m/n on input line 81. +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Checking defaults for TS1/cmr/m/n on input line 81. +LaTeX Font Info: Try loading font information for TS1+cmr on input line 81. + (/usr/share/texlive/texmf-dist/tex/latex/base/ts1cmr.fd +File: ts1cmr.fd 2014/09/29 v2.5h Standard LaTeX font definitions +) +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Checking defaults for PD1/pdf/m/n on input line 81. +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Checking defaults for PU/pdf/m/n on input line 81. +LaTeX Font Info: ... okay on input line 81. +LaTeX Font Info: Try loading font information for T1+ptm on input line 81. + (/usr/share/texlive/texmf-dist/tex/latex/psnfss/t1ptm.fd +File: t1ptm.fd 2001/06/04 font definitions for T1/ptm. +) +(/usr/share/texlive/texmf-dist/tex/context/base/mkii/supp-pdf.mkii +[Loading MPS to PDF converter (version 2006.09.02).] +\scratchcounter=\count130 +\scratchdimen=\dimen157 +\scratchbox=\box42 +\nofMPsegments=\count131 +\nofMParguments=\count132 +\everyMPshowfont=\toks29 +\MPscratchCnt=\count133 +\MPscratchDim=\dimen158 +\MPnumerator=\count134 +\makeMPintoPDFobject=\count135 +\everyMPtoPDFconversion=\toks30 +) (/usr/share/texlive/texmf-dist/tex/latex/oberdiek/epstopdf-base.sty +Package: epstopdf-base 2016/05/15 v2.6 Base part for package epstopdf + +(/usr/share/texlive/texmf-dist/tex/latex/oberdiek/grfext.sty +Package: grfext 2016/05/16 v1.2 Manage graphics extensions (HO) +) +Package epstopdf-base Info: Redefining graphics rule for `.eps' on input line 4 +38. +Package grfext Info: Graphics extension search list: +(grfext) [.pdf,.png,.jpg,.mps,.jpeg,.jbig2,.jb2,.PDF,.PNG,.JPG,.JPE +G,.JBIG2,.JB2,.eps] +(grfext) \AppendGraphicsExtensions on input line 456. + +(/usr/share/texlive/texmf-dist/tex/latex/latexconfig/epstopdf-sys.cfg +File: epstopdf-sys.cfg 2010/07/13 v1.3 Configuration of (r)epstopdf for TeX Liv +e +)) +*geometry* driver: auto-detecting +*geometry* detected driver: pdftex +*geometry* verbose mode - [ preamble ] result: +* driver: pdftex +* paper: letterpaper +* layout: <same size as paper> +* layoutoffset:(h,v)=(0.0pt,0.0pt) +* modes: twoside +* h-part:(L,W,R)=(72.26999pt, 469.75502pt, 72.26999pt) +* v-part:(T,H,B)=(72.26999pt, 650.43001pt, 72.26999pt) +* \paperwidth=614.295pt +* \paperheight=794.96999pt +* \textwidth=469.75502pt +* \textheight=650.43001pt +* \oddsidemargin=0.0pt +* \evensidemargin=0.0pt +* \topmargin=-37.0pt +* \headheight=12.0pt +* \headsep=25.0pt +* \topskip=10.0pt +* \footskip=30.0pt +* \marginparwidth=36.135pt +* \marginparsep=11.0pt +* \columnsep=10.0pt +* \skip\footins=9.0pt plus 4.0pt minus 2.0pt +* \hoffset=0.0pt +* \voffset=0.0pt +* \mag=1000 +* \@twocolumnfalse +* \@twosidetrue +* \@mparswitchtrue +* \@reversemarginfalse +* (1in=72.27pt=25.4mm, 1cm=28.453pt) + +\AtBeginShipoutBox=\box43 +Package hyperref Info: Link coloring ON on input line 81. +(/usr/share/texlive/texmf-dist/tex/latex/hyperref/nameref.sty +Package: nameref 2016/05/21 v2.44 Cross-referencing by name of section + +(/usr/share/texlive/texmf-dist/tex/generic/oberdiek/gettitlestring.sty +Package: gettitlestring 2016/05/16 v1.5 Cleanup title references (HO) +) +\c@section@level=\count136 +) +LaTeX Info: Redefining \ref on input line 81. +LaTeX Info: Redefining \pageref on input line 81. +LaTeX Info: Redefining \nameref on input line 81. + +(./binary_c-python.out) (./binary_c-python.out) +\@outlinefile=\write5 +\openout5 = `binary_c-python.out'. + +Package hyperref Info: Option `pageanchor' set `false' on input line 84. +LaTeX Font Info: Try loading font information for T1+phv on input line 84. + +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/t1phv.fd +File: t1phv.fd 2001/06/04 scalable font definitions for T1/phv. +) +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <10> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 84. +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <24.88> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 84. +LaTeX Font Info: Font shape `T1/phv/bx/it' in size <10> not available +(Font) Font shape `T1/phv/b/it' tried instead on input line 84. +LaTeX Font Info: Font shape `T1/phv/b/it' in size <10> not available +(Font) Font shape `T1/phv/b/sl' tried instead on input line 84. +LaTeX Font Info: Font shape `T1/phv/bx/it' in size <17.28> not available +(Font) Font shape `T1/phv/b/it' tried instead on input line 84. +LaTeX Font Info: Font shape `T1/phv/b/it' in size <17.28> not available +(Font) Font shape `T1/phv/b/sl' tried instead on input line 84. +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <17.28> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 84. +<<ot1.cmap>><<oml.cmap>><<oms.cmap>><<omx.cmap>> +LaTeX Font Info: Try loading font information for U+msa on input line 84. + +(/usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsa.fd +File: umsa.fd 2013/01/14 v3.01 AMS symbols A +) +LaTeX Font Info: Try loading font information for U+msb on input line 84. + +(/usr/share/texlive/texmf-dist/tex/latex/amsfonts/umsb.fd +File: umsb.fd 2013/01/14 v3.01 AMS symbols B +) +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <12> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 84. + [1 + +{/var/lib/texmf/fonts/map/pdftex/updmap/pdftex.map}] [2 + + +] +LaTeX Font Info: Font shape `T1/phv/bx/n' in size <14.4> not available +(Font) Font shape `T1/phv/b/n' tried instead on input line 86. + (./binary_c-python.toc +LaTeX Font Info: Font shape `T1/ptm/bx/n' in size <10> not available +(Font) Font shape `T1/ptm/b/n' tried instead on input line 2. +) +\tf@toc=\write6 +\openout6 = `binary_c-python.toc'. + + [1 + +] [2 + +] +Chapter 1. +LaTeX Font Info: Try loading font information for TS1+ptm on input line 106. + +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1ptm.fd +File: ts1ptm.fd 2001/06/04 font definitions for TS1/ptm. +) +LaTeX Font Info: Try loading font information for T1+pcr on input line 123. + +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/t1pcr.fd +File: t1pcr.fd 2001/06/04 font definitions for T1/pcr. +) [1 + +] [2] +Chapter 2. +LaTeX Font Info: Font shape `T1/pcr/bx/n' in size <10> not available +(Font) Font shape `T1/pcr/b/n' tried instead on input line 175. +[3 + +] [4 + +] +Chapter 3. +LaTeX Font Info: Try loading font information for TS1+pcr on input line 227. + +(/usr/share/texlive/texmf-dist/tex/latex/psnfss/ts1pcr.fd +File: ts1pcr.fd 2001/06/04 font definitions for TS1/pcr. +) [5] [6] +Chapter 4. +[7 + +] [8 + +] [9 + + +] (./binary_c-python.ind [10 + + +] +Underfull \hbox (badness 10000) in paragraph at lines 8--10 +[]\T1/pcr/m/n/10 autogen_C_logging_code() \T1/ptm/m/n/10 (\T1/ptm/m/it/10 in mo +d-ule cus- + [] + + +Underfull \hbox (badness 10000) in paragraph at lines 13--15 +[]\T1/pcr/m/n/10 binary_c_log_code() \T1/ptm/m/n/10 (\T1/ptm/m/it/10 in mod-ule + cus- + [] + + +Underfull \hbox (badness 10000) in paragraph at lines 20--22 +[]\T1/pcr/m/n/10 compile_shared_lib() \T1/ptm/m/n/10 (\T1/ptm/m/it/10 in mod-ul +e cus- + [] + + +Underfull \hbox (badness 10000) in paragraph at lines 22--24 +[]\T1/pcr/m/n/10 create_and_load_logging_function() \T1/ptm/m/n/10 (\T1/ptm/m/i +t/10 in + [] + + +Underfull \hbox (badness 10000) in paragraph at lines 33--35 +[]\T1/pcr/m/n/10 from_binary_c_config() \T1/ptm/m/n/10 (\T1/ptm/m/it/10 in mod- +ule cus- + [] + + +Underfull \hbox (badness 10000) in paragraph at lines 50--51 +[]\T1/pcr/m/n/10 run_example_binary() \T1/ptm/m/n/10 (\T1/ptm/m/it/10 in mod-ul +e ex-am- + [] + + +Overfull \hbox (10.1225pt too wide) in paragraph at lines 51--53 +[]\T1/pcr/m/n/10 run_example_binary_with_custom_logging() + [] + + +Overfull \hbox (16.1225pt too wide) in paragraph at lines 55--57 +[]\T1/pcr/m/n/10 run_example_binary_with_writing_logfile() + [] + +[11 + +]) +Package atveryend Info: Empty hook `BeforeClearDocument' on input line 413. +Package atveryend Info: Empty hook `AfterLastShipout' on input line 413. + (./binary_c-python.aux) +Package atveryend Info: Executing hook `AtVeryEndDocument' on input line 413. +Package atveryend Info: Executing hook `AtEndAfterFileList' on input line 413. +Package rerunfilecheck Info: File `binary_c-python.out' has not changed. +(rerunfilecheck) Checksum: E1564592C69D66DDF198A9EA56A34D1B;1665. +Package atveryend Info: Empty hook `AtVeryVeryEnd' on input line 413. + ) +Here is how much of TeX's memory you used: + 13698 strings out of 492982 + 190593 string characters out of 6134895 + 286496 words of memory out of 5000000 + 16907 multiletter control sequences out of 15000+600000 + 45314 words of font info for 67 fonts, out of 8000000 for 9000 + 1142 hyphenation exceptions out of 8191 + 37i,12n,45p,484b,536s stack positions out of 5000i,500n,10000p,200000b,80000s +{/usr/share/texlive/texmf-dist/fonts/enc/dvips/base/8r.enc}</usr/share/texliv +e/texmf-dist/fonts/type1/public/amsfonts/cm/cmmi5.pfb></usr/share/texlive/texmf +-dist/fonts/type1/public/amsfonts/cm/cmsy5.pfb></usr/share/texlive/texmf-dist/f +onts/type1/urw/courier/ucrb8a.pfb></usr/share/texlive/texmf-dist/fonts/type1/ur +w/courier/ucrr8a.pfb></usr/share/texlive/texmf-dist/fonts/type1/urw/helvetic/uh +vb8a.pfb></usr/share/texlive/texmf-dist/fonts/type1/urw/helvetic/uhvr8a.pfb></u +sr/share/texlive/texmf-dist/fonts/type1/urw/times/utmb8a.pfb></usr/share/texliv +e/texmf-dist/fonts/type1/urw/times/utmr8a.pfb></usr/share/texlive/texmf-dist/fo +nts/type1/urw/times/utmri8a.pfb> +Output written on binary_c-python.pdf (15 pages, 119138 bytes). +PDF statistics: + 233 PDF objects out of 1000 (max. 8388607) + 200 compressed objects within 2 object streams + 47 named destinations out of 1000 (max. 500000) + 117 words of extra memory for PDF output out of 10000 (max. 10000000) + diff --git a/docs/build/latex/binary_c-python.out b/docs/build/latex/binary_c-python.out new file mode 100644 index 0000000000000000000000000000000000000000..3122f0715810a785b4cc2809ce2a4c09d4fe7ab8 --- /dev/null +++ b/docs/build/latex/binary_c-python.out @@ -0,0 +1,12 @@ +\BOOKMARK [0][-]{chapter.1}{\376\377\000P\000y\000t\000h\000o\000n\000\040\000m\000o\000d\000u\000l\000e\000\040\000f\000o\000r\000\040\000b\000i\000n\000a\000r\000y\000\137\000c}{}% 1 +\BOOKMARK [1][-]{section.1.1}{\376\377\000R\000e\000q\000u\000i\000r\000e\000m\000e\000n\000t\000s}{chapter.1}% 2 +\BOOKMARK [1][-]{section.1.2}{\376\377\000E\000n\000v\000i\000r\000o\000n\000m\000e\000n\000t\000\040\000v\000a\000r\000i\000a\000b\000l\000e\000s}{chapter.1}% 3 +\BOOKMARK [1][-]{section.1.3}{\376\377\000B\000u\000i\000l\000d\000\040\000i\000n\000s\000t\000r\000u\000c\000t\000i\000o\000n\000s}{chapter.1}% 4 +\BOOKMARK [1][-]{section.1.4}{\376\377\000U\000s\000a\000g\000e\000\040\000n\000o\000t\000e\000s}{chapter.1}% 5 +\BOOKMARK [0][-]{chapter.2}{\376\377\000e\000x\000a\000m\000p\000l\000e\000s}{}% 6 +\BOOKMARK [0][-]{chapter.3}{\376\377\000b\000i\000n\000a\000r\000y\000c\000\137\000p\000y\000t\000h\000o\000n\000\137\000u\000t\000i\000l\000s}{}% 7 +\BOOKMARK [1][-]{section.3.1}{\376\377\000c\000u\000s\000t\000o\000m\000\137\000l\000o\000g\000g\000i\000n\000g\000\137\000f\000u\000n\000c\000t\000i\000o\000n\000s\000\040\000m\000o\000d\000u\000l\000e}{chapter.3}% 8 +\BOOKMARK [1][-]{section.3.2}{\376\377\000f\000u\000n\000c\000t\000i\000o\000n\000s\000\040\000m\000o\000d\000u\000l\000e}{chapter.3}% 9 +\BOOKMARK [0][-]{chapter.4}{\376\377\000I\000n\000d\000i\000c\000e\000s\000\040\000a\000n\000d\000\040\000t\000a\000b\000l\000e\000s}{}% 10 +\BOOKMARK [0][-]{section*.22}{\376\377\000P\000y\000t\000h\000o\000n\000\040\000M\000o\000d\000u\000l\000e\000\040\000I\000n\000d\000e\000x}{}% 11 +\BOOKMARK [0][-]{section*.23}{\376\377\000I\000n\000d\000e\000x}{}% 12 diff --git a/docs/build/latex/binary_c-python.pdf b/docs/build/latex/binary_c-python.pdf new file mode 100644 index 0000000000000000000000000000000000000000..d3d03b9a2f80c6f171b413e78fb1c9e363c2279e Binary files /dev/null and b/docs/build/latex/binary_c-python.pdf differ diff --git a/docs/build/latex/binary_c-python.tex b/docs/build/latex/binary_c-python.tex new file mode 100644 index 0000000000000000000000000000000000000000..fb342a0667e43c8a8672bf1de4dde3f7b7838036 --- /dev/null +++ b/docs/build/latex/binary_c-python.tex @@ -0,0 +1,413 @@ +%% Generated by Sphinx. +\def\sphinxdocclass{report} +\documentclass[letterpaper,10pt,english]{sphinxmanual} +\ifdefined\pdfpxdimen + \let\sphinxpxdimen\pdfpxdimen\else\newdimen\sphinxpxdimen +\fi \sphinxpxdimen=.75bp\relax + +\PassOptionsToPackage{warn}{textcomp} +\usepackage[utf8]{inputenc} +\ifdefined\DeclareUnicodeCharacter +% support both utf8 and utf8x syntaxes + \ifdefined\DeclareUnicodeCharacterAsOptional + \def\sphinxDUC#1{\DeclareUnicodeCharacter{"#1}} + \else + \let\sphinxDUC\DeclareUnicodeCharacter + \fi + \sphinxDUC{00A0}{\nobreakspace} + \sphinxDUC{2500}{\sphinxunichar{2500}} + \sphinxDUC{2502}{\sphinxunichar{2502}} + \sphinxDUC{2514}{\sphinxunichar{2514}} + \sphinxDUC{251C}{\sphinxunichar{251C}} + \sphinxDUC{2572}{\textbackslash} +\fi +\usepackage{cmap} +\usepackage[T1]{fontenc} +\usepackage{amsmath,amssymb,amstext} +\usepackage{babel} + + + +\usepackage{times} +\expandafter\ifx\csname T@LGR\endcsname\relax +\else +% LGR was declared as font encoding + \substitutefont{LGR}{\rmdefault}{cmr} + \substitutefont{LGR}{\sfdefault}{cmss} + \substitutefont{LGR}{\ttdefault}{cmtt} +\fi +\expandafter\ifx\csname T@X2\endcsname\relax + \expandafter\ifx\csname T@T2A\endcsname\relax + \else + % T2A was declared as font encoding + \substitutefont{T2A}{\rmdefault}{cmr} + \substitutefont{T2A}{\sfdefault}{cmss} + \substitutefont{T2A}{\ttdefault}{cmtt} + \fi +\else +% X2 was declared as font encoding + \substitutefont{X2}{\rmdefault}{cmr} + \substitutefont{X2}{\sfdefault}{cmss} + \substitutefont{X2}{\ttdefault}{cmtt} +\fi + + +\usepackage[Bjarne]{fncychap} +\usepackage{sphinx} + +\fvset{fontsize=\small} +\usepackage{geometry} + +% Include hyperref last. +\usepackage{hyperref} +% Fix anchor placement for figures with captions. +\usepackage{hypcap}% it must be loaded after hyperref. +% Set up styles of URL: it should be placed after hyperref. +\urlstyle{same} +\addto\captionsenglish{\renewcommand{\contentsname}{Contents:}} + +\usepackage{sphinxmessages} +\setcounter{tocdepth}{3} +\setcounter{secnumdepth}{3} + + +\title{binary\_c-python} +\date{Nov 20, 2019} +\release{} +\author{Jeff Andrews, Robert Izzard, David Hendriks} +\newcommand{\sphinxlogo}{\vbox{}} +\renewcommand{\releasename}{} +\makeindex +\begin{document} + +\pagestyle{empty} +\sphinxmaketitle +\pagestyle{plain} +\sphinxtableofcontents +\pagestyle{normal} +\phantomsection\label{\detokenize{index::doc}} + + + +\chapter{Python module for binary\_c} +\label{\detokenize{readme_link:python-module-for-binary-c}}\label{\detokenize{readme_link::doc}} +Based on a original work by Jeff Andrews (can be found in old\_solution/ directory) +updated and extended for Python3 by Robert Izzard, David hendriks + +Warning : THIS CODE IS EXPERIMENTAL! + +\sphinxhref{mailto:r.izzard@surrey.ac.uk}{r.izzard@surrey.ac.uk} +\sphinxurl{http://personal.ph.surrey.ac.uk/~ri0005/binary\_c.html} +09/06/2019 + + +\section{Requirements} +\label{\detokenize{readme_link:requirements}}\begin{itemize} +\item {} +Python3 + +\item {} +binary\_c version 2.1+ + +\item {} +requirements.txt (no?) + +\end{itemize} + + +\section{Environment variables} +\label{\detokenize{readme_link:environment-variables}} +Before compilation you should set the following environment variables: +\begin{itemize} +\item {} +required: \sphinxcode{\sphinxupquote{BINARY\_C}} should point to the root directory of your binary\_c installation + +\item {} +recommended: \sphinxcode{\sphinxupquote{LD\_LIBRARY\_PATH}} should include \$BINARY\_C/src and whatever directories are required to run binary\_c (e.g. locations of libgsl, libmemoize, librinterpolate, etc.) + +\item {} +recommended: \sphinxcode{\sphinxupquote{LIBRARY\_PATH}} should include whatever directories are required to build binary\_c (e.g. locations of libgsl, libmemoize, librinterpolate, etc.) + +\end{itemize} + + +\section{Build instructions} +\label{\detokenize{readme_link:build-instructions}} +To build the module, make sure you have built binary\_c (with \sphinxcode{\sphinxupquote{make}} in the binary\_c root directory), its shared library (with \sphinxcode{\sphinxupquote{make libbinary\_c.so}} in the binary\_c root directory), and set environment variables as described above, then run the following code in t: + +\begin{sphinxVerbatim}[commandchars=\\\{\}] +\PYG{n}{make} \PYG{n}{clean} +\PYG{n}{make} +\end{sphinxVerbatim} + +Then to test the Python module: + +\begin{sphinxVerbatim}[commandchars=\\\{\}] +\PYG{n}{python3} \PYG{p}{.}\PYG{o}{/}\PYG{n}{python\PYGZus{}API\PYGZus{}test}\PYG{p}{.}\PYG{n}{py} +\end{sphinxVerbatim} + +You will require whatever libraries with which binary\_c was compiled, as well as the compiler with which Python was built (usually gcc, which is easily installed on most systems). + +If you want to be able to import the binary\_c module correctly for child directories (or anywhere for that matter), execute or put the following code in your .bashrc/.zshrc: + +\begin{sphinxVerbatim}[commandchars=\\\{\}] +export LD\PYGZus{}LIBRARY\PYGZus{}PATH=\PYGZlt{}full path to directory containing libbinary\PYGZus{}c\PYGZus{}api.so\PYGZgt{}:\PYGZdl{}LD\PYGZus{}LIBRARY\PYGZus{}PATH +export PYTHONPATH=\PYGZlt{}full path to directory containing libbinary\PYGZus{}c\PYGZus{}api.so\PYGZgt{}:\PYGZdl{}PYTHONPATH +\end{sphinxVerbatim} + + +\section{Usage notes} +\label{\detokenize{readme_link:usage-notes}} +When running a jupyter notebook and importing binary\_c, it might happen that the module binary\_c cannot be found. I experienced this when I executed Jupyter Notebook from a virtual environment which didnt use the same python (version/binary/shim) as the one I built this library with. Make sure jupyter does use the same underlying python version/binary/shim. That resolved the issue for me. + +Also: I figured that having binaryc output the log like “ t=10e4 …†(i.e. printing the parameter names as well as their values) would be useful because in that way one can easily have python read that out automatically instead of having to manually copy the list of parameter names. + +See examples/ dir for some working examples + + +\chapter{examples} +\label{\detokenize{examples:examples}}\label{\detokenize{examples::doc}} +This chapter serves to document several of the example usages + +\phantomsection\label{\detokenize{examples:module-examples.examples}}\index{examples.examples (module)@\spxentry{examples.examples}\spxextra{module}}\index{run\_example\_binary() (in module examples.examples)@\spxentry{run\_example\_binary()}\spxextra{in module examples.examples}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{examples:examples.examples.run_example_binary}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{examples.examples.}}\sphinxbfcode{\sphinxupquote{run\_example\_binary}}}{}{} +Function to run a binary system. Very basic approach which directly adresses the run\_binary(..) python-c wrapper function. + +\end{fulllineitems} + +\index{run\_example\_binary\_with\_custom\_logging() (in module examples.examples)@\spxentry{run\_example\_binary\_with\_custom\_logging()}\spxextra{in module examples.examples}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{examples:examples.examples.run_example_binary_with_custom_logging}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{examples.examples.}}\sphinxbfcode{\sphinxupquote{run\_example\_binary\_with\_custom\_logging}}}{}{} +Function that will use a automatically generated piece of logging code. Compile it, load it +into memory and run a binary system. See run\_system on how several things are done in the background here. + +\end{fulllineitems} + +\index{run\_example\_binary\_with\_run\_system() (in module examples.examples)@\spxentry{run\_example\_binary\_with\_run\_system()}\spxextra{in module examples.examples}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{examples:examples.examples.run_example_binary_with_run_system}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{examples.examples.}}\sphinxbfcode{\sphinxupquote{run\_example\_binary\_with\_run\_system}}}{}{} +This function serves as an example on the function run\_system and parse\_output. +There is more functionality with this method and several tasks are done behind the scene. + +Requires pandas, numpy to run. + +run\_system: mostly just makes passing arguments to the function easier. It also loads all the necessary defaults in the background +parse\_output: Takes the raw output of binary\_c and selects those lines that start with the given header. +Note, if you dont use the custom\_logging functionality binary\_c should be configured to have output that starts with that given header + +\end{fulllineitems} + +\index{run\_example\_binary\_with\_writing\_logfile() (in module examples.examples)@\spxentry{run\_example\_binary\_with\_writing\_logfile()}\spxextra{in module examples.examples}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{examples:examples.examples.run_example_binary_with_writing_logfile}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{examples.examples.}}\sphinxbfcode{\sphinxupquote{run\_example\_binary\_with\_writing\_logfile}}}{}{} +Same as above but when giving the log\_filename argument the log filename will be written + +\end{fulllineitems} + + + +\chapter{binaryc\_python\_utils} +\label{\detokenize{modules:binaryc-python-utils}}\label{\detokenize{modules::doc}} + +\section{custom\_logging\_functions module} +\label{\detokenize{custom_logging_functions:module-custom_logging_functions}}\label{\detokenize{custom_logging_functions:custom-logging-functions-module}}\label{\detokenize{custom_logging_functions::doc}}\index{custom\_logging\_functions (module)@\spxentry{custom\_logging\_functions}\spxextra{module}}\index{autogen\_C\_logging\_code() (in module custom\_logging\_functions)@\spxentry{autogen\_C\_logging\_code()}\spxextra{in module custom\_logging\_functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{custom_logging_functions:custom_logging_functions.autogen_C_logging_code}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{custom\_logging\_functions.}}\sphinxbfcode{\sphinxupquote{autogen\_C\_logging\_code}}}{\emph{logging\_dict}}{} +Function that autogenerates PRINTF statements for binaryc. intput is a dictionary where the key is the header of that logging line and items which are lists of parameters that will be put in that logging line + +Example: + +\begin{sphinxVerbatim}[commandchars=\\\{\}] +\PYG{p}{\PYGZob{}}\PYG{l+s+s1}{\PYGZsq{}}\PYG{l+s+s1}{MY\PYGZus{}STELLAR\PYGZus{}DATA}\PYG{l+s+s1}{\PYGZsq{}}\PYG{p}{:} + \PYG{p}{[} + \PYG{l+s+s1}{\PYGZsq{}}\PYG{l+s+s1}{model.time}\PYG{l+s+s1}{\PYGZsq{}}\PYG{p}{,} + \PYG{l+s+s1}{\PYGZsq{}}\PYG{l+s+s1}{star[0].mass}\PYG{l+s+s1}{\PYGZsq{}}\PYG{p}{,} + \PYG{l+s+s1}{\PYGZsq{}}\PYG{l+s+s1}{model.probability}\PYG{l+s+s1}{\PYGZsq{}}\PYG{p}{,} + \PYG{l+s+s1}{\PYGZsq{}}\PYG{l+s+s1}{model.dt}\PYG{l+s+s1}{\PYGZsq{}} + \PYG{p}{]} +\PYG{p}{\PYGZcb{}} +\end{sphinxVerbatim} + +\end{fulllineitems} + +\index{binary\_c\_log\_code() (in module custom\_logging\_functions)@\spxentry{binary\_c\_log\_code()}\spxextra{in module custom\_logging\_functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{custom_logging_functions:custom_logging_functions.binary_c_log_code}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{custom\_logging\_functions.}}\sphinxbfcode{\sphinxupquote{binary\_c\_log\_code}}}{\emph{code}}{} +Function to construct the code to construct the custom logging function + +\end{fulllineitems} + +\index{binary\_c\_write\_log\_code() (in module custom\_logging\_functions)@\spxentry{binary\_c\_write\_log\_code()}\spxextra{in module custom\_logging\_functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{custom_logging_functions:custom_logging_functions.binary_c_write_log_code}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{custom\_logging\_functions.}}\sphinxbfcode{\sphinxupquote{binary\_c\_write\_log\_code}}}{\emph{code}, \emph{filename}}{} +Function to write the generated logging code to a file + +\end{fulllineitems} + +\index{compile\_shared\_lib() (in module custom\_logging\_functions)@\spxentry{compile\_shared\_lib()}\spxextra{in module custom\_logging\_functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{custom_logging_functions:custom_logging_functions.compile_shared_lib}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{custom\_logging\_functions.}}\sphinxbfcode{\sphinxupquote{compile\_shared\_lib}}}{\emph{code}, \emph{sourcefile\_name}, \emph{outfile\_name}}{} +Function to write the custom logging code to a file and then compile it. + +\end{fulllineitems} + +\index{create\_and\_load\_logging\_function() (in module custom\_logging\_functions)@\spxentry{create\_and\_load\_logging\_function()}\spxextra{in module custom\_logging\_functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{custom_logging_functions:custom_logging_functions.create_and_load_logging_function}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{custom\_logging\_functions.}}\sphinxbfcode{\sphinxupquote{create\_and\_load\_logging\_function}}}{\emph{custom\_logging\_code}}{} +Function to automatically compile the shared library with the given custom logging code and load it with ctypes +\begin{description} +\item[{returns:}] \leavevmode +memory adress of the custom logging function in a int type. + +\end{description} + +\end{fulllineitems} + +\index{from\_binary\_c\_config() (in module custom\_logging\_functions)@\spxentry{from\_binary\_c\_config()}\spxextra{in module custom\_logging\_functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{custom_logging_functions:custom_logging_functions.from_binary_c_config}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{custom\_logging\_functions.}}\sphinxbfcode{\sphinxupquote{from\_binary\_c\_config}}}{\emph{config\_file}, \emph{flag}}{} +Function to run the binaryc\_config command with flags + +\end{fulllineitems} + +\index{return\_compilation\_dict() (in module custom\_logging\_functions)@\spxentry{return\_compilation\_dict()}\spxextra{in module custom\_logging\_functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{custom_logging_functions:custom_logging_functions.return_compilation_dict}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{custom\_logging\_functions.}}\sphinxbfcode{\sphinxupquote{return\_compilation\_dict}}}{}{} +Function to build the compile command for the shared library + +inspired by binary\_c\_inline\_config command in perl + +TODO: this function still has some cleaning up to do wrt default values for the compile command +\# \sphinxurl{https://developers.redhat.com/blog/2018/03/21/compiler-and-linker-flags-gcc/} +\begin{description} +\item[{returns:}] \leavevmode\begin{itemize} +\item {} +string containing the command to build the shared library + +\end{itemize} + +\end{description} + +\end{fulllineitems} + +\index{temp\_custom\_logging\_dir() (in module custom\_logging\_functions)@\spxentry{temp\_custom\_logging\_dir()}\spxextra{in module custom\_logging\_functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{custom_logging_functions:custom_logging_functions.temp_custom_logging_dir}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{custom\_logging\_functions.}}\sphinxbfcode{\sphinxupquote{temp\_custom\_logging\_dir}}}{}{} +Function to return the path the custom logging library shared object and script will be written to. + +Makes use of os.makedirs exist\_ok which requires python 3.2+ + +\end{fulllineitems} + + + +\section{functions module} +\label{\detokenize{functions:module-functions}}\label{\detokenize{functions:functions-module}}\label{\detokenize{functions::doc}}\index{functions (module)@\spxentry{functions}\spxextra{module}}\index{create\_arg\_string() (in module functions)@\spxentry{create\_arg\_string()}\spxextra{in module functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{functions:functions.create_arg_string}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{functions.}}\sphinxbfcode{\sphinxupquote{create\_arg\_string}}}{\emph{arg\_dict}}{} +Function that creates the arg string + +\end{fulllineitems} + +\index{get\_arg\_keys() (in module functions)@\spxentry{get\_arg\_keys()}\spxextra{in module functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{functions:functions.get_arg_keys}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{functions.}}\sphinxbfcode{\sphinxupquote{get\_arg\_keys}}}{}{} +Function that return the list of possible keys to give in the arg string + +\end{fulllineitems} + +\index{get\_defaults() (in module functions)@\spxentry{get\_defaults()}\spxextra{in module functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{functions:functions.get_defaults}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{functions.}}\sphinxbfcode{\sphinxupquote{get\_defaults}}}{}{} +Function that calls the binaryc get args function and cast it into a dictionary +All the values are strings + +\end{fulllineitems} + +\index{parse\_output() (in module functions)@\spxentry{parse\_output()}\spxextra{in module functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{functions:functions.parse_output}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{functions.}}\sphinxbfcode{\sphinxupquote{parse\_output}}}{\emph{output}, \emph{selected\_header}}{} +Function that parses output of binaryc when it is construction like this: +DAVID\_SINGLE\_ANALYSIS t=0 mass=20 + +You can give a ‘selected\_header’ to catch any line that starts with that. +Then the values will be put into a dictionary. +TODO: Think about exporting to numpy array or pandas + +\end{fulllineitems} + +\index{run\_system() (in module functions)@\spxentry{run\_system()}\spxextra{in module functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{functions:functions.run_system}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{functions.}}\sphinxbfcode{\sphinxupquote{run\_system}}}{\emph{**kwargs}}{} +Wrapper to run a system with settings + +This function determines which underlying python-c api function will be called based upon the arguments that are passed via kwargs. +\begin{itemize} +\item {} +if custom\_logging\_code or custom\_logging\_dict is included in the kwargs then it will + +\item {} +if + +\end{itemize} + +\end{fulllineitems} + +\index{run\_system\_with\_log() (in module functions)@\spxentry{run\_system\_with\_log()}\spxextra{in module functions}} + +\begin{fulllineitems} +\phantomsection\label{\detokenize{functions:functions.run_system_with_log}}\pysiglinewithargsret{\sphinxcode{\sphinxupquote{functions.}}\sphinxbfcode{\sphinxupquote{run\_system\_with\_log}}}{\emph{**kwargs}}{} +Wrapper to run a system with settings AND logs the files to a designated place defined by the log\_filename parameter. + +\end{fulllineitems} + + + +\chapter{Indices and tables} +\label{\detokenize{index:indices-and-tables}}\begin{itemize} +\item {} +\DUrole{xref,std,std-ref}{genindex} + +\item {} +\DUrole{xref,std,std-ref}{modindex} + +\item {} +\DUrole{xref,std,std-ref}{search} + +\end{itemize} + + +\renewcommand{\indexname}{Python Module Index} +\begin{sphinxtheindex} +\let\bigletter\sphinxstyleindexlettergroup +\bigletter{c} +\item\relax\sphinxstyleindexentry{custom\_logging\_functions}\sphinxstyleindexpageref{custom_logging_functions:\detokenize{module-custom_logging_functions}} +\indexspace +\bigletter{e} +\item\relax\sphinxstyleindexentry{examples.examples}\sphinxstyleindexpageref{examples:\detokenize{module-examples.examples}} +\indexspace +\bigletter{f} +\item\relax\sphinxstyleindexentry{functions}\sphinxstyleindexpageref{functions:\detokenize{module-functions}} +\end{sphinxtheindex} + +\renewcommand{\indexname}{Index} +\printindex +\end{document} \ No newline at end of file diff --git a/docs/build/latex/binary_c-python.toc b/docs/build/latex/binary_c-python.toc new file mode 100644 index 0000000000000000000000000000000000000000..87813efeca54c76d2a798869f44fc267dacf593d --- /dev/null +++ b/docs/build/latex/binary_c-python.toc @@ -0,0 +1,13 @@ +\babel@toc {english}{} +\contentsline {chapter}{\numberline {1}Python module for binary\_c}{1}{chapter.1} +\contentsline {section}{\numberline {1.1}Requirements}{1}{section.1.1} +\contentsline {section}{\numberline {1.2}Environment variables}{1}{section.1.2} +\contentsline {section}{\numberline {1.3}Build instructions}{1}{section.1.3} +\contentsline {section}{\numberline {1.4}Usage notes}{2}{section.1.4} +\contentsline {chapter}{\numberline {2}examples}{3}{chapter.2} +\contentsline {chapter}{\numberline {3}binaryc\_python\_utils}{5}{chapter.3} +\contentsline {section}{\numberline {3.1}custom\_logging\_functions module}{5}{section.3.1} +\contentsline {section}{\numberline {3.2}functions module}{6}{section.3.2} +\contentsline {chapter}{\numberline {4}Indices and tables}{7}{chapter.4} +\contentsline {chapter}{Python Module Index}{9}{section*.22} +\contentsline {chapter}{Index}{11}{section*.23} diff --git a/docs/build/latex/footnotehyper-sphinx.sty b/docs/build/latex/footnotehyper-sphinx.sty new file mode 100644 index 0000000000000000000000000000000000000000..b6692cfb859b90c91dff079bb08fc12bbde2ccd1 --- /dev/null +++ b/docs/build/latex/footnotehyper-sphinx.sty @@ -0,0 +1,269 @@ +\NeedsTeXFormat{LaTeX2e} +\ProvidesPackage{footnotehyper-sphinx}% + [2017/10/27 v1.7 hyperref aware footnote.sty for sphinx (JFB)] +%% +%% Package: footnotehyper-sphinx +%% Version: based on footnotehyper.sty 2017/03/07 v1.0 +%% as available at https://www.ctan.org/pkg/footnotehyper +%% License: the one applying to Sphinx +%% +%% Refer to the PDF documentation at https://www.ctan.org/pkg/footnotehyper for +%% the code comments. +%% +%% Differences: +%% 1. a partial tabulary compatibility layer added (enough for Sphinx mark-up), +%% 2. use of \spx@opt@BeforeFootnote from sphinx.sty, +%% 3. use of \sphinxunactivateextrasandspace from sphinx.sty, +%% 4. macro definition \sphinxfootnotemark, +%% 5. macro definition \sphinxlongtablepatch +%% 6. replaced an \undefined by \@undefined +\DeclareOption*{\PackageWarning{footnotehyper-sphinx}{Option `\CurrentOption' is unknown}}% +\ProcessOptions\relax +\newbox\FNH@notes +\newdimen\FNH@width +\let\FNH@colwidth\columnwidth +\newif\ifFNH@savingnotes +\AtBeginDocument {% + \let\FNH@latex@footnote \footnote + \let\FNH@latex@footnotetext\footnotetext + \let\FNH@H@@footnotetext \@footnotetext + \newenvironment{savenotes} + {\FNH@savenotes\ignorespaces}{\FNH@spewnotes\ignorespacesafterend}% + \let\spewnotes \FNH@spewnotes + \let\footnote \FNH@footnote + \let\footnotetext \FNH@footnotetext + \let\endfootnote \FNH@endfntext + \let\endfootnotetext\FNH@endfntext + \@ifpackageloaded{hyperref} + {\ifHy@hyperfootnotes + \let\FNH@H@@footnotetext\H@@footnotetext + \else + \let\FNH@hyper@fntext\FNH@nohyp@fntext + \fi}% + {\let\FNH@hyper@fntext\FNH@nohyp@fntext}% +}% +\def\FNH@hyper@fntext{\FNH@fntext\FNH@hyper@fntext@i}% +\def\FNH@nohyp@fntext{\FNH@fntext\FNH@nohyp@fntext@i}% +\def\FNH@fntext #1{% + \ifx\ifmeasuring@\@undefined + \expandafter\@secondoftwo\else\expandafter\@firstofone\fi +% these two lines modified for Sphinx (tabulary compatibility): + {\ifmeasuring@\expandafter\@gobbletwo\else\expandafter\@firstofone\fi}% + {\ifx\equation$\expandafter\@gobbletwo\fi #1}%$ +}% +\long\def\FNH@hyper@fntext@i#1{% + \global\setbox\FNH@notes\vbox + {\unvbox\FNH@notes + \FNH@startnote + \@makefntext + {\rule\z@\footnotesep\ignorespaces + \ifHy@nesting\expandafter\ltx@firstoftwo + \else\expandafter\ltx@secondoftwo + \fi + {\expandafter\hyper@@anchor\expandafter{\Hy@footnote@currentHref}{#1}}% + {\Hy@raisedlink + {\expandafter\hyper@@anchor\expandafter{\Hy@footnote@currentHref}% + {\relax}}% + \let\@currentHref\Hy@footnote@currentHref + \let\@currentlabelname\@empty + #1}% + \@finalstrut\strutbox + }% + \FNH@endnote + }% +}% +\long\def\FNH@nohyp@fntext@i#1{% + \global\setbox\FNH@notes\vbox + {\unvbox\FNH@notes + \FNH@startnote + \@makefntext{\rule\z@\footnotesep\ignorespaces#1\@finalstrut\strutbox}% + \FNH@endnote + }% +}% +\def\FNH@startnote{% + \hsize\FNH@colwidth + \interlinepenalty\interfootnotelinepenalty + \reset@font\footnotesize + \floatingpenalty\@MM + \@parboxrestore + \protected@edef\@currentlabel{\csname p@\@mpfn\endcsname\@thefnmark}% + \color@begingroup +}% +\def\FNH@endnote{\color@endgroup}% +\def\FNH@savenotes{% + \begingroup + \ifFNH@savingnotes\else + \FNH@savingnotestrue + \let\@footnotetext \FNH@hyper@fntext + \let\@mpfootnotetext \FNH@hyper@fntext + \let\H@@mpfootnotetext\FNH@nohyp@fntext + \FNH@width\columnwidth + \let\FNH@colwidth\FNH@width + \global\setbox\FNH@notes\box\voidb@x + \let\FNH@thempfn\thempfn + \let\FNH@mpfn\@mpfn + \ifx\@minipagerestore\relax\let\@minipagerestore\@empty\fi + \expandafter\def\expandafter\@minipagerestore\expandafter{% + \@minipagerestore + \let\thempfn\FNH@thempfn + \let\@mpfn\FNH@mpfn + }% + \fi +}% +\def\FNH@spewnotes {% + \endgroup + \ifFNH@savingnotes\else + \ifvoid\FNH@notes\else + \begingroup + \let\@makefntext\@empty + \let\@finalstrut\@gobble + \let\rule\@gobbletwo + \FNH@H@@footnotetext{\unvbox\FNH@notes}% + \endgroup + \fi + \fi +}% +\def\FNH@footnote@envname {footnote}% +\def\FNH@footnotetext@envname{footnotetext}% +\def\FNH@footnote{% +% this line added for Sphinx: + \spx@opt@BeforeFootnote + \ifx\@currenvir\FNH@footnote@envname + \expandafter\FNH@footnoteenv + \else + \expandafter\FNH@latex@footnote + \fi +}% +\def\FNH@footnoteenv{% +% this line added for Sphinx (footnotes in parsed literal blocks): + \catcode13=5 \sphinxunactivateextrasandspace + \@ifnextchar[% + \FNH@footnoteenv@i %] + {\stepcounter\@mpfn + \protected@xdef\@thefnmark{\thempfn}% + \@footnotemark + \def\FNH@endfntext@fntext{\@footnotetext}% + \FNH@startfntext}% +}% +\def\FNH@footnoteenv@i[#1]{% + \begingroup + \csname c@\@mpfn\endcsname #1\relax + \unrestored@protected@xdef\@thefnmark{\thempfn}% + \endgroup + \@footnotemark + \def\FNH@endfntext@fntext{\@footnotetext}% + \FNH@startfntext +}% +\def\FNH@footnotetext{% + \ifx\@currenvir\FNH@footnotetext@envname + \expandafter\FNH@footnotetextenv + \else + \expandafter\FNH@latex@footnotetext + \fi +}% +\def\FNH@footnotetextenv{% + \@ifnextchar[% + \FNH@footnotetextenv@i %] + {\protected@xdef\@thefnmark{\thempfn}% + \def\FNH@endfntext@fntext{\@footnotetext}% + \FNH@startfntext}% +}% +\def\FNH@footnotetextenv@i[#1]{% + \begingroup + \csname c@\@mpfn\endcsname #1\relax + \unrestored@protected@xdef\@thefnmark{\thempfn}% + \endgroup + \ifFNH@savingnotes + \def\FNH@endfntext@fntext{\FNH@nohyp@fntext}% + \else + \def\FNH@endfntext@fntext{\FNH@H@@footnotetext}% + \fi + \FNH@startfntext +}% +\def\FNH@startfntext{% + \setbox\z@\vbox\bgroup + \FNH@startnote + \FNH@prefntext + \rule\z@\footnotesep\ignorespaces +}% +\def\FNH@endfntext {% + \@finalstrut\strutbox + \FNH@postfntext + \FNH@endnote + \egroup + \begingroup + \let\@makefntext\@empty\let\@finalstrut\@gobble\let\rule\@gobbletwo + \FNH@endfntext@fntext {\unvbox\z@}% + \endgroup +}% +\AtBeginDocument{% + \let\FNH@@makefntext\@makefntext + \ifx\@makefntextFB\@undefined + \expandafter\@gobble\else\expandafter\@firstofone\fi + {\ifFBFrenchFootnotes \let\FNH@@makefntext\@makefntextFB \else + \let\FNH@@makefntext\@makefntextORI\fi}% + \expandafter\FNH@check@a\FNH@@makefntext{1.2!3?4,}% + \FNH@@@1.2!3?4,\FNH@@@\relax +}% +\long\def\FNH@check@a #11.2!3?4,#2\FNH@@@#3{% + \ifx\relax#3\expandafter\@firstoftwo\else\expandafter\@secondoftwo\fi + \FNH@bad@makefntext@alert + {\def\FNH@prefntext{#1}\def\FNH@postfntext{#2}\FNH@check@b}% +}% +\def\FNH@check@b #1\relax{% + \expandafter\expandafter\expandafter\FNH@check@c + \expandafter\meaning\expandafter\FNH@prefntext + \meaning\FNH@postfntext1.2!3?4,\FNH@check@c\relax +}% +\def\FNH@check@c #11.2!3?4,#2#3\relax{% + \ifx\FNH@check@c#2\expandafter\@gobble\fi\FNH@bad@makefntext@alert +}% +% slight reformulation for Sphinx +\def\FNH@bad@makefntext@alert{% + \PackageWarningNoLine{footnotehyper-sphinx}% + {Footnotes will be sub-optimal, sorry. This is due to the document class or^^J + some package modifying macro \string\@makefntext.^^J + You can try to report this incompatibility at^^J + https://github.com/sphinx-doc/sphinx with this info:}% + \typeout{\meaning\@makefntext}% + \let\FNH@prefntext\@empty\let\FNH@postfntext\@empty +}% +% this macro from original footnote.sty is not used anymore by Sphinx +% but for simplicity sake let's just keep it as is +\def\makesavenoteenv{\@ifnextchar[\FNH@msne@ii\FNH@msne@i}%] +\def\FNH@msne@i #1{% + \expandafter\let\csname FNH$#1\expandafter\endcsname %$ + \csname #1\endcsname + \expandafter\let\csname endFNH$#1\expandafter\endcsname %$ + \csname end#1\endcsname + \FNH@msne@ii[#1]{FNH$#1}%$ +}% +\def\FNH@msne@ii[#1]#2{% + \expandafter\edef\csname#1\endcsname{% + \noexpand\savenotes + \expandafter\noexpand\csname#2\endcsname + }% + \expandafter\edef\csname end#1\endcsname{% + \expandafter\noexpand\csname end#2\endcsname + \noexpand\expandafter + \noexpand\spewnotes + \noexpand\if@endpe\noexpand\@endpetrue\noexpand\fi + }% +}% +% end of footnotehyper 2017/02/16 v0.99 +% some extras for Sphinx : +% \sphinxfootnotemark: usable in section titles and silently removed from TOCs. +\def\sphinxfootnotemark [#1]% + {\ifx\thepage\relax\else\protect\spx@opt@BeforeFootnote + \protect\footnotemark[#1]\fi}% +\AtBeginDocument{% + % let hyperref less complain + \pdfstringdefDisableCommands{\def\sphinxfootnotemark [#1]{}}% + % to obtain hyperlinked footnotes in longtable environment we must replace + % hyperref's patch of longtable's patch of \@footnotetext by our own + \let\LT@p@ftntext\FNH@hyper@fntext + % this *requires* longtable to be used always wrapped in savenotes environment +}% +\endinput +%% +%% End of file `footnotehyper-sphinx.sty'. diff --git a/docs/build/latex/latexmkjarc b/docs/build/latex/latexmkjarc new file mode 100644 index 0000000000000000000000000000000000000000..5b315d6c9cf569ec35a25593c9b47e12f212a59f --- /dev/null +++ b/docs/build/latex/latexmkjarc @@ -0,0 +1,22 @@ +$latex = 'platex ' . $ENV{'LATEXOPTS'} . ' -kanji=utf8 %O %S'; +$dvipdf = 'dvipdfmx %O -o %D %S'; +$makeindex = 'internal mendex %S %B %D'; +sub mendex { + my ($source, $basename, $destination) = @_; + my $dictfile = $basename . ".dic"; + unlink($destination); + system("mendex", "-U", "-f", "-d", $dictfile, "-s", "python.ist", $source); + if ($? > 0) { + print("mendex exited with error code $? (ignored)\n"); + } + if (!-e $destination) { + # create an empty .ind file if nothing + open(FH, ">" . $destination); + close(FH); + } + return 0; +} +add_cus_dep( "glo", "gls", 0, "makeglo" ); +sub makeglo { + return system( "mendex -J -f -s gglo.ist -o '$_[0].gls' '$_[0].glo'" ); +} diff --git a/docs/build/latex/latexmkrc b/docs/build/latex/latexmkrc new file mode 100644 index 0000000000000000000000000000000000000000..bba17fa6bc6aa2e1a0f08088b7bd685077463e8e --- /dev/null +++ b/docs/build/latex/latexmkrc @@ -0,0 +1,9 @@ +$latex = 'latex ' . $ENV{'LATEXOPTS'} . ' %O %S'; +$pdflatex = 'pdflatex ' . $ENV{'LATEXOPTS'} . ' %O %S'; +$lualatex = 'lualatex ' . $ENV{'LATEXOPTS'} . ' %O %S'; +$xelatex = 'xelatex --no-pdf ' . $ENV{'LATEXOPTS'} . ' %O %S'; +$makeindex = 'makeindex -s python.ist %O -o %D %S'; +add_cus_dep( "glo", "gls", 0, "makeglo" ); +sub makeglo { + return system( "makeindex -s gglo.ist -o '$_[0].gls' '$_[0].glo'" ); +} \ No newline at end of file diff --git a/docs/build/latex/make.bat b/docs/build/latex/make.bat new file mode 100644 index 0000000000000000000000000000000000000000..94bda2139156340fc42bb1cb678e49ac9ac8d3c6 --- /dev/null +++ b/docs/build/latex/make.bat @@ -0,0 +1,31 @@ +@ECHO OFF + +REM Command file for Sphinx documentation + +pushd %~dp0 + +set PDFLATEX=latexmk -pdf -dvi- -ps- + +set "LATEXOPTS= " + +if "%1" == "" goto all-pdf + +if "%1" == "all-pdf" ( + :all-pdf + for %%i in (*.tex) do ( + %PDFLATEX% %LATEXMKOPTS% %%i + ) + goto end +) + +if "%1" == "all-pdf-ja" ( + goto all-pdf +) + +if "%1" == "clean" ( + del /q /s *.dvi *.log *.ind *.aux *.toc *.syn *.idx *.out *.ilg *.pla *.ps *.tar *.tar.gz *.tar.bz2 *.tar.xz *.fls *.fdb_latexmk + goto end +) + +:end +popd \ No newline at end of file diff --git a/docs/build/latex/python.ist b/docs/build/latex/python.ist new file mode 100644 index 0000000000000000000000000000000000000000..70536a6683577925167e84e0b0f6a06228754d0a --- /dev/null +++ b/docs/build/latex/python.ist @@ -0,0 +1,16 @@ +line_max 100 +headings_flag 1 +heading_prefix " \\bigletter " + +preamble "\\begin{sphinxtheindex} +\\let\\bigletter\\sphinxstyleindexlettergroup +\\let\\spxpagem \\sphinxstyleindexpagemain +\\let\\spxentry \\sphinxstyleindexentry +\\let\\spxextra \\sphinxstyleindexextra + +" + +postamble "\n\n\\end{sphinxtheindex}\n" + +symhead_positive "{\\sphinxsymbolsname}" +numhead_positive "{\\sphinxnumbersname}" diff --git a/docs/build/latex/sphinx.sty b/docs/build/latex/sphinx.sty new file mode 100644 index 0000000000000000000000000000000000000000..c18e87a9b7d4f3bb3d4fdf5fd5dcf37da28ac54d --- /dev/null +++ b/docs/build/latex/sphinx.sty @@ -0,0 +1,1859 @@ +% +% sphinx.sty +% +% Adapted from the old python.sty, mostly written by Fred Drake, +% by Georg Brandl. +% + +\NeedsTeXFormat{LaTeX2e}[1995/12/01] +\ProvidesPackage{sphinx}[2019/09/02 v2.2.1 LaTeX package (Sphinx markup)] + +% provides \ltx@ifundefined +% (many packages load ltxcmds: graphicx does for pdftex and lualatex but +% not xelatex, and anyhow kvoptions does, but it may be needed in future to +% use \sphinxdeprecationwarning earlier, and it needs \ltx@ifundefined) +\RequirePackage{ltxcmds} + +%% for deprecation warnings +\newcommand\sphinxdeprecationwarning[4]{% #1 the deprecated macro or name, +% #2 = when deprecated, #3 = when removed, #4 = additional info + \edef\spx@tempa{\detokenize{#1}}% + \ltx@ifundefined{sphinx_depr_\spx@tempa}{% + \global\expandafter\let\csname sphinx_depr_\spx@tempa\endcsname\spx@tempa + \expandafter\AtEndDocument\expandafter{\expandafter\let\expandafter + \sphinxdeprecatedmacro\csname sphinx_depr_\spx@tempa\endcsname + \PackageWarningNoLine{sphinx}{^^J**** SPHINX DEPRECATION WARNING:^^J + \sphinxdeprecatedmacro^^J + \@spaces- is deprecated at Sphinx #2^^J + \@spaces- and removed at Sphinx #3.^^J + #4^^J****}}% + }{% warning already emitted (at end of latex log), don't repeat + }} + + +%% PACKAGES +% +% we delay handling of options to after having loaded packages, because +% of the need to use \definecolor. +\RequirePackage{graphicx} +\@ifclassloaded{memoir}{}{\RequirePackage{fancyhdr}} +% for \text macro and \iffirstchoice@ conditional even if amsmath not loaded +\RequirePackage{amstext} +\RequirePackage{textcomp}% "warn" option issued from template +\RequirePackage{titlesec} +\@ifpackagelater{titlesec}{2016/03/15}% + {\@ifpackagelater{titlesec}{2016/03/21}% + {}% + {\newif\ifsphinx@ttlpatch@ok + \IfFileExists{etoolbox.sty}{% + \RequirePackage{etoolbox}% + \patchcmd{\ttlh@hang}{\parindent\z@}{\parindent\z@\leavevmode}% + {\sphinx@ttlpatch@oktrue}{}% + \ifsphinx@ttlpatch@ok + \patchcmd{\ttlh@hang}{\noindent}{}{}{\sphinx@ttlpatch@okfalse}% + \fi + }{}% + \ifsphinx@ttlpatch@ok + \typeout{^^J Package Sphinx Info: ^^J + **** titlesec 2.10.1 successfully patched for bugfix ****^^J}% + \else + \AtEndDocument{\PackageWarningNoLine{sphinx}{^^J% +******** titlesec 2.10.1 has a bug, (section numbers disappear) ......|^^J% +******** and Sphinx could not patch it, perhaps because your local ...|^^J% +******** copy is already fixed without a changed release date. .......|^^J% +******** If not, you must update titlesec! ...........................|}}% + \fi + }% + }{} +\RequirePackage{tabulary} +% tabulary has a bug with its re-definition of \multicolumn in its first pass +% which is not \long. But now Sphinx does not use LaTeX's \multicolumn but its +% own macro. Hence we don't even need to patch tabulary. See sphinxmulticell.sty +% X or S (Sphinx) may have meanings if some table package is loaded hence +% \X was chosen to avoid possibility of conflict +\newcolumntype{\X}[2]{p{\dimexpr + (\linewidth-\arrayrulewidth)*#1/#2-\tw@\tabcolsep-\arrayrulewidth\relax}} +\newcolumntype{\Y}[1]{p{\dimexpr + #1\dimexpr\linewidth-\arrayrulewidth\relax-\tw@\tabcolsep-\arrayrulewidth\relax}} +% using here T (for Tabulary) feels less of a problem than the X could be +\newcolumntype{T}{J}% +% For tables allowing pagebreaks +\RequirePackage{longtable} +% User interface to set-up whitespace before and after tables: +\newcommand*\sphinxtablepre {0pt}% +\newcommand*\sphinxtablepost{\medskipamount}% +% Space from caption baseline to top of table or frame of literal-block +\newcommand*\sphinxbelowcaptionspace{.5\sphinxbaselineskip}% +% as one can not use \baselineskip from inside longtable (it is zero there) +% we need \sphinxbaselineskip, which defaults to \baselineskip +\def\sphinxbaselineskip{\baselineskip}% +% The following is to ensure that, whether tabular(y) or longtable: +% - if a caption is on top of table: +% a) the space between its last baseline and the top rule of table is +% exactly \sphinxbelowcaptionspace +% b) the space from last baseline of previous text to first baseline of +% caption is exactly \parskip+\baselineskip+ height of a strut. +% c) the caption text will wrap at width \LTcapwidth (4in) +% - make sure this works also if "caption" package is loaded by user +% (with its width or margin option taking place of \LTcapwidth role) +% TODO: obtain same for caption of literal block: a) & c) DONE, b) TO BE DONE +% +% To modify space below such top caption, adjust \sphinxbelowcaptionspace +% To add or remove space above such top caption, adjust \sphinxtablepre: +% notice that \abovecaptionskip, \belowcaptionskip, \LTpre are **ignored** +% A. Table with longtable +\def\sphinxatlongtablestart + {\par + \vskip\parskip + \vskip\dimexpr\sphinxtablepre\relax % adjust vertical position + \vbox{}% get correct baseline from above + \LTpre\z@skip\LTpost\z@skip % set to zero longtable's own skips + \edef\sphinxbaselineskip{\dimexpr\the\dimexpr\baselineskip\relax\relax}% + }% +% Compatibility with caption package +\def\sphinxthelongtablecaptionisattop{% + \spx@ifcaptionpackage{\noalign{\vskip-\belowcaptionskip}}{}% +}% +% Achieves exactly \sphinxbelowcaptionspace below longtable caption +\def\sphinxlongtablecapskipadjust + {\dimexpr-\dp\strutbox + -\spx@ifcaptionpackage{\abovecaptionskip}{\sphinxbaselineskip}% + +\sphinxbelowcaptionspace\relax}% +\def\sphinxatlongtableend{\prevdepth\z@\vskip\sphinxtablepost\relax}% +% B. Table with tabular or tabulary +\def\sphinxattablestart{\par\vskip\dimexpr\sphinxtablepre\relax}% +\let\sphinxattableend\sphinxatlongtableend +% This is used by tabular and tabulary templates +\newcommand*\sphinxcapstartof[1]{% + \vskip\parskip + \vbox{}% force baselineskip for good positioning by capstart of hyperanchor + % hyperref puts the anchor 6pt above this baseline; in case of caption + % this baseline will be \ht\strutbox above first baseline of caption + \def\@captype{#1}% + \capstart +% move back vertically, as tabular (or its caption) will compensate + \vskip-\baselineskip\vskip-\parskip +}% +\def\sphinxthecaptionisattop{% locate it after \sphinxcapstartof + \spx@ifcaptionpackage + {\caption@setposition{t}% + \vskip\baselineskip\vskip\parskip % undo those from \sphinxcapstartof + \vskip-\belowcaptionskip % anticipate caption package skip + % caption package uses a \vbox, not a \vtop, so "single line" case + % gives different result from "multi-line" without this: + \nointerlineskip + }% + {}% +}% +\def\sphinxthecaptionisatbottom{% (not finalized; for template usage) + \spx@ifcaptionpackage{\caption@setposition{b}}{}% +}% +% The aim of \sphinxcaption is to apply to tabular(y) the maximal width +% of caption as done by longtable +\def\sphinxtablecapwidth{\LTcapwidth}% +\newcommand\sphinxcaption{\@dblarg\spx@caption}% +\long\def\spx@caption[#1]#2{% + \noindent\hb@xt@\linewidth{\hss + \vtop{\@tempdima\dimexpr\sphinxtablecapwidth\relax +% don't exceed linewidth for the caption width + \ifdim\@tempdima>\linewidth\hsize\linewidth\else\hsize\@tempdima\fi +% longtable ignores \abovecaptionskip/\belowcaptionskip, so do the same here + \abovecaptionskip\sphinxabovecaptionskip % \z@skip + \belowcaptionskip\sphinxbelowcaptionskip % \z@skip + \caption[{#1}]% + {\strut\ignorespaces#2\ifhmode\unskip\@finalstrut\strutbox\fi}% + }\hss}% + \par\prevdepth\dp\strutbox +}% +\def\sphinxabovecaptionskip{\z@skip}% Do not use! Flagged for removal +\def\sphinxbelowcaptionskip{\z@skip}% Do not use! Flagged for removal +% This wrapper of \abovecaptionskip is used in sphinxVerbatim for top +% caption, and with another value in sphinxVerbatimintable +% TODO: To unify space above caption of a code-block with the one above +% caption of a table/longtable, \abovecaptionskip must not be used +% This auxiliary will get renamed and receive a different meaning +% in future. +\def\spx@abovecaptionskip{\abovecaptionskip}% +% Achieve \sphinxbelowcaptionspace below a caption located above a tabular +% or a tabulary +\newcommand\sphinxaftertopcaption +{% + \spx@ifcaptionpackage + {\par\prevdepth\dp\strutbox\nobreak\vskip-\abovecaptionskip}{\nobreak}% + \vskip\dimexpr\sphinxbelowcaptionspace\relax + \vskip-\baselineskip\vskip-\parskip +}% +% varwidth is crucial for our handling of general contents in merged cells +\RequirePackage{varwidth} +% but addition of a compatibility patch with hyperref is needed +% (tested with varwidth v 0.92 Mar 2009) +\AtBeginDocument {% + \let\@@vwid@Hy@raisedlink\Hy@raisedlink + \long\def\@vwid@Hy@raisedlink#1{\@vwid@wrap{\@@vwid@Hy@raisedlink{#1}}}% + \edef\@vwid@setup{% + \let\noexpand\Hy@raisedlink\noexpand\@vwid@Hy@raisedlink % HYPERREF ! + \unexpanded\expandafter{\@vwid@setup}}% +}% +% Homemade package to handle merged cells +\RequirePackage{sphinxmulticell} +\RequirePackage{makeidx} +% For framing code-blocks and warning type notices, and shadowing topics +\RequirePackage{framed} +% The xcolor package draws better fcolorboxes around verbatim code +\IfFileExists{xcolor.sty}{ + \RequirePackage{xcolor} +}{ + \RequirePackage{color} +} +% For highlighted code. +\RequirePackage{fancyvrb} +\define@key{FV}{hllines}{\def\sphinx@verbatim@checkifhl##1{\in@{, ##1,}{#1}}} +% sphinxVerbatim must be usable by third party without requiring hllines set-up +\def\sphinxresetverbatimhllines{\def\sphinx@verbatim@checkifhl##1{\in@false}} +\sphinxresetverbatimhllines +% For hyperlinked footnotes in tables; also for gathering footnotes from +% topic and warning blocks. Also to allow code-blocks in footnotes. +\RequirePackage{footnotehyper-sphinx} +% For the H specifier. Do not \restylefloat{figure}, it breaks Sphinx code +% for allowing figures in tables. +\RequirePackage{float} +% For floating figures in the text. Better to load after float. +\RequirePackage{wrapfig} +% Separate paragraphs by space by default. +\IfFileExists{parskip-2001-04-09.sty}% since September 2018 TeXLive update +% new parskip.sty, but let it rollback to old one. +% hopefully TeX installation not broken and LaTeX kernel not too old + {\RequirePackage{parskip}[=v1]} +% standard one from 1989. Admittedly \section of article/book gives possibly +% anomalous spacing, but we can't require September 2018 release for some time. + {\RequirePackage{parskip}} +% For parsed-literal blocks. +\RequirePackage{alltt} +% Display "real" single quotes in literal blocks. +\RequirePackage{upquote} +% control caption around literal-block +\RequirePackage{capt-of} +\RequirePackage{needspace} +% LaTeX 2018-04-01 and later provides \@removefromreset +\ltx@ifundefined{@removefromreset} + {\RequirePackage{remreset}} + {}% avoid warning +% to make pdf with correct encoded bookmarks in Japanese +% this should precede the hyperref package +\ifx\kanjiskip\@undefined +% for non-Japanese: make sure bookmarks are ok also with lualatex + \PassOptionsToPackage{pdfencoding=unicode}{hyperref} +\else + \RequirePackage{atbegshi} + \ifx\ucs\@undefined + \ifnum 42146=\euc"A4A2 + \AtBeginShipoutFirst{\special{pdf:tounicode EUC-UCS2}} + \else + \AtBeginShipoutFirst{\special{pdf:tounicode 90ms-RKSJ-UCS2}} + \fi + \else + \AtBeginShipoutFirst{\special{pdf:tounicode UTF8-UCS2}} + \fi +\fi + +\ifx\@jsc@uplatextrue\@undefined\else + \PassOptionsToPackage{setpagesize=false}{hyperref} +\fi + +% These options can be overriden inside 'hyperref' key +% or by later use of \hypersetup. +\PassOptionsToPackage{colorlinks,breaklinks,% + linkcolor=InnerLinkColor,filecolor=OuterLinkColor,% + menucolor=OuterLinkColor,urlcolor=OuterLinkColor,% + citecolor=InnerLinkColor}{hyperref} + +% stylesheet for highlighting with pygments +\RequirePackage{sphinxhighlight} +% fix baseline increase from Pygments latex formatter in case of error tokens +% and keep \fboxsep's scope local via added braces +\def\PYG@tok@err{% + \def\PYG@bc##1{{\setlength{\fboxsep}{-\fboxrule}% + \fcolorbox[rgb]{1.00,0.00,0.00}{1,1,1}{\strut ##1}}}% +} +\def\PYG@tok@cs{% + \def\PYG@tc##1{\textcolor[rgb]{0.25,0.50,0.56}{##1}}% + \def\PYG@bc##1{{\setlength{\fboxsep}{0pt}% + \colorbox[rgb]{1.00,0.94,0.94}{\strut ##1}}}% +}% + + +%% OPTIONS +% +% Handle options via "kvoptions" (later loaded by hyperref anyhow) +\RequirePackage{kvoptions} +\SetupKeyvalOptions{prefix=spx@opt@} % use \spx@opt@ prefix + +% Sphinx legacy text layout: 1in margins on all four sides +\ifx\@jsc@uplatextrue\@undefined +\DeclareStringOption[1in]{hmargin} +\DeclareStringOption[1in]{vmargin} +\DeclareStringOption[.5in]{marginpar} +\else +% Japanese standard document classes handle \mag in a special way +\DeclareStringOption[\inv@mag in]{hmargin} +\DeclareStringOption[\inv@mag in]{vmargin} +\DeclareStringOption[.5\dimexpr\inv@mag in\relax]{marginpar} +\fi + +\DeclareStringOption[0]{maxlistdepth}% \newcommand*\spx@opt@maxlistdepth{0} +\DeclareStringOption[-1]{numfigreset} +\DeclareBoolOption[false]{nonumfigreset} +\DeclareBoolOption[false]{mathnumfig} +% \DeclareBoolOption[false]{usespart}% not used +% dimensions, we declare the \dimen registers here. +\newdimen\sphinxverbatimsep +\newdimen\sphinxverbatimborder +\newdimen\sphinxshadowsep +\newdimen\sphinxshadowsize +\newdimen\sphinxshadowrule +% \DeclareStringOption is not convenient for the handling of these dimensions +% because we want to assign the values to the corresponding registers. Even if +% we added the code to the key handler it would be too late for the initial +% set-up and we would need to do initial assignments explicitely. We end up +% using \define@key directly. +% verbatim +\sphinxverbatimsep=\fboxsep + \define@key{sphinx}{verbatimsep}{\sphinxverbatimsep\dimexpr #1\relax} +\sphinxverbatimborder=\fboxrule + \define@key{sphinx}{verbatimborder}{\sphinxverbatimborder\dimexpr #1\relax} +% topic boxes +\sphinxshadowsep =5pt + \define@key{sphinx}{shadowsep}{\sphinxshadowsep\dimexpr #1\relax} +\sphinxshadowsize=4pt + \define@key{sphinx}{shadowsize}{\sphinxshadowsize\dimexpr #1\relax} +\sphinxshadowrule=\fboxrule + \define@key{sphinx}{shadowrule}{\sphinxshadowrule\dimexpr #1\relax} +% verbatim +\DeclareBoolOption[true]{verbatimwithframe} +\DeclareBoolOption[true]{verbatimwrapslines} +\DeclareBoolOption[true]{verbatimhintsturnover} +\DeclareBoolOption[true]{inlineliteralwraps} +\DeclareStringOption[t]{literalblockcappos} +\DeclareStringOption[r]{verbatimcontinuedalign} +\DeclareStringOption[r]{verbatimcontinuesalign} +% parsed literal +\DeclareBoolOption[true]{parsedliteralwraps} +% \textvisiblespace for compatibility with fontspec+XeTeX/LuaTeX +\DeclareStringOption[\textcolor{red}{\textvisiblespace}]{verbatimvisiblespace} +\DeclareStringOption % must use braces to hide the brackets + [{\makebox[2\fontcharwd\font`\x][r]{\textcolor{red}{\tiny$\m@th\hookrightarrow$}}}]% + {verbatimcontinued} +% notices/admonitions +% the dimensions for notices/admonitions are kept as macros and assigned to +% \spx@notice@border at time of use, hence \DeclareStringOption is ok for this +\newdimen\spx@notice@border +\DeclareStringOption[0.5pt]{noteborder} +\DeclareStringOption[0.5pt]{hintborder} +\DeclareStringOption[0.5pt]{importantborder} +\DeclareStringOption[0.5pt]{tipborder} +\DeclareStringOption[1pt]{warningborder} +\DeclareStringOption[1pt]{cautionborder} +\DeclareStringOption[1pt]{attentionborder} +\DeclareStringOption[1pt]{dangerborder} +\DeclareStringOption[1pt]{errorborder} +% footnotes +\DeclareStringOption[\mbox{ }]{AtStartFootnote} +% we need a public macro name for direct use in latex file +\newcommand*{\sphinxAtStartFootnote}{\spx@opt@AtStartFootnote} +% no such need for this one, as it is used inside other macros +\DeclareStringOption[\leavevmode\unskip]{BeforeFootnote} +% some font styling. +\DeclareStringOption[\sffamily\bfseries]{HeaderFamily} +% colours +% same problems as for dimensions: we want the key handler to use \definecolor. +% first, some colours with no prefix, for backwards compatibility +\newcommand*{\sphinxDeclareColorOption}[2]{% + \definecolor{#1}#2% + \define@key{sphinx}{#1}{\definecolor{#1}##1}% +}% +\sphinxDeclareColorOption{TitleColor}{{rgb}{0.126,0.263,0.361}} +\sphinxDeclareColorOption{InnerLinkColor}{{rgb}{0.208,0.374,0.486}} +\sphinxDeclareColorOption{OuterLinkColor}{{rgb}{0.216,0.439,0.388}} +\sphinxDeclareColorOption{VerbatimColor}{{rgb}{1,1,1}} +\sphinxDeclareColorOption{VerbatimBorderColor}{{rgb}{0,0,0}} +% now the colours defined with "sphinx" prefix in their names +\newcommand*{\sphinxDeclareSphinxColorOption}[2]{% + % set the initial default + \definecolor{sphinx#1}#2% + % set the key handler. The "value" ##1 must be acceptable by \definecolor. + \define@key{sphinx}{#1}{\definecolor{sphinx#1}##1}% +}% +% Default color chosen to be as in minted.sty LaTeX package! +\sphinxDeclareSphinxColorOption{VerbatimHighlightColor}{{rgb}{0.878,1,1}} +% admonition boxes, "light" style +\sphinxDeclareSphinxColorOption{noteBorderColor}{{rgb}{0,0,0}} +\sphinxDeclareSphinxColorOption{hintBorderColor}{{rgb}{0,0,0}} +\sphinxDeclareSphinxColorOption{importantBorderColor}{{rgb}{0,0,0}} +\sphinxDeclareSphinxColorOption{tipBorderColor}{{rgb}{0,0,0}} +% admonition boxes, "heavy" style +\sphinxDeclareSphinxColorOption{warningBorderColor}{{rgb}{0,0,0}} +\sphinxDeclareSphinxColorOption{cautionBorderColor}{{rgb}{0,0,0}} +\sphinxDeclareSphinxColorOption{attentionBorderColor}{{rgb}{0,0,0}} +\sphinxDeclareSphinxColorOption{dangerBorderColor}{{rgb}{0,0,0}} +\sphinxDeclareSphinxColorOption{errorBorderColor}{{rgb}{0,0,0}} +\sphinxDeclareSphinxColorOption{warningBgColor}{{rgb}{1,1,1}} +\sphinxDeclareSphinxColorOption{cautionBgColor}{{rgb}{1,1,1}} +\sphinxDeclareSphinxColorOption{attentionBgColor}{{rgb}{1,1,1}} +\sphinxDeclareSphinxColorOption{dangerBgColor}{{rgb}{1,1,1}} +\sphinxDeclareSphinxColorOption{errorBgColor}{{rgb}{1,1,1}} + +\DeclareDefaultOption{\@unknownoptionerror} +\ProcessKeyvalOptions* +% don't allow use of maxlistdepth via \sphinxsetup. +\DisableKeyvalOption{sphinx}{maxlistdepth} +\DisableKeyvalOption{sphinx}{numfigreset} +\DisableKeyvalOption{sphinx}{nonumfigreset} +\DisableKeyvalOption{sphinx}{mathnumfig} +% user interface: options can be changed midway in a document! +\newcommand\sphinxsetup[1]{\setkeys{sphinx}{#1}} + + +%% ALPHANUMERIC LIST ITEMS +\newcommand\sphinxsetlistlabels[5] +{% #1 = style, #2 = enum, #3 = enumnext, #4 = prefix, #5 = suffix + % #2 and #3 are counters used by enumerate environement e.g. enumi, enumii. + % #1 is a macro such as \arabic or \alph + % prefix and suffix are strings (by default empty and a dot). + \@namedef{the#2}{#1{#2}}% + \@namedef{label#2}{#4\@nameuse{the#2}#5}% + \@namedef{p@#3}{\@nameuse{p@#2}#4\@nameuse{the#2}#5}% +}% + + +%% MAXLISTDEPTH +% +% remove LaTeX's cap on nesting depth if 'maxlistdepth' key used. +% This is a hack, which works with the standard classes: it assumes \@toodeep +% is always used in "true" branches: "\if ... \@toodeep \else .. \fi." + +% will force use the "false" branch (if there is one) +\def\spx@toodeep@hack{\fi\iffalse} + +% do nothing if 'maxlistdepth' key not used or if package enumitem loaded. +\ifnum\spx@opt@maxlistdepth=\z@\expandafter\@gobbletwo\fi +\AtBeginDocument{% +\@ifpackageloaded{enumitem}{\remove@to@nnil}{}% + \let\spx@toodeepORI\@toodeep + \def\@toodeep{% + \ifnum\@listdepth<\spx@opt@maxlistdepth\relax + \expandafter\spx@toodeep@hack + \else + \expandafter\spx@toodeepORI + \fi}% +% define all missing \@list... macros + \count@\@ne + \loop + \ltx@ifundefined{@list\romannumeral\the\count@} + {\iffalse}{\iftrue\advance\count@\@ne}% + \repeat + \loop + \ifnum\count@>\spx@opt@maxlistdepth\relax\else + \expandafter\let + \csname @list\romannumeral\the\count@\expandafter\endcsname + \csname @list\romannumeral\the\numexpr\count@-\@ne\endcsname + % workaround 2.6--3.2d babel-french issue (fixed in 3.2e; no change needed) + \ltx@ifundefined{leftmargin\romannumeral\the\count@} + {\expandafter\let + \csname leftmargin\romannumeral\the\count@\expandafter\endcsname + \csname leftmargin\romannumeral\the\numexpr\count@-\@ne\endcsname}{}% + \advance\count@\@ne + \repeat +% define all missing enum... counters and \labelenum... macros and \p@enum.. + \count@\@ne + \loop + \ltx@ifundefined{c@enum\romannumeral\the\count@} + {\iffalse}{\iftrue\advance\count@\@ne}% + \repeat + \loop + \ifnum\count@>\spx@opt@maxlistdepth\relax\else + \newcounter{enum\romannumeral\the\count@}% + \expandafter\def + \csname labelenum\romannumeral\the\count@\expandafter\endcsname + \expandafter + {\csname theenum\romannumeral\the\numexpr\count@\endcsname.}% + \expandafter\def + \csname p@enum\romannumeral\the\count@\expandafter\endcsname + \expandafter + {\csname p@enum\romannumeral\the\numexpr\count@-\@ne\expandafter + \endcsname\csname theenum\romannumeral\the\numexpr\count@-\@ne\endcsname.}% + \advance\count@\@ne + \repeat +% define all missing labelitem... macros + \count@\@ne + \loop + \ltx@ifundefined{labelitem\romannumeral\the\count@} + {\iffalse}{\iftrue\advance\count@\@ne}% + \repeat + \loop + \ifnum\count@>\spx@opt@maxlistdepth\relax\else + \expandafter\let + \csname labelitem\romannumeral\the\count@\expandafter\endcsname + \csname labelitem\romannumeral\the\numexpr\count@-\@ne\endcsname + \advance\count@\@ne + \repeat + \PackageInfo{sphinx}{maximal list depth extended to \spx@opt@maxlistdepth}% +\@gobble\@nnil +} + + +%% INDEX, BIBLIOGRAPHY, APPENDIX, TABLE OF CONTENTS +% +% fix the double index and bibliography on the table of contents +% in jsclasses (Japanese standard document classes) +\ifx\@jsc@uplatextrue\@undefined\else + \renewenvironment{sphinxtheindex} + {\cleardoublepage\phantomsection + \begin{theindex}} + {\end{theindex}} + + \renewenvironment{sphinxthebibliography}[1] + {\cleardoublepage% \phantomsection % not needed here since TeXLive 2010's hyperref + \begin{thebibliography}{#1}} + {\end{thebibliography}} +\fi + +% disable \@chappos in Appendix in pTeX +\ifx\kanjiskip\@undefined\else + \let\py@OldAppendix=\appendix + \renewcommand{\appendix}{ + \py@OldAppendix + \gdef\@chappos{} + } +\fi + +% make commands known to non-Sphinx document classes +\providecommand*{\sphinxmaketitle}{\maketitle} +\providecommand*{\sphinxtableofcontents}{\tableofcontents} +\ltx@ifundefined{sphinxthebibliography} + {\newenvironment + {sphinxthebibliography}{\begin{thebibliography}}{\end{thebibliography}}% + } + {}% else clause of \ltx@ifundefined +\ltx@ifundefined{sphinxtheindex} + {\newenvironment{sphinxtheindex}{\begin{theindex}}{\end{theindex}}}% + {}% else clause of \ltx@ifundefined + +% for usage with xindy: this string gets internationalized in preamble +\newcommand*{\sphinxnonalphabeticalgroupname}{} +% redefined in preamble, headings for makeindex produced index +\newcommand*{\sphinxsymbolsname}{} +\newcommand*{\sphinxnumbersname}{} + +%% COLOR (general) +% +% FIXME: \normalcolor should probably be used in place of \py@NormalColor +% elsewhere, and \py@NormalColor should never be defined. \normalcolor +% switches to the colour from last \color call in preamble. +\def\py@NormalColor{\color{black}} +% FIXME: it is probably better to use \color{TitleColor}, as TitleColor +% can be customized from 'sphinxsetup', and drop usage of \py@TitleColor +\def\py@TitleColor{\color{TitleColor}} +% FIXME: this line should be dropped, as "9" is default anyhow. +\ifdefined\pdfcompresslevel\pdfcompresslevel = 9 \fi + + +%% PAGE STYLING +% +% Style parameters and macros used by most documents here +\raggedbottom +\sloppy +\hbadness = 5000 % don't print trivial gripes + +% Use \pagestyle{normal} as the primary pagestyle for text. +% Redefine the 'normal' header/footer style when using "fancyhdr" package: +\@ifpackageloaded{fancyhdr}{% + \ltx@ifundefined{c@chapter} + {% no \chapter, "howto" (non-Japanese) docclass + \fancypagestyle{plain}{ + \fancyhf{} + \fancyfoot[C]{{\py@HeaderFamily\thepage}} + \renewcommand{\headrulewidth}{0pt} + \renewcommand{\footrulewidth}{0pt} + } + % Same as 'plain', this way we can use it in template + % FIXME: shouldn't this have a running header with Name and Release like 'manual'? + \fancypagestyle{normal}{ + \fancyhf{} + \fancyfoot[C]{{\py@HeaderFamily\thepage}} + \renewcommand{\headrulewidth}{0pt} + \renewcommand{\footrulewidth}{0pt} + } + }% + {% classes with \chapter command + \fancypagestyle{normal}{ + \fancyhf{} + % FIXME: this presupposes "twoside". + % If "oneside" class option, there are warnings in LaTeX log. + \fancyfoot[LE,RO]{{\py@HeaderFamily\thepage}} + \fancyfoot[LO]{{\py@HeaderFamily\nouppercase{\rightmark}}} + \fancyfoot[RE]{{\py@HeaderFamily\nouppercase{\leftmark}}} + \fancyhead[LE,RO]{{\py@HeaderFamily \@title\sphinxheadercomma\py@release}} + \renewcommand{\headrulewidth}{0.4pt} + \renewcommand{\footrulewidth}{0.4pt} + % define chaptermark with \@chappos when \@chappos is available for Japanese + \ltx@ifundefined{@chappos}{} + {\def\chaptermark##1{\markboth{\@chapapp\space\thechapter\space\@chappos\space ##1}{}}} + } + % Update the plain style so we get the page number & footer line, + % but not a chapter or section title. This is to keep the first + % page of a chapter `clean.' + \fancypagestyle{plain}{ + \fancyhf{} + \fancyfoot[LE,RO]{{\py@HeaderFamily\thepage}} + \renewcommand{\headrulewidth}{0pt} + \renewcommand{\footrulewidth}{0.4pt} + } + } + } + {% no fancyhdr: memoir class + % Provide default for 'normal' style simply as an alias of 'plain' style + % This way we can use \pagestyle{normal} in LaTeX template + \def\ps@normal{\ps@plain} + % Users of memoir class are invited to redefine 'normal' style in preamble + } + +% geometry +\ifx\kanjiskip\@undefined + \PassOptionsToPackage{% + hmargin={\unexpanded{\spx@opt@hmargin}},% + vmargin={\unexpanded{\spx@opt@vmargin}},% + marginpar=\unexpanded{\spx@opt@marginpar}} + {geometry} +\else + % set text width for Japanese documents to be integer multiple of 1zw + % and text height to be integer multiple of \baselineskip + % the execution is delayed to \sphinxsetup then geometry.sty + \normalsize\normalfont + \newcommand*\sphinxtextwidthja[1]{% + \if@twocolumn\tw@\fi + \dimexpr + \numexpr\dimexpr\paperwidth-\tw@\dimexpr#1\relax\relax/ + \dimexpr\if@twocolumn\tw@\else\@ne\fi zw\relax + zw\relax}% + \newcommand*\sphinxmarginparwidthja[1]{% + \dimexpr\numexpr\dimexpr#1\relax/\dimexpr1zw\relax zw\relax}% + \newcommand*\sphinxtextlinesja[1]{% + \numexpr\@ne+\dimexpr\paperheight-\topskip-\tw@\dimexpr#1\relax\relax/ + \baselineskip\relax}% + \ifx\@jsc@uplatextrue\@undefined\else + % the way we found in order for the papersize special written by + % geometry in the dvi file to be correct in case of jsbook class + \ifnum\mag=\@m\else % do nothing special if nomag class option or 10pt + \PassOptionsToPackage{truedimen}{geometry}% + \fi + \fi + \PassOptionsToPackage{% + hmarginratio={1:1},% + textwidth=\unexpanded{\sphinxtextwidthja{\spx@opt@hmargin}},% + vmarginratio={1:1},% + lines=\unexpanded{\sphinxtextlinesja{\spx@opt@vmargin}},% + marginpar=\unexpanded{\sphinxmarginparwidthja{\spx@opt@marginpar}},% + footskip=2\baselineskip,% + }{geometry}% + \AtBeginDocument + {% update a dimension used by the jsclasses + \ifx\@jsc@uplatextrue\@undefined\else\fullwidth\textwidth\fi + % for some reason, jreport normalizes all dimensions with \@settopoint + \@ifclassloaded{jreport} + {\@settopoint\textwidth\@settopoint\textheight\@settopoint\marginparwidth} + {}% <-- "false" clause of \@ifclassloaded + }% +\fi + +% fix fncychap's bug which uses prematurely the \textwidth value +\@ifpackagewith{fncychap}{Bjornstrup} + {\AtBeginDocument{\mylen\textwidth\advance\mylen-2\myhi}}% + {}% <-- "false" clause of \@ifpackagewith + + +%% TITLES +% +% Since Sphinx 1.5, users should use HeaderFamily key to 'sphinxsetup' rather +% than defining their own \py@HeaderFamily command (which is still possible). +% Memo: \py@HeaderFamily is also used by \maketitle as defined in +% sphinxmanual.cls/sphinxhowto.cls +\newcommand{\py@HeaderFamily}{\spx@opt@HeaderFamily} + +% This sets up the fancy chapter headings that make the documents look +% at least a little better than the usual LaTeX output. +\@ifpackagewith{fncychap}{Bjarne}{ + \ChNameVar {\raggedleft\normalsize \py@HeaderFamily} + \ChNumVar {\raggedleft\Large \py@HeaderFamily} + \ChTitleVar{\raggedleft\Large \py@HeaderFamily} + % This creates (numbered) chapter heads without the leading \vspace*{}: + \def\@makechapterhead#1{% + {\parindent \z@ \raggedright \normalfont + \ifnum \c@secnumdepth >\m@ne + \if@mainmatter + \DOCH + \fi + \fi + \interlinepenalty\@M + \if@mainmatter + \DOTI{#1}% + \else% + \DOTIS{#1}% + \fi + }} +}{}% <-- "false" clause of \@ifpackagewith + +% Augment the sectioning commands used to get our own font family in place, +% and reset some internal data items (\titleformat from titlesec package) +\titleformat{\section}{\Large\py@HeaderFamily}% + {\py@TitleColor\thesection}{0.5em}{\py@TitleColor}{\py@NormalColor} +\titleformat{\subsection}{\large\py@HeaderFamily}% + {\py@TitleColor\thesubsection}{0.5em}{\py@TitleColor}{\py@NormalColor} +\titleformat{\subsubsection}{\py@HeaderFamily}% + {\py@TitleColor\thesubsubsection}{0.5em}{\py@TitleColor}{\py@NormalColor} +% By default paragraphs (and subsubsections) will not be numbered because +% sphinxmanual.cls and sphinxhowto.cls set secnumdepth to 2 +\titleformat{\paragraph}{\py@HeaderFamily}% + {\py@TitleColor\theparagraph}{0.5em}{\py@TitleColor}{\py@NormalColor} +\titleformat{\subparagraph}{\py@HeaderFamily}% + {\py@TitleColor\thesubparagraph}{0.5em}{\py@TitleColor}{\py@NormalColor} + + +%% GRAPHICS +% +% \sphinxincludegraphics resizes images larger than the TeX \linewidth (which +% is adjusted in indented environments), or taller than a certain maximal +% height (usually \textheight and this is reduced in the environments which use +% framed.sty to avoid infinite loop if image too tall). +% +% In case height or width options are present the rescaling is done +% (since 2.0), in a way keeping the width:height ratio either native from +% image or from the width and height options if both were present. +% +\newdimen\spx@image@maxheight +\AtBeginDocument{\spx@image@maxheight\textheight} + +% box scratch register +\newdimen\spx@image@box +\newcommand*{\sphinxsafeincludegraphics}[2][]{% + % #1 contains possibly width=, height=, but no scale= since 1.8.4 + \setbox\spx@image@box\hbox{\includegraphics[#1,draft]{#2}}% + \in@false % use some handy boolean flag + \ifdim \wd\spx@image@box>\linewidth + \in@true % flag to remember to adjust options and set box dimensions + % compute height which results from rescaling width to \linewidth + % and keep current aspect ratio. multiply-divide in \numexpr uses + % temporarily doubled precision, hence no overflow. (of course we + % assume \ht is not a few sp's below \maxdimen...(about 16384pt). + \edef\spx@image@rescaledheight % with sp units + {\the\numexpr\ht\spx@image@box + *\linewidth/\wd\spx@image@box sp}% + \ifdim\spx@image@rescaledheight>\spx@image@maxheight + % the rescaled height will be too big, so it is height which decides + % the rescaling factor + \def\spx@image@requiredheight{\spx@image@maxheight}% dimen register + \edef\spx@image@requiredwidth % with sp units + {\the\numexpr\wd\spx@image@box + *\spx@image@maxheight/\ht\spx@image@box sp}% + % TODO: decide if this commented-out block could be needed due to + % rounding in numexpr operations going up + % \ifdim\spx@image@requiredwidth>\linewidth + % \def\spx@image@requiredwidth{\linewidth}% dimen register + % \fi + \else + \def\spx@image@requiredwidth{\linewidth}% dimen register + \let\spx@image@requiredheight\spx@image@rescaledheight% sp units + \fi + \else + % width is ok, let's check height + \ifdim\ht\spx@image@box>\spx@image@maxheight + \in@true + \edef\spx@image@requiredwidth % with sp units + {\the\numexpr\wd\spx@image@box + *\spx@image@maxheight/\ht\spx@image@box sp}% + \def\spx@image@requiredheight{\spx@image@maxheight}% dimen register + \fi + \fi % end of check of width and height + \ifin@ + \setbox\spx@image@box + \hbox{\includegraphics + [%#1,% contained only width and/or height and overruled anyhow + width=\spx@image@requiredwidth,height=\spx@image@requiredheight]% + {#2}}% + % \includegraphics does not set box dimensions to the exactly + % requested ones, see https://github.com/latex3/latex2e/issues/112 + \wd\spx@image@box\spx@image@requiredwidth + \ht\spx@image@box\spx@image@requiredheight + \leavevmode\box\spx@image@box + \else + % here we do not modify the options, no need to adjust width and height + % on output, they will be computed exactly as with "draft" option + \setbox\spx@image@box\box\voidb@x % clear memory + \includegraphics[#1]{#2}% + \fi +}% +% Use the "safe" one by default (2.0) +\def\sphinxincludegraphics{\sphinxsafeincludegraphics} + + +%% FIGURE IN TABLE +% +\newenvironment{sphinxfigure-in-table}[1][\linewidth]{% + \def\@captype{figure}% + \sphinxsetvskipsforfigintablecaption + \begin{minipage}{#1}% +}{\end{minipage}} +% store the original \caption macro for usage with figures inside longtable +% and tabulary cells. Make sure we get the final \caption in presence of +% caption package, whether the latter was loaded before or after sphinx. +\AtBeginDocument{% + \let\spx@originalcaption\caption + \@ifpackageloaded{caption} + {\let\spx@ifcaptionpackage\@firstoftwo + \caption@AtBeginDocument*{\let\spx@originalcaption\caption}% +% in presence of caption package, drop our own \sphinxcaption whose aim was to +% ensure same width of caption to all kinds of tables (tabular(y), longtable), +% because caption package has its own width (or margin) option + \def\sphinxcaption{\caption}% + }% + {\let\spx@ifcaptionpackage\@secondoftwo}% +} +% tabulary expands twice contents, we need to prevent double counter stepping +\newcommand*\sphinxfigcaption + {\ifx\equation$%$% this is trick to identify tabulary first pass + \firstchoice@false\else\firstchoice@true\fi + \spx@originalcaption } +\newcommand*\sphinxsetvskipsforfigintablecaption + {\abovecaptionskip\smallskipamount + \belowcaptionskip\smallskipamount} + + +%% CITATIONS +% +\protected\def\sphinxcite{\cite} + +%% FOOTNOTES +% +% Support large numbered footnotes in minipage +% But now obsolete due to systematic use of \savenotes/\spewnotes +% when minipages are in use in the various macro definitions next. +\def\thempfootnote{\arabic{mpfootnote}} + + +%% NUMBERING OF FIGURES, TABLES, AND LITERAL BLOCKS +\ltx@ifundefined{c@chapter} + {\newcounter{literalblock}}% + {\newcounter{literalblock}[chapter]% + \def\theliteralblock{\ifnum\c@chapter>\z@\arabic{chapter}.\fi + \arabic{literalblock}}% + }% +\ifspx@opt@nonumfigreset + \ltx@ifundefined{c@chapter}{}{% + \@removefromreset{figure}{chapter}% + \@removefromreset{table}{chapter}% + \@removefromreset{literalblock}{chapter}% + \ifspx@opt@mathnumfig + \@removefromreset{equation}{chapter}% + \fi + }% + \def\thefigure{\arabic{figure}}% + \def\thetable {\arabic{table}}% + \def\theliteralblock{\arabic{literalblock}}% + \ifspx@opt@mathnumfig + \def\theequation{\arabic{equation}}% + \fi +\else +\let\spx@preAthefigure\@empty +\let\spx@preBthefigure\@empty +% \ifspx@opt@usespart % <-- LaTeX writer could pass such a 'usespart' boolean +% % as sphinx.sty package option +% If document uses \part, (triggered in Sphinx by latex_toplevel_sectioning) +% LaTeX core per default does not reset chapter or section +% counters at each part. +% But if we modify this, we need to redefine \thechapter, \thesection to +% include the part number and this will cause problems in table of contents +% because of too wide numbering. Simplest is to do nothing. +% \fi +\ifnum\spx@opt@numfigreset>0 + \ltx@ifundefined{c@chapter} + {} + {\g@addto@macro\spx@preAthefigure{\ifnum\c@chapter>\z@\arabic{chapter}.}% + \g@addto@macro\spx@preBthefigure{\fi}}% +\fi +\ifnum\spx@opt@numfigreset>1 + \@addtoreset{figure}{section}% + \@addtoreset{table}{section}% + \@addtoreset{literalblock}{section}% + \ifspx@opt@mathnumfig + \@addtoreset{equation}{section}% + \fi + \g@addto@macro\spx@preAthefigure{\ifnum\c@section>\z@\arabic{section}.}% + \g@addto@macro\spx@preBthefigure{\fi}% +\fi +\ifnum\spx@opt@numfigreset>2 + \@addtoreset{figure}{subsection}% + \@addtoreset{table}{subsection}% + \@addtoreset{literalblock}{subsection}% + \ifspx@opt@mathnumfig + \@addtoreset{equation}{subsection}% + \fi + \g@addto@macro\spx@preAthefigure{\ifnum\c@subsection>\z@\arabic{subsection}.}% + \g@addto@macro\spx@preBthefigure{\fi}% +\fi +\ifnum\spx@opt@numfigreset>3 + \@addtoreset{figure}{subsubsection}% + \@addtoreset{table}{subsubsection}% + \@addtoreset{literalblock}{subsubsection}% + \ifspx@opt@mathnumfig + \@addtoreset{equation}{subsubsection}% + \fi + \g@addto@macro\spx@preAthefigure{\ifnum\c@subsubsection>\z@\arabic{subsubsection}.}% + \g@addto@macro\spx@preBthefigure{\fi}% +\fi +\ifnum\spx@opt@numfigreset>4 + \@addtoreset{figure}{paragraph}% + \@addtoreset{table}{paragraph}% + \@addtoreset{literalblock}{paragraph}% + \ifspx@opt@mathnumfig + \@addtoreset{equation}{paragraph}% + \fi + \g@addto@macro\spx@preAthefigure{\ifnum\c@subparagraph>\z@\arabic{subparagraph}.}% + \g@addto@macro\spx@preBthefigure{\fi}% +\fi +\ifnum\spx@opt@numfigreset>5 + \@addtoreset{figure}{subparagraph}% + \@addtoreset{table}{subparagraph}% + \@addtoreset{literalblock}{subparagraph}% + \ifspx@opt@mathnumfig + \@addtoreset{equation}{subparagraph}% + \fi + \g@addto@macro\spx@preAthefigure{\ifnum\c@subsubparagraph>\z@\arabic{subsubparagraph}.}% + \g@addto@macro\spx@preBthefigure{\fi}% +\fi +\expandafter\g@addto@macro +\expandafter\spx@preAthefigure\expandafter{\spx@preBthefigure}% +\let\thefigure\spx@preAthefigure +\let\thetable\spx@preAthefigure +\let\theliteralblock\spx@preAthefigure +\g@addto@macro\thefigure{\arabic{figure}}% +\g@addto@macro\thetable{\arabic{table}}% +\g@addto@macro\theliteralblock{\arabic{literalblock}}% + \ifspx@opt@mathnumfig + \let\theequation\spx@preAthefigure + \g@addto@macro\theequation{\arabic{equation}}% + \fi +\fi + + +%% LITERAL BLOCKS +% +% Based on use of "fancyvrb.sty"'s Verbatim. +% - with framing allowing page breaks ("framed.sty") +% - with breaking of long lines (exploits Pygments mark-up), +% - with possibly of a top caption, non-separable by pagebreak. +% - and usable inside tables or footnotes ("footnotehyper-sphinx"). + +% For extensions which use \OriginalVerbatim and compatibility with Sphinx < +% 1.5, we define and use these when (unmodified) Verbatim will be needed. But +% Sphinx >= 1.5 does not modify the \Verbatim macro anymore. +\let\OriginalVerbatim \Verbatim +\let\endOriginalVerbatim\endVerbatim + +% for captions of literal blocks +% at start of caption title +\newcommand*{\fnum@literalblock}{\literalblockname\nobreakspace\theliteralblock} +% this will be overwritten in document preamble by Babel translation +\newcommand*{\literalblockname}{Listing } +% file extension needed for \caption's good functioning, the file is created +% only if a \listof{literalblock}{foo} command is encountered, which is +% analogous to \listoffigures, but for the code listings (foo = chosen title.) +\newcommand*{\ext@literalblock}{lol} + +\newif\ifspx@inframed % flag set if we are already in a framed environment +% if forced use of minipage encapsulation is needed (e.g. table cells) +\newif\ifsphinxverbatimwithminipage \sphinxverbatimwithminipagefalse + +% Framing macro for use with framed.sty's \FrameCommand +% - it obeys current indentation, +% - frame is \fboxsep separated from the contents, +% - the contents use the full available text width, +% - #1 = color of frame, #2 = color of background, +% - #3 = above frame, #4 = below frame, #5 = within frame, +% - #3 and #4 must be already typeset boxes; they must issue \normalcolor +% or similar, else, they are under scope of color #1 +\long\def\spx@fcolorbox #1#2#3#4#5{% + \hskip\@totalleftmargin + \hskip-\fboxsep\hskip-\fboxrule + % use of \color@b@x here is compatible with both xcolor.sty and color.sty + \color@b@x {\color{#1}\spx@CustomFBox{#3}{#4}}{\color{#2}}{#5}% + \hskip-\fboxsep\hskip-\fboxrule + \hskip-\linewidth \hskip-\@totalleftmargin \hskip\columnwidth +}% +% #1 = for material above frame, such as a caption or a "continued" hint +% #2 = for material below frame, such as a caption or "continues on next page" +% #3 = actual contents, which will be typeset with a background color +\long\def\spx@CustomFBox#1#2#3{% + \begingroup + \setbox\@tempboxa\hbox{{#3}}% inner braces to avoid color leaks + \vbox{#1% above frame + % draw frame border _latest_ to avoid pdf viewer issue + \kern\fboxrule + \hbox{\kern\fboxrule + \copy\@tempboxa + \kern-\wd\@tempboxa\kern-\fboxrule + \vrule\@width\fboxrule + \kern\wd\@tempboxa + \vrule\@width\fboxrule}% + \kern-\dimexpr\ht\@tempboxa+\dp\@tempboxa+\fboxrule\relax + \hrule\@height\fboxrule + \kern\dimexpr\ht\@tempboxa+\dp\@tempboxa\relax + \hrule\@height\fboxrule + #2% below frame + }% + \endgroup +}% +\def\spx@fcolorbox@put@c#1{% hide width from framed.sty measuring + \moveright\dimexpr\fboxrule+.5\wd\@tempboxa\hb@xt@\z@{\hss#1\hss}% +}% +\def\spx@fcolorbox@put@r#1{% right align with contents, width hidden + \moveright\dimexpr\fboxrule+\wd\@tempboxa-\fboxsep\hb@xt@\z@{\hss#1}% +}% +\def\spx@fcolorbox@put@l#1{% left align with contents, width hidden + \moveright\dimexpr\fboxrule+\fboxsep\hb@xt@\z@{#1\hss}% +}% +% +\def\sphinxVerbatim@Continued + {\csname spx@fcolorbox@put@\spx@opt@verbatimcontinuedalign\endcsname + {\normalcolor\sphinxstylecodecontinued\literalblockcontinuedname}}% +\def\sphinxVerbatim@Continues + {\csname spx@fcolorbox@put@\spx@opt@verbatimcontinuesalign\endcsname + {\normalcolor\sphinxstylecodecontinues\literalblockcontinuesname}}% +\def\sphinxVerbatim@Title + {\spx@fcolorbox@put@c{\unhcopy\sphinxVerbatim@TitleBox}}% +\let\sphinxVerbatim@Before\@empty +\let\sphinxVerbatim@After\@empty +% Defaults are redefined in document preamble according to language +\newcommand*\literalblockcontinuedname{continued from previous page}% +\newcommand*\literalblockcontinuesname{continues on next page}% +% +\def\spx@verbatimfcolorbox{\spx@fcolorbox{VerbatimBorderColor}{VerbatimColor}}% +\def\sphinxVerbatim@FrameCommand + {\spx@verbatimfcolorbox\sphinxVerbatim@Before\sphinxVerbatim@After}% +\def\sphinxVerbatim@FirstFrameCommand + {\spx@verbatimfcolorbox\sphinxVerbatim@Before\sphinxVerbatim@Continues}% +\def\sphinxVerbatim@MidFrameCommand + {\spx@verbatimfcolorbox\sphinxVerbatim@Continued\sphinxVerbatim@Continues}% +\def\sphinxVerbatim@LastFrameCommand + {\spx@verbatimfcolorbox\sphinxVerbatim@Continued\sphinxVerbatim@After}% + +% For linebreaks inside Verbatim environment from package fancyvrb. +\newbox\sphinxcontinuationbox +\newbox\sphinxvisiblespacebox +\newcommand*\sphinxafterbreak {\copy\sphinxcontinuationbox} + +% Take advantage of the already applied Pygments mark-up to insert +% potential linebreaks for TeX processing. +% {, <, #, %, $, ' and ": go to next line. +% _, }, ^, &, >, - and ~: stay at end of broken line. +% Use of \textquotesingle for straight quote. +% FIXME: convert this to package options ? +\newcommand*\sphinxbreaksbeforelist {% + \do\PYGZob\{\do\PYGZlt\<\do\PYGZsh\#\do\PYGZpc\%% {, <, #, %, + \do\PYGZdl\$\do\PYGZdq\"% $, " + \def\PYGZsq + {\discretionary{}{\sphinxafterbreak\textquotesingle}{\textquotesingle}}% ' +} +\newcommand*\sphinxbreaksafterlist {% + \do\PYGZus\_\do\PYGZcb\}\do\PYGZca\^\do\PYGZam\&% _, }, ^, &, + \do\PYGZgt\>\do\PYGZhy\-\do\PYGZti\~% >, -, ~ +} +\newcommand*\sphinxbreaksatspecials {% + \def\do##1##2% + {\def##1{\discretionary{}{\sphinxafterbreak\char`##2}{\char`##2}}}% + \sphinxbreaksbeforelist + \def\do##1##2% + {\def##1{\discretionary{\char`##2}{\sphinxafterbreak}{\char`##2}}}% + \sphinxbreaksafterlist +} + +\def\sphinx@verbatim@nolig@list {\do \`}% +% Some characters . , ; ? ! / are not pygmentized. +% This macro makes them "active" and they will insert potential linebreaks. +% Not compatible with math mode (cf \sphinxunactivateextras). +\newcommand*\sphinxbreaksbeforeactivelist {}% none +\newcommand*\sphinxbreaksafteractivelist {\do\.\do\,\do\;\do\?\do\!\do\/} +\newcommand*\sphinxbreaksviaactive {% + \def\do##1{\lccode`\~`##1% + \lowercase{\def~}{\discretionary{}{\sphinxafterbreak\char`##1}{\char`##1}}% + \catcode`##1\active}% + \sphinxbreaksbeforeactivelist + \def\do##1{\lccode`\~`##1% + \lowercase{\def~}{\discretionary{\char`##1}{\sphinxafterbreak}{\char`##1}}% + \catcode`##1\active}% + \sphinxbreaksafteractivelist + \lccode`\~`\~ +} + +% If the linebreak is at a space, the latter will be displayed as visible +% space at end of first line, and a continuation symbol starts next line. +\def\spx@verbatim@space {% + \nobreak\hskip\z@skip + \discretionary{\copy\sphinxvisiblespacebox}{\sphinxafterbreak} + {\kern\fontdimen2\font}% +}% + +% if the available space on page is less than \literalblockneedspace, insert pagebreak +\newcommand{\sphinxliteralblockneedspace}{5\baselineskip} +\newcommand{\sphinxliteralblockwithoutcaptionneedspace}{1.5\baselineskip} +% The title (caption) is specified from outside as macro \sphinxVerbatimTitle. +% \sphinxVerbatimTitle is reset to empty after each use of Verbatim. +\newcommand*\sphinxVerbatimTitle {} +% This box to typeset the caption before framed.sty multiple passes for framing. +\newbox\sphinxVerbatim@TitleBox +% This is a workaround to a "feature" of French lists, when literal block +% follows immediately; usable generally (does only \par then), a priori... +\newcommand*\sphinxvspacefixafterfrenchlists{% + \ifvmode\ifdim\lastskip<\z@ \vskip\parskip\fi\else\par\fi +} +% Holder macro for labels of literal blocks. Set-up by LaTeX writer. +\newcommand*\sphinxLiteralBlockLabel {} +\newcommand*\sphinxSetupCaptionForVerbatim [1] +{% + \sphinxvspacefixafterfrenchlists + \needspace{\sphinxliteralblockneedspace}% +% insert a \label via \sphinxLiteralBlockLabel +% reset to normal the color for the literal block caption + \def\sphinxVerbatimTitle + {\py@NormalColor\sphinxcaption{\sphinxLiteralBlockLabel #1}}% +} +\newcommand*\sphinxSetupCodeBlockInFootnote {% + \fvset{fontsize=\footnotesize}\let\caption\sphinxfigcaption + \sphinxverbatimwithminipagetrue % reduces vertical spaces + % we counteract (this is in a group) the \@normalsize from \caption + \let\normalsize\footnotesize\let\@parboxrestore\relax + \def\spx@abovecaptionskip{\sphinxverbatimsmallskipamount}% +} +\newcommand*{\sphinxverbatimsmallskipamount}{\smallskipamount} +% serves to implement line highlighting and line wrapping +\newcommand\sphinxFancyVerbFormatLine[1]{% + \expandafter\sphinx@verbatim@checkifhl\expandafter{\the\FV@CodeLineNo}% + \ifin@ + \sphinxVerbatimHighlightLine{#1}% + \else + \sphinxVerbatimFormatLine{#1}% + \fi +}% +\newcommand\sphinxVerbatimHighlightLine[1]{% + \edef\sphinxrestorefboxsep{\fboxsep\the\fboxsep\relax}% + \fboxsep0pt\relax % cf LaTeX bug graphics/4524 + \colorbox{sphinxVerbatimHighlightColor}% + {\sphinxrestorefboxsep\sphinxVerbatimFormatLine{#1}}% + % no need to restore \fboxsep here, as this ends up in a \hbox from fancyvrb +}% +% \sphinxVerbatimFormatLine will be set locally to one of those two: +\newcommand\sphinxVerbatimFormatLineWrap[1]{% + \hsize\linewidth + \vtop{\raggedright\hyphenpenalty\z@\exhyphenpenalty\z@ + \doublehyphendemerits\z@\finalhyphendemerits\z@ + \strut #1\strut}% +}% +\newcommand\sphinxVerbatimFormatLineNoWrap[1]{\hb@xt@\linewidth{\strut #1\hss}}% +\g@addto@macro\FV@SetupFont{% + \sbox\sphinxcontinuationbox {\spx@opt@verbatimcontinued}% + \sbox\sphinxvisiblespacebox {\spx@opt@verbatimvisiblespace}% +}% +\newenvironment{sphinxVerbatim}{% + % first, let's check if there is a caption + \ifx\sphinxVerbatimTitle\empty + \sphinxvspacefixafterfrenchlists + \parskip\z@skip + \vskip\sphinxverbatimsmallskipamount + % there was no caption. Check if nevertheless a label was set. + \ifx\sphinxLiteralBlockLabel\empty\else + % we require some space to be sure hyperlink target from \phantomsection + % will not be separated from upcoming verbatim by a page break + \needspace{\sphinxliteralblockwithoutcaptionneedspace}% + \phantomsection\sphinxLiteralBlockLabel + \fi + \else + \parskip\z@skip + \if t\spx@opt@literalblockcappos + \vskip\spx@abovecaptionskip + \def\sphinxVerbatim@Before + {\sphinxVerbatim@Title\nointerlineskip + \kern\dimexpr-\dp\strutbox+\sphinxbelowcaptionspace + % if no frame (code-blocks inside table cells), remove + % the "verbatimsep" whitespace from the top (better visually) + \ifspx@opt@verbatimwithframe\else-\sphinxverbatimsep\fi + % caption package adds \abovecaptionskip vspace, remove it + \spx@ifcaptionpackage{-\abovecaptionskip}{}\relax}% + \else + \vskip\sphinxverbatimsmallskipamount + \def\sphinxVerbatim@After + {\nointerlineskip\kern\dimexpr\dp\strutbox + \ifspx@opt@verbatimwithframe\else-\sphinxverbatimsep\fi + \spx@ifcaptionpackage{-\abovecaptionskip}{}\relax + \sphinxVerbatim@Title}% + \fi + \def\@captype{literalblock}% + \capstart + % \sphinxVerbatimTitle must reset color + \setbox\sphinxVerbatim@TitleBox + \hbox{\begin{minipage}{\linewidth}% + % caption package may detect wrongly if top or bottom, so we help it + \spx@ifcaptionpackage + {\caption@setposition{\spx@opt@literalblockcappos}}{}% + \sphinxVerbatimTitle + \end{minipage}}% + \fi + \global\let\sphinxLiteralBlockLabel\empty + \global\let\sphinxVerbatimTitle\empty + \fboxsep\sphinxverbatimsep \fboxrule\sphinxverbatimborder + \ifspx@opt@verbatimwithframe\else\fboxrule\z@\fi + \let\FrameCommand \sphinxVerbatim@FrameCommand + \let\FirstFrameCommand\sphinxVerbatim@FirstFrameCommand + \let\MidFrameCommand \sphinxVerbatim@MidFrameCommand + \let\LastFrameCommand \sphinxVerbatim@LastFrameCommand + \ifspx@opt@verbatimhintsturnover\else + \let\sphinxVerbatim@Continued\@empty + \let\sphinxVerbatim@Continues\@empty + \fi + \ifspx@opt@verbatimwrapslines + % fancyvrb's Verbatim puts each input line in (unbreakable) horizontal boxes. + % This customization wraps each line from the input in a \vtop, thus + % allowing it to wrap and display on two or more lines in the latex output. + % - The codeline counter will be increased only once. + % - The wrapped material will not break across pages, it is impossible + % to achieve this without extensive rewrite of fancyvrb. + % - The (not used in sphinx) obeytabs option to Verbatim is + % broken by this change (showtabs and tabspace work). + \let\sphinxVerbatimFormatLine\sphinxVerbatimFormatLineWrap + \let\FV@Space\spx@verbatim@space + % Allow breaks at special characters using \PYG... macros. + \sphinxbreaksatspecials + % Breaks at punctuation characters . , ; ? ! and / (needs catcode activation) + \fvset{codes*=\sphinxbreaksviaactive}% + \else % end of conditional code for wrapping long code lines + \let\sphinxVerbatimFormatLine\sphinxVerbatimFormatLineNoWrap + \fi + \let\FancyVerbFormatLine\sphinxFancyVerbFormatLine + \VerbatimEnvironment + % workaround to fancyvrb's check of current list depth + \def\@toodeep {\advance\@listdepth\@ne}% + % The list environment is needed to control perfectly the vertical space. + % Note: \OuterFrameSep used by framed.sty is later set to \topsep hence 0pt. + % - if caption: distance from last text baseline to caption baseline is + % A+(B-F)+\ht\strutbox, A = \abovecaptionskip (default 10pt), B = + % \baselineskip, F is the framed.sty \FrameHeightAdjust macro, default 6pt. + % Formula valid for F < 10pt. + % - distance of baseline of caption to top of frame is like for tables: + % \sphinxbelowcaptionspace (=0.5\baselineskip) + % - if no caption: distance of last text baseline to code frame is S+(B-F), + % with S = \sphinxverbatimtopskip (=\smallskip) + % - and distance from bottom of frame to next text baseline is + % \baselineskip+\parskip. + % The \trivlist is used to avoid possible "too deeply nested" error. + \itemsep \z@skip + \topsep \z@skip + \partopsep \z@skip + % trivlist will set \parsep to \parskip = zero + % \leftmargin will be set to zero by trivlist + \rightmargin\z@ + \parindent \z@% becomes \itemindent. Default zero, but perhaps overwritten. + \trivlist\item\relax + \ifsphinxverbatimwithminipage\spx@inframedtrue\fi + % use a minipage if we are already inside a framed environment + \ifspx@inframed\noindent\begin{minipage}{\linewidth}\fi + \MakeFramed {% adapted over from framed.sty's snugshade environment + \advance\hsize-\width\@totalleftmargin\z@\linewidth\hsize\@setminipage + }% + % For grid placement from \strut's in \FancyVerbFormatLine + \lineskip\z@skip + % active comma should not be overwritten by \@noligs + \ifspx@opt@verbatimwrapslines + \let\verbatim@nolig@list \sphinx@verbatim@nolig@list + \fi + % will fetch its optional arguments if any + \OriginalVerbatim +} +{% + \endOriginalVerbatim + \par\unskip\@minipagefalse\endMakeFramed % from framed.sty snugshade + \ifspx@inframed\end{minipage}\fi + \endtrivlist +} +\newenvironment {sphinxVerbatimNoFrame} + {\spx@opt@verbatimwithframefalse + \VerbatimEnvironment + \begin{sphinxVerbatim}} + {\end{sphinxVerbatim}} +\newenvironment {sphinxVerbatimintable} + {% don't use a frame if in a table cell + \spx@opt@verbatimwithframefalse + \sphinxverbatimwithminipagetrue + % the literal block caption uses \sphinxcaption which is wrapper of \caption, + % but \caption must be modified because longtable redefines it to work only + % for the own table caption, and tabulary has multiple passes + \let\caption\sphinxfigcaption + % reduce above caption skip + \def\spx@abovecaptionskip{\sphinxverbatimsmallskipamount}% + \VerbatimEnvironment + \begin{sphinxVerbatim}} + {\end{sphinxVerbatim}} + + +%% PARSED LITERALS +% allow long lines to wrap like they do in code-blocks + +% this should be kept in sync with definitions in sphinx.util.texescape +\newcommand*\sphinxbreaksattexescapedchars{% + \def\do##1##2% put potential break point before character + {\def##1{\discretionary{}{\sphinxafterbreak\char`##2}{\char`##2}}}% + \do\{\{\do\textless\<\do\#\#\do\%\%\do\$\$% {, <, #, %, $ + \def\do##1##2% put potential break point after character + {\def##1{\discretionary{\char`##2}{\sphinxafterbreak}{\char`##2}}}% + \do\_\_\do\}\}\do\textasciicircum\^\do\&\&% _, }, ^, &, + \do\textgreater\>\do\textasciitilde\~% >, ~ +} +\newcommand*\sphinxbreaksviaactiveinparsedliteral{% + \sphinxbreaksviaactive % by default handles . , ; ? ! / + \do\-% we need also the hyphen character (ends up "as is" in parsed-literal) + \lccode`\~`\~ % + % update \dospecials as it is used by \url + % but deactivation will already have been done hence this is unneeded: + % \expandafter\def\expandafter\dospecials\expandafter{\dospecials + % \sphinxbreaksbeforeactivelist\sphinxbreaksafteractivelist\do\-}% +} +\newcommand*\sphinxbreaksatspaceinparsedliteral{% + \lccode`~32 \lowercase{\let~}\spx@verbatim@space\lccode`\~`\~ +} +\newcommand*{\sphinxunactivateextras}{\let\do\@makeother + \sphinxbreaksbeforeactivelist\sphinxbreaksafteractivelist\do\-}% +% the \catcode13=5\relax (deactivate end of input lines) is left to callers +\newcommand*{\sphinxunactivateextrasandspace}{\catcode32=10\relax + \sphinxunactivateextras}% +% now for the modified alltt environment +\newenvironment{sphinxalltt} +{% at start of next line to workaround Emacs/AUCTeX issue with this file +\begin{alltt}% + \ifspx@opt@parsedliteralwraps + \sbox\sphinxcontinuationbox {\spx@opt@verbatimcontinued}% + \sbox\sphinxvisiblespacebox {\spx@opt@verbatimvisiblespace}% + \sphinxbreaksattexescapedchars + \sphinxbreaksviaactiveinparsedliteral + \sphinxbreaksatspaceinparsedliteral +% alltt takes care of the ' as derivative ("prime") in math mode + \everymath\expandafter{\the\everymath\sphinxunactivateextrasandspace + \catcode`\<=12\catcode`\>=12\catcode`\^=7\catcode`\_=8 }% +% not sure if displayed math (align,...) can end up in parsed-literal, anyway + \everydisplay\expandafter{\the\everydisplay + \catcode13=5 \sphinxunactivateextrasandspace + \catcode`\<=12\catcode`\>=12\catcode`\^=7\catcode`\_=8 }% + \fi } +{\end{alltt}} + +% Protect \href's first argument in contexts such as sphinxalltt (or +% \sphinxcode). Sphinx uses \#, \%, \& ... always inside \sphinxhref. +\protected\def\sphinxhref#1#2{{% + \sphinxunactivateextrasandspace % never do \scantokens with active space! + \endlinechar\m@ne\everyeof{{#2}}% keep catcode regime for #2 + \scantokens{\href{#1}}% normalise it for #1 during \href expansion +}} +% Same for \url. And also \nolinkurl for coherence. +\protected\def\sphinxurl#1{{% + \sphinxunactivateextrasandspace\everyeof{}% (<- precaution for \scantokens) + \endlinechar\m@ne\scantokens{\url{#1}}% +}} +\protected\def\sphinxnolinkurl#1{{% + \sphinxunactivateextrasandspace\everyeof{}% + \endlinechar\m@ne\scantokens{\nolinkurl{#1}}% +}} + + +%% TOPIC AND CONTENTS BOXES +% +% Again based on use of "framed.sty", this allows breakable framed boxes. +\long\def\spx@ShadowFBox#1{% + \leavevmode\begingroup + % first we frame the box #1 + \setbox\@tempboxa + \hbox{\vrule\@width\sphinxshadowrule + \vbox{\hrule\@height\sphinxshadowrule + \kern\sphinxshadowsep + \hbox{\kern\sphinxshadowsep #1\kern\sphinxshadowsep}% + \kern\sphinxshadowsep + \hrule\@height\sphinxshadowrule}% + \vrule\@width\sphinxshadowrule}% + % Now we add the shadow, like \shadowbox from fancybox.sty would do + \dimen@\dimexpr.5\sphinxshadowrule+\sphinxshadowsize\relax + \hbox{\vbox{\offinterlineskip + \hbox{\copy\@tempboxa\kern-.5\sphinxshadowrule + % add shadow on right side + \lower\sphinxshadowsize + \hbox{\vrule\@height\ht\@tempboxa \@width\dimen@}% + }% + \kern-\dimen@ % shift back vertically to bottom of frame + % and add shadow at bottom + \moveright\sphinxshadowsize + \vbox{\hrule\@width\wd\@tempboxa \@height\dimen@}% + }% + % move left by the size of right shadow so shadow adds no width + \kern-\sphinxshadowsize + }% + \endgroup +} + +% use framed.sty to allow page breaks in frame+shadow +% works well inside Lists and Quote-like environments +% produced by ``topic'' directive (or local contents) +% could nest if LaTeX writer authorized it +\newenvironment{sphinxShadowBox} + {\def\FrameCommand {\spx@ShadowFBox }% + \advance\spx@image@maxheight + -\dimexpr2\sphinxshadowrule + +2\sphinxshadowsep + +\sphinxshadowsize + +\baselineskip\relax + % configure framed.sty not to add extra vertical spacing + \ltx@ifundefined{OuterFrameSep}{}{\OuterFrameSep\z@skip}% + % the \trivlist will add the vertical spacing on top and bottom which is + % typical of center environment as used in Sphinx <= 1.4.1 + % the \noindent has the effet of an extra blank line on top, to + % imitate closely the layout from Sphinx <= 1.4.1; the \FrameHeightAdjust + % will put top part of frame on this baseline. + \def\FrameHeightAdjust {\baselineskip}% + % use package footnote to handle footnotes + \savenotes + \trivlist\item\noindent + % use a minipage if we are already inside a framed environment + \ifspx@inframed\begin{minipage}{\linewidth}\fi + \MakeFramed {\spx@inframedtrue + % framed.sty puts into "\width" the added width (=2shadowsep+2shadowrule) + % adjust \hsize to what the contents must use + \advance\hsize-\width + % adjust LaTeX parameters to behave properly in indented/quoted contexts + \FrameRestore + % typeset the contents as in a minipage (Sphinx <= 1.4.1 used a minipage and + % itemize/enumerate are therein typeset more tightly, we want to keep + % that). We copy-paste from LaTeX source code but don't do a real minipage. + \@pboxswfalse + \let\@listdepth\@mplistdepth \@mplistdepth\z@ + \@minipagerestore + \@setminipage + }% + }% + {% insert the "endminipage" code + \par\unskip + \@minipagefalse + \endMakeFramed + \ifspx@inframed\end{minipage}\fi + \endtrivlist + % output the stored footnotes + \spewnotes + } + + +%% NOTICES AND ADMONITIONS +% +% Some are quite plain +% the spx@notice@bordercolor etc are set in the sphinxadmonition environment +\newenvironment{sphinxlightbox}{% + \par + \noindent{\color{spx@notice@bordercolor}% + \rule{\linewidth}{\spx@notice@border}}\par\nobreak + {\parskip\z@skip\noindent}% + } + {% + % counteract previous possible negative skip (French lists!): + % (we can't cancel that any earlier \vskip introduced a potential pagebreak) + \sphinxvspacefixafterfrenchlists + \nobreak\vbox{\noindent\kern\@totalleftmargin + {\color{spx@notice@bordercolor}% + \rule[\dimexpr.4\baselineskip-\spx@notice@border\relax] + {\linewidth}{\spx@notice@border}}\hss}\allowbreak + }% end of sphinxlightbox environment definition +% may be renewenvironment'd by user for complete customization +\newenvironment{sphinxnote}[1] + {\begin{sphinxlightbox}\sphinxstrong{#1} }{\end{sphinxlightbox}} +\newenvironment{sphinxhint}[1] + {\begin{sphinxlightbox}\sphinxstrong{#1} }{\end{sphinxlightbox}} +\newenvironment{sphinximportant}[1] + {\begin{sphinxlightbox}\sphinxstrong{#1} }{\end{sphinxlightbox}} +\newenvironment{sphinxtip}[1] + {\begin{sphinxlightbox}\sphinxstrong{#1} }{\end{sphinxlightbox}} +% or just use the package options +% these are needed for common handling by notice environment of lightbox +% and heavybox but they are currently not used by lightbox environment +% and there is consequently no corresponding package option +\definecolor{sphinxnoteBgColor}{rgb}{1,1,1} +\definecolor{sphinxhintBgColor}{rgb}{1,1,1} +\definecolor{sphinximportantBgColor}{rgb}{1,1,1} +\definecolor{sphinxtipBgColor}{rgb}{1,1,1} + +% Others get more distinction +% Code adapted from framed.sty's "snugshade" environment. +% Nesting works (inner frames do not allow page breaks). +\newenvironment{sphinxheavybox}{\par + \setlength{\FrameRule}{\spx@notice@border}% + \setlength{\FrameSep}{\dimexpr.6\baselineskip-\FrameRule\relax} + \advance\spx@image@maxheight + -\dimexpr2\FrameRule + +2\FrameSep + +\baselineskip\relax % will happen again if nested, needed indeed! + % configure framed.sty's parameters to obtain same vertical spacing + % as for "light" boxes. We need for this to manually insert parskip glue and + % revert a skip done by framed before the frame. + \ltx@ifundefined{OuterFrameSep}{}{\OuterFrameSep\z@skip}% + \vspace{\FrameHeightAdjust} + % copied/adapted from framed.sty's snugshade + \def\FrameCommand##1{\hskip\@totalleftmargin + \fboxsep\FrameSep \fboxrule\FrameRule + \fcolorbox{spx@notice@bordercolor}{spx@notice@bgcolor}{##1}% + \hskip-\linewidth \hskip-\@totalleftmargin \hskip\columnwidth}% + \savenotes + % use a minipage if we are already inside a framed environment + \ifspx@inframed + \noindent\begin{minipage}{\linewidth} + \else + % handle case where notice is first thing in a list item (or is quoted) + \if@inlabel + \noindent\par\vspace{-\baselineskip} + \else + \vspace{\parskip} + \fi + \fi + \MakeFramed {\spx@inframedtrue + \advance\hsize-\width \@totalleftmargin\z@ \linewidth\hsize + % minipage initialization copied from LaTeX source code. + \@pboxswfalse + \let\@listdepth\@mplistdepth \@mplistdepth\z@ + \@minipagerestore + \@setminipage }% + } + {% + \par\unskip + \@minipagefalse + \endMakeFramed + \ifspx@inframed\end{minipage}\fi + % set footnotes at bottom of page + \spewnotes + % arrange for similar spacing below frame as for "light" boxes. + \vskip .4\baselineskip + }% end of sphinxheavybox environment definition +% may be renewenvironment'd by user for complete customization +\newenvironment{sphinxwarning}[1] + {\begin{sphinxheavybox}\sphinxstrong{#1} }{\end{sphinxheavybox}} +\newenvironment{sphinxcaution}[1] + {\begin{sphinxheavybox}\sphinxstrong{#1} }{\end{sphinxheavybox}} +\newenvironment{sphinxattention}[1] + {\begin{sphinxheavybox}\sphinxstrong{#1} }{\end{sphinxheavybox}} +\newenvironment{sphinxdanger}[1] + {\begin{sphinxheavybox}\sphinxstrong{#1} }{\end{sphinxheavybox}} +\newenvironment{sphinxerror}[1] + {\begin{sphinxheavybox}\sphinxstrong{#1} }{\end{sphinxheavybox}} +% or just use package options + +% the \colorlet of xcolor (if at all loaded) is overkill for our use case +\newcommand{\sphinxcolorlet}[2] + {\expandafter\let\csname\@backslashchar color@#1\expandafter\endcsname + \csname\@backslashchar color@#2\endcsname } + +% the main dispatch for all types of notices +\newenvironment{sphinxadmonition}[2]{% #1=type, #2=heading + % can't use #1 directly in definition of end part + \def\spx@noticetype {#1}% + % set parameters of heavybox/lightbox + \sphinxcolorlet{spx@notice@bordercolor}{sphinx#1BorderColor}% + \sphinxcolorlet{spx@notice@bgcolor}{sphinx#1BgColor}% + \spx@notice@border \dimexpr\csname spx@opt@#1border\endcsname\relax + % start specific environment, passing the heading as argument + \begin{sphinx#1}{#2}} + % workaround some LaTeX "feature" of \end command + {\edef\spx@temp{\noexpand\end{sphinx\spx@noticetype}}\spx@temp} + + +%% PYTHON DOCS MACROS AND ENVIRONMENTS +% (some macros here used by \maketitle in sphinxmanual.cls and sphinxhowto.cls) + +% \moduleauthor{name}{email} +\newcommand{\moduleauthor}[2]{} + +% \sectionauthor{name}{email} +\newcommand{\sectionauthor}[2]{} + +% Allow the release number to be specified independently of the +% \date{}. This allows the date to reflect the document's date and +% release to specify the release that is documented. +% +\newcommand{\py@release}{\releasename\space\version} +\newcommand{\version}{}% part of \py@release, used by title page and headers +% \releaseinfo is used on titlepage (sphinxmanual.cls, sphinxhowto.cls) +\newcommand{\releaseinfo}{} +\newcommand{\setreleaseinfo}[1]{\renewcommand{\releaseinfo}{#1}} +% this is inserted via template and #1=release config variable +\newcommand{\release}[1]{\renewcommand{\version}{#1}} +% this is defined by template to 'releasename' latex_elements key +\newcommand{\releasename}{} +% Fix issue in case release and releasename deliberately left blank +\newcommand{\sphinxheadercomma}{, }% used in fancyhdr header definition +\newcommand{\sphinxifemptyorblank}[1]{% +% test after one expansion of macro #1 if contents is empty or spaces + \if&\expandafter\@firstofone\detokenize\expandafter{#1}&% + \expandafter\@firstoftwo\else\expandafter\@secondoftwo\fi}% +\AtBeginDocument {% + \sphinxifemptyorblank{\releasename} + {\sphinxifemptyorblank{\version}{\let\sphinxheadercomma\empty}{}} + {}% +}% + +% Allow specification of the author's address separately from the +% author's name. This can be used to format them differently, which +% is a good thing. +% +\newcommand{\py@authoraddress}{} +\newcommand{\authoraddress}[1]{\renewcommand{\py@authoraddress}{#1}} + +% {fulllineitems} is the main environment for object descriptions. +% +\newcommand{\py@itemnewline}[1]{% + \kern\labelsep + \@tempdima\linewidth + \advance\@tempdima \labelwidth\makebox[\@tempdima][l]{#1}% + \kern-\labelsep +} + +\newenvironment{fulllineitems}{% + \begin{list}{}{\labelwidth \leftmargin + \rightmargin \z@ \topsep -\parskip \partopsep \parskip + \itemsep -\parsep + \let\makelabel=\py@itemnewline}% +}{\end{list}} + +% Signatures, possibly multi-line +% +\newlength{\py@argswidth} +\newcommand{\py@sigparams}[2]{% + \parbox[t]{\py@argswidth}{#1\sphinxcode{)}#2}} +\newcommand{\pysigline}[1]{\item[{#1}]} +\newcommand{\pysiglinewithargsret}[3]{% + \settowidth{\py@argswidth}{#1\sphinxcode{(}}% + \addtolength{\py@argswidth}{-2\py@argswidth}% + \addtolength{\py@argswidth}{\linewidth}% + \item[{#1\sphinxcode{(}\py@sigparams{#2}{#3}}]} +\newcommand{\pysigstartmultiline}{% + \def\pysigstartmultiline{\vskip\smallskipamount\parskip\z@skip\itemsep\z@skip}% + \edef\pysigstopmultiline + {\noexpand\leavevmode\parskip\the\parskip\relax\itemsep\the\itemsep\relax}% + \parskip\z@skip\itemsep\z@skip +} + +% Production lists +% +\newenvironment{productionlist}{% +% \def\sphinxoptional##1{{\Large[}##1{\Large]}} + \def\production##1##2{\\\sphinxcode{\sphinxupquote{##1}}&::=&\sphinxcode{\sphinxupquote{##2}}}% + \def\productioncont##1{\\& &\sphinxcode{\sphinxupquote{##1}}}% + \parindent=2em + \indent + \setlength{\LTpre}{0pt}% + \setlength{\LTpost}{0pt}% + \begin{longtable}[l]{lcl} +}{% + \end{longtable} +} + +% Definition lists; requested by AMK for HOWTO documents. Probably useful +% elsewhere as well, so keep in in the general style support. +% +\newenvironment{definitions}{% + \begin{description}% + \def\term##1{\item[{##1}]\mbox{}\\*[0mm]}% +}{% + \end{description}% +} + +%% FROM DOCTUTILS LATEX WRITER +% +% The following is stuff copied from docutils' latex writer. +% +\newcommand{\optionlistlabel}[1]{\normalfont\bfseries #1 \hfill}% \bf deprecated +\newenvironment{optionlist}[1] +{\begin{list}{} + {\setlength{\labelwidth}{#1} + \setlength{\rightmargin}{1cm} + \setlength{\leftmargin}{\rightmargin} + \addtolength{\leftmargin}{\labelwidth} + \addtolength{\leftmargin}{\labelsep} + \renewcommand{\makelabel}{\optionlistlabel}} +}{\end{list}} + +\newlength{\lineblockindentation} +\setlength{\lineblockindentation}{2.5em} +\newenvironment{lineblock}[1] +{\begin{list}{} + {\setlength{\partopsep}{\parskip} + \addtolength{\partopsep}{\baselineskip} + \topsep0pt\itemsep0.15\baselineskip\parsep0pt + \leftmargin#1\relax} + \raggedright} +{\end{list}} + +% From docutils.writers.latex2e +% inline markup (custom roles) +% \DUrole{#1}{#2} tries \DUrole#1{#2} +\providecommand*{\DUrole}[2]{% + \ifcsname DUrole\detokenize{#1}\endcsname + \csname DUrole\detokenize{#1}\endcsname{#2}% + \else% backwards compatibility: try \docutilsrole#1{#2} + \ifcsname docutilsrole\detokenize{#1}\endcsname + \csname docutilsrole\detokenize{#1}\endcsname{#2}% + \else + #2% + \fi + \fi +} + +\providecommand*{\DUprovidelength}[2]{% + \ifdefined#1\else\newlength{#1}\setlength{#1}{#2}\fi +} + +\DUprovidelength{\DUlineblockindent}{2.5em} +\ifdefined\DUlineblock\else + \newenvironment{DUlineblock}[1]{% + \list{}{\setlength{\partopsep}{\parskip} + \addtolength{\partopsep}{\baselineskip} + \setlength{\topsep}{0pt} + \setlength{\itemsep}{0.15\baselineskip} + \setlength{\parsep}{0pt} + \setlength{\leftmargin}{#1}} + \raggedright + } + {\endlist} +\fi + +%% TEXT STYLING +% +% to obtain straight quotes we execute \@noligs as patched by upquote, and +% \scantokens is needed in cases where it would be too late for the macro to +% first set catcodes and then fetch its argument. We also make the contents +% breakable at non-escaped . , ; ? ! / using \sphinxbreaksviaactive. +% the macro must be protected if it ends up used in moving arguments, +% in 'alltt' \@noligs is done already, and the \scantokens must be avoided. +\protected\def\sphinxupquote#1{{\def\@tempa{alltt}% + \ifx\@tempa\@currenvir\else + \ifspx@opt@inlineliteralwraps + \sphinxbreaksviaactive\let\sphinxafterbreak\empty + % do not overwrite the comma set-up + \let\verbatim@nolig@list\sphinx@literal@nolig@list + \fi + % fix a space-gobbling issue due to LaTeX's original \do@noligs + \let\do@noligs\sphinx@do@noligs + \@noligs\endlinechar\m@ne\everyeof{}% (<- in case inside \sphinxhref) + \expandafter\scantokens + \fi {{#1}}}}% extra brace pair to fix end-space gobbling issue... +\def\sphinx@do@noligs #1{\catcode`#1\active\begingroup\lccode`\~`#1\relax + \lowercase{\endgroup\def~{\leavevmode\kern\z@\char`#1 }}} +\def\sphinx@literal@nolig@list {\do\`\do\<\do\>\do\'\do\-}% + +% Some custom font markup commands. +\protected\def\sphinxstrong#1{\textbf{#1}} +\protected\def\sphinxcode#1{\texttt{#1}} +\protected\def\sphinxbfcode#1{\textbf{\sphinxcode{#1}}} +\protected\def\sphinxemail#1{\textsf{#1}} +\protected\def\sphinxtablecontinued#1{\textsf{#1}} +\protected\def\sphinxtitleref#1{\emph{#1}} +\protected\def\sphinxmenuselection#1{\emph{#1}} +\protected\def\sphinxguilabel#1{\emph{#1}} +\protected\def\sphinxaccelerator#1{\underline{#1}} +\protected\def\sphinxcrossref#1{\emph{#1}} +\protected\def\sphinxtermref#1{\emph{#1}} +% \optional is used for ``[, arg]``, i.e. desc_optional nodes. +\long\protected\def\sphinxoptional#1{% + {\textnormal{\Large[}}{#1}\hspace{0.5mm}{\textnormal{\Large]}}} + +% additional customizable styling +\def\sphinxstyleindexentry #1{\texttt{#1}} +\def\sphinxstyleindexextra #1{ (\emph{#1})} +\def\sphinxstyleindexpageref #1{, \pageref{#1}} +\def\sphinxstyleindexpagemain#1{\textbf{#1}} +\protected\def\spxentry#1{#1}% will get \let to \sphinxstyleindexentry in index +\protected\def\spxextra#1{#1}% will get \let to \sphinxstyleindexextra in index +\def\sphinxstyleindexlettergroup #1% + {{\Large\sffamily#1}\nopagebreak\vspace{1mm}} +\def\sphinxstyleindexlettergroupDefault #1% + {{\Large\sffamily\sphinxnonalphabeticalgroupname}\nopagebreak\vspace{1mm}} +\protected\def\sphinxstyletopictitle #1{\textbf{#1}\par\medskip} +\let\sphinxstylesidebartitle\sphinxstyletopictitle +\protected\def\sphinxstyleothertitle #1{\textbf{#1}} +\protected\def\sphinxstylesidebarsubtitle #1{~\\\textbf{#1} \smallskip} +% \text.. commands do not allow multiple paragraphs +\protected\def\sphinxstyletheadfamily {\sffamily} +\protected\def\sphinxstyleemphasis #1{\emph{#1}} +\protected\def\sphinxstyleliteralemphasis#1{\emph{\sphinxcode{#1}}} +\protected\def\sphinxstylestrong #1{\textbf{#1}} +\protected\def\sphinxstyleliteralstrong#1{\sphinxbfcode{#1}} +\protected\def\sphinxstyleabbreviation #1{\textsc{#1}} +\protected\def\sphinxstyleliteralintitle#1{\sphinxcode{#1}} +\newcommand*\sphinxstylecodecontinued[1]{\footnotesize(#1)}% +\newcommand*\sphinxstylecodecontinues[1]{\footnotesize(#1)}% +% figure legend comes after caption and may contain arbitrary body elements +\newenvironment{sphinxlegend}{\par\small}{\par} +% reduce hyperref "Token not allowed in a PDF string" warnings on PDF builds +\AtBeginDocument{\pdfstringdefDisableCommands{% +% all "protected" macros possibly ending up in section titles should be here + \let\sphinxstyleemphasis \@firstofone + \let\sphinxstyleliteralemphasis \@firstofone + \let\sphinxstylestrong \@firstofone + \let\sphinxstyleliteralstrong \@firstofone + \let\sphinxstyleabbreviation \@firstofone + \let\sphinxstyleliteralintitle \@firstofone + \let\sphinxupquote \@firstofone + \let\sphinxstrong \@firstofone + \let\sphinxcode \@firstofone + \let\sphinxbfcode \@firstofone + \let\sphinxemail \@firstofone + \let\sphinxcrossref \@firstofone + \let\sphinxtermref \@firstofone +}} + +% For curly braces inside \index macro +\def\sphinxleftcurlybrace{\{} +\def\sphinxrightcurlybrace{\}} + +% Declare Unicode characters used by linux tree command to pdflatex utf8/utf8x +\def\spx@bd#1#2{% + \leavevmode + \begingroup + \ifx\spx@bd@height \@undefined\def\spx@bd@height{\baselineskip}\fi + \ifx\spx@bd@width \@undefined\setbox0\hbox{0}\def\spx@bd@width{\wd0 }\fi + \ifx\spx@bd@thickness\@undefined\def\spx@bd@thickness{.6\p@}\fi + \ifx\spx@bd@lower \@undefined\def\spx@bd@lower{\dp\strutbox}\fi + \lower\spx@bd@lower#1{#2}% + \endgroup +}% +\@namedef{sphinx@u2500}% BOX DRAWINGS LIGHT HORIZONTAL + {\spx@bd{\vbox to\spx@bd@height} + {\vss\hrule\@height\spx@bd@thickness + \@width\spx@bd@width\vss}}% +\@namedef{sphinx@u2502}% BOX DRAWINGS LIGHT VERTICAL + {\spx@bd{\hb@xt@\spx@bd@width} + {\hss\vrule\@height\spx@bd@height + \@width \spx@bd@thickness\hss}}% +\@namedef{sphinx@u2514}% BOX DRAWINGS LIGHT UP AND RIGHT + {\spx@bd{\hb@xt@\spx@bd@width} + {\hss\raise.5\spx@bd@height + \hb@xt@\z@{\hss\vrule\@height.5\spx@bd@height + \@width \spx@bd@thickness\hss}% + \vbox to\spx@bd@height{\vss\hrule\@height\spx@bd@thickness + \@width.5\spx@bd@width\vss}}}% +\@namedef{sphinx@u251C}% BOX DRAWINGS LIGHT VERTICAL AND RIGHT + {\spx@bd{\hb@xt@\spx@bd@width} + {\hss + \hb@xt@\z@{\hss\vrule\@height\spx@bd@height + \@width \spx@bd@thickness\hss}% + \vbox to\spx@bd@height{\vss\hrule\@height\spx@bd@thickness + \@width.5\spx@bd@width\vss}}}% +\protected\def\sphinxunichar#1{\@nameuse{sphinx@u#1}}% + +% Tell TeX about pathological hyphenation cases: +\hyphenation{Base-HTTP-Re-quest-Hand-ler} +\endinput diff --git a/docs/build/latex/sphinx.xdy b/docs/build/latex/sphinx.xdy new file mode 100644 index 0000000000000000000000000000000000000000..1c0794cd91da9602c172c3107a530c3cb8b1ed12 --- /dev/null +++ b/docs/build/latex/sphinx.xdy @@ -0,0 +1,228 @@ +;;; -*- mode: lisp; coding: utf-8; -*- + +;; Unfortunately xindy is out-of-the-box hyperref-incompatible. This +;; configuration is a workaround, which requires to pass option +;; hyperindex=false to hyperref. +;; textit and emph not currently used, spxpagem replaces former textbf +(define-attributes (("textbf" "textit" "emph" "spxpagem" "default"))) +(markup-locref :open "\textbf{\hyperpage{" :close "}}" :attr "textbf") +(markup-locref :open "\textit{\hyperpage{" :close "}}" :attr "textit") +(markup-locref :open "\emph{\hyperpage{" :close "}}" :attr "emph") +(markup-locref :open "\spxpagem{\hyperpage{" :close "}}" :attr "spxpagem") +(markup-locref :open "\hyperpage{" :close "}" :attr "default") + +(require "numeric-sort.xdy") + +;; xindy base module latex.xdy loads tex.xdy and the latter instructs +;; xindy to ignore **all** TeX macros in .idx entries, except those +;; explicitely described in merge rule. But when after applying all +;; merge rules an empty string results, xindy raises an error: + +;; ERROR: CHAR: index 0 should be less than the length of the string + +;; For example when using pdflatex with utf-8 characters the index +;; file will contain \IeC macros and they will get ignored except if +;; suitable merge rules are loaded early. The texindy script coming +;; with xindy provides this, but only for Latin scripts. The texindy +;; man page says to use rather xelatex or lualatex in case of Cyrillic +;; scripts. + +;; Sphinx contributes LICRcyr2utf8.xdy to provide support for Cyrillic +;; scripts for the pdflatex engine. + +;; Another issue caused by xindy ignoring all TeX macros except those +;; explicitely declared reveals itself when attempting to index ">>>", +;; as the ">" is converted to "\textgreater{}" by Sphinx's LaTeX +;; escaping. + +;; To fix this, Sphinx does **not** use texindy, and does not even +;; load the xindy latex.xdy base module. + +;(require "latex.xdy") + +;; Rather it incorporates some suitable extracts from latex.xdy and +;; tex.xdy with additional Sphinx contributed rules. + +;; But, this means for pdflatex and Latin scripts that the xindy file +;; tex/inputenc/uf8.xdy is not usable because it refers to the macro +;; \IeC only sporadically, and as tex.xdy is not loaded, a rule such as +;; (merge-rule "\'e" "é" :string) +;; does not work, it must be +;; (merge-rule "\IeC {\'e}" "é" :string) +;; So Sphinx contributes LICRlatin2utf8.xdy to mitigate that problem. + +;;;;;;;; extracts from tex.xdy (discarding most original comments): + +;;; +;;; TeX conventions +;;; + +;; Discard leading and trailing white space. Collapse multiple white +;; space characters to blank. + +(merge-rule "^ +" "" :eregexp) +(merge-rule " +$" "" :eregexp) +(merge-rule " +" " " :eregexp) + +;; Handle TeX markup + +(merge-rule "\\([{}$%&#])" "\1" :eregexp) + +;;;;;;;; end of extracts from xindy's tex.xdy + +;;;;;;;; extracts from latex.xdy: + +;; Standard location classes: arabic and roman numbers, and alphabets. + +(define-location-class "arabic-page-numbers" ("arabic-numbers")) +(define-location-class "roman-page-numbers" ("roman-numbers-lowercase")) +(define-location-class "Roman-page-numbers" ("roman-numbers-uppercase")) +(define-location-class "alpha-page-numbers" ("alpha")) +(define-location-class "Alpha-page-numbers" ("ALPHA")) + +;; Output Markup + +(markup-letter-group-list :sep "~n~n \indexspace~n") + +(markup-indexentry :open "~n \item " :depth 0) +(markup-indexentry :open "~n \subitem " :depth 1) +(markup-indexentry :open "~n \subsubitem " :depth 2) + +(markup-locclass-list :open ", " :sep ", ") +(markup-locref-list :sep ", ") + +;;;;;;;; end of extracts from latex.xdy + +;; The LaTeX \index command turns \ into normal character so the TeX macros +;; written to .idx files are not followed by a blank. This is different +;; from non-ascii letters which end up (with pdflatex) as \IeC macros in .idx +;; file, with a blank space after \IeC + +;; Details of the syntax are explained at +;; http://xindy.sourceforge.net/doc/manual-3.html +;; In absence of :string, "xindy uses an auto-detection mechanism to decide, +;; if the pattern is a regular expression or not". But it is not obvious to +;; guess, for example "\\_" is not detected as RE but "\\P\{\}" is, so for +;; being sure we apply the :string switch everywhere and do not use \\ etc... + +;; Go back from sphinx.util.texescape TeX macros to UTF-8 + +(merge-rule "\sphinxleftcurlybrace{}" "{" :string) +(merge-rule "\sphinxrightcurlybrace{}" "}" :string) +(merge-rule "\_" "_" :string) +(merge-rule "{[}" "[" :string) +(merge-rule "{]}" "]" :string) +(merge-rule "{}`" "`" :string) +(merge-rule "\textbackslash{}" "\" :string) ; " for Emacs syntax highlighting +(merge-rule "\textasciitilde{}" "~~" :string); the ~~ escape is needed here +(merge-rule "\textless{}" "<" :string) +(merge-rule "\textgreater{}" ">" :string) +(merge-rule "\textasciicircum{}" "^" :string) +(merge-rule "\P{}" "¶" :string) +(merge-rule "\S{}" "§" :string) +(merge-rule "\texteuro{}" "€" :string) +(merge-rule "\(\infty\)" "∞" :string) +(merge-rule "\(\pm\)" "±" :string) +(merge-rule "\(\rightarrow\)" "→" :string) +(merge-rule "\(\checkmark\)" "✓" :string) +(merge-rule "\textendash{}" "–" :string) +(merge-rule "\textbar{}" "|" :string) +(merge-rule "\(\sp{\text{0}}\)" "â°" :string) +(merge-rule "\(\sp{\text{1}}\)" "¹" :string) +(merge-rule "\(\sp{\text{2}}\)" "²" :string) +(merge-rule "\(\sp{\text{3}}\)" "³" :string) +(merge-rule "\(\sp{\text{4}}\)" "â´" :string) +(merge-rule "\(\sp{\text{5}}\)" "âµ" :string) +(merge-rule "\(\sp{\text{6}}\)" "â¶" :string) +(merge-rule "\(\sp{\text{7}}\)" "â·" :string) +(merge-rule "\(\sp{\text{8}}\)" "â¸" :string) +(merge-rule "\(\sp{\text{9}}\)" "â¹" :string) +(merge-rule "\(\sb{\text{0}}\)" "â‚€" :string) +(merge-rule "\(\sb{\text{1}}\)" "â‚" :string) +(merge-rule "\(\sb{\text{2}}\)" "â‚‚" :string) +(merge-rule "\(\sb{\text{3}}\)" "₃" :string) +(merge-rule "\(\sb{\text{4}}\)" "â‚„" :string) +(merge-rule "\(\sb{\text{5}}\)" "â‚…" :string) +(merge-rule "\(\sb{\text{6}}\)" "₆" :string) +(merge-rule "\(\sb{\text{7}}\)" "₇" :string) +(merge-rule "\(\sb{\text{8}}\)" "₈" :string) +(merge-rule "\(\sb{\text{9}}\)" "₉" :string) +(merge-rule "\IeC {\textalpha }" "α" :string) +(merge-rule "\IeC {\textbeta }" "β" :string) +(merge-rule "\IeC {\textgamma }" "γ" :string) +(merge-rule "\IeC {\textdelta }" "δ" :string) +(merge-rule "\IeC {\textepsilon }" "ε" :string) +(merge-rule "\IeC {\textzeta }" "ζ" :string) +(merge-rule "\IeC {\texteta }" "η" :string) +(merge-rule "\IeC {\texttheta }" "θ" :string) +(merge-rule "\IeC {\textiota }" "ι" :string) +(merge-rule "\IeC {\textkappa }" "κ" :string) +(merge-rule "\IeC {\textlambda }" "λ" :string) +(merge-rule "\IeC {\textmu }" "μ" :string) +(merge-rule "\IeC {\textnu }" "ν" :string) +(merge-rule "\IeC {\textxi }" "ξ" :string) +(merge-rule "\IeC {\textomicron }" "ο" :string) +(merge-rule "\IeC {\textpi }" "Ï€" :string) +(merge-rule "\IeC {\textrho }" "Ï" :string) +(merge-rule "\IeC {\textsigma }" "σ" :string) +(merge-rule "\IeC {\texttau }" "Ï„" :string) +(merge-rule "\IeC {\textupsilon }" "Ï…" :string) +(merge-rule "\IeC {\textphi }" "φ" :string) +(merge-rule "\IeC {\textchi }" "χ" :string) +(merge-rule "\IeC {\textpsi }" "ψ" :string) +(merge-rule "\IeC {\textomega }" "ω" :string) +(merge-rule "\IeC {\textAlpha }" "Α" :string) +(merge-rule "\IeC {\textBeta }" "Î’" :string) +(merge-rule "\IeC {\textGamma }" "Γ" :string) +(merge-rule "\IeC {\textDelta }" "Δ" :string) +(merge-rule "\IeC {\textEpsilon }" "Ε" :string) +(merge-rule "\IeC {\textZeta }" "Ζ" :string) +(merge-rule "\IeC {\textEta }" "Η" :string) +(merge-rule "\IeC {\textTheta }" "Θ" :string) +(merge-rule "\IeC {\textIota }" "Ι" :string) +(merge-rule "\IeC {\textKappa }" "Κ" :string) +(merge-rule "\IeC {\textLambda }" "Λ" :string) +(merge-rule "\IeC {\textMu }" "Îœ" :string) +(merge-rule "\IeC {\textNu }" "Î" :string) +(merge-rule "\IeC {\textTheta }" "Θ" :string) +(merge-rule "\IeC {\textIota }" "Ι" :string) +(merge-rule "\IeC {\textKappa }" "Κ" :string) +(merge-rule "\IeC {\textLambda }" "Λ" :string) +(merge-rule "\IeC {\textMu }" "Îœ" :string) +(merge-rule "\IeC {\textNu }" "Î" :string) +(merge-rule "\IeC {\textXi }" "Ξ" :string) +(merge-rule "\IeC {\textOmicron }" "Ο" :string) +(merge-rule "\IeC {\textPi }" "Î " :string) +(merge-rule "\IeC {\textRho }" "Ρ" :string) +(merge-rule "\IeC {\textSigma }" "Σ" :string) +(merge-rule "\IeC {\textTau }" "Τ" :string) +(merge-rule "\IeC {\textUpsilon }" "Î¥" :string) +(merge-rule "\IeC {\textPhi }" "Φ" :string) +(merge-rule "\IeC {\textChi }" "Χ" :string) +(merge-rule "\IeC {\textPsi }" "Ψ" :string) +(merge-rule "\IeC {\textOmega }" "Ω" :string) +(merge-rule "\IeC {\textohm }" "Ω" :string) + +;; This xindy module provides some basic support for "see" +(require "makeindex.xdy") + +;; This creates one-letter headings and works fine with utf-8 letters. +;; For Cyrillic with pdflatex works thanks to LICRcyr2utf8.xdy +(require "latin-lettergroups.xdy") + +;; currently we don't (know how to easily) separate "Numbers" from +;; "Symbols" with xindy as is the case with makeindex. +(markup-index :open "\begin{sphinxtheindex} +\let\lettergroup\sphinxstyleindexlettergroup +\let\lettergroupDefault\sphinxstyleindexlettergroupDefault +\let\spxpagem\sphinxstyleindexpagemain +\let\spxentry\sphinxstyleindexentry +\let\spxextra\sphinxstyleindexextra + +" + :close " + +\end{sphinxtheindex} +" + :tree) + diff --git a/docs/build/latex/sphinxcyrillic.sty b/docs/build/latex/sphinxcyrillic.sty new file mode 100644 index 0000000000000000000000000000000000000000..1a14c7b24cbd2fe6e586849d2932d108e7c68e35 --- /dev/null +++ b/docs/build/latex/sphinxcyrillic.sty @@ -0,0 +1,53 @@ +%% CYRILLIC IN NON-CYRILLIC DOCUMENTS (pdflatex only) +% +% refs: https://tex.stackexchange.com/q/460271/ +\ProvidesPackage{sphinxcyrillic}% + [2018/11/21 v2.0 support for Cyrillic in non-Cyrillic documents] +\RequirePackage{kvoptions} +\SetupKeyvalOptions{prefix=spx@cyropt@} % use \spx@cyropt@ prefix +\DeclareBoolOption[false]{Xtwo} +\DeclareBoolOption[false]{TtwoA} +\DeclareDefaultOption{\@unknownoptionerror} +\ProcessLocalKeyvalOptions* % ignore class options + +\ifspx@cyropt@Xtwo +% original code by tex.sx user egreg: +% https://tex.stackexchange.com/a/460325/ +% 159 Cyrillic glyphs as available in X2 TeX 8bit font encoding +% This assumes inputenc loaded with utf8 option, or LaTeX release +% as recent as 2018/04/01 which does it automatically. + \@tfor\next:=% + {Ð}{Ђ}{Є}{Ð…}{І}{Ј}{Љ}{Њ}{Ћ}{ÐŽ}{Ð}{Ð}{Б}{Ð’}{Г}{Д}{Е}{Ж}{З}{И}{Й}% + {К}{Л}{Ðœ}{Ð}{О}{П}{Ð }{С}{Т}{У}{Ф}{Ð¥}{Ц}{Ч}{Ш}{Щ}{Ъ}{Ы}{Ь}{Ð}{Ю}% + {Я}{а}{б}{в}{г}{д}{е}{ж}{з}{и}{й}{к}{л}{м}{н}{о}{п}{Ñ€}{Ñ}{Ñ‚}{у}% + {Ñ„}{Ñ…}{ц}{ч}{ш}{щ}{ÑŠ}{Ñ‹}{ÑŒ}{Ñ}{ÑŽ}{Ñ}{Ñ‘}{Ñ’}{Ñ”}{Ñ•}{Ñ–}{ј}{Ñ™}{Ñš}{Ñ›}% + {Ñž}{ÑŸ}{Ñ¢}{Ñ£}{Ѫ}{Ñ«}{Ñ´}{ѵ}{Ò}{Ò‘}{Ò’}{Ò“}{Ò”}{Ò•}{Ò–}{Ò—}{Ò˜}{Ò™}{Òš}{Ò›}{Òœ}{Ò}% + {Òž}{ÒŸ}{Ò }{Ò¡}{Ò¢}{Ò£}{Ò¤}{Ò¥}{Ò¦}{Ò§}{Ò¨}{Ò©}{Òª}{Ò«}{Ò¬}{Ò}{Ò®}{Ò¯}{Ò°}{Ò±}{Ò²}{Ò³}% + {Ò´}{Òµ}{Ò¶}{Ò·}{Ò¸}{Ò¹}{Òº}{Ò»}{Ò¼}{Ò½}{Ò¾}{Ò¿}{Ó€}{Óƒ}{Ó„}{Ó…}{Ó†}{Ó‡}{Óˆ}{Ó‹}{ÓŒ}% + {Ó}{ÓŽ}{Ó”}{Ó•}{Ó˜}{Ó™}{Ó }{Ó¡}{Ó¨}{Ó©}\do + {% + \begingroup\def\IeC{\protect\DeclareTextSymbolDefault}% + \protected@edef\@temp{\endgroup\next{X2}}\@temp + }% +\else +\ifspx@cyropt@TtwoA +% original code by tex.sx user jfbu: +% https://tex.stackexchange.com/a/460305/ +% 63*2+1=127 Cyrillic glyphs as found in T2A 8bit TeX font-encoding + \@tfor\@tempa:=% + {ae}{a}{b}{chrdsc}{chvcrs}{ch}{c}{dje}{dze}{dzhe}{d}{erev}{ery}{e}% + {f}{ghcrs}{gup}{g}{hdsc}{hrdsn}{h}{ie}{ii}{ishrt}{i}{je}% + {kbeak}{kdsc}{kvcrs}{k}{lje}{l}{m}{ndsc}{ng}{nje}{n}{otld}{o}{p}{r}% + {schwa}{sdsc}{sftsn}{shch}{shha}{sh}{s}{tshe}{t}{ushrt}{u}{v}% + {ya}{yhcrs}{yi}{yo}{yu}{y}{zdsc}{zhdsc}{zh}{z}\do + {% + \expandafter\DeclareTextSymbolDefault\expandafter + {\csname cyr\@tempa\endcsname}{T2A}% + \expandafter\uppercase\expandafter{\expandafter + \def\expandafter\@tempa\expandafter{\@tempa}}% + \expandafter\DeclareTextSymbolDefault\expandafter + {\csname CYR\@tempa\endcsname}{T2A}% + }% + \DeclareTextSymbolDefault{\CYRpalochka}{T2A}% +\fi\fi +\endinput diff --git a/docs/build/latex/sphinxhighlight.sty b/docs/build/latex/sphinxhighlight.sty new file mode 100644 index 0000000000000000000000000000000000000000..1557ce6e32d943a825cc18fa11a32e3ec2f7cc26 --- /dev/null +++ b/docs/build/latex/sphinxhighlight.sty @@ -0,0 +1,105 @@ +\NeedsTeXFormat{LaTeX2e}[1995/12/01] +\ProvidesPackage{sphinxhighlight}[2016/05/29 stylesheet for highlighting with pygments] + + +\makeatletter +\def\PYG@reset{\let\PYG@it=\relax \let\PYG@bf=\relax% + \let\PYG@ul=\relax \let\PYG@tc=\relax% + \let\PYG@bc=\relax \let\PYG@ff=\relax} +\def\PYG@tok#1{\csname PYG@tok@#1\endcsname} +\def\PYG@toks#1+{\ifx\relax#1\empty\else% + \PYG@tok{#1}\expandafter\PYG@toks\fi} +\def\PYG@do#1{\PYG@bc{\PYG@tc{\PYG@ul{% + \PYG@it{\PYG@bf{\PYG@ff{#1}}}}}}} +\def\PYG#1#2{\PYG@reset\PYG@toks#1+\relax+\PYG@do{#2}} + +\expandafter\def\csname PYG@tok@w\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.73,0.73,0.73}{##1}}} +\expandafter\def\csname PYG@tok@c\endcsname{\let\PYG@it=\textit\def\PYG@tc##1{\textcolor[rgb]{0.25,0.50,0.56}{##1}}} +\expandafter\def\csname PYG@tok@cp\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@cs\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.50,0.56}{##1}}\def\PYG@bc##1{\setlength{\fboxsep}{0pt}\colorbox[rgb]{1.00,0.94,0.94}{\strut ##1}}} +\expandafter\def\csname PYG@tok@k\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@kp\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@kt\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.56,0.13,0.00}{##1}}} +\expandafter\def\csname PYG@tok@o\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.40,0.40,0.40}{##1}}} +\expandafter\def\csname PYG@tok@ow\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@nb\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@nf\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.02,0.16,0.49}{##1}}} +\expandafter\def\csname PYG@tok@nc\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.05,0.52,0.71}{##1}}} +\expandafter\def\csname PYG@tok@nn\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.05,0.52,0.71}{##1}}} +\expandafter\def\csname PYG@tok@ne\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@nv\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.73,0.38,0.84}{##1}}} +\expandafter\def\csname PYG@tok@no\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.38,0.68,0.84}{##1}}} +\expandafter\def\csname PYG@tok@nl\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.00,0.13,0.44}{##1}}} +\expandafter\def\csname PYG@tok@ni\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.84,0.33,0.22}{##1}}} +\expandafter\def\csname PYG@tok@na\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@nt\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.02,0.16,0.45}{##1}}} +\expandafter\def\csname PYG@tok@nd\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.33,0.33,0.33}{##1}}} +\expandafter\def\csname PYG@tok@s\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@sd\endcsname{\let\PYG@it=\textit\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@si\endcsname{\let\PYG@it=\textit\def\PYG@tc##1{\textcolor[rgb]{0.44,0.63,0.82}{##1}}} +\expandafter\def\csname PYG@tok@se\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@sr\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.14,0.33,0.53}{##1}}} +\expandafter\def\csname PYG@tok@ss\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.32,0.47,0.09}{##1}}} +\expandafter\def\csname PYG@tok@sx\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.78,0.36,0.04}{##1}}} +\expandafter\def\csname PYG@tok@m\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.13,0.50,0.31}{##1}}} +\expandafter\def\csname PYG@tok@gh\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.00,0.00,0.50}{##1}}} +\expandafter\def\csname PYG@tok@gu\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.50,0.00,0.50}{##1}}} +\expandafter\def\csname PYG@tok@gd\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.63,0.00,0.00}{##1}}} +\expandafter\def\csname PYG@tok@gi\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.00,0.63,0.00}{##1}}} +\expandafter\def\csname PYG@tok@gr\endcsname{\def\PYG@tc##1{\textcolor[rgb]{1.00,0.00,0.00}{##1}}} +\expandafter\def\csname PYG@tok@ge\endcsname{\let\PYG@it=\textit} +\expandafter\def\csname PYG@tok@gs\endcsname{\let\PYG@bf=\textbf} +\expandafter\def\csname PYG@tok@gp\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.78,0.36,0.04}{##1}}} +\expandafter\def\csname PYG@tok@go\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.20,0.20,0.20}{##1}}} +\expandafter\def\csname PYG@tok@gt\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.00,0.27,0.87}{##1}}} +\expandafter\def\csname PYG@tok@err\endcsname{\def\PYG@bc##1{\setlength{\fboxsep}{0pt}\fcolorbox[rgb]{1.00,0.00,0.00}{1,1,1}{\strut ##1}}} +\expandafter\def\csname PYG@tok@kc\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@kd\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@kn\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@kr\endcsname{\let\PYG@bf=\textbf\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@bp\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.00,0.44,0.13}{##1}}} +\expandafter\def\csname PYG@tok@fm\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.02,0.16,0.49}{##1}}} +\expandafter\def\csname PYG@tok@vc\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.73,0.38,0.84}{##1}}} +\expandafter\def\csname PYG@tok@vg\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.73,0.38,0.84}{##1}}} +\expandafter\def\csname PYG@tok@vi\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.73,0.38,0.84}{##1}}} +\expandafter\def\csname PYG@tok@vm\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.73,0.38,0.84}{##1}}} +\expandafter\def\csname PYG@tok@sa\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@sb\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@sc\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@dl\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@s2\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@sh\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@s1\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.25,0.44,0.63}{##1}}} +\expandafter\def\csname PYG@tok@mb\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.13,0.50,0.31}{##1}}} +\expandafter\def\csname PYG@tok@mf\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.13,0.50,0.31}{##1}}} +\expandafter\def\csname PYG@tok@mh\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.13,0.50,0.31}{##1}}} +\expandafter\def\csname PYG@tok@mi\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.13,0.50,0.31}{##1}}} +\expandafter\def\csname PYG@tok@il\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.13,0.50,0.31}{##1}}} +\expandafter\def\csname PYG@tok@mo\endcsname{\def\PYG@tc##1{\textcolor[rgb]{0.13,0.50,0.31}{##1}}} +\expandafter\def\csname PYG@tok@ch\endcsname{\let\PYG@it=\textit\def\PYG@tc##1{\textcolor[rgb]{0.25,0.50,0.56}{##1}}} +\expandafter\def\csname PYG@tok@cm\endcsname{\let\PYG@it=\textit\def\PYG@tc##1{\textcolor[rgb]{0.25,0.50,0.56}{##1}}} +\expandafter\def\csname PYG@tok@cpf\endcsname{\let\PYG@it=\textit\def\PYG@tc##1{\textcolor[rgb]{0.25,0.50,0.56}{##1}}} +\expandafter\def\csname PYG@tok@c1\endcsname{\let\PYG@it=\textit\def\PYG@tc##1{\textcolor[rgb]{0.25,0.50,0.56}{##1}}} + +\def\PYGZbs{\char`\\} +\def\PYGZus{\char`\_} +\def\PYGZob{\char`\{} +\def\PYGZcb{\char`\}} +\def\PYGZca{\char`\^} +\def\PYGZam{\char`\&} +\def\PYGZlt{\char`\<} +\def\PYGZgt{\char`\>} +\def\PYGZsh{\char`\#} +\def\PYGZpc{\char`\%} +\def\PYGZdl{\char`\$} +\def\PYGZhy{\char`\-} +\def\PYGZsq{\char`\'} +\def\PYGZdq{\char`\"} +\def\PYGZti{\char`\~} +% for compatibility with earlier versions +\def\PYGZat{@} +\def\PYGZlb{[} +\def\PYGZrb{]} +\makeatother + +\renewcommand\PYGZsq{\textquotesingle} diff --git a/docs/build/latex/sphinxhowto.cls b/docs/build/latex/sphinxhowto.cls new file mode 100644 index 0000000000000000000000000000000000000000..ba5e0031c17c27d9ae93078aec2c83cf7965e9c8 --- /dev/null +++ b/docs/build/latex/sphinxhowto.cls @@ -0,0 +1,91 @@ +% +% sphinxhowto.cls for Sphinx (http://sphinx-doc.org/) +% + +\NeedsTeXFormat{LaTeX2e}[1995/12/01] +\ProvidesClass{sphinxhowto}[2018/12/23 v2.0 Document class (Sphinx howto)] + +% 'oneside' option overriding the 'twoside' default +\newif\if@oneside +\DeclareOption{oneside}{\@onesidetrue} +% Pass remaining document options to the parent class. +\DeclareOption*{\PassOptionsToClass{\CurrentOption}{\sphinxdocclass}} +\ProcessOptions\relax + +% Default to two-side document +\if@oneside +% nothing to do (oneside is the default) +\else +\PassOptionsToClass{twoside}{\sphinxdocclass} +\fi + +\LoadClass{\sphinxdocclass} + +% Set some sane defaults for section numbering depth and TOC depth. You can +% reset these counters in your preamble. +% +\setcounter{secnumdepth}{2} +\setcounter{tocdepth}{2}% i.e. section and subsection + +% Change the title page to look a bit better, and fit in with the fncychap +% ``Bjarne'' style a bit better. +% +\newcommand{\sphinxmaketitle}{% + \noindent\rule{\textwidth}{1pt}\par + \begingroup % for PDF information dictionary + \def\endgraf{ }\def\and{\& }% + \pdfstringdefDisableCommands{\def\\{, }}% overwrite hyperref setup + \hypersetup{pdfauthor={\@author}, pdftitle={\@title}}% + \endgroup + \begin{flushright} + \sphinxlogo + \py@HeaderFamily + {\Huge \@title }\par + {\itshape\large \py@release \releaseinfo}\par + \vspace{25pt} + {\Large + \begin{tabular}[t]{c} + \@author + \end{tabular}\kern-\tabcolsep}\par + \vspace{25pt} + \@date \par + \py@authoraddress \par + \end{flushright} + \@thanks + \setcounter{footnote}{0} + \let\thanks\relax\let\maketitle\relax + %\gdef\@thanks{}\gdef\@author{}\gdef\@title{} +} + +\newcommand{\sphinxtableofcontents}{% + \begingroup + \parskip \z@skip + \sphinxtableofcontentshook + \tableofcontents + \endgroup + \noindent\rule{\textwidth}{1pt}\par + \vspace{12pt}% +} +\newcommand\sphinxtableofcontentshook{} +\pagenumbering{arabic} + +% Fix the bibliography environment to add an entry to the Table of +% Contents. +% For an article document class this environment is a section, +% so no page break before it. +% +\newenvironment{sphinxthebibliography}[1]{% + % \phantomsection % not needed here since TeXLive 2010's hyperref + \begin{thebibliography}{#1}% + \addcontentsline{toc}{section}{\ifdefined\refname\refname\else\ifdefined\bibname\bibname\fi\fi}}{\end{thebibliography}} + + +% Same for the indices. +% The memoir class already does this, so we don't duplicate it in that case. +% +\@ifclassloaded{memoir} + {\newenvironment{sphinxtheindex}{\begin{theindex}}{\end{theindex}}} + {\newenvironment{sphinxtheindex}{% + \phantomsection % needed because no chapter, section, ... is created by theindex + \begin{theindex}% + \addcontentsline{toc}{section}{\indexname}}{\end{theindex}}} diff --git a/docs/build/latex/sphinxmanual.cls b/docs/build/latex/sphinxmanual.cls new file mode 100644 index 0000000000000000000000000000000000000000..e7c8f41efd7e627d1f4011d7d019c85ae16bcdbd --- /dev/null +++ b/docs/build/latex/sphinxmanual.cls @@ -0,0 +1,117 @@ +% +% sphinxmanual.cls for Sphinx (http://sphinx-doc.org/) +% + +\NeedsTeXFormat{LaTeX2e}[1995/12/01] +\ProvidesClass{sphinxmanual}[2018/12/23 v2.0 Document class (Sphinx manual)] + +% chapters starting at odd pages (overridden by 'openany' document option) +\PassOptionsToClass{openright}{\sphinxdocclass} + +% 'oneside' option overriding the 'twoside' default +\newif\if@oneside +\DeclareOption{oneside}{\@onesidetrue} +% Pass remaining document options to the parent class. +\DeclareOption*{\PassOptionsToClass{\CurrentOption}{\sphinxdocclass}} +\ProcessOptions\relax + +% Defaults two-side document +\if@oneside +% nothing to do (oneside is the default) +\else +\PassOptionsToClass{twoside}{\sphinxdocclass} +\fi + +\LoadClass{\sphinxdocclass} + +% Set some sane defaults for section numbering depth and TOC depth. You can +% reset these counters in your preamble. +% +\setcounter{secnumdepth}{2} +\setcounter{tocdepth}{1} + +% Change the title page to look a bit better, and fit in with the fncychap +% ``Bjarne'' style a bit better. +% +\newcommand{\sphinxmaketitle}{% + \let\sphinxrestorepageanchorsetting\relax + \ifHy@pageanchor\def\sphinxrestorepageanchorsetting{\Hy@pageanchortrue}\fi + \hypersetup{pageanchor=false}% avoid duplicate destination warnings + \begin{titlepage}% + \let\footnotesize\small + \let\footnoterule\relax + \noindent\rule{\textwidth}{1pt}\par + \begingroup % for PDF information dictionary + \def\endgraf{ }\def\and{\& }% + \pdfstringdefDisableCommands{\def\\{, }}% overwrite hyperref setup + \hypersetup{pdfauthor={\@author}, pdftitle={\@title}}% + \endgroup + \begin{flushright}% + \sphinxlogo + \py@HeaderFamily + {\Huge \@title \par} + {\itshape\LARGE \py@release\releaseinfo \par} + \vfill + {\LARGE + \begin{tabular}[t]{c} + \@author + \end{tabular}\kern-\tabcolsep + \par} + \vfill\vfill + {\large + \@date \par + \vfill + \py@authoraddress \par + }% + \end{flushright}%\par + \@thanks + \end{titlepage}% + \setcounter{footnote}{0}% + \let\thanks\relax\let\maketitle\relax + %\gdef\@thanks{}\gdef\@author{}\gdef\@title{} + \clearpage + \ifdefined\sphinxbackoftitlepage\sphinxbackoftitlepage\fi + \if@openright\cleardoublepage\else\clearpage\fi + \sphinxrestorepageanchorsetting +} + +\newcommand{\sphinxtableofcontents}{% + \pagenumbering{roman}% + \begingroup + \parskip \z@skip + \sphinxtableofcontentshook + \tableofcontents + \endgroup + % before resetting page counter, let's do the right thing. + \if@openright\cleardoublepage\else\clearpage\fi + \pagenumbering{arabic}% +} + +% This is needed to get the width of the section # area wide enough in the +% library reference. Doing it here keeps it the same for all the manuals. +% +\newcommand{\sphinxtableofcontentshook}{% + \renewcommand*\l@section{\@dottedtocline{1}{1.5em}{2.6em}}% + \renewcommand*\l@subsection{\@dottedtocline{2}{4.1em}{3.5em}}% +} + +% Fix the bibliography environment to add an entry to the Table of +% Contents. +% For a report document class this environment is a chapter. +% +\newenvironment{sphinxthebibliography}[1]{% + \if@openright\cleardoublepage\else\clearpage\fi + % \phantomsection % not needed here since TeXLive 2010's hyperref + \begin{thebibliography}{#1}% + \addcontentsline{toc}{chapter}{\bibname}}{\end{thebibliography}} + +% Same for the indices. +% The memoir class already does this, so we don't duplicate it in that case. +% +\@ifclassloaded{memoir} + {\newenvironment{sphinxtheindex}{\begin{theindex}}{\end{theindex}}} + {\newenvironment{sphinxtheindex}{% + \if@openright\cleardoublepage\else\clearpage\fi + \phantomsection % needed as no chapter, section, ... created + \begin{theindex}% + \addcontentsline{toc}{chapter}{\indexname}}{\end{theindex}}} diff --git a/docs/build/latex/sphinxmessages.sty b/docs/build/latex/sphinxmessages.sty new file mode 100644 index 0000000000000000000000000000000000000000..121f0af0bf4d0d6b1a8c6b7f6d4aa6fc223ef2da --- /dev/null +++ b/docs/build/latex/sphinxmessages.sty @@ -0,0 +1,21 @@ +% +% sphinxmessages.sty +% +% message resources for Sphinx +% +\ProvidesPackage{sphinxmessages}[2019/01/04 v2.0 Localized LaTeX macros (Sphinx team)] + +\renewcommand{\literalblockcontinuedname}{continued from previous page} +\renewcommand{\literalblockcontinuesname}{continues on next page} +\renewcommand{\sphinxnonalphabeticalgroupname}{Non-alphabetical} +\renewcommand{\sphinxsymbolsname}{Symbols} +\renewcommand{\sphinxnumbersname}{Numbers} +\def\pageautorefname{page} + +\addto\captionsenglish{\renewcommand{\figurename}{Fig.\@{} }} +\def\fnum@figure{\figurename\thefigure{}} + +\addto\captionsenglish{\renewcommand{\tablename}{Table }} +\def\fnum@table{\tablename\thetable{}} + +\addto\captionsenglish{\renewcommand{\literalblockname}{Listing}} \ No newline at end of file diff --git a/docs/build/latex/sphinxmulticell.sty b/docs/build/latex/sphinxmulticell.sty new file mode 100644 index 0000000000000000000000000000000000000000..f0d11b1f99a01f08b58ac273e10df5100f13babf --- /dev/null +++ b/docs/build/latex/sphinxmulticell.sty @@ -0,0 +1,317 @@ +\NeedsTeXFormat{LaTeX2e} +\ProvidesPackage{sphinxmulticell}% + [2017/02/23 v1.6 better span rows and columns of a table (Sphinx team)]% +\DeclareOption*{\PackageWarning{sphinxmulticell}{Option `\CurrentOption' is unknown}}% +\ProcessOptions\relax +% +% --- MULTICOLUMN --- +% standard LaTeX's \multicolumn +% 1. does not allow verbatim contents, +% 2. interacts very poorly with tabulary. +% +% It is needed to write own macros for Sphinx: to allow code-blocks in merged +% cells rendered by tabular/longtable, and to allow multi-column cells with +% paragraphs to be taken into account sanely by tabulary algorithm for column +% widths. +% +% This requires quite a bit of hacking. First, in Sphinx, the multi-column +% contents will *always* be wrapped in a varwidth environment. The issue +% becomes to pass it the correct target width. We must trick tabulary into +% believing the multicolumn is simply separate columns, else tabulary does not +% incorporate the contents in its algorithm. But then we must clear the +% vertical rules... +% +% configuration of tabulary +\setlength{\tymin}{3\fontcharwd\font`0 }% minimal width of "squeezed" columns +\setlength{\tymax}{10000pt}% allow enough room for paragraphs to "compete" +% we need access to tabulary's final computed width. \@tempdima is too volatile +% to hope it has kept tabulary's value when \sphinxcolwidth needs it. +\newdimen\sphinx@TY@tablewidth +\def\tabulary{% + \def\TY@final{\sphinx@TY@tablewidth\@tempdima\tabular}% + \let\endTY@final\endtabular + \TY@tabular}% +% next hack is needed only if user has set latex_use_latex_multicolumn to True: +% it fixes tabulary's bug with \multicolumn defined "short" in first pass. (if +% upstream tabulary adds a \long, our extra one causes no harm) +\def\sphinx@tempa #1\def\multicolumn#2#3#4#5#6#7#8#9\sphinx@tempa + {\def\TY@tab{#1\long\def\multicolumn####1####2####3{\multispan####1\relax}#9}}% +\expandafter\sphinx@tempa\TY@tab\sphinx@tempa +% +% TN. 1: as \omit is never executed, Sphinx multicolumn does not need to worry +% like standard multicolumn about |l| vs l|. On the other hand it assumes +% columns are separated by a | ... (if not it will add extraneous +% \arrayrulewidth space for each column separation in its estimate of available +% width). +% +% TN. 1b: as Sphinx multicolumn uses neither \omit nor \span, it can not +% (easily) get rid of extra macros from >{...} or <{...} between columns. At +% least, it has been made compatible with colortbl's \columncolor. +% +% TN. 2: tabulary's second pass is handled like tabular/longtable's single +% pass, with the difference that we hacked \TY@final to set in +% \sphinx@TY@tablewidth the final target width as computed by tabulary. This is +% needed only to handle columns with a "horizontal" specifier: "p" type columns +% (inclusive of tabulary's LJRC) holds the target column width in the +% \linewidth dimension. +% +% TN. 3: use of \begin{sphinxmulticolumn}...\end{sphinxmulticolumn} mark-up +% would need some hacking around the fact that groups can not span across table +% cells (the code does inserts & tokens, see TN1b). It was decided to keep it +% simple with \sphinxstartmulticolumn...\sphinxstopmulticolumn. +% +% MEMO about nesting: if sphinxmulticolumn is encountered in a nested tabular +% inside a tabulary it will think to be at top level in the tabulary. But +% Sphinx generates no nested tables, and if some LaTeX macro uses internally a +% tabular this will not have a \sphinxstartmulticolumn within it! +% +\def\sphinxstartmulticolumn{% + \ifx\equation$% $ tabulary's first pass + \expandafter\sphinx@TYI@start@multicolumn + \else % either not tabulary or tabulary's second pass + \expandafter\sphinx@start@multicolumn + \fi +}% +\def\sphinxstopmulticolumn{% + \ifx\equation$% $ tabulary's first pass + \expandafter\sphinx@TYI@stop@multicolumn + \else % either not tabulary or tabulary's second pass + \ignorespaces + \fi +}% +\def\sphinx@TYI@start@multicolumn#1{% + % use \gdef always to avoid stack space build up + \gdef\sphinx@tempa{#1}\begingroup\setbox\z@\hbox\bgroup +}% +\def\sphinx@TYI@stop@multicolumn{\egroup % varwidth was used with \tymax + \xdef\sphinx@tempb{\the\dimexpr\wd\z@/\sphinx@tempa}% per column width + \endgroup + \expandafter\sphinx@TYI@multispan\expandafter{\sphinx@tempa}% +}% +\def\sphinx@TYI@multispan #1{% + \kern\sphinx@tempb\ignorespaces % the per column occupied width + \ifnum#1>\@ne % repeat, taking into account subtleties of TeX's & ... + \expandafter\sphinx@TYI@multispan@next\expandafter{\the\numexpr#1-\@ne\expandafter}% + \fi +}% +\def\sphinx@TYI@multispan@next{&\relax\sphinx@TYI@multispan}% +% +% Now the branch handling either the second pass of tabulary or the single pass +% of tabular/longtable. This is the delicate part where we gather the +% dimensions from the p columns either set-up by tabulary or by user p column +% or Sphinx \X, \Y columns. The difficulty is that to get the said width, the +% template must be inserted (other hacks would be horribly complicated except +% if we rewrote crucial parts of LaTeX's \@array !) and we can not do +% \omit\span like standard \multicolumn's easy approach. Thus we must cancel +% the \vrule separators. Also, perhaps the column specifier is of the l, c, r +% type, then we attempt an ad hoc rescue to give varwidth a reasonable target +% width. +\def\sphinx@start@multicolumn#1{% + \gdef\sphinx@multiwidth{0pt}\gdef\sphinx@tempa{#1}\sphinx@multispan{#1}% +}% +\def\sphinx@multispan #1{% + \ifnum#1=\@ne\expandafter\sphinx@multispan@end + \else\expandafter\sphinx@multispan@next + \fi {#1}% +}% +\def\sphinx@multispan@next #1{% + % trick to recognize L, C, R, J or p, m, b type columns + \ifdim\baselineskip>\z@ + \gdef\sphinx@tempb{\linewidth}% + \else + % if in an l, r, c type column, try and hope for the best + \xdef\sphinx@tempb{\the\dimexpr(\ifx\TY@final\@undefined\linewidth\else + \sphinx@TY@tablewidth\fi-\arrayrulewidth)/\sphinx@tempa + -\tw@\tabcolsep-\arrayrulewidth\relax}% + \fi + \noindent\kern\sphinx@tempb\relax + \xdef\sphinx@multiwidth + {\the\dimexpr\sphinx@multiwidth+\sphinx@tempb+\tw@\tabcolsep+\arrayrulewidth}% + % hack the \vline and the colortbl macros + \sphinx@hack@vline\sphinx@hack@CT&\relax + % repeat + \expandafter\sphinx@multispan\expandafter{\the\numexpr#1-\@ne}% +}% +% packages like colortbl add group levels, we need to "climb back up" to be +% able to hack the \vline and also the colortbl inserted tokens. This creates +% empty space whether or not the columns were | separated: +\def\sphinx@hack@vline{\ifnum\currentgrouptype=6\relax + \kern\arrayrulewidth\arrayrulewidth\z@\else\aftergroup\sphinx@hack@vline\fi}% +\def\sphinx@hack@CT{\ifnum\currentgrouptype=6\relax + \let\CT@setup\sphinx@CT@setup\else\aftergroup\sphinx@hack@CT\fi}% +% It turns out \CT@row@color is not expanded contrarily to \CT@column@color +% during LaTeX+colortbl preamble preparation, hence it would be possible for +% \sphinx@CT@setup to discard only the column color and choose to obey or not +% row color and cell color. It would even be possible to propagate cell color +% to row color for the duration of the Sphinx multicolumn... the (provisional?) +% choice has been made to cancel the colortbl colours for the multicolumn +% duration. +\def\sphinx@CT@setup #1\endgroup{\endgroup}% hack to remove colour commands +\def\sphinx@multispan@end#1{% + % first, trace back our steps horizontally + \noindent\kern-\dimexpr\sphinx@multiwidth\relax + % and now we set the final computed width for the varwidth environment + \ifdim\baselineskip>\z@ + \xdef\sphinx@multiwidth{\the\dimexpr\sphinx@multiwidth+\linewidth}% + \else + \xdef\sphinx@multiwidth{\the\dimexpr\sphinx@multiwidth+ + (\ifx\TY@final\@undefined\linewidth\else + \sphinx@TY@tablewidth\fi-\arrayrulewidth)/\sphinx@tempa + -\tw@\tabcolsep-\arrayrulewidth\relax}% + \fi + % we need to remove colour set-up also for last cell of the multi-column + \aftergroup\sphinx@hack@CT +}% +\newcommand*\sphinxcolwidth[2]{% + % this dimension will always be used for varwidth, and serves as maximum + % width when cells are merged either via multirow or multicolumn or both, + % as always their contents is wrapped in varwidth environment. + \ifnum#1>\@ne % multi-column (and possibly also multi-row) + % we wrote our own multicolumn code especially to handle that (and allow + % verbatim contents) + \ifx\equation$%$ + \tymax % first pass of tabulary (cf MEMO above regarding nesting) + \else % the \@gobble thing is for compatibility with standard \multicolumn + \sphinx@multiwidth\@gobble{#1/#2}% + \fi + \else % single column multirow + \ifx\TY@final\@undefined % not a tabulary. + \ifdim\baselineskip>\z@ + % in a p{..} type column, \linewidth is the target box width + \linewidth + \else + % l, c, r columns. Do our best. + \dimexpr(\linewidth-\arrayrulewidth)/#2- + \tw@\tabcolsep-\arrayrulewidth\relax + \fi + \else % in tabulary + \ifx\equation$%$% first pass + \tymax % it is set to a big value so that paragraphs can express themselves + \else + % second pass. + \ifdim\baselineskip>\z@ + \linewidth % in a L, R, C, J column or a p, \X, \Y ... + \else + % we have hacked \TY@final to put in \sphinx@TY@tablewidth the table width + \dimexpr(\sphinx@TY@tablewidth-\arrayrulewidth)/#2- + \tw@\tabcolsep-\arrayrulewidth\relax + \fi + \fi + \fi + \fi +}% +% fallback default in case user has set latex_use_latex_multicolumn to True: +% \sphinxcolwidth will use this only inside LaTeX's standard \multicolumn +\def\sphinx@multiwidth #1#2{\dimexpr % #1 to gobble the \@gobble (!) + (\ifx\TY@final\@undefined\linewidth\else\sphinx@TY@tablewidth\fi + -\arrayrulewidth)*#2-\tw@\tabcolsep-\arrayrulewidth\relax}% +% +% --- MULTIROW --- +% standard \multirow +% 1. does not allow verbatim contents, +% 2. does not allow blank lines in its argument, +% 3. its * specifier means to typeset "horizontally" which is very +% bad for paragraph content. 2016 version has = specifier but it +% must be used with p type columns only, else results are bad, +% 4. it requires manual intervention if the contents is too long to fit +% in the asked-for number of rows. +% 5. colour panels (either from \rowcolor or \columncolor) will hide +% the bottom part of multirow text, hence manual tuning is needed +% to put the multirow insertion at the _bottom_. +% +% The Sphinx solution consists in always having contents wrapped +% in a varwidth environment so that it makes sense to estimate how many +% lines it will occupy, and then ensure by insertion of suitable struts +% that the table rows have the needed height. The needed mark-up is done +% by LaTeX writer, which has its own id for the merged cells. +% +% The colour issue is solved by clearing colour panels in all cells, +% whether or not the multirow is single-column or multi-column. +% +% In passing we obtain baseline alignements across rows (only if +% \arraylinestretch is 1, as LaTeX's does not obey \arraylinestretch in "p" +% multi-line contents, only first and last line...) +% +% TODO: examine the situation with \arraylinestretch > 1. The \extrarowheight +% is hopeless for multirow anyhow, it makes baseline alignment strictly +% impossible. +\newcommand\sphinxmultirow[2]{\begingroup + % #1 = nb of spanned rows, #2 = Sphinx id of "cell", #3 = contents + % but let's fetch #3 in a way allowing verbatim contents ! + \def\sphinx@nbofrows{#1}\def\sphinx@cellid{#2}% + \afterassignment\sphinx@multirow\let\next= +}% +\def\sphinx@multirow {% + \setbox\z@\hbox\bgroup\aftergroup\sphinx@@multirow\strut +}% +\def\sphinx@@multirow {% + % The contents, which is a varwidth environment, has been captured in + % \box0 (a \hbox). + % We have with \sphinx@cellid an assigned unique id. The goal is to give + % about the same height to all the involved rows. + % For this Sphinx will insert a \sphinxtablestrut{cell_id} mark-up + % in LaTeX file and the expansion of the latter will do the suitable thing. + \dimen@\dp\z@ + \dimen\tw@\ht\@arstrutbox + \advance\dimen@\dimen\tw@ + \advance\dimen\tw@\dp\@arstrutbox + \count@=\dimen@ % type conversion dim -> int + \count\tw@=\dimen\tw@ + \divide\count@\count\tw@ % TeX division truncates + \advance\dimen@-\count@\dimen\tw@ + % 1300sp is about 0.02pt. For comparison a rule default width is 0.4pt. + % (note that if \count@ holds 0, surely \dimen@>1300sp) + \ifdim\dimen@>1300sp \advance\count@\@ne \fi + % now \count@ holds the count L of needed "lines" + % and \sphinx@nbofrows holds the number N of rows + % we have L >= 1 and N >= 1 + % if L is a multiple of N, ... clear what to do ! + % else write L = qN + r, 1 <= r < N and we will + % arrange for each row to have enough space for: + % q+1 "lines" in each of the first r rows + % q "lines" in each of the (N-r) bottom rows + % for a total of (q+1) * r + q * (N-r) = q * N + r = L + % It is possible that q == 0. + \count\tw@\count@ + % the TeX division truncates + \divide\count\tw@\sphinx@nbofrows\relax + \count4\count\tw@ % q + \multiply\count\tw@\sphinx@nbofrows\relax + \advance\count@-\count\tw@ % r + \expandafter\xdef\csname sphinx@tablestrut_\sphinx@cellid\endcsname + {\noexpand\sphinx@tablestrut{\the\count4}{\the\count@}{\sphinx@cellid}}% + \dp\z@\z@ + % this will use the real height if it is >\ht\@arstrutbox + \sphinxtablestrut{\sphinx@cellid}\box\z@ + \endgroup % group was opened in \sphinxmultirow +}% +\newcommand*\sphinxtablestrut[1]{% + % #1 is a "cell_id", i.e. the id of a merged group of table cells + \csname sphinx@tablestrut_#1\endcsname +}% +% LaTeX typesets the table row by row, hence each execution can do +% an update for the next row. +\newcommand*\sphinx@tablestrut[3]{\begingroup + % #1 = q, #2 = (initially) r, #3 = cell_id, q+1 lines in first r rows + % if #2 = 0, create space for max(q,1) table lines + % if #2 > 0, create space for q+1 lines and decrement #2 + \leavevmode + \count@#1\relax + \ifnum#2=\z@ + \ifnum\count@=\z@\count@\@ne\fi + \else + % next row will be with a #2 decremented by one + \expandafter\xdef\csname sphinx@tablestrut_#3\endcsname + {\noexpand\sphinx@tablestrut{#1}{\the\numexpr#2-\@ne}{#3}}% + \advance\count@\@ne + \fi + \vrule\@height\ht\@arstrutbox + \@depth\dimexpr\count@\ht\@arstrutbox+\count@\dp\@arstrutbox-\ht\@arstrutbox\relax + \@width\z@ + \endgroup + % we need this to avoid colour panels hiding bottom parts of multirow text + \sphinx@hack@CT +}% +\endinput +%% +%% End of file `sphinxmulticell.sty'. diff --git a/docs/make.bat b/docs/make.bat new file mode 100644 index 0000000000000000000000000000000000000000..6247f7e231716482115f34084ac61030743e0715 --- /dev/null +++ b/docs/make.bat @@ -0,0 +1,35 @@ +@ECHO OFF + +pushd %~dp0 + +REM Command file for Sphinx documentation + +if "%SPHINXBUILD%" == "" ( + set SPHINXBUILD=sphinx-build +) +set SOURCEDIR=source +set BUILDDIR=build + +if "%1" == "" goto help + +%SPHINXBUILD% >NUL 2>NUL +if errorlevel 9009 ( + echo. + echo.The 'sphinx-build' command was not found. Make sure you have Sphinx + echo.installed, then set the SPHINXBUILD environment variable to point + echo.to the full path of the 'sphinx-build' executable. Alternatively you + echo.may add the Sphinx directory to PATH. + echo. + echo.If you don't have Sphinx installed, grab it from + echo.http://sphinx-doc.org/ + exit /b 1 +) + +%SPHINXBUILD% -M %1 %SOURCEDIR% %BUILDDIR% %SPHINXOPTS% %O% +goto end + +:help +%SPHINXBUILD% -M help %SOURCEDIR% %BUILDDIR% %SPHINXOPTS% %O% + +:end +popd diff --git a/docs/notes.org b/docs/notes.org new file mode 100644 index 0000000000000000000000000000000000000000..4e0f65d2965be47f238f1699d48309fd39ffdf94 --- /dev/null +++ b/docs/notes.org @@ -0,0 +1,7 @@ +* Notes: +https://stackoverflow.com/questions/39534718/how-to-create-a-pdf-out-of-sphinx-documentation-tool +* Todo: +** TODO Write script to automatically rebuild the whole bunch +** TODO: use typing from mypy and build that into the docs +https://github.com/seqan/seqan3-doc/blob/user/source/make_source.py +https://www.pythonforthelab.com/blog/documenting-with-sphinx-and-readthedocs/ diff --git a/docs/source/conf.py b/docs/source/conf.py new file mode 100644 index 0000000000000000000000000000000000000000..6c887288b9447a3df0be3ef18b32b6acf47ee131 --- /dev/null +++ b/docs/source/conf.py @@ -0,0 +1,66 @@ +# Configuration file for the Sphinx documentation builder. +# +# This file only contains a selection of the most common options. For a full +# list see the documentation: +# https://www.sphinx-doc.org/en/master/usage/configuration.html + +# -- Path setup -------------------------------------------------------------- + +# If extensions (or modules to document with autodoc) are in another directory, +# add these directories to sys.path here. If the directory is relative to the +# documentation root, use os.path.abspath to make it absolute, like shown here. +# +import os +import sys + +# Include paths for python code +sys.path.insert(0, os.path.abspath('.')) +sys.path.insert(0, os.path.abspath('../../')) +# sys.path.insert(0, os.path.abspath('../../examples')) +sys.path.insert(0, os.path.abspath('../../binaryc_python_utils')) +sys.path.insert(0, os.path.join(os.getenv("BINARY_C"), "src/API/")) + +# include paths for c code +cautodoc_root = os.path.abspath('../../') + +# -- Project information ----------------------------------------------------- + +project = 'binary_c-python' +copyright = '2019, Jeff Andrews, Robert Izzard, David Hendriks' +author = 'Jeff Andrews, Robert Izzard, David Hendriks' + + +# -- General configuration --------------------------------------------------- + +# Add any Sphinx extension module names here, as strings. They can be +# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom +# ones. +extensions = [ + 'sphinx.ext.autodoc', + 'sphinx.ext.doctest', + 'hawkmoth', + 'm2r', +] + +source_suffix = ['.rst', '.md'] + +# Add any paths that contain templates here, relative to this directory. +templates_path = ['_templates'] + +# List of patterns, relative to source directory, that match files and +# directories to ignore when looking for source files. +# This pattern also affects html_static_path and html_extra_path. +exclude_patterns = [] + + +# -- Options for HTML output ------------------------------------------------- + +# The theme to use for HTML and HTML Help pages. See the documentation for +# a list of builtin themes. +# +html_theme = 'alabaster' + +# Add any paths that contain custom static files (such as style sheets) here, +# relative to this directory. They are copied after the builtin static files, +# so a file named "default.css" will overwrite the builtin "default.css". +html_static_path = ['_static'] diff --git a/docs/source/custom_logging_functions.rst b/docs/source/custom_logging_functions.rst new file mode 100644 index 0000000000000000000000000000000000000000..84f5bcf9954aab034c5ee509f3be6038e5bf7c51 --- /dev/null +++ b/docs/source/custom_logging_functions.rst @@ -0,0 +1,7 @@ +custom\_logging\_functions module +================================= + +.. automodule:: custom_logging_functions + :members: + :undoc-members: + :show-inheritance: diff --git a/docs/source/examples.rst b/docs/source/examples.rst new file mode 100644 index 0000000000000000000000000000000000000000..619224b9c847e5cb18bc55eb22c43f60382e5398 --- /dev/null +++ b/docs/source/examples.rst @@ -0,0 +1,9 @@ +examples +======== +This chapter serves to document several of the example usages + + +.. automodule:: examples.examples + :members: + :undoc-members: + :show-inheritance: \ No newline at end of file diff --git a/docs/source/functions.rst b/docs/source/functions.rst new file mode 100644 index 0000000000000000000000000000000000000000..087d090c05d40e4c58022adbc9fb1d41b0b84507 --- /dev/null +++ b/docs/source/functions.rst @@ -0,0 +1,7 @@ +functions module +================ + +.. automodule:: functions + :members: + :undoc-members: + :show-inheritance: diff --git a/docs/source/index.rst b/docs/source/index.rst new file mode 100644 index 0000000000000000000000000000000000000000..cae3549628f939c62fbde8504f9c57b0b3be7992 --- /dev/null +++ b/docs/source/index.rst @@ -0,0 +1,23 @@ +.. binary_c-python documentation master file, created by + sphinx-quickstart on Wed Nov 13 11:43:40 2019. + You can adapt this file completely to your liking, but it should at least + contain the root `toctree` directive. + +Welcome to binary_c-python's documentation! +=========================================== + +.. toctree:: + :maxdepth: 4 + :caption: Contents: + + readme_link + examples + modules + + +Indices and tables +================== + +* :ref:`genindex` +* :ref:`modindex` +* :ref:`search` diff --git a/docs/source/modules.rst b/docs/source/modules.rst new file mode 100644 index 0000000000000000000000000000000000000000..cc9bb7deb7eda24ee72102d53594ddf309f48265 --- /dev/null +++ b/docs/source/modules.rst @@ -0,0 +1,9 @@ +binaryc_python_utils +==================== + +.. toctree:: + :maxdepth: 4 + + custom_logging_functions + functions +.. stellar_types diff --git a/docs/source/readme_link.rst b/docs/source/readme_link.rst new file mode 100644 index 0000000000000000000000000000000000000000..3bd447c431e4695451c11a92ad57b5829d9059af --- /dev/null +++ b/docs/source/readme_link.rst @@ -0,0 +1 @@ +.. mdinclude:: ../../README.md diff --git a/docs/source/stellar_types.rst b/docs/source/stellar_types.rst new file mode 100644 index 0000000000000000000000000000000000000000..4fbcab371f65b4e07137de53ecf0d7c10923cd0e --- /dev/null +++ b/docs/source/stellar_types.rst @@ -0,0 +1,7 @@ +stellar\_types module +===================== + +.. automodule:: stellar_types + :members: + :undoc-members: + :show-inheritance: diff --git a/examples/examples_run_binary.py b/examples/examples.py similarity index 96% rename from examples/examples_run_binary.py rename to examples/examples.py index 7487e698d34e3aac73a5d1687a16070dd9bc2920..a8609771c4b863fc8fb5bd673d5ce1b4a8eb629d 100644 --- a/examples/examples_run_binary.py +++ b/examples/examples.py @@ -13,7 +13,7 @@ from binaryc_python_utils.custom_logging_functions import ( """ Very basic scripts to run a binary system and print the output. -Use these as inspiration/base +Use these as inspiration/base. """ @@ -47,7 +47,7 @@ def run_example_binary(): print(output) -run_example_binary() +# run_example_binary() def run_example_binary_with_run_system(): @@ -85,8 +85,7 @@ def run_example_binary_with_run_system(): # Some routine to plot. - -run_example_binary_with_run_system() +# run_example_binary_with_run_system() def run_example_binary_with_custom_logging(): @@ -130,9 +129,7 @@ def run_example_binary_with_custom_logging(): # Do whatever you like with the dataframe. print(df) - -run_example_binary_with_custom_logging() - +# run_example_binary_with_custom_logging() def run_example_binary_with_writing_logfile(): """ @@ -169,5 +166,4 @@ def run_example_binary_with_writing_logfile(): # Some routine to plot. - -run_example_binary_with_writing_logfile() +# run_example_binary_with_writing_logfile() diff --git a/testing_doxygen/ding.h b/testing_doxygen/ding.h new file mode 100644 index 0000000000000000000000000000000000000000..77fc7410a4ae857d76befcaaacd1e1333f2fe8f9 --- /dev/null +++ b/testing_doxygen/ding.h @@ -0,0 +1,127 @@ +/**************************************************************************** + * Copyright (C) 2012 by Matteo Franchin * + * * + * This file is part of Box. * + * * + * Box is free software: you can redistribute it and/or modify it * + * under the terms of the GNU Lesser General Public License as published * + * by the Free Software Foundation, either version 3 of the License, or * + * (at your option) any later version. * + * * + * Box is distributed in the hope that it will be useful, * + * but WITHOUT ANY WARRANTY; without even the implied warranty of * + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * + * GNU Lesser General Public License for more details. * + * * + * You should have received a copy of the GNU Lesser General Public * + * License along with Box. If not, see <http://www.gnu.org/licenses/>. * + ****************************************************************************/ + +/** + * @file doxygen_c.h + * @author My Self + * @date 9 Sep 2012 + * @brief File containing example of doxygen usage for quick reference. + * + * Here typically goes a more extensive explanation of what the header + * defines. Doxygens tags are words preceeded by either a backslash @\ + * or by an at symbol @@. + * @see http://www.stack.nl/~dimitri/doxygen/docblocks.html + * @see http://www.stack.nl/~dimitri/doxygen/commands.html + */ + +#ifndef _BOX_PROTOTYPES_DOXYGEN_H +# define _BOX_PROTOTYPES_DOXYGEN_H + +# include <systemheader1.h> +# include <systemheader2.h> + +# include <box/header1.h> +# include <box/header2.h> + +# include "local_header1.h" +# include "local_header2.h" + +/** + * @brief Use brief, otherwise the index won't have a brief explanation. + * + * Detailed explanation. + */ +typedef enum BoxEnum_enum { + BOXENUM_FIRST, /**< Some documentation for first. */ + BOXENUM_SECOND, /**< Some documentation for second. */ + BOXENUM_ETC /**< Etc. */ +} BoxEnum; + +/** + * @brief Use brief, otherwise the index won't have a brief explanation. + * + * Detailed explanation. + */ +typedef struct BoxStruct_struct { + int a; /**< Some documentation for the member BoxStruct#a. */ + int b; /**< Some documentation for the member BoxStruct#b. */ + double c; /**< Etc. */ +} BoxStruct; + +/** + * @brief Example showing how to document a function with Doxygen. + * + * Description of what the function does. This part may refer to the parameters + * of the function, like @p param1 or @p param2. A word of code can also be + * inserted like @c this which is equivalent to <tt>this</tt> and can be useful + * to say that the function returns a @c void or an @c int. If you want to have + * more than one word in typewriter font, then just use @<tt@>. + * We can also include text verbatim, + * @verbatim like this@endverbatim + * Sometimes it is also convenient to include an example of usage: + * @code + * BoxStruct *out = Box_The_Function_Name(param1, param2); + * printf("something...\n"); + * @endcode + * Or, + * @code{.py} + * pyval = python_func(arg1, arg2) + * print pyval + * @endcode + * when the language is not the one used in the current source file (but + * <b>be careful</b> as this may be supported only by recent versions + * of Doxygen). By the way, <b>this is how you write bold text</b> or, + * if it is just one word, then you can just do @b this. + * @param param1 Description of the first parameter of the function. + * @param param2 The second one, which follows @p param1. + * @return Describe what the function returns. + * @see Box_The_Second_Function + * @see Box_The_Last_One + * @see http://website/ + * @note Something to note. + * @warning Warning. + */ +BOXEXPORT BoxStruct * +Box_The_Function_Name(BoxParamType1 param1, BoxParamType2 param2 /*, ...*/); + +/** + * @brief A simple stub function to show how links do work. + * + * Links are generated automatically for webpages (like http://www.google.co.uk) + * and for structures, like BoxStruct_struct. For typedef-ed types use + * #BoxStruct. + * For functions, automatic links are generated when the parenthesis () follow + * the name of the function, like Box_The_Function_Name(). + * Alternatively, you can use #Box_The_Function_Name. + * @return @c NULL is always returned. + */ +BOXEXPORT void * +Box_The_Second_Function(void); + +/** + * Brief can be omitted. If you configure Doxygen with + * <tt>JAVADOC_AUTOBRIEF=YES</tt>, then the first Line of the comment is used + * instead. In this function this would be as if + * @verbatim @brief Brief can be omitted. @endverbatim + * was used instead. + */ +BOXEXPORT void +Box_The_Last_One(void); + +#endif /* _BOX_PROTOTYPES_DOXYGEN_H */ diff --git a/testing_doxygen/test.h b/testing_doxygen/test.h new file mode 100644 index 0000000000000000000000000000000000000000..65e4e70ca16d5a6f3dd860b7ab86c7c9c87b91f4 --- /dev/null +++ b/testing_doxygen/test.h @@ -0,0 +1,61 @@ +#pragma once +#ifndef BINARY_C_PYTHON_H +#define BINARY_C_PYTHON_H + +/** + * A structure to represent 3d vectors + */ +typedef struct +{ + /*@{*/ + double x ; /**< the x coordinate */ + double y ; /**< the y coordinate */ + double z ; /**< the z coordinate */ + /*@}*/ + /** + * @name group 2 + */ + /*@{*/ + char * name ; /**< the name of the point */ + int namelength ; /**< the size of the point name */ + /*@}*/ +} point3d ; + + +/* + * Include binary_C's API + */ +//#include "binary_c_API.h" +//#include "binary_c_API_prototypes.h" + +/* Binary_c's python API prototypes */ +/** + * Function to run a binary + */ +int run_binary (char * argstring, + char ** const outstring, + char ** const errorstring); + + // size_t * const nbytes); + +// int run_binary_with_logfile (char * argstring, +// char ** const outstring, +// char ** const errorstring, +// size_t * const nbytes); + +// int run_binary_custom_logging(char * argstring, +// long int func_memaddr, +// char ** const buffer, +// char ** const error_buffer, +// size_t * const nbytes); + +// int return_arglines(char ** const outstring, +// char ** const errorstring, +// size_t * const nbytes); + +/* C macros */ +#define BINARY_C_APITEST_VERSION 0.1 +#define APIprint(...) APIprintf(__VA_ARGS__); +#define NO_OUTPUT + +#endif // BINARY_C_C_PYTHON_H